{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "96c82a73-baf6-4cd9-97c1-e877a7952f2e",
          "code": "465-16-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=465-16-7",
          "code_system": "CAS",
          "references": [
            "81457242-31a3-4265-98c8-cc265ffb7426",
            "4c571272-c240-4038-844f-2bc77adfc44f"
          ]
        },
        {
          "uuid": "0e464f7f-b6fd-455d-b746-9fd3c3bdb245",
          "code": "C021065",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67021065",
          "code_system": "MESH",
          "references": [
            "81457242-31a3-4265-98c8-cc265ffb7426"
          ]
        },
        {
          "uuid": "d9b41598-b71c-4e9e-baec-81f593d96bd3",
          "code": "OLEANDRIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Oleandrin",
          "code_system": "WIKIPEDIA",
          "references": [
            "81457242-31a3-4265-98c8-cc265ffb7426"
          ]
        },
        {
          "uuid": "055e02e3-1271-4000-bdd7-fddd5150925d",
          "code": "m8189",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8189?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "81457242-31a3-4265-98c8-cc265ffb7426"
          ]
        },
        {
          "uuid": "a44e721c-1a01-4c5e-b285-0d51dd7f278b",
          "code": "SUB14684MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "81457242-31a3-4265-98c8-cc265ffb7426"
          ]
        },
        {
          "uuid": "cadf6a05-fcd9-4b31-a70a-51238f8bad64",
          "code": "207-361-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.693",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "81457242-31a3-4265-98c8-cc265ffb7426"
          ]
        },
        {
          "uuid": "03580895-6d5b-461d-a925-81fee11af1dc",
          "code": "11541511",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11541511",
          "code_system": "PUBCHEM",
          "references": [
            "81457242-31a3-4265-98c8-cc265ffb7426"
          ]
        },
        {
          "uuid": "a85f7aa5-ee86-2c27-fbcb-9db42ceebf39",
          "code": "C90586",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C90586",
          "code_system": "NCI_THESAURUS",
          "references": [
            "18639ca3-1577-f85f-ecb1-dd5854e73288"
          ]
        },
        {
          "uuid": "eecd2a78-c7cd-0f8c-5105-488ce0220ae8",
          "code": "3518",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3518",
          "code_system": "HSDB",
          "references": [
            "1832d75e-9ca1-78fa-9170-ebd23fb6c84a"
          ]
        },
        {
          "uuid": "c39408af-5e8c-4f39-7e9c-7ff9f4d79bf8",
          "code": "C274",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C274",
          "code_system": "NCI_THESAURUS",
          "references": [
            "77bc25c4-f283-dc56-c5bd-a45b9f67118e"
          ]
        },
        {
          "uuid": "16ba4f26-2717-41a2-b96b-3e73b1e6c7d0",
          "code": "II95UDU7I4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "eec616a5-b3de-c159-b091-a8e403e0884f",
          "code": "3399",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3399",
          "code_system": "DRUG CENTRAL",
          "references": [
            "77bc25c4-f283-dc56-c5bd-a45b9f67118e"
          ]
        },
        {
          "uuid": "f77118d6-4a73-cb90-66c5-8b2012b843a2",
          "code": "DB12843",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB12843",
          "code_system": "DRUG BANK",
          "references": [
            "77bc25c4-f283-dc56-c5bd-a45b9f67118e"
          ]
        },
        {
          "uuid": "16bdd9dc-b5bb-d2b3-0042-17abe66d8782",
          "code": "100000080011",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "7d26c1ac-ec69-c583-6269-f1be7526177f"
          ]
        },
        {
          "uuid": "539f824a-9e83-554d-007f-9ce93b7dd4e0",
          "code": "DTXSID40861950",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40861950",
          "code_system": "EPA CompTox",
          "references": [
            "77bc25c4-f283-dc56-c5bd-a45b9f67118e"
          ]
        },
        {
          "uuid": "a9522df8-02b8-be42-6f6a-f196e1905a24",
          "code": "692219",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=692219",
          "code_system": "NSC",
          "references": [
            "b0ba8d15-b1fe-fa59-a4af-a51c664bb398"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "5576ea77-73ed-4c7f-a4a5-261d923e2e8c",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "aa783c46-19ea-4ad3-a60b-21e827d86220",
            "refuuid": "0e68da2f-cbe7-4188-b5bf-02c213a625a7",
            "name": "OLEANDRIN",
            "unii": "II95UDU7I4",
            "linking_id": "II95UDU7I4",
            "ref_pname": "OLEANDRIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8d2d954a-5c76-4a3e-b088-8a8917f5bcba",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "da6af559-7de4-48ef-b5cf-4723977e8c6b",
            "refuuid": "8bc6ec34-a291-4ba1-abb4-39d799480290",
            "name": "NERIUM OLEANDER (OLEANDER) LEAF EXTRACT",
            "linking_id": "8bc6ec34-a291-4ba1-abb4-39d799480290",
            "ref_pname": "NERIUM OLEANDER (OLEANDER) LEAF EXTRACT"
          }
        },
        {
          "uuid": "0d687730-2c92-4e6f-8419-a9008f110751",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "1db0c172-5277-436e-adf9-c9edb0226e62"
          ],
          "related_substance": {
            "uuid": "c7b42bfd-acd9-4a40-b887-ad83da425478",
            "refuuid": "52a83d5f-ed34-415d-b295-6ca354080f64",
            "name": "NERIUM OLEANDER LEAF",
            "unii": "7KV510R6H6",
            "linking_id": "7KV510R6H6",
            "ref_pname": "NERIUM OLEANDER LEAF"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "eddb497a-94f7-4bf8-b939-3b0998e889f8",
          "name": "ANVIRZEL",
          "stdName": "ANVIRZEL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae32465f-619c-4a2f-ae3b-70afc16ffde9",
            "1cbca9c7-4527-467c-ac05-4a1ec7dd39d5"
          ],
          "display_name": false
        },
        {
          "uuid": "74af9d0a-f3cc-451a-a107-715c69805188",
          "name": "CARD-20(22)-ENOLIDE, 16-(ACETYLOXY)-3-((2,6-DIDEOXY-3-O-METHYL-.ALPHA.-L-ARABINO-HEXOPYRANOSYL)OXY)-14-HYDROXY-, (3.BETA.,5.BETA.,16.BETA.)-",
          "stdName": "CARD-20(22)-ENOLIDE, 16-(ACETYLOXY)-3-((2,6-DIDEOXY-3-O-METHYL-.ALPHA.-L-ARABINO-HEXOPYRANOSYL)OXY)-14-HYDROXY-, (3.BETA.,5.BETA.,16.BETA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cbca9c7-4527-467c-ac05-4a1ec7dd39d5",
            "c8d8b466-9b30-4ecb-b7e0-bcb5404595cd"
          ],
          "display_name": false
        },
        {
          "uuid": "e3adefde-8cfe-47f1-88c4-7aae9d2f7d39",
          "name": "NSC-692219",
          "stdName": "NSC-692219",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cbca9c7-4527-467c-ac05-4a1ec7dd39d5",
            "2edfb13e-5d92-4191-bc0c-4f6d7a435f8a"
          ],
          "display_name": false
        },
        {
          "uuid": "ebb885b7-bb7f-4c9c-a608-a3ef1aace19f",
          "name": "OLEANDRIN",
          "stdName": "OLEANDRIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4d1037f-c791-40dd-a7d1-3f89f43e606c",
            "1cbca9c7-4527-467c-ac05-4a1ec7dd39d5",
            "a4352088-18aa-4134-9f48-22e9b511d3a7",
            "1353726c-5ac5-4ba9-83ac-5eea6e44df29",
            "50a3282b-50f2-484f-b59b-50b8acb30909",
            "25ca74ba-ac67-42c4-b718-a222f036f20a"
          ],
          "display_name": true
        },
        {
          "uuid": "05f76e43-f579-494b-8305-48450c3357ab",
          "name": "OLEANDRIN [MI]",
          "stdName": "OLEANDRIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cbca9c7-4527-467c-ac05-4a1ec7dd39d5",
            "1353726c-5ac5-4ba9-83ac-5eea6e44df29"
          ],
          "display_name": false
        },
        {
          "uuid": "fd5f1713-b5bd-6652-9d23-70d5702f7ba6",
          "name": "Oleandrin [WHO-DD]",
          "stdName": "OLEANDRIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4d0dd28-52fd-95e0-8cb6-66bc83841829"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "50a3282b-50f2-484f-b59b-50b8acb30909",
          "citation": "merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1cbca9c7-4527-467c-ac05-4a1ec7dd39d5",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8d8b466-9b30-4ecb-b7e0-bcb5404595cd",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "25ca74ba-ac67-42c4-b718-a222f036f20a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1353726c-5ac5-4ba9-83ac-5eea6e44df29",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae32465f-619c-4a2f-ae3b-70afc16ffde9",
          "citation": "https://www.mskcc.org/cancer-care/integrative-medicine/herbs/oleandrin",
          "url": "https://www.mskcc.org/cancer-care/integrative-medicine/herbs/oleandrin",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2edfb13e-5d92-4191-bc0c-4f6d7a435f8a",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81457242-31a3-4265-98c8-cc265ffb7426",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391671000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4244d73-41b8-417d-a94d-61ca78b9c380",
          "citation": "SRS import [II95UDU7I4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=II95UDU7I4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391671000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4352088-18aa-4134-9f48-22e9b511d3a7",
          "citation": "OLEANDRIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a4d1037f-c791-40dd-a7d1-3f89f43e606c",
          "citation": "OLEANDRIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1832d75e-9ca1-78fa-9170-ebd23fb6c84a",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+465-16-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "77bc25c4-f283-dc56-c5bd-a45b9f67118e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4c571272-c240-4038-844f-2bc77adfc44f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1db0c172-5277-436e-adf9-c9edb0226e62",
          "citation": "Gechtman, Cecilia, et al. \"Unexpectedly dangerous escargot stew: oleandrin poisoning through the alimentary chain.\" Journal of analytical toxicology 30.9 (2006): 683-686.",
          "url": "https://academic.oup.com/jat/article/30/9/683/740701",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "18639ca3-1577-f85f-ecb1-dd5854e73288",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "b0ba8d15-b1fe-fa59-a4af-a51c664bb398",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c4d0dd28-52fd-95e0-8cb6-66bc83841829",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7d26c1ac-ec69-c583-6269-f1be7526177f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bb9069ca-3803-42ac-a42e-4c1f83ccfe27",
          "id": "bb9069ca-3803-42ac-a42e-4c1f83ccfe27",
          "molfile": "\n  Marvin  01132109422D          \n\n 41 46  0  0  1  0            999 V2000\n   12.4637   -5.5551    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   12.4637   -6.3857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0398   -6.3857    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   11.0398   -7.2101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3279   -6.8009    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.3279   -7.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6140   -8.0468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9020   -7.6315    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    8.1901   -8.0468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4782   -7.6315    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.4782   -6.8009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1901   -6.3857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9020   -6.8009    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.9020   -5.9764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6140   -6.3857    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.6140   -5.5551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3279   -5.1377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0398   -5.5551    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   11.0398   -4.7306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7518   -5.1377    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   11.7518   -4.3133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0992   -3.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3652   -3.0387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8926   -2.3637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1957   -3.0387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4331   -3.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7642   -8.0447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0502   -7.6315    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.3383   -8.0447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6223   -7.6315    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.9082   -8.0447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1943   -7.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6223   -6.8070    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.9082   -6.3959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3383   -6.3959    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.3383   -5.5714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0502   -6.8070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1777   -5.1418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8917   -5.5551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6057   -5.1418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8917   -6.3795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n 20  1  1  0  0  0  0\n  1 38  1  1  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  1  0  0  0\n  5  3  1  0  0  0  0\n  3 18  1  0  0  0  0\n  5  6  1  6  0  0  0\n 15  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 13  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 27  1  1  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  1  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  1  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  1  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  1  0  0  0\n 21 22  2  0  0  0  0\n 21 26  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 23 25  1  0  0  0  0\n 26 25  1  0  0  0  0\n 28 27  1  1  0  0  0\n 28 29  1  0  0  0  0\n 28 37  1  0  0  0  0\n 30 29  1  0  0  0  0\n 30 31  1  6  0  0  0\n 30 33  1  0  0  0  0\n 31 32  1  0  0  0  0\n 33 34  1  1  0  0  0\n 33 35  1  0  0  0  0\n 35 36  1  6  0  0  0\n 35 37  1  0  0  0  0\n 38 39  1  0  0  0  0\n 39 40  1  0  0  0  0\n 39 41  2  0  0  0  0\nM  END",
          "smiles": "C[C@H]1[C@@H]([C@H](C[C@@H](O1)O[C@H]2CC[C@@]3(C)[C@H](CC[C@@H]4[C@@H]3CC[C@]5(C)[C@@H](C6=CC(=O)OC6)[C@H](C[C@]45O)OC(=O)C)C2)OC)O",
          "formula": "C32H48O9",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ad454fb0-20a9-4512-8cd4-7db869506000"
          },
          "defined_stereo": 13,
          "ez_centers": 0,
          "molecular_weight": "576.7193",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 13
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0e68da2f-cbe7-4188-b5bf-02c213a625a7",
      "version": "15",
      "structure": {
        "id": "0f57de1b-0cfb-4a28-861c-6c7a765355c2",
        "molfile": "\n  Marvin  01132101022D          \n\n 45 50  0  0  1  0            999 V2000\n   11.0409   -7.2108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0409   -6.3863    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.0409   -5.5556    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.0409   -4.7311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7529   -5.1382    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.4649   -5.5556    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.4649   -6.3863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1790   -5.1423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8930   -5.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6071   -5.1423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8930   -6.3801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7529   -4.3137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1003   -3.8103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3663   -3.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1969   -3.0390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4343   -3.8103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8936   -2.3639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3289   -5.1382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6149   -5.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6149   -6.3863    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.3289   -6.8016    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.3289   -7.6322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6149   -8.0476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9029   -7.6322    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.9029   -6.8016    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.9029   -5.9770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1909   -6.3863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4789   -6.8016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4789   -7.6322    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.1909   -8.0476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7648   -8.0455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0508   -7.6322    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.3388   -8.0455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6227   -7.6322    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.9086   -8.0455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1946   -7.6322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6227   -6.8077    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.3388   -6.3965    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.0508   -6.8077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3388   -5.5719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9086   -6.3965    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0508   -8.4568    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9029   -8.4568    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3289   -5.9770    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6149   -7.2108    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  1  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  1  1  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n  5 12  1  1  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 12 16  1  0  0  0  0\n 16 15  1  0  0  0  0\n 14 17  2  0  0  0  0\n  3 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n  2 21  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 20 25  1  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  1  0  0  0\n 25 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 24 30  1  0  0  0  0\n 30 29  1  0  0  0  0\n 29 31  1  1  0  0  0\n 31 32  1  0  0  0  0\n 32 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  6  0  0  0\n 35 36  1  0  0  0  0\n 34 37  1  0  0  0  0\n 38 37  1  0  0  0  0\n 32 39  1  0  0  0  0\n 39 38  1  0  0  0  0\n 38 40  1  6  0  0  0\n 37 41  1  1  0  0  0\n 32 42  1  6  0  0  0\n 24 43  1  1  0  0  0\n 21 44  1  1  0  0  0\n 20 45  1  6  0  0  0\nM  END",
        "smiles": "C[C@H]1[C@@H]([C@H](C[C@@]([H])(O1)O[C@H]2CC[C@@]3(C)[C@]([H])(CC[C@]4([H])[C@]3([H])CC[C@]5(C)[C@@H](C6=CC(=O)OC6)[C@H](C[C@]45O)OC(=O)C)C2)OC)O",
        "formula": "C32H48O9",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 13,
        "ez_centers": 0,
        "molecular_weight": "576.7193",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d4244d73-41b8-417d-a94d-61ca78b9c380",
          "50a3282b-50f2-484f-b59b-50b8acb30909"
        ],
        "stereo_centers": 13
      },
      "unii": "II95UDU7I4"
    }
  ]
}