{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ee042cd4-1310-4c58-83b2-9d4491eb23b1",
          "code": "1646-88-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1646-88-4",
          "code_system": "CAS",
          "references": [
            "9e7ac376-20a7-4ccd-afc1-8b5ca8b5ed04",
            "f88e8a64-710a-4f6c-933b-6d64cfd73fd3"
          ]
        },
        {
          "uuid": "5093f3b4-bfc2-4033-a3d8-6aacffcc840b",
          "code": "110801",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1053",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "9e7ac376-20a7-4ccd-afc1-8b5ca8b5ed04"
          ]
        },
        {
          "uuid": "6cd91580-9ece-44e6-8caa-9bea77ce0c32",
          "code": "216-710-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.192",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9e7ac376-20a7-4ccd-afc1-8b5ca8b5ed04"
          ]
        },
        {
          "uuid": "0f6bc27a-eac0-41b0-89c8-97eaf9d9e382",
          "code": "9570093",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9570093",
          "code_system": "PUBCHEM",
          "references": [
            "9e7ac376-20a7-4ccd-afc1-8b5ca8b5ed04"
          ]
        },
        {
          "uuid": "a26dd591-ae32-6206-9478-0a1b8dbc2ad8",
          "code": "DTXSID6023862",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6023862",
          "code_system": "EPA CompTox",
          "references": [
            "a8b6022c-5a09-f14d-a1d0-4ba2f0384dc3"
          ]
        },
        {
          "uuid": "2ec843da-f9c6-429c-a952-586a3902c170",
          "code": "IL70ANS043",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4850d3f7-3dcf-8e1e-4020-f4b59a504029",
          "code": "aldoxycarb",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/aldoxycarb.html",
          "code_system": "ALANWOOD",
          "references": [
            "d7799bf1-30b4-de7d-1ebf-4b3eb0f9f7c4"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "f2d33208-5c19-44ae-a32d-4e74b877a5c1",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1afbd30d-c3b9-4884-bd7d-c83333f0aab1",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff5fcaf3-16d9-4604-9911-a3d9c8c3cbeb",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29cfaa02-e299-45ea-9b16-24dfff7c2010",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e7ac376-20a7-4ccd-afc1-8b5ca8b5ed04",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390947000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49544b42-4df1-4d2e-9a06-584ecec728d0",
          "citation": "SRS import [IL70ANS043]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IL70ANS043",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390947000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6bf9f9a9-504f-4507-9d5d-e1de03099ec9",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5371773e-3654-48ea-88d8-59607ce26a26",
          "citation": "ALDOXYCARB [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a8b6022c-5a09-f14d-a1d0-4ba2f0384dc3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1646-88-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d7799bf1-30b4-de7d-1ebf-4b3eb0f9f7c4",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "ab90fc72-3d32-4318-8887-e60bfddaac2e",
          "citation": "J Assoc Off Anal Chem 1981;64(3):724",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f88e8a64-710a-4f6c-933b-6d64cfd73fd3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cca3cb5e-1fe7-4448-87aa-ee887505a8d7",
          "id": "cca3cb5e-1fe7-4448-87aa-ee887505a8d7",
          "molfile": "\n  Marvin  01132110342D          \n\n 14 13  0  0  0  0            999 V2000\n    9.6807   -6.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2663   -5.4903    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4436   -5.4903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0245   -6.1960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0245   -4.7735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2020   -4.7735    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7873   -4.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9601   -4.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9601   -3.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9601   -4.8881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1375   -4.0523    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3148   -4.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1375   -3.2297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1375   -4.8881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  2  0  0  0  0\nM  END",
          "smiles": "CC(C)(/C=N/OC(=O)NC)S(=O)(=O)C",
          "formula": "C7H14N2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "55c748f1-5626-4517-a021-308716c4b44f"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "222.2634",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8c7f96ce-9ed2-4d24-9c61-7a442a7814fa",
      "version": "5",
      "structure": {
        "id": "a052b85b-60c3-4965-87a6-9d61fa2271f8",
        "molfile": "\n  Marvin  01132108202D          \n\n 14 13  0  0  0  0            999 V2000\n    5.9601   -4.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7873   -4.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2020   -4.7735    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0245   -4.7735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4436   -5.4903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2663   -5.4903    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6807   -6.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0245   -6.1960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1375   -4.0523    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3148   -4.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1375   -3.2297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1375   -4.8881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9601   -3.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9601   -4.8881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  5  8  2  0  0  0  0\n  1  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n  9 12  2  0  0  0  0\n  1 13  1  0  0  0  0\n  1 14  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(/C=N/OC(=O)NC)S(=O)(=O)C",
        "formula": "C7H14N2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "222.2634",
        "optical_activity": "NONE",
        "references": [
          "49544b42-4df1-4d2e-9a06-584ecec728d0",
          "6bf9f9a9-504f-4507-9d5d-e1de03099ec9"
        ],
        "stereo_centers": 0
      },
      "unii": "IL70ANS043",
      "relationships": [
        {
          "uuid": "00c3a7c2-49f3-4467-9eee-c89b089c33b9",
          "amount": {
            "uuid": "a4b77854-2725-44d6-81ad-3fc8e6ece8d2"
          },
          "type": "PARENT->METABOLITE",
          "references": [
            "ab90fc72-3d32-4318-8887-e60bfddaac2e"
          ],
          "related_substance": {
            "uuid": "aa065579-93d2-472e-abb3-0a826682c307",
            "refuuid": "a0fdcfba-223b-4ed0-b99a-6e93e5ab65e2",
            "name": "ALDICARB",
            "unii": "8V071SH05P",
            "linking_id": "8V071SH05P",
            "ref_pname": "ALDICARB",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "b132807d-f79b-4372-ae31-7796ed6861ae",
          "name": "2-METHYL-2-(METHYLSULFONYL)PROPIONALDEHYDE O-(METHYLCARBAMOYL)OXIME",
          "stdName": "2-METHYL-2-(METHYLSULFONYL)PROPIONALDEHYDE O-(METHYLCARBAMOYL)OXIME",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29cfaa02-e299-45ea-9b16-24dfff7c2010",
            "ff5fcaf3-16d9-4604-9911-a3d9c8c3cbeb"
          ],
          "display_name": false
        },
        {
          "uuid": "c8705cd7-1c44-4768-9a0e-a1341c0c2ec2",
          "name": "ALDICARB SULFONE",
          "stdName": "ALDICARB SULFONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1afbd30d-c3b9-4884-bd7d-c83333f0aab1",
            "ff5fcaf3-16d9-4604-9911-a3d9c8c3cbeb"
          ],
          "display_name": false
        },
        {
          "uuid": "a2504025-7d03-4c13-bc16-f1408119fd88",
          "name": "ALDOXYCARB",
          "stdName": "ALDOXYCARB",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f2d33208-5c19-44ae-a32d-4e74b877a5c1",
            "1afbd30d-c3b9-4884-bd7d-c83333f0aab1",
            "ff5fcaf3-16d9-4604-9911-a3d9c8c3cbeb",
            "5371773e-3654-48ea-88d8-59607ce26a26"
          ],
          "display_name": true
        },
        {
          "uuid": "51a220ab-123f-4d25-b45b-6b8c75e536a3",
          "name": "ALDOXYCARB [ISO]",
          "stdName": "ALDOXYCARB [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1afbd30d-c3b9-4884-bd7d-c83333f0aab1",
            "ff5fcaf3-16d9-4604-9911-a3d9c8c3cbeb"
          ],
          "display_name": false
        },
        {
          "uuid": "f4f739fa-8061-468b-b524-08ab1b80a9e4",
          "name": "PROPANAL, 2-METHYL-2-(METHYLSULFONYL)-, O- ((METHYLAMINO)CARBONYL) OXIME",
          "stdName": "PROPANAL, 2-METHYL-2-(METHYLSULFONYL)-, O- ((METHYLAMINO)CARBONYL) OXIME",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1afbd30d-c3b9-4884-bd7d-c83333f0aab1",
            "ff5fcaf3-16d9-4604-9911-a3d9c8c3cbeb"
          ],
          "display_name": false
        },
        {
          "uuid": "deff6a12-92e0-4cda-a3ee-4e6de0bf163f",
          "name": "PROPANAL, 2-METHYL-2-(METHYLSULFONYL)-, O-((METHYLAMINO)CARBONYL)OXIME",
          "stdName": "PROPANAL, 2-METHYL-2-(METHYLSULFONYL)-, O-((METHYLAMINO)CARBONYL)OXIME",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29cfaa02-e299-45ea-9b16-24dfff7c2010",
            "ff5fcaf3-16d9-4604-9911-a3d9c8c3cbeb"
          ],
          "display_name": false
        },
        {
          "uuid": "68fe0d5e-31ef-4aa3-b890-c5cc4f350e71",
          "name": "PROPIONALDEHYDE, 2-METHYL-2-(METHYLSULFONYL)-, O-(METHYLCARBAMOYL)OXIME",
          "stdName": "PROPIONALDEHYDE, 2-METHYL-2-(METHYLSULFONYL)-, O-(METHYLCARBAMOYL)OXIME",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29cfaa02-e299-45ea-9b16-24dfff7c2010",
            "ff5fcaf3-16d9-4604-9911-a3d9c8c3cbeb"
          ],
          "display_name": false
        },
        {
          "uuid": "d3924eef-3787-40b9-8e91-2b656b721e66",
          "name": "RCRA WASTE NO. P203",
          "stdName": "RCRA WASTE NO. P203",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1afbd30d-c3b9-4884-bd7d-c83333f0aab1",
            "ff5fcaf3-16d9-4604-9911-a3d9c8c3cbeb"
          ],
          "display_name": false
        },
        {
          "uuid": "fa079a9d-fe6e-4c5e-8c32-6ea28e7d070e",
          "name": "STANDAK",
          "stdName": "STANDAK",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29cfaa02-e299-45ea-9b16-24dfff7c2010",
            "ff5fcaf3-16d9-4604-9911-a3d9c8c3cbeb"
          ],
          "display_name": false
        },
        {
          "uuid": "3eeab67a-b5ce-4a7e-9598-27550acb7d21",
          "name": "SULFOCARB",
          "stdName": "SULFOCARB",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29cfaa02-e299-45ea-9b16-24dfff7c2010",
            "ff5fcaf3-16d9-4604-9911-a3d9c8c3cbeb"
          ],
          "display_name": false
        },
        {
          "uuid": "4912fd6d-c209-4c86-8e6a-3641861dab5f",
          "name": "TEMIK SULFONE",
          "stdName": "TEMIK SULFONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29cfaa02-e299-45ea-9b16-24dfff7c2010",
            "ff5fcaf3-16d9-4604-9911-a3d9c8c3cbeb"
          ],
          "display_name": false
        },
        {
          "uuid": "016b458f-0a76-4236-a9fb-c87d1d6dc637",
          "name": "UC-21865",
          "stdName": "UC-21865",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29cfaa02-e299-45ea-9b16-24dfff7c2010",
            "ff5fcaf3-16d9-4604-9911-a3d9c8c3cbeb"
          ],
          "display_name": false
        },
        {
          "uuid": "42f15edf-4435-4d97-8e62-656c37f876e9",
          "name": "UCES",
          "stdName": "UCES",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29cfaa02-e299-45ea-9b16-24dfff7c2010",
            "ff5fcaf3-16d9-4604-9911-a3d9c8c3cbeb"
          ],
          "display_name": false
        },
        {
          "uuid": "1df54713-f642-46c9-abe7-937688a2078e",
          "name": "YANGDIMIEWEI",
          "stdName": "YANGDIMIEWEI",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "29cfaa02-e299-45ea-9b16-24dfff7c2010",
            "ff5fcaf3-16d9-4604-9911-a3d9c8c3cbeb"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "b500a47b-d6ab-4c5c-9b95-714ce229c52f"
      }
    }
  ]
}