{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1a8cf659-307e-4331-a369-27048f4fe78a",
          "code": "745047-53-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=745047-53-4",
          "code_system": "CAS",
          "references": [
            "987a6f08-bda3-4efa-9902-398f155a8eb8",
            "e7ffbf55-8fa3-4b90-9a6f-82a88d0a7169"
          ]
        },
        {
          "uuid": "d733f79c-2c91-44a9-ae36-9fa343cf85d5",
          "code": "11739408",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11739408",
          "code_system": "PUBCHEM",
          "references": [
            "987a6f08-bda3-4efa-9902-398f155a8eb8"
          ]
        },
        {
          "uuid": "6bed2694-fbd8-991b-b130-3a00eb6d2ff4",
          "code": "DTXSID50225504",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50225504",
          "code_system": "EPA CompTox",
          "references": [
            "1cfc2a3f-492a-19fa-4ea6-48ea46da7dcb"
          ]
        },
        {
          "uuid": "5228e1e0-4247-4a9c-bc93-03b24a302271",
          "code": "IG3GV1WE4R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f95b7917-d7b9-360f-6cf5-f3e030be7338",
          "code": "1746",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1746/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "b026997d-636b-7dcd-810f-6536440a749d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ae3a1184-5074-46e6-8978-3f8d67aa519e",
          "name": "ETHANEDIAMIDE, N-((2,4-DIMETHOXYPHENYL)METHYL)-N'-(2-(2-PYRIDINYL)ETHYL)-",
          "stdName": "ETHANEDIAMIDE, N-((2,4-DIMETHOXYPHENYL)METHYL)-N'-(2-(2-PYRIDINYL)ETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74d36f25-4175-4c0f-b4d3-2b00525be4c6",
            "c1f65cef-463a-4ec3-a76f-cc25e8888e93"
          ],
          "display_name": false
        },
        {
          "uuid": "a14d0cb8-8674-464a-ac1a-1c7b51a2edc6",
          "name": "ETHANEDIAMIDE, N1-((2,4-DIMETHOXYPHENYL)METHYL)-N2-(2-(2-PYRIDINYL)ETHYL)-",
          "stdName": "ETHANEDIAMIDE, N1-((2,4-DIMETHOXYPHENYL)METHYL)-N2-(2-(2-PYRIDINYL)ETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74d36f25-4175-4c0f-b4d3-2b00525be4c6",
            "c1f65cef-463a-4ec3-a76f-cc25e8888e93"
          ],
          "display_name": false
        },
        {
          "uuid": "51149c6d-114c-4feb-a5d4-afe5640467db",
          "name": "FEMA NO. 4233",
          "stdName": "FEMA NO. 4233",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74d36f25-4175-4c0f-b4d3-2b00525be4c6",
            "b84da262-45c2-48dd-913a-e6f1028023aa"
          ],
          "display_name": false
        },
        {
          "uuid": "491f2575-84a9-4074-a6c3-0865e7bbc741",
          "name": "N-((2,4-DIMETHOXYPHENYL)METHYL)-N'-(2-(2-PYRIDINYL)ETHYL)ETHANEDIAMIDE",
          "stdName": "N-((2,4-DIMETHOXYPHENYL)METHYL)-N'-(2-(2-PYRIDINYL)ETHYL)ETHANEDIAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74d36f25-4175-4c0f-b4d3-2b00525be4c6",
            "3611c88a-be8c-4147-bca3-df8eea71f1fb"
          ],
          "display_name": false
        },
        {
          "uuid": "5792b8cb-17b9-4fb7-aeb1-5db5904a0a72",
          "name": "N1-(2,4-DIMETHOXYBENZYL)-N2-(2-(PYRIDIN-2-YL)ETHYL)OXALAMIDE",
          "stdName": "N1-(2,4-DIMETHOXYBENZYL)-N2-(2-(PYRIDIN-2-YL)ETHYL)OXALAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7642109f-d058-48fb-9b24-9beb719256f5",
            "74d36f25-4175-4c0f-b4d3-2b00525be4c6",
            "b84da262-45c2-48dd-913a-e6f1028023aa",
            "b8036777-6f70-479a-b09e-ef338bca1f79"
          ],
          "display_name": true
        },
        {
          "uuid": "7c8be663-5499-46f3-b42a-d2ab257909fd",
          "name": "N1-(2,4-DIMETHOXYBENZYL)-N2-(2-(PYRIDIN-2-YL)ETHYL)OXALAMIDE [FHFI]",
          "stdName": "N1-(2,4-DIMETHOXYBENZYL)-N2-(2-(PYRIDIN-2-YL)ETHYL)OXALAMIDE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74d36f25-4175-4c0f-b4d3-2b00525be4c6",
            "b84da262-45c2-48dd-913a-e6f1028023aa"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7642109f-d058-48fb-9b24-9beb719256f5",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "74d36f25-4175-4c0f-b4d3-2b00525be4c6",
          "citation": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "doc_type": "JECFA: JOINT FAO/WHO COMMITTEE FOOD ADD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c1f65cef-463a-4ec3-a76f-cc25e8888e93",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b84da262-45c2-48dd-913a-e6f1028023aa",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3611c88a-be8c-4147-bca3-df8eea71f1fb",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "987a6f08-bda3-4efa-9902-398f155a8eb8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391123000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d0523c4-1168-4f7b-8758-46e78d214ec6",
          "citation": "SRS import [IG3GV1WE4R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IG3GV1WE4R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391123000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b8036777-6f70-479a-b09e-ef338bca1f79",
          "citation": "N1-(2,4-DIMETHOXYBENZYL)-N2-(2-(PYRIDIN-2-YL)ETHYL)OXALAMIDE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1cfc2a3f-492a-19fa-4ea6-48ea46da7dcb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=745047-53-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e7ffbf55-8fa3-4b90-9a6f-82a88d0a7169",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b026997d-636b-7dcd-810f-6536440a749d",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "746260e8-0ddc-4041-a148-1f864130b873",
          "id": "746260e8-0ddc-4041-a148-1f864130b873",
          "molfile": "\n  Marvin  01132106022D          \n\n 25 26  0  0  0  0            999 V2000\n   11.3523   -2.6878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6380   -2.2750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9234   -2.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9230   -3.5123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2085   -3.9245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4941   -3.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7795   -3.9240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0652   -3.5113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3506   -3.9236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3506   -4.7486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6362   -3.5108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6362   -2.6858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9216   -3.9231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2073   -3.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4926   -3.9226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7784   -3.5098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7786   -2.6848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0643   -2.2721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3497   -2.6843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3494   -3.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0637   -3.9221    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4944   -2.6868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7801   -2.2740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0655   -2.6863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2090   -2.2745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3 25  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n 22  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 21 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 25 22  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "COc1ccc(CNC(=O)C(=O)NCCc2ccccn2)c(c1)OC",
          "formula": "C18H21N3O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f9307daf-d7d6-4ff9-8e6e-aa13b8e5a94b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "343.3777",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6c8c0fce-912c-41a6-b372-6847563f971c",
      "version": "5",
      "structure": {
        "id": "79560c77-2841-4583-99c1-42294d6d6159",
        "molfile": "\n  Marvin  01132106182D          \n\n 25 26  0  0  0  0            999 V2000\n    2.0643   -2.2721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7786   -2.6848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7784   -3.5098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0637   -3.9221    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3494   -3.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3497   -2.6843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4926   -3.9226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2073   -3.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9216   -3.9231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6362   -3.5108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3506   -3.9236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0652   -3.5113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7795   -3.9240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4941   -3.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4944   -2.6868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2090   -2.2745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9234   -2.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9230   -3.5123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2085   -3.9245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7801   -2.2740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0655   -2.6863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6380   -2.2750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3523   -2.6878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6362   -2.6858    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3506   -4.7486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 15 14  2  0  0  0  0\n 14 19  1  0  0  0  0\n 15 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 17 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 10 24  2  0  0  0  0\n 11 25  2  0  0  0  0\nM  END",
        "smiles": "COc1ccc(CNC(=O)C(=O)NCCc2ccccn2)c(c1)OC",
        "formula": "C18H21N3O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "343.3777",
        "optical_activity": "NONE",
        "references": [
          "3d0523c4-1168-4f7b-8758-46e78d214ec6",
          "c1f65cef-463a-4ec3-a76f-cc25e8888e93"
        ],
        "stereo_centers": 0
      },
      "unii": "IG3GV1WE4R"
    }
  ]
}