{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c169d651-ae4f-4920-9047-e46f2d80d92f", "code": "73772-45-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=73772-45-9", "code_system": "CAS", "references": [ "b5291fe0-9e0d-4a8b-b5e8-3eff1db69f75", "87892021-6c39-4def-8975-90360d6d5ad7" ] }, { "uuid": "f9e7a796-1a0b-490f-99c1-df92925b6818", "code": "277-599-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.070.524", "code_system": "ECHA (EC/EINECS)", "references": [ "b5291fe0-9e0d-4a8b-b5e8-3eff1db69f75" ] }, { "uuid": "4ec0dc80-5dcc-48fb-9d52-9bbe0054941a", "code": "1541737", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1541737/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "b5291fe0-9e0d-4a8b-b5e8-3eff1db69f75" ] }, { "uuid": "6bddb095-6cde-4789-a784-8b8eeb302306", "code": "173217", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/173217", "code_system": "PUBCHEM", "references": [ "b5291fe0-9e0d-4a8b-b5e8-3eff1db69f75" ] }, { "uuid": "62f0566a-6543-4da1-a6d1-97b45be01c3d", "code": "IQ93EE887Z", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "1da808bc-0f03-b6d7-7572-bc164229a4db", "code": "DTXSID80891978", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80891978", "code_system": "EPA CompTox" }, { "uuid": "8ce4673d-3868-bd23-89ea-8c04c4cac715", "code": "IQ93EE887Z", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=IQ93EE887Z", "code_system": "DAILYMED", "references": [ "b5bf9ad0-9682-0962-d089-bdde3741a3af" ] } ], "substance_class": "chemical", "names": [ { "uuid": "0a33d9dd-ca88-4cc5-b428-5944afeca255", "name": "1-PROPANAMINIUM, N-(CARBOXYMETHYL)-N,N-DIMETHYL-3-((1-OXODECYL)AMINO)-, INNER SALT", "stdName": "1-PROPANAMINIUM, N-(CARBOXYMETHYL)-N,N-DIMETHYL-3-((1-OXODECYL)AMINO)-, INNER SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b63902b6-7fd5-4671-997f-548fa788d8d2", "61c575dc-3551-41a2-85c8-caee15bbfd44" ], "display_name": false }, { "uuid": "9ceac2c2-318a-4bfb-897a-2221ae96e2d4", "name": "CAPRAMIDOPROPYL BETAINE", "stdName": "CAPRAMIDOPROPYL BETAINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "61c575dc-3551-41a2-85c8-caee15bbfd44", "2ce08b10-82e7-4d7c-a1ae-8de21e85381b" ], "display_name": true } ], "references": [ { "uuid": "2ce08b10-82e7-4d7c-a1ae-8de21e85381b", "citation": "http://www.cosmeticsdatabase.com/ingredient.php?ingred06=701052", "url": "http://www.cosmeticsdatabase.com/ingredient.php?ingred06=701052", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "61c575dc-3551-41a2-85c8-caee15bbfd44", "citation": "WEB PAGE", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b63902b6-7fd5-4671-997f-548fa788d8d2", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b5291fe0-9e0d-4a8b-b5e8-3eff1db69f75", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390553000, "tags": [ "NOMEN" ] }, { "uuid": "5ceb787f-a9b6-4776-a75e-bfcb74324c47", "citation": "SRS import [IQ93EE887Z]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IQ93EE887Z", "doc_type": "SRS", "public_domain": true, "document_date": 1493390553000, "tags": [ "NOMEN" ] }, { "uuid": "9b89d133-5761-4b61-832f-1d3a02333844", "citation": "WEB PAGE", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "87892021-6c39-4def-8975-90360d6d5ad7", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "b5bf9ad0-9682-0962-d089-bdde3741a3af", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "47488e4d-57a3-492c-8407-1eaa88903ef4", "id": "47488e4d-57a3-492c-8407-1eaa88903ef4", "molfile": "\n Marvin 01132103442D \n\n 22 21 0 0 0 0 999 V2000\n 6.3600 -10.0256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0912 -9.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7990 -10.0162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5162 -9.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2286 -10.0162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9551 -9.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6676 -10.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3848 -9.5943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0924 -9.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8189 -9.5802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8189 -8.7740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5315 -9.9880 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2486 -9.5802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9563 -9.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6736 -9.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4000 -9.9740 0.0000 N 0 3 0 0 0 0 0 0 0 3 0 0\n 15.9266 -10.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0280 -10.4943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1687 -9.4537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1624 -9.8615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1624 -10.6162 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 18.9170 -9.3318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 16 1 0 0 0 0\n 16 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 20 2 0 0 0 0\nM CHG 2 16 1 21 -1\nM END", "smiles": "CCCCCCCCCC(=O)NCCC[N+](C)(C)CC(=O)[O-]", "formula": "C17H34N2O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f24d6f79-beba-4b14-b6f3-bf178e91aa5d" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "314.4641", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "8ee584f4-c0a1-4f10-bef0-2b30c6279d9d", "version": "5", "structure": { "id": "e1c96dad-c64c-46d4-83eb-067b559346c5", "molfile": "\n Marvin 01132111412D \n\n 22 21 0 0 0 0 999 V2000\n 6.3600 -10.0256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0912 -9.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7990 -10.0162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5162 -9.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2286 -10.0162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9551 -9.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6676 -10.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3848 -9.5943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0924 -9.9880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8189 -9.5802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8189 -8.7740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5315 -9.9880 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2486 -9.5802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9563 -9.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6736 -9.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4000 -9.9740 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 15.9266 -10.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0280 -10.4943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1687 -9.4537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1624 -9.8615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1624 -10.6162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.9170 -9.3318 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 16 1 0 0 0 0\n 16 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 20 2 0 0 0 0\n 22 20 1 0 0 0 0\nM CHG 2 16 1 22 -1\nM END", "smiles": "CCCCCCCCCC(=O)NCCC[N+](C)(C)CC(=O)[O-]", "formula": "C17H34N2O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "314.4641", "optical_activity": "NONE", "references": [ "5ceb787f-a9b6-4776-a75e-bfcb74324c47", "9b89d133-5761-4b61-832f-1d3a02333844" ], "stereo_centers": 0 }, "unii": "IQ93EE887Z" } ] }