{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1c912fbe-e940-4169-9a84-67920e7bd458", "code": "82735-99-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=82735-99-7", "code_system": "CAS", "references": [ "866d28dd-e5a7-4afa-b1b8-9cf0172603c7", "86bd8824-7064-43cc-80e2-7cae8892b4f3" ] }, { "uuid": "71eb2785-2362-4389-8fbb-928c087df297", "code": "1426607", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426607/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "866d28dd-e5a7-4afa-b1b8-9cf0172603c7" ] }, { "uuid": "860bbd2c-3c3b-44e2-a9c1-70526a72f093", "code": "13628816", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13628816", "code_system": "PUBCHEM", "references": [ "866d28dd-e5a7-4afa-b1b8-9cf0172603c7" ] }, { "uuid": "cbd97e49-8af1-ed0c-625c-0727c4478d63", "code": "DTXSID70231980", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70231980", "code_system": "EPA CompTox", "references": [ "302bd041-66a5-c0a7-90b0-3a423446f403" ] }, { "uuid": "da7dc7e8-e1b1-431e-a1ac-075b854af461", "code": "IO86V844FA", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "b1265e95-2113-4bf9-8e27-4f8846fce8f8", "name": "D 600 (PLASTICIZER)", "stdName": "D 600 (PLASTICIZER)", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "556d92a1-8b1a-41c5-a69d-b1f63b79875e", "3a1be89e-9dca-4c85-bf92-69300d0da289" ], "display_name": false }, { "uuid": "3897b841-a41a-4a3a-8695-7c12781e30fb", "name": "DIPENTAERYTHRITOL HEXAOCTANOATE", "stdName": "DIPENTAERYTHRITOL HEXAOCTANOATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "556d92a1-8b1a-41c5-a69d-b1f63b79875e", "3a1be89e-9dca-4c85-bf92-69300d0da289" ], "display_name": false }, { "uuid": "1f7e8a6a-c375-4d74-9462-07e06756b42e", "name": "DIPENTAERYTHRITYL HEXACAPRYLATE", "stdName": "DIPENTAERYTHRITYL HEXACAPRYLATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "56760c7c-ec99-4037-8942-bf77088f3f51", "3a1be89e-9dca-4c85-bf92-69300d0da289" ], "display_name": true }, { "uuid": "275a5fec-499e-4a96-a2cf-5076fcd93d6f", "name": "OCTANOIC ACID, 2-((3-((1-OXOOCTYL)OXY)-2,2-BIS(((1-OXOOCTYL)OXY)METHYL)PROPOXY)METHYL)-2-(((1-OXOOCTYL)OXY)METHYL)-1,3-PROPANEDIYL ESTER", "stdName": "OCTANOIC ACID, 2-((3-((1-OXOOCTYL)OXY)-2,2-BIS(((1-OXOOCTYL)OXY)METHYL)PROPOXY)METHYL)-2-(((1-OXOOCTYL)OXY)METHYL)-1,3-PROPANEDIYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "556d92a1-8b1a-41c5-a69d-b1f63b79875e", "3a1be89e-9dca-4c85-bf92-69300d0da289" ], "display_name": false } ], "references": [ { "uuid": "56760c7c-ec99-4037-8942-bf77088f3f51", "citation": "pcpc-db", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "3a1be89e-9dca-4c85-bf92-69300d0da289", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "556d92a1-8b1a-41c5-a69d-b1f63b79875e", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "866d28dd-e5a7-4afa-b1b8-9cf0172603c7", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391013000, "tags": [ "NOMEN" ] }, { "uuid": "a3843ee2-aa47-439d-a248-3e5bbbeebe4c", "citation": "SRS import [IO86V844FA]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IO86V844FA", "doc_type": "SRS", "public_domain": true, "document_date": 1493391013000, "tags": [ "NOMEN" ] }, { "uuid": "37d160a4-4a7d-495e-9171-813dac11f032", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "302bd041-66a5-c0a7-90b0-3a423446f403", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=82735-99-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "86bd8824-7064-43cc-80e2-7cae8892b4f3", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7d1037fb-db1f-4709-a14e-52465d5b2471", "id": "7d1037fb-db1f-4709-a14e-52465d5b2471", "molfile": "\n Marvin 01132106292D \n\n 71 70 0 0 0 0 999 V2000\n 20.8863 -13.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4737 -12.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6487 -12.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2363 -11.5977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4113 -11.5977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9987 -10.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1737 -10.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7612 -10.1688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1737 -9.4543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9362 -10.1688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5237 -9.4543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6987 -9.4543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8737 -9.4543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4612 -8.7398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6362 -8.7398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2237 -8.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9382 -7.6128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9382 -6.7878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2237 -6.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5092 -6.7878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2237 -5.5504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5092 -5.1378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5092 -4.3128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7947 -3.9003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7947 -3.0753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0803 -2.6628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0803 -1.8378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8112 -7.3108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9862 -7.3108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5736 -6.5964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9862 -5.8820 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7486 -6.5964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3362 -5.8820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5112 -5.8820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0986 -5.1675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2736 -5.1675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8612 -4.4530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0362 -4.4530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5092 -8.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7947 -8.0254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0803 -8.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0803 -9.2628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3658 -8.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6513 -8.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9369 -8.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2223 -8.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5079 -8.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7934 -8.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0789 -8.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6987 -8.6293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4132 -8.2168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4132 -7.3918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6987 -6.9793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1276 -6.9793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1276 -6.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8422 -5.7418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8422 -4.9168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5566 -4.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5566 -3.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2710 -3.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6987 -10.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9842 -10.6918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9842 -11.5168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6987 -11.9293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2697 -11.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2697 -12.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5553 -13.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5553 -13.9918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8408 -14.4044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8408 -15.2294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1263 -15.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 8 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 50 1 0 0 0 0\n 12 61 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 28 1 0 0 0 0\n 16 39 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 2 0 0 0 0\n 21 19 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 28 29 1 0 0 0 0\n 30 29 1 0 0 0 0\n 30 31 2 0 0 0 0\n 32 30 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 39 40 1 0 0 0 0\n 41 40 1 0 0 0 0\n 41 42 2 0 0 0 0\n 43 41 1 0 0 0 0\n 44 43 1 0 0 0 0\n 45 44 1 0 0 0 0\n 46 45 1 0 0 0 0\n 47 46 1 0 0 0 0\n 47 48 1 0 0 0 0\n 48 49 1 0 0 0 0\n 50 51 1 0 0 0 0\n 52 51 1 0 0 0 0\n 52 53 2 0 0 0 0\n 54 52 1 0 0 0 0\n 55 54 1 0 0 0 0\n 56 55 1 0 0 0 0\n 57 56 1 0 0 0 0\n 58 57 1 0 0 0 0\n 58 59 1 0 0 0 0\n 59 60 1 0 0 0 0\n 61 62 1 0 0 0 0\n 63 62 1 0 0 0 0\n 63 64 2 0 0 0 0\n 65 63 1 0 0 0 0\n 66 65 1 0 0 0 0\n 67 66 1 0 0 0 0\n 68 67 1 0 0 0 0\n 69 68 1 0 0 0 0\n 69 70 1 0 0 0 0\n 70 71 1 0 0 0 0\nM END", "smiles": "CCCCCCCC(=O)OCC(COCC(COC(=O)CCCCCCC)(COC(=O)CCCCCCC)COC(=O)CCCCCCC)(COC(=O)CCCCCCC)COC(=O)CCCCCCC", "formula": "C58H106O13", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "13ddacb1-c8d6-4e72-a582-ff37ecb32b1e" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "1011.4567", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "6eb0bcb9-67d2-4497-bff4-aff0a730fdb2", "version": "3", "structure": { "id": "1eb339da-c414-4067-bdca-72a2779ef327", "molfile": "\n Marvin 01132101452D \n\n 71 70 0 0 0 0 999 V2000\n 19.6487 -12.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2363 -11.5977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4113 -11.5977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9987 -10.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1737 -10.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7612 -10.1688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1737 -9.4543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9362 -10.1688 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5237 -9.4543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6987 -9.4543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6987 -8.6293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4132 -8.2168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4132 -7.3918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1276 -6.9793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1276 -6.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8422 -5.7418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8422 -4.9168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5566 -4.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6987 -6.9793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8737 -9.4543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4612 -8.7398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6362 -8.7398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2237 -8.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5092 -8.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7947 -8.0254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0803 -8.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0803 -9.2628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3658 -8.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6513 -8.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9369 -8.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2223 -8.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5079 -8.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9382 -7.6128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9382 -6.7878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2237 -6.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5092 -6.7878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2237 -5.5504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5092 -5.1378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5092 -4.3128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7947 -3.9003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7947 -3.0753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8112 -7.3108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9862 -7.3108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5736 -6.5964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7486 -6.5964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3362 -5.8820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5112 -5.8820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0986 -5.1675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2736 -5.1675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9862 -5.8820 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6987 -10.2793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9842 -10.6918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9842 -11.5168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2697 -11.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2697 -12.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5553 -13.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5553 -13.9918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8408 -14.4044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6987 -11.9293 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4737 -12.3122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.5566 -3.6793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0803 -2.6628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8612 -4.4530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7934 -8.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8408 -15.2294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.8863 -13.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2710 -3.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0803 -1.8378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0362 -4.4530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0789 -8.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1263 -15.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 2 0 0 0 0\n 8 6 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 13 19 2 0 0 0 0\n 20 10 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 2 0 0 0 0\n 28 26 1 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 23 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 35 34 1 0 0 0 0\n 35 36 2 0 0 0 0\n 37 35 1 0 0 0 0\n 38 37 1 0 0 0 0\n 39 38 1 0 0 0 0\n 40 39 1 0 0 0 0\n 41 40 1 0 0 0 0\n 23 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 44 43 1 0 0 0 0\n 45 44 1 0 0 0 0\n 46 45 1 0 0 0 0\n 47 46 1 0 0 0 0\n 48 47 1 0 0 0 0\n 49 48 1 0 0 0 0\n 44 50 2 0 0 0 0\n 10 51 1 0 0 0 0\n 51 52 1 0 0 0 0\n 53 52 1 0 0 0 0\n 54 53 1 0 0 0 0\n 55 54 1 0 0 0 0\n 56 55 1 0 0 0 0\n 57 56 1 0 0 0 0\n 58 57 1 0 0 0 0\n 53 59 2 0 0 0 0\n 1 60 1 0 0 0 0\n 18 61 1 0 0 0 0\n 41 62 1 0 0 0 0\n 49 63 1 0 0 0 0\n 32 64 1 0 0 0 0\n 58 65 1 0 0 0 0\n 60 66 1 0 0 0 0\n 61 67 1 0 0 0 0\n 62 68 1 0 0 0 0\n 63 69 1 0 0 0 0\n 64 70 1 0 0 0 0\n 65 71 1 0 0 0 0\nM END", "smiles": "CCCCCCCC(=O)OCC(COCC(COC(=O)CCCCCCC)(COC(=O)CCCCCCC)COC(=O)CCCCCCC)(COC(=O)CCCCCCC)COC(=O)CCCCCCC", "formula": "C58H106O13", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "1011.4567", "optical_activity": "NONE", "references": [ "a3843ee2-aa47-439d-a248-3e5bbbeebe4c", "37d160a4-4a7d-495e-9171-813dac11f032" ], "stereo_centers": 0 }, "unii": "IO86V844FA" } ] }