{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f76ccc86-40d2-41fd-91bd-2dd4e17c9712", "code": "7542", "type": "PRIMARY", "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111", "code_system": "DEA NO.", "references": [ "047b0724-0f9e-4250-b998-82347db7f9ef" ] }, { "uuid": "dc9b1b61-f648-4d9e-b15f-dc6d07d9290a", "code": "698963-77-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=698963-77-8", "code_system": "CAS", "references": [ "047b0724-0f9e-4250-b998-82347db7f9ef", "b04da9c2-44d0-4d41-9f61-87760e28bd0e" ] }, { "uuid": "2049aee4-8b4d-4762-88c0-fd27b8f44bfa", "code": "PENTYLONE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Pentylone", "code_system": "WIKIPEDIA", "references": [ "047b0724-0f9e-4250-b998-82347db7f9ef" ] }, { "uuid": "b923b5ca-477b-4842-b0a2-883009a09260", "code": "60208608", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/60208608", "code_system": "PUBCHEM", "references": [ "047b0724-0f9e-4250-b998-82347db7f9ef" ] }, { "uuid": "0869911a-0396-dbf6-9e3c-53a9d243672e", "code": "DTXSID401014183", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID401014183", "code_system": "EPA CompTox", "references": [ "495cab18-9723-c307-0f1b-d42d7bf80dc5" ] }, { "uuid": "21f31aab-33b2-44e3-9a3c-13f77736af82", "code": "SUB195746", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "1f9e5054-054c-17cf-c1bd-f81c77af8bf3" ] }, { "uuid": "28210157-bf6f-4aa7-bb9a-44016d4496bd", "code": "IGN39WGH0Q", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "600db218-e5d2-1d7d-4841-f3a55cd2bf22", "code": "Designer-drugs-Pentylone", "comments": "Wikipedia|List of designer drugs|Empathogens|MDxx (Substituted methylenedioxyphenethylamines)", "type": "CONCEPT", "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs", "code_system": "WIKIPEDIA", "references": [ "b9885e25-15d9-3af7-fb21-6b5befafb08b" ] }, { "uuid": "e8999d37-edad-0e81-ba2c-1d59bb59f619", "code": "100000181861", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "30639706-5c37-2ade-9465-d85d4095ef64" ] } ], "relationships": [ { "uuid": "feeb0cad-8b09-4027-8f0b-eb82235c3da4", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "f1a49528-603a-4eb9-aad1-6e7f14678642", "refuuid": "29120599-0b83-48df-a3ab-691eb6b43e91", "name": "PENTYLONE", "unii": "IGN39WGH0Q", "linking_id": "IGN39WGH0Q", "ref_pname": "PENTYLONE", "substance_class": "reference" } }, { "uuid": "7f991a20-c083-4ce3-b2bb-934a55c8edc9", "amount": { "uuid": "1a7c6a29-6fe9-4a1a-8e6c-71c68bd6c099" }, "type": "PARENT->METABOLITE ACTIVE", "references": [ "2b97c014-56fd-42a2-aca4-e1c42ad2e21f" ], "related_substance": { "uuid": "da2da980-a1df-49d5-a4a1-99d672d7da08", "refuuid": "9fe1ec91-7140-4851-b6d5-1720f4fb7b96", "name": "DIPENTYLONE", "unii": "V41961I345", "linking_id": "V41961I345", "ref_pname": "DIPENTYLONE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "1c04ede0-607b-4b2d-8d13-7724dd57378f", "name": "1-(1,3-BENZODIOXOL-5-YL)-2-(METHYLAMINO)PENTAN-1-ONE", "stdName": "1-(1,3-BENZODIOXOL-5-YL)-2-(METHYLAMINO)PENTAN-1-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "078e3a06-a8b6-43c5-a217-409e03f0b438", "ca0fc212-1bce-4dd6-812b-a67f95d1627f" ], "display_name": false }, { "uuid": "091d834c-65e2-4d1a-9062-2b49104e7e70", "name": "1-PENTANONE, 1-(1,3-BENZODIOXOL-5-YL)-2-(METHYLAMINO)-", "stdName": "1-PENTANONE, 1-(1,3-BENZODIOXOL-5-YL)-2-(METHYLAMINO)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "078e3a06-a8b6-43c5-a217-409e03f0b438", "2b4f25fa-9d8c-4d11-a958-d2201835d399" ], "display_name": false }, { "uuid": "d61d6eb9-49b5-484f-a40c-0e4cf3242afa", "name": "BK-MBDP", "stdName": "BK-MBDP", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "078e3a06-a8b6-43c5-a217-409e03f0b438", "739b6caf-fd83-4672-bad8-179e125e465b" ], "display_name": false }, { "uuid": "0042182c-18b6-47a3-946f-991896a66b33", "name": "BK-METHYL-K", "stdName": "BK-METHYL-K", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "078e3a06-a8b6-43c5-a217-409e03f0b438", "739b6caf-fd83-4672-bad8-179e125e465b" ], "display_name": false }, { "uuid": "a811d652-c234-430c-9c2d-00a23b1c7234", "name": "DEA NO. 7542", "stdName": "DEA NO. 7542", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "078e3a06-a8b6-43c5-a217-409e03f0b438", "8828b4fd-7650-4106-a9bf-8d04871782de" ], "display_name": false }, { "uuid": "73fca0fc-e863-4d89-97c1-82a88b7a67af", "name": "J3.293.464A", "stdName": "J3.293.464A", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "078e3a06-a8b6-43c5-a217-409e03f0b438", "b5faea55-8ddf-4c27-9161-2e6eb37d9475" ], "display_name": false }, { "uuid": "372312ad-e47e-482e-b590-a09e15313659", "name": "PENTYLONE", "stdName": "PENTYLONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "078e3a06-a8b6-43c5-a217-409e03f0b438", "739b6caf-fd83-4672-bad8-179e125e465b" ], "display_name": true } ], "references": [ { "uuid": "b5faea55-8ddf-4c27-9161-2e6eb37d9475", "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J3.293.464A", "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J3.293.464A", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "078e3a06-a8b6-43c5-a217-409e03f0b438", "citation": "JAPAN CHEMICAL SUBSTANCE DICTIONARY", "doc_type": "JAPAN CHEMICAL SUBSTANCE DICTIONARY", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8828b4fd-7650-4106-a9bf-8d04871782de", "citation": "http://chem.sis.nlm.nih.gov/chemidplus/rn/698963-77-8", "url": "http://chem.sis.nlm.nih.gov/chemidplus/rn/698963-77-8", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ca0fc212-1bce-4dd6-812b-a67f95d1627f", "citation": "http://www.deadiversion.usdoj.gov/schedules/orangebook/c_cs_alpha.pdf", "url": "http://www.deadiversion.usdoj.gov/schedules/orangebook/c_cs_alpha.pdf", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "739b6caf-fd83-4672-bad8-179e125e465b", "citation": "https://en.wikipedia.org/wiki/Pentylone", "url": "https://en.wikipedia.org/wiki/Pentylone", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2b4f25fa-9d8c-4d11-a958-d2201835d399", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "047b0724-0f9e-4250-b998-82347db7f9ef", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393366000, "tags": [ "NOMEN" ] }, { "uuid": "2c857ea7-331b-430d-9b32-1278ca69cd44", "citation": "SRS import [IGN39WGH0Q]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IGN39WGH0Q", "doc_type": "SRS", "public_domain": true, "document_date": 1493393366000, "tags": [ "NOMEN" ] }, { "uuid": "2b97c014-56fd-42a2-aca4-e1c42ad2e21f", "citation": "https://www.npsdiscovery.org/synthetic-stimulant-market-rapidly-changing-as-nn-dimethylpentylone-replaces-eutylone-in-drug-supply-typically-sold-as-ecstasy-or-molly/", "url": "https://www.npsdiscovery.org/synthetic-stimulant-market-rapidly-changing-as-nn-dimethylpentylone-replaces-eutylone-in-drug-supply-typically-sold-as-ecstasy-or-molly/", "doc_type": "WEB PAGE", "public_domain": true }, { "uuid": "1f9e5054-054c-17cf-c1bd-f81c77af8bf3", "citation": "EVMPD", "doc_type": "EVMPD", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b04da9c2-44d0-4d41-9f61-87760e28bd0e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "b9885e25-15d9-3af7-fb21-6b5befafb08b", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "495cab18-9723-c307-0f1b-d42d7bf80dc5", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "30639706-5c37-2ade-9465-d85d4095ef64", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "97f55516-2bc0-4cb0-93ad-fb4d0072452a", "id": "97f55516-2bc0-4cb0-93ad-fb4d0072452a", "molfile": "\n Marvin 01132107532D \n\n 17 18 0 0 0 0 999 V2000\n -3.1354 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4209 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7065 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9920 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n -0.9920 0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7065 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2775 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2775 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4369 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4369 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1514 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8659 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6505 1.0799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1354 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6505 -0.2549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8659 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1514 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 7 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 17 9 2 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 16 12 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 1 0 0 0 0\nM END", "smiles": "CCCC(C(=O)c1ccc2c(c1)OCO2)NC", "formula": "C13H17NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "02a9778b-9728-4173-bd4c-49342d1f61b6" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "235.2795", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "29120599-0b83-48df-a3ab-691eb6b43e91", "version": "15", "structure": { "id": "fb27091b-5c8e-481c-8489-e28a467ce3d8", "molfile": "\n Marvin 01132113012D \n\n 17 18 0 0 0 0 999 V2000\n -0.2775 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9920 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7065 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4209 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1354 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2775 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9920 0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7065 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6505 1.0799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1354 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6505 -0.2549 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8659 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8659 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1514 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4369 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4369 0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1514 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 1 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 2 7 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 9 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 13 2 0 0 0 0\n 14 12 2 0 0 0 0\n 1 15 1 0 0 0 0\nM END", "smiles": "CCCC(C(=O)c1ccc2c(c1)OCO2)NC", "formula": "C13H17NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "235.2795", "optical_activity": "( + / - )", "references": [ "739b6caf-fd83-4672-bad8-179e125e465b", "2c857ea7-331b-430d-9b32-1278ca69cd44" ], "stereo_centers": 1 }, "unii": "IGN39WGH0Q" } ] }