{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5932d6f8-6e43-4e8a-ac0d-84ca3d799945",
          "code": "60-46-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=60-46-8",
          "code_system": "CAS",
          "references": [
            "3385fc4a-c719-4c30-acf3-9cb62b34693e",
            "e15e4e5a-561e-433e-9ae6-dc6a3f13f49b"
          ]
        },
        {
          "uuid": "e39d49e0-86b9-430f-9020-3ca8f1827a19",
          "code": "C75273",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C75273",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3385fc4a-c719-4c30-acf3-9cb62b34693e"
          ]
        },
        {
          "uuid": "d2152303-ac19-4b33-9649-18f4287f58da",
          "code": "C012725",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67012725",
          "code_system": "MESH",
          "references": [
            "3385fc4a-c719-4c30-acf3-9cb62b34693e"
          ]
        },
        {
          "uuid": "c911c192-c749-40e2-b231-f1134569226f",
          "code": "SUB07184MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "3385fc4a-c719-4c30-acf3-9cb62b34693e"
          ]
        },
        {
          "uuid": "76f0de48-501c-4586-812a-506f4a9c7e90",
          "code": "604",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=604",
          "code_system": "INN",
          "references": [
            "3385fc4a-c719-4c30-acf3-9cb62b34693e"
          ]
        },
        {
          "uuid": "03ffd9f8-58db-4f1c-87d0-2ae0d8fa4c86",
          "code": "1006397",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1006397/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3385fc4a-c719-4c30-acf3-9cb62b34693e"
          ]
        },
        {
          "uuid": "af5fbf7b-1ce5-4bc6-8309-e08b60dd39c1",
          "code": "m1725",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1725?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3385fc4a-c719-4c30-acf3-9cb62b34693e"
          ]
        },
        {
          "uuid": "94829396-5551-4d6e-9f0e-08102967b07b",
          "code": "5985-87-5",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5985-87-5",
          "code_system": "CAS",
          "references": [
            "3385fc4a-c719-4c30-acf3-9cb62b34693e",
            "148e5a9f-d071-42ec-b490-4f3d72f15b09"
          ]
        },
        {
          "uuid": "1bf8cbd6-5cb4-4115-84a1-598e7f445884",
          "code": "21 CFR 522.62",
          "comments": "SUBCHAPTER E?ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 522?IMPLANTATION OR INJECTABLE DOSAGE FORM NEW ANIMAL DRUGS|Sec. 522.62 Aminopentamide.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=522.62",
          "code_system": "CFR",
          "references": [
            "3385fc4a-c719-4c30-acf3-9cb62b34693e"
          ]
        },
        {
          "uuid": "823351f0-4f97-4ec3-a66b-53f468d62ebd",
          "code": "21 CFR 520.62",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 520 ORAL DOSAGE FORM NEW ANIMAL DRUGS|Sec. 520.62 Aminopentamide.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=520.62",
          "code_system": "CFR",
          "references": [
            "3385fc4a-c719-4c30-acf3-9cb62b34693e"
          ]
        },
        {
          "uuid": "d42d80e5-a9fa-4612-96ab-635b32915665",
          "code": "CHEMBL92915",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL92915",
          "code_system": "ChEMBL",
          "references": [
            "3385fc4a-c719-4c30-acf3-9cb62b34693e"
          ]
        },
        {
          "uuid": "432f2877-2cd3-41cf-bee5-0e0331d86b56",
          "code": "200-479-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.436",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3385fc4a-c719-4c30-acf3-9cb62b34693e"
          ]
        },
        {
          "uuid": "5f406be8-4edf-4963-bddd-efd340229f78",
          "code": "22565",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22565",
          "code_system": "PUBCHEM",
          "references": [
            "3385fc4a-c719-4c30-acf3-9cb62b34693e"
          ]
        },
        {
          "uuid": "b2ec59d5-b7e5-6373-8f04-833d9f1d5d1c",
          "code": "DTXSID2057605",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2057605",
          "code_system": "EPA CompTox",
          "references": [
            "088f0a4d-7fcf-18f0-0ecd-618f80db4669"
          ]
        },
        {
          "uuid": "9b2af9b2-895f-16ff-2c15-30f2322b277c",
          "code": "C29704",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anticholinergic Agent[C66880]|Antimuscarinic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29704",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4d89332e-319a-38bf-3eb8-5fa385c0707a"
          ]
        },
        {
          "uuid": "7233f65c-cd5b-43e7-b35e-511bf5ab11a9",
          "code": "IP1B47L61M",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0012a387-b0af-a8b1-6775-8fc251683ba1",
          "code": "170",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/170",
          "code_system": "DRUG CENTRAL",
          "references": [
            "4d89332e-319a-38bf-3eb8-5fa385c0707a"
          ]
        },
        {
          "uuid": "fd49fa02-0121-f9a8-7eaa-78ba1f14aa21",
          "code": "DB15597",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB15597",
          "code_system": "DRUG BANK",
          "references": [
            "4d89332e-319a-38bf-3eb8-5fa385c0707a"
          ]
        },
        {
          "uuid": "58a57698-bfcf-962c-cebf-7d388d3460f9",
          "code": "100000082667",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8426b283-f90b-4d05-ff5d-ab2c02542cd1"
          ]
        },
        {
          "uuid": "d854f93a-f8ca-cf2d-4a1d-39358f801612",
          "code": "IP1B47L61M",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=IP1B47L61M",
          "code_system": "DAILYMED",
          "references": [
            "3c8310b1-4f9f-536a-f83d-2d4550aea95f"
          ]
        },
        {
          "uuid": "bd4cd565-6eb0-1f8b-5835-52378f0a7803",
          "code": "759162",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759162",
          "code_system": "NSC",
          "references": [
            "62cf5a30-6146-f945-3581-48ef2fa4f680"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6732dcd7-ebea-4e70-bfba-88f0f0b4fbfa",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "e81087fd-c66d-4c6b-922f-50ae077173d1",
            "refuuid": "51bc53a5-ffa4-4487-86c3-bf7565069fc8",
            "name": "AMINOPENTAMIDE",
            "unii": "IP1B47L61M",
            "linking_id": "IP1B47L61M",
            "ref_pname": "AMINOPENTAMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2d198f7f-5bd0-4d96-a768-be0a9f56cdb0",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "6a28692a-e373-437b-923e-b7cac009683b",
            "refuuid": "36ac126b-a0c0-4db7-86e2-9e48cfaff533",
            "name": "AMINOPENTAMIDE HYDROCHLORIDE",
            "unii": "H1HPQ055F3",
            "linking_id": "H1HPQ055F3",
            "ref_pname": "AMINOPENTAMIDE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d3cbb2fc-a04c-43c9-8fc7-385564eb1580",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "b88ae7f3-ded7-4b49-870f-75fe1adcbfe1",
            "refuuid": "c085c197-aa38-4c4c-a6a2-6f7f8a2ac2ac",
            "name": "AMINOPENTAMIDE SULFATE",
            "unii": "20P9NI883O",
            "linking_id": "20P9NI883O",
            "ref_pname": "AMINOPENTAMIDE SULFATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "03c2901f-b033-4b80-aa38-272ded0699bb",
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "20b8da40-fb6f-4c91-8d88-8ee9a9ac66cc",
            "eda6ecd6-8dde-418b-81b2-d0e59b7581a2"
          ],
          "related_substance": {
            "uuid": "1c48402f-f5a5-493e-aea1-9a1b0bd443d9",
            "refuuid": "7b8d3b7f-d16b-4560-a2d1-faa1658636ca",
            "name": "AMINOPENTAMIDE HEMISULFATE",
            "unii": "3QF2626U6O",
            "linking_id": "3QF2626U6O",
            "ref_pname": "AMINOPENTAMIDE HEMISULFATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2d2aa251-3b72-4fbd-b3ce-bceefba7c915",
          "name": ".ALPHA.-(2-(DIMETHYLAMINO)PROPYL)-.ALPHA.-PHENYLBENZENEACETAMIDE",
          "stdName": ".ALPHA.-(2-(DIMETHYLAMINO)PROPYL)-.ALPHA.-PHENYLBENZENEACETAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18118493-9479-4855-8820-8b4ea86ee079"
          ],
          "display_name": false
        },
        {
          "uuid": "4a4de5b7-8664-4626-8c92-9bfcfc54e36f",
          "name": "4-DIMETHYLAMINO-2,2-DIPHENYLVALERAMIDE",
          "stdName": "4-DIMETHYLAMINO-2,2-DIPHENYLVALERAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9dcba3f-e6cc-4d8b-826c-efebdff47f4b",
            "5e3c75df-38e0-4c5e-aa09-57a73d20c880"
          ],
          "display_name": false
        },
        {
          "uuid": "b529ca54-d0e6-47a3-96c1-a6b7bc0eeac0",
          "name": "AMINOPENTAMIDE",
          "stdName": "AMINOPENTAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "50eb3151-dca7-4b51-8e37-ba604ac0cc1d",
            "fab5185d-3267-43e5-97ae-a00fe840cf6b",
            "a09f3985-1185-4609-ad30-b0b9e9cfd8b0",
            "bcfef817-4f9b-4b10-aa2a-9076b5d76e1e"
          ],
          "display_name": true
        },
        {
          "uuid": "3fe0422d-29c4-4b66-9092-ad436543543d",
          "name": "AMINOPENTAMIDE [MI]",
          "stdName": "AMINOPENTAMIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fab5185d-3267-43e5-97ae-a00fe840cf6b",
            "bcfef817-4f9b-4b10-aa2a-9076b5d76e1e"
          ],
          "display_name": false
        },
        {
          "uuid": "06409bc4-b744-4381-863f-24ead16a5232",
          "name": "BENZENEACETAMIDE, .ALPHA.-(2-(DIMETHYLAMINO)PROPYL)-.ALPHA.-PHENYL-",
          "stdName": "BENZENEACETAMIDE, .ALPHA.-(2-(DIMETHYLAMINO)PROPYL)-.ALPHA.-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9dcba3f-e6cc-4d8b-826c-efebdff47f4b",
            "5e3c75df-38e0-4c5e-aa09-57a73d20c880"
          ],
          "display_name": false
        },
        {
          "uuid": "c89231b7-147b-4a84-b025-dc1f21e25b9e",
          "name": "BL-139",
          "stdName": "BL-139",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7af91b8b-4c77-4e04-ad1c-cb534b6bcc04",
            "bcfef817-4f9b-4b10-aa2a-9076b5d76e1e"
          ],
          "display_name": false
        },
        {
          "uuid": "9071c396-234f-40f2-ad66-287333087c0f",
          "name": "CENTRINE",
          "stdName": "CENTRINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e3c75df-38e0-4c5e-aa09-57a73d20c880",
            "bcfef817-4f9b-4b10-aa2a-9076b5d76e1e"
          ],
          "display_name": false
        },
        {
          "uuid": "2e45b440-e501-4a3a-87d9-fa7e2efbbd0c",
          "name": "DIMEVAMIDE",
          "stdName": "DIMEVAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "423cadf0-be9a-4807-b972-f42b1468dfbe",
            "d9dcba3f-e6cc-4d8b-826c-efebdff47f4b",
            "8d5086b9-aff3-408b-a35c-315d55d52635",
            "18118493-9479-4855-8820-8b4ea86ee079",
            "e27903cb-8416-48d1-b4ac-7c7e5f3371c9",
            "34a46884-5ccc-4e1e-a9cc-0ce6ccfc4d1c",
            "3598cb17-df53-4a2c-8965-6d7a5afda160",
            "bcfef817-4f9b-4b10-aa2a-9076b5d76e1e",
            "79c99cde-3de3-432e-a288-ad34a3423155"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "2589ef5a-616f-4a43-8bfb-7d653911d985",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "dc957479-cb9d-4cc6-89ca-736154afc0c8",
          "name": "DIMEVAMIDE [MART.]",
          "stdName": "DIMEVAMIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3598cb17-df53-4a2c-8965-6d7a5afda160"
          ],
          "display_name": false
        },
        {
          "uuid": "c3308b2e-2580-c9f9-7b33-af39f67bb576",
          "name": "Dimevamide [WHO-DD]",
          "stdName": "DIMEVAMIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c866e61-d1db-fb0d-d76f-526faa0815c0"
          ],
          "display_name": false
        },
        {
          "uuid": "469c4f45-417f-82d3-bb28-082969796e1a",
          "name": "NSC-759162",
          "stdName": "NSC-759162",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62cf5a30-6146-f945-3581-48ef2fa4f680"
          ],
          "display_name": false
        },
        {
          "uuid": "0b9282b4-c1d5-45ff-8485-2c7f630dcc86",
          "name": "VALERAMIDE, 4-(DIMETHYLAMINO)-2,2-DIPHENYL-",
          "stdName": "VALERAMIDE, 4-(DIMETHYLAMINO)-2,2-DIPHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d9dcba3f-e6cc-4d8b-826c-efebdff47f4b",
            "5e3c75df-38e0-4c5e-aa09-57a73d20c880"
          ],
          "display_name": false
        },
        {
          "uuid": "a5ed8175-6bf5-42c3-9d90-6b4a5c3a77e3",
          "name": "dimevamide [INN]",
          "stdName": "DIMEVAMIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "34a46884-5ccc-4e1e-a9cc-0ce6ccfc4d1c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "50eb3151-dca7-4b51-8e37-ba604ac0cc1d",
          "citation": "USP Dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "18118493-9479-4855-8820-8b4ea86ee079",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e3c75df-38e0-4c5e-aa09-57a73d20c880",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9dcba3f-e6cc-4d8b-826c-efebdff47f4b",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bcfef817-4f9b-4b10-aa2a-9076b5d76e1e",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7af91b8b-4c77-4e04-ad1c-cb534b6bcc04",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34a46884-5ccc-4e1e-a9cc-0ce6ccfc4d1c",
          "citation": "INN Proposed List 14",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL14.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3598cb17-df53-4a2c-8965-6d7a5afda160",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fab5185d-3267-43e5-97ae-a00fe840cf6b",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "79c99cde-3de3-432e-a288-ad34a3423155",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3385fc4a-c719-4c30-acf3-9cb62b34693e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390773000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b2912e06-e9e5-47df-acc4-beb5a6918b6c",
          "citation": "SRS import [IP1B47L61M]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IP1B47L61M",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390773000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "423cadf0-be9a-4807-b972-f42b1468dfbe",
          "citation": "DIMEVAMIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e27903cb-8416-48d1-b4ac-7c7e5f3371c9",
          "citation": "DIMEVAMIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a09f3985-1185-4609-ad30-b0b9e9cfd8b0",
          "citation": "AMINOPENTAMIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8d5086b9-aff3-408b-a35c-315d55d52635",
          "citation": "DIMEVAMIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "088f0a4d-7fcf-18f0-0ecd-618f80db4669",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=60-46-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4d89332e-319a-38bf-3eb8-5fa385c0707a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "148e5a9f-d071-42ec-b490-4f3d72f15b09",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e15e4e5a-561e-433e-9ae6-dc6a3f13f49b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "20b8da40-fb6f-4c91-8d88-8ee9a9ac66cc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "eda6ecd6-8dde-418b-81b2-d0e59b7581a2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "62cf5a30-6146-f945-3581-48ef2fa4f680",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "3c8310b1-4f9f-536a-f83d-2d4550aea95f",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "1c866e61-d1db-fb0d-d76f-526faa0815c0",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8426b283-f90b-4d05-ff5d-ab2c02542cd1",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e3f52285-f292-4112-b7df-df3bee73dd59",
          "id": "e3f52285-f292-4112-b7df-df3bee73dd59",
          "molfile": "\n  Marvin  01132111482D          \n\n 22 23  0  0  0  0            999 V2000\n    4.1920   -1.1081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1869   -1.8145    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.5778   -2.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6591   -2.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8913   -2.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4127   -1.5509    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4870   -3.0429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6437   -1.3768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3551   -0.9597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3424   -0.1254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6207    0.2739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9117   -0.1433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9194   -0.9776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6616   -3.0327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9553   -3.4550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9706   -4.2816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6898   -4.6859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4012   -4.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3910   -3.4344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0596   -2.2521    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6252   -1.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0545   -3.0480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 20  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  8  4  1  0  0  0  0\n 14  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  2  0  0  0  0\n  9  8  1  0  0  0  0\n 13  8  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 19 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 20  1  0  0  0  0\nM  END",
          "smiles": "CC(CC(c1ccccc1)(c2ccccc2)C(=O)N)N(C)C",
          "formula": "C19H24N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a4918590-fbe7-45f0-869b-3dee8a403498"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "296.4074",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "51bc53a5-ffa4-4487-86c3-bf7565069fc8",
      "version": "14",
      "structure": {
        "id": "728c6fbe-c6fa-47e3-9309-ee29eef3a31a",
        "molfile": "\n  Marvin  01132105562D          \n\n 22 23  0  0  0  0            999 V2000\n    2.6591   -2.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5778   -2.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8913   -2.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1869   -1.8145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6437   -1.3768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6616   -3.0327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0596   -2.2521    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4870   -3.0429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4127   -1.5509    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6252   -1.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0545   -3.0480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1920   -1.1081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9194   -0.9776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3551   -0.9597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9553   -3.4550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3910   -3.4344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3424   -0.1254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9706   -4.2816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4012   -4.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9117   -0.1433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6207    0.2739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6898   -4.6859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  3  2  0  0  0  0\n  9  3  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11  7  1  0  0  0  0\n  4 12  1  0  0  0  0\n 13  5  1  0  0  0  0\n 14  5  2  0  0  0  0\n 15  6  2  0  0  0  0\n 16  6  1  0  0  0  0\n 17 14  1  0  0  0  0\n 18 15  1  0  0  0  0\n 19 16  2  0  0  0  0\n 20 13  2  0  0  0  0\n 21 17  2  0  0  0  0\n 22 19  1  0  0  0  0\n 18 22  2  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
        "smiles": "CC(CC(c1ccccc1)(c2ccccc2)C(=O)N)N(C)C",
        "formula": "C19H24N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "296.4074",
        "optical_activity": "( + / - )",
        "references": [
          "50eb3151-dca7-4b51-8e37-ba604ac0cc1d",
          "b2912e06-e9e5-47df-acc4-beb5a6918b6c",
          "34a46884-5ccc-4e1e-a9cc-0ce6ccfc4d1c"
        ],
        "stereo_centers": 1
      },
      "unii": "IP1B47L61M"
    }
  ]
}