{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8c20c935-5620-4474-a058-34e04d9577fb",
          "code": "1243-33-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1243-33-0",
          "code_system": "CAS",
          "references": [
            "b1dd80cc-0d5b-4385-9017-a3526ae2e550",
            "45fa7075-d274-4683-82c1-4f45b12d1d65"
          ]
        },
        {
          "uuid": "740b6d12-80df-4c8a-9934-2aa34c2df99c",
          "code": "C76941",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76941",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b1dd80cc-0d5b-4385-9017-a3526ae2e550"
          ]
        },
        {
          "uuid": "e9f1e1e2-bfcf-4ee0-b339-9b4a6443f8ef",
          "code": "SUB08702MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b1dd80cc-0d5b-4385-9017-a3526ae2e550"
          ]
        },
        {
          "uuid": "822daae9-ed88-4572-97b4-8af29d5d8185",
          "code": "1216",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1216",
          "code_system": "INN",
          "references": [
            "b1dd80cc-0d5b-4385-9017-a3526ae2e550"
          ]
        },
        {
          "uuid": "a7945a54-8377-472b-af95-58b57ab294b5",
          "code": "CHEMBL2107173",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2107173",
          "code_system": "ChEMBL",
          "references": [
            "b1dd80cc-0d5b-4385-9017-a3526ae2e550"
          ]
        },
        {
          "uuid": "db156aaf-704b-41ad-825d-053c39f56b20",
          "code": "3064105",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3064105",
          "code_system": "PUBCHEM",
          "references": [
            "b1dd80cc-0d5b-4385-9017-a3526ae2e550"
          ]
        },
        {
          "uuid": "9321971a-4f52-b513-0963-1f72236e8108",
          "code": "DTXSID30154262",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30154262",
          "code_system": "EPA CompTox",
          "references": [
            "58a10e0f-16f5-5a28-37b5-ad36df2ae52c"
          ]
        },
        {
          "uuid": "b906e65e-cf66-5b09-9309-fb85644ea6a7",
          "code": "C29756",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Sedative and Hypnotic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29756",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c7ab3a7e-0656-ea26-c7a8-c6cac40024ca"
          ]
        },
        {
          "uuid": "83d50b51-a611-4ad1-a81c-b6e719a27137",
          "code": "IM840F32VV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a5eb6a03-5a34-f60b-ae7e-2355a69ffb4a",
          "code": "100000082014",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "5369fd21-fa38-9cbb-5e36-b1135c6a6f47"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "00c4b967-d28d-4818-a247-597b3c4d3d12",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "91926c0d-031f-4bc6-9f2a-45977530533e",
            "refuuid": "f033cb08-5a08-4ea9-a6fc-be8e860d8c7f",
            "name": "MEFECLORAZINE",
            "unii": "IM840F32VV",
            "linking_id": "IM840F32VV",
            "ref_pname": "MEFECLORAZINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "141d5479-f72d-4397-ac78-77a335c2e2aa",
          "name": "1-O-CHLOROPHENYL-4-(3,4-DIMETHOXYPHENETHYL)PIPERAZINE",
          "stdName": "1-O-CHLOROPHENYL-4-(3,4-DIMETHOXYPHENETHYL)PIPERAZINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f266e7c3-06b2-4c31-8699-87ddaa743260"
          ],
          "display_name": false
        },
        {
          "uuid": "ce7c75e6-2a1a-49a9-af90-4d74c4e0633f",
          "name": "MEFECLORAZINE",
          "stdName": "MEFECLORAZINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f266e7c3-06b2-4c31-8699-87ddaa743260",
            "9ea98c27-9f2f-4168-8b31-c759f454a5eb",
            "72117bed-8c7f-4d5b-8dfd-04a0a22134b7"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "dbf1dff3-1a48-4742-8cc5-6d18bba157ae",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "d070c5ba-c782-4239-9d32-d37f25cb43fc",
          "name": "mefeclorazine [INN]",
          "stdName": "MEFECLORAZINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9ea98c27-9f2f-4168-8b31-c759f454a5eb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9ea98c27-9f2f-4168-8b31-c759f454a5eb",
          "citation": "INN Proposed List 12",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL12.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b1dd80cc-0d5b-4385-9017-a3526ae2e550",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390693000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fcd6d3bf-7da9-4e2c-b170-502d0529cebe",
          "citation": "SRS import [IM840F32VV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IM840F32VV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390693000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72117bed-8c7f-4d5b-8dfd-04a0a22134b7",
          "citation": "MEFECLORAZINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f266e7c3-06b2-4c31-8699-87ddaa743260",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "58a10e0f-16f5-5a28-37b5-ad36df2ae52c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1243-33-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c7ab3a7e-0656-ea26-c7a8-c6cac40024ca",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "45fa7075-d274-4683-82c1-4f45b12d1d65",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5369fd21-fa38-9cbb-5e36-b1135c6a6f47",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "109e1eb5-2bdb-4a88-9dd5-68fff25c75bb",
          "id": "109e1eb5-2bdb-4a88-9dd5-68fff25c75bb",
          "molfile": "\n  Marvin  01132101052D          \n\n 25 27  0  0  0  0            999 V2000\n   -0.7441   -2.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7441   -1.9674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0295   -1.5554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6852   -1.9674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3999   -1.5554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3999   -0.7063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1145   -0.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1145    0.5549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8292    0.9670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5439    0.5549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2585    0.9670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2585    1.8161    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5439    2.2281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8292    1.8161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9731    2.2281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9731    3.0773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6879    3.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4025    3.0773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4025    2.2281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6879    1.8161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6836    0.9921    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.6852   -0.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0295   -0.7063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7441   -0.2942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4546   -0.7063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n 23  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n 22  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 14  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 15 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 16 15  1  0  0  0  0\n 20 15  2  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\nM  END",
          "smiles": "COc1ccc(CCN2CCN(CC2)c3ccccc3Cl)cc1OC",
          "formula": "C20H25ClN2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cc1e9d48-13cd-4765-a4f3-cba6339f6be7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "360.8784",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f033cb08-5a08-4ea9-a6fc-be8e860d8c7f",
      "version": "6",
      "structure": {
        "id": "fe330028-2736-4fa8-98de-2fa4f40a7fea",
        "molfile": "\n  Marvin  01132113102D          \n\n 25 27  0  0  0  0            999 V2000\n    4.2585    1.8161    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9731    2.2281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8292    0.9670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6879    1.8161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0295   -0.7063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0295   -1.5554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5439    2.2281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2585    0.9670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6852   -0.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6852   -1.9674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5439    0.5549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8292    1.8161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4025    2.2281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1145    0.5549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3999   -0.7063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3999   -1.5554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7441   -0.2942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1145   -0.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7441   -1.9674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9731    3.0773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6879    3.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4025    3.0773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4546   -0.7063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7441   -2.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6836    0.9921    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3 11  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  9  1  0  0  0  0\n  6 10  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9 15  2  0  0  0  0\n 10 16  2  0  0  0  0\n 11  8  1  0  0  0  0\n 12  7  1  0  0  0  0\n 13  4  2  0  0  0  0\n 14  3  1  0  0  0  0\n 15 18  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17  5  1  0  0  0  0\n 18 14  1  0  0  0  0\n 19  6  1  0  0  0  0\n 20  2  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 17  1  0  0  0  0\n 24 19  1  0  0  0  0\n 12  3  1  0  0  0  0\n 22 13  1  0  0  0  0\n  5  6  2  0  0  0  0\n  4 25  1  0  0  0  0\nM  END",
        "smiles": "COc1ccc(CCN2CCN(CC2)c3ccccc3Cl)cc1OC",
        "formula": "C20H25ClN2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "360.8784",
        "optical_activity": "NONE",
        "references": [
          "f266e7c3-06b2-4c31-8699-87ddaa743260",
          "fcd6d3bf-7da9-4e2c-b170-502d0529cebe",
          "9ea98c27-9f2f-4168-8b31-c759f454a5eb"
        ],
        "stereo_centers": 0
      },
      "unii": "IM840F32VV"
    }
  ]
}