{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "af608f32-94c7-4327-8b5b-b9fa8a93f245",
          "code": "Urolithin_A",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Urolithin_A",
          "code_system": "WIKIPEDIA"
        },
        {
          "uuid": "b9dab492-f10c-4a96-9d6b-47ec8d302161",
          "code": "1143-70-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1143-70-0",
          "code_system": "CAS",
          "references": [
            "f3dd76a1-fd39-4300-be0d-8bcaa1781521"
          ]
        },
        {
          "uuid": "f1e4607f-19b6-4b7f-8a7f-5a291c49d439",
          "code": "ILJ8NEF6DT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d2b03e3a-094f-16f6-c438-5d7ccebbd7bc",
          "code": "5488186",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5488186",
          "code_system": "PUBCHEM",
          "references": [
            "b4b04a6b-470c-52a1-157c-d3eda903b4f2"
          ]
        },
        {
          "uuid": "d7768311-5eab-f63b-a949-484c337cd243",
          "code": "DB15464",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB15464",
          "code_system": "DRUG BANK",
          "references": [
            "1d454b0d-25e6-b70a-f912-02c6d9d6d76b"
          ]
        },
        {
          "uuid": "09065a3f-cde7-0c85-afb9-f76c1ab5a4eb",
          "code": "DTXSID40150694",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40150694",
          "code_system": "EPA CompTox",
          "references": [
            "1d454b0d-25e6-b70a-f912-02c6d9d6d76b"
          ]
        },
        {
          "uuid": "d2f84f8a-93f6-d9e0-2fd6-29bded988ecc",
          "code": "791",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=791",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "1d454b0d-25e6-b70a-f912-02c6d9d6d76b"
          ]
        },
        {
          "uuid": "234f7d43-0348-0243-95ae-058b2aa38ea8",
          "code": "ILJ8NEF6DT",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(ILJ8NEF6DT)",
          "code_system": "DAILYMED",
          "references": [
            "2c5ca3a6-1407-bded-88d5-921c522cd50e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "0a744d21-65af-4972-9dff-4ea4850f9c00",
          "amount": {
            "uuid": "b177278a-5dad-4f32-8339-9e2548bfcb3b"
          },
          "comments": "FORMED BY MICROFLORA",
          "type": "PARENT->METABOLITE ACTIVE",
          "references": [
            "0693b35a-76b9-bc2e-fdce-07ff07b107a5"
          ],
          "related_substance": {
            "uuid": "16675aa5-615c-4747-b3a2-724d5677ed45",
            "refuuid": "9ef63249-390f-4942-8f9f-941fa76b3f45",
            "name": "ELLAGIC ACID",
            "unii": "19YRN3ZS9P",
            "linking_id": "19YRN3ZS9P",
            "ref_pname": "ELLAGIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2f68860d-a53b-464f-980a-5521be9315db",
          "amount": {
            "uuid": "d8b48da7-9c21-46e1-a1f2-980c2d85a244"
          },
          "comments": "induce mitophagy, which is a selective recycling of mitochondria by autophagy,",
          "type": "ACTIVE MOIETY",
          "references": [
            "0693b35a-76b9-bc2e-fdce-07ff07b107a5"
          ],
          "related_substance": {
            "uuid": "b2125c6d-67c1-4512-a665-1843bdf8983b",
            "refuuid": "41841930-4044-4843-8221-23cf4e11165f",
            "name": "UROLITHIN A",
            "unii": "ILJ8NEF6DT",
            "linking_id": "ILJ8NEF6DT",
            "ref_pname": "UROLITHIN A",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e2c35414-7e28-f282-05c7-a32b890948da",
          "name": "3,8-DIHYDROXYBENZO(C)CHROMEN-6-ONE",
          "stdName": "3,8-DIHYDROXYBENZO(C)CHROMEN-6-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0693b35a-76b9-bc2e-fdce-07ff07b107a5"
          ],
          "display_name": false
        },
        {
          "uuid": "cfdf3a45-31f8-5622-9f82-4b3bd6d3ecdd",
          "name": "3,8-DIHYDROXYUROLITHIN",
          "stdName": "3,8-DIHYDROXYUROLITHIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3dd76a1-fd39-4300-be0d-8bcaa1781521"
          ],
          "display_name": false
        },
        {
          "uuid": "0964b1b8-2632-c3e4-82ea-1bd90000713b",
          "name": "6H-DIBENZO(B,D)PYRAN-6-ONE, 3,8-DIHYDROXY-",
          "stdName": "6H-DIBENZO(B,D)PYRAN-6-ONE, 3,8-DIHYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3dd76a1-fd39-4300-be0d-8bcaa1781521"
          ],
          "display_name": false
        },
        {
          "uuid": "057421ef-9292-4454-a734-c0d2da1c3252",
          "name": "Mitopure",
          "stdName": "MITOPURE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76c5e141-f105-47c0-b07c-a32543ecaf41"
          ],
          "display_name": false
        },
        {
          "uuid": "800d2a4d-0075-bdeb-9ffa-56582e8b2e03",
          "name": "URO-A",
          "stdName": "URO-A",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0693b35a-76b9-bc2e-fdce-07ff07b107a5"
          ],
          "display_name": false
        },
        {
          "uuid": "662d2994-c1dc-d82a-fdb5-f7ce1bba662f",
          "name": "UROLITHIN A",
          "stdName": "UROLITHIN A",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0693b35a-76b9-bc2e-fdce-07ff07b107a5"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d53f23ce-b882-475d-96a9-77e38b20cbaa",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "62ea1626-6659-409a-c823-578c9a82c0e7",
          "name": "Urolithin A [WHO-DD]",
          "stdName": "UROLITHIN A [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b015629-2bf0-060d-26c6-3e272c7497e0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0693b35a-76b9-bc2e-fdce-07ff07b107a5",
          "citation": "https://en.wikipedia.org/wiki/Urolithin_A",
          "url": "https://en.wikipedia.org/wiki/Urolithin_A",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7d7c5f46-97a6-f89b-1f47-217dc2bf6598",
          "citation": "PubChem",
          "doc_type": "resolver",
          "public_domain": true,
          "document_date": 1560745876059
        },
        {
          "uuid": "f3dd76a1-fd39-4300-be0d-8bcaa1781521",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b4b04a6b-470c-52a1-157c-d3eda903b4f2",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "1d454b0d-25e6-b70a-f912-02c6d9d6d76b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "76c5e141-f105-47c0-b07c-a32543ecaf41",
          "citation": "https://www.mitopure.com/",
          "url": "https://www.mitopure.com/",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2c5ca3a6-1407-bded-88d5-921c522cd50e",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "5b015629-2bf0-060d-26c6-3e272c7497e0",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5bc11ab1-1478-d43b-100e-c676b0edd8ae",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "923b730c-ead1-46ff-491e-7c813093da42",
          "id": "923b730c-ead1-46ff-491e-7c813093da42",
          "molfile": "\n  Marvin  01132107352D          \n\n 17 19  0  0  0  0            999 V2000\n   17.7106   -2.2795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0232   -2.6729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3087   -2.2604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5974   -2.6784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6101   -3.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2961   -3.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0169   -3.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2961   -4.6913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6101   -5.0874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6101   -5.8795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9241   -4.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2161   -5.1148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4984   -4.7079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8140   -5.1065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4984   -3.8828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2161   -3.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9241   -3.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  7  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n 17  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 17 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\nM  END",
          "smiles": "c1cc2c3ccc(cc3oc(=O)c2cc1O)O",
          "formula": "C13H8O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3fb850c4-2067-4efc-8bd5-c9821a5970e9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "228.2007",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "41841930-4044-4843-8221-23cf4e11165f",
      "version": "19",
      "structure": {
        "id": "40f1d9b5-e1ca-5a66-646f-0599e480682a",
        "molfile": "5488186\n  Marvin  01132103262D          \n\n 17 19  0  0  0  0            999 V2000\n   16.2955   -4.6911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8134   -5.1064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6095   -5.8793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7100   -2.2793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9235   -3.8990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6095   -3.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9235   -4.6911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2955   -3.8990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2155   -3.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5968   -2.6782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2155   -5.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6095   -5.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0163   -3.4976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4977   -3.8826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4977   -4.7077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3081   -2.2602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0226   -2.6727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  8  1  0  0  0  0\n  1 12  1  0  0  0  0\n  2 15  1  0  0  0  0\n  3 12  2  0  0  0  0\n  4 17  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  5  9  1  0  0  0  0\n  6  8  2  0  0  0  0\n  6 10  1  0  0  0  0\n  7 11  1  0  0  0  0\n  7 12  1  0  0  0  0\n  8 13  1  0  0  0  0\n  9 14  2  0  0  0  0\n 10 16  2  0  0  0  0\n 11 15  2  0  0  0  0\n 13 17  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
        "smiles": "c1cc2c3ccc(cc3oc(=O)c2cc1O)O",
        "formula": "C13H8O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "228.2007",
        "optical_activity": "NONE",
        "references": [
          "7d7c5f46-97a6-f89b-1f47-217dc2bf6598",
          "f3dd76a1-fd39-4300-be0d-8bcaa1781521"
        ],
        "stereo_centers": 0
      },
      "unii": "ILJ8NEF6DT"
    }
  ]
}