{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "228dcfe2-37b7-4026-9f61-8dbef1fcc9f1",
          "code": "28251-55-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=28251-55-0",
          "code_system": "CAS",
          "references": [
            "2f4030ae-da8b-4d95-a9f0-134e825098a3",
            "0060fe3f-8a94-4f4f-9fba-7e7d5fa691e2"
          ]
        },
        {
          "uuid": "a0804bf3-d863-4842-a796-c60a33a7ac9b",
          "code": "21145406",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21145406",
          "code_system": "PUBCHEM",
          "references": [
            "2f4030ae-da8b-4d95-a9f0-134e825098a3"
          ]
        },
        {
          "uuid": "006d2e1b-dc7a-46d7-a180-f91fa1e7e6ed",
          "code": "II64NNN45G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2a82fbd2-e288-3c50-ab37-814e1ee2bde3",
          "code": "300000020371",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "61ade630-149d-1819-14f5-ef67b0f4e2a3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "391060f4-c16e-404b-8b37-e6ea7040e674",
          "name": "3,6-ANHYDRO-L-GALACTOSE",
          "stdName": "3,6-ANHYDRO-L-GALACTOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a543380-c5ec-4c78-a28a-66597768a258",
            "e9c13bcd-126b-4617-9f10-17b2d7b3cc05"
          ],
          "display_name": false
        },
        {
          "uuid": "981f1fa4-9016-410b-9a2b-2747129f51f7",
          "name": "3,6-ANHYDROGALACTOSE, L-",
          "stdName": "3,6-ANHYDROGALACTOSE, L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a543380-c5ec-4c78-a28a-66597768a258",
            "4a24fef6-25f3-4f3a-8aa0-c91fec89d38f"
          ],
          "display_name": true
        },
        {
          "uuid": "a26b13b4-5041-4c9b-86a0-5bccf7fb7ae9",
          "name": "AHG",
          "stdName": "AHG",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a543380-c5ec-4c78-a28a-66597768a258",
            "1ce66837-accf-4ac3-a817-63046750acd2"
          ],
          "display_name": false
        },
        {
          "uuid": "3af3b018-e446-4707-9c5e-29d1615e42b4",
          "name": "L-GALACTOSE, 3,6-ANHYDRO-",
          "stdName": "L-GALACTOSE, 3,6-ANHYDRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8a543380-c5ec-4c78-a28a-66597768a258",
            "e9c13bcd-126b-4617-9f10-17b2d7b3cc05"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1ce66837-accf-4ac3-a817-63046750acd2",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8a543380-c5ec-4c78-a28a-66597768a258",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9c13bcd-126b-4617-9f10-17b2d7b3cc05",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a24fef6-25f3-4f3a-8aa0-c91fec89d38f",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f4030ae-da8b-4d95-a9f0-134e825098a3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391318000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf624891-1ca1-48ad-9492-59650cd08cd5",
          "citation": "SRS import [II64NNN45G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=II64NNN45G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391318000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0060fe3f-8a94-4f4f-9fba-7e7d5fa691e2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "61ade630-149d-1819-14f5-ef67b0f4e2a3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ff26d392-cfdf-4050-8336-04e77cb1e36f",
          "id": "ff26d392-cfdf-4050-8336-04e77cb1e36f",
          "molfile": "\n  Marvin  01132113122D          \n\n 11 11  0  0  1  0            999 V2000\n   13.8399   -7.5975    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   13.4275   -6.8830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6650   -7.5975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0774   -6.8830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4275   -8.3120    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   12.7599   -7.8271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0925   -8.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3475   -9.0967    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   11.8626   -9.7641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1725   -9.0967    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   13.6574   -9.7641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  6  1  1  0  0  0\n  5 10  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  1  0  0  0\n 10  8  1  0  0  0  0\n 10 11  1  6  0  0  0\nM  END",
          "smiles": "C(=O)[C@H]([C@H]1[C@@H]([C@H](CO1)O)O)O",
          "formula": "C6H10O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4f7e8ef1-27e3-44fe-a8c0-29846970f69e"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "162.1408",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "609480d2-310c-460c-8409-696a8f7c7dd1",
      "version": "3",
      "structure": {
        "id": "9a4fb5f4-f932-4299-8a24-1e3c77dd2791",
        "molfile": "\n  Marvin  01132108012D          \n\n 12 12  0  0  1  0            999 V2000\n   13.8399   -7.5975    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.4275   -8.3120    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.3475   -9.0967    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.1725   -9.0967    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.1811   -8.6476    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7599   -7.8271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0925   -8.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8626   -9.7641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6574   -9.7641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4275   -6.8830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6650   -7.5975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0774   -6.8830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  3  1  0  0  0  0\n  2  5  1  6  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  6  7  1  0  0  0  0\n  3  8  1  1  0  0  0\n  4  9  1  6  0  0  0\n  1 10  1  6  0  0  0\n  1 11  1  0  0  0  0\n 11 12  2  0  0  0  0\nM  END",
        "smiles": "C(=O)[C@H]([C@@]1([H])[C@@H]([C@H](CO1)O)O)O",
        "formula": "C6H10O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "162.1408",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e9c13bcd-126b-4617-9f10-17b2d7b3cc05",
          "cf624891-1ca1-48ad-9492-59650cd08cd5"
        ],
        "stereo_centers": 4
      },
      "unii": "II64NNN45G"
    }
  ]
}