{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1a41f9cd-1326-43df-83e5-0a83d2172032",
          "code": "80-57-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=80-57-9",
          "code_system": "CAS",
          "references": [
            "3a8409c7-f539-4361-868f-4337d25d6c7b",
            "08ea32a6-ee30-4b81-9d98-36ebd6479dc6"
          ]
        },
        {
          "uuid": "d3208747-8cb5-4008-817e-6b4c4900412e",
          "code": "201-292-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.176",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3a8409c7-f539-4361-868f-4337d25d6c7b"
          ]
        },
        {
          "uuid": "6f95deb2-82c2-ee7d-726e-daa02f2838c5",
          "code": "DTXSID2048115",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2048115",
          "code_system": "EPA CompTox",
          "references": [
            "c96c867c-25c1-c5b9-5a1e-b61b7fa8161f"
          ]
        },
        {
          "uuid": "844025a0-c601-4507-8676-616f3a35d449",
          "code": "IFV46DXC6U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9df6da2d-734d-a643-98f5-b7cdf9bdc38d",
          "code": "6832",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=6832",
          "code_system": "NSC",
          "references": [
            "bdc18414-695e-ebbc-6d31-f72648c4b2e4"
          ]
        },
        {
          "uuid": "f6e6350c-6e2f-af06-51b8-75035566ce6e",
          "code": "1848",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1848/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "19bb4930-789a-a06e-3b08-5ed3b33fa252"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "1e26fccc-354f-4a21-89f3-57c758369abd",
          "amount": {
            "uuid": "638f7765-0fc2-4e5d-8202-6bd5d16041ad"
          },
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "800ef4e6-56d2-426b-85fb-d38c79344a37",
            "refuuid": "bcbbd173-f325-4080-bbd7-d962a5301265",
            "name": "VERBENONE, (+)-",
            "unii": "99S17893UW",
            "linking_id": "99S17893UW",
            "ref_pname": "VERBENONE, (+)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0663c3bb-b7f6-45d4-a4a6-7705d089d83c",
          "name": "(±)-VERBENONE",
          "stdName": "(+/-)-VERBENONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9079b12-594b-4825-a99e-4e2fc305179c",
            "5d49a1d4-4b4c-4f8f-a9d4-f876be540f6c"
          ],
          "display_name": false
        },
        {
          "uuid": "f96eb5dd-2682-4d82-add9-8e00322ab9d0",
          "name": "4,6,6-TRIMETHYLBICYCLO(3.1.1)HEPT-3-EN-2-ONE",
          "stdName": "4,6,6-TRIMETHYLBICYCLO(3.1.1)HEPT-3-EN-2-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "28d19636-1a05-4ffd-a51e-58fc22d06138",
            "a9079b12-594b-4825-a99e-4e2fc305179c"
          ],
          "display_name": false
        },
        {
          "uuid": "55f03f72-1a6e-40dd-b3ed-eb098e82a576",
          "name": "BICYCLO(3.1.1)HEPT-3-EN-2-ONE, 4,6,6-TRIMETHYL-",
          "stdName": "BICYCLO(3.1.1)HEPT-3-EN-2-ONE, 4,6,6-TRIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "28d19636-1a05-4ffd-a51e-58fc22d06138",
            "a9079b12-594b-4825-a99e-4e2fc305179c"
          ],
          "display_name": false
        },
        {
          "uuid": "e7928c6a-528b-44fb-af32-2995ccfa0660",
          "name": "FEMA NO. 4216",
          "stdName": "FEMA NO. 4216",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "746a5993-1e30-46b8-b74a-c3f9692d507d",
            "a9079b12-594b-4825-a99e-4e2fc305179c"
          ],
          "display_name": false
        },
        {
          "uuid": "6897c501-91a6-47ec-b483-5b424ffb10d2",
          "name": "NSC-6832",
          "stdName": "NSC-6832",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08ea32a6-ee30-4b81-9d98-36ebd6479dc6"
          ],
          "display_name": false
        },
        {
          "uuid": "80e75ef4-f595-4f7d-9511-4db64c0c7e26",
          "name": "VERBENONE [FHFI]",
          "stdName": "VERBENONE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27e017d9-7aba-4d22-a24a-4b60c061ba40",
            "a9079b12-594b-4825-a99e-4e2fc305179c"
          ],
          "display_name": false
        },
        {
          "uuid": "7f8f41de-cc88-4c43-9326-42681051ce4c",
          "name": "VERBENONE, (±)-",
          "stdName": "VERBENONE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7b176bf-b171-43d8-9eea-17ab540d33ea",
            "a9079b12-594b-4825-a99e-4e2fc305179c"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "a7b176bf-b171-43d8-9eea-17ab540d33ea",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a9079b12-594b-4825-a99e-4e2fc305179c",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28d19636-1a05-4ffd-a51e-58fc22d06138",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2fe1740b-44c2-459a-b61f-9fb3651d149e",
          "citation": "ChemSpider",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d49a1d4-4b4c-4f8f-a9d4-f876be540f6c",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "746a5993-1e30-46b8-b74a-c3f9692d507d",
          "citation": "GRAS 22",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27e017d9-7aba-4d22-a24a-4b60c061ba40",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3a8409c7-f539-4361-868f-4337d25d6c7b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390916000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1bc38c0-cf96-48d1-b6a9-36a14004cab2",
          "citation": "SRS import [IFV46DXC6U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IFV46DXC6U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390916000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c96c867c-25c1-c5b9-5a1e-b61b7fa8161f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=80-57-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fc052647-0ac3-485c-bbbb-698651406ccd",
          "citation": "https://pubchem.ncbi.nlm.nih.gov/compound/29025",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/29025",
          "doc_type": "PUBCHEM",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "08ea32a6-ee30-4b81-9d98-36ebd6479dc6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1ad8a0d3-49a5-50d7-8bdd-eeee9869850b",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "bdc18414-695e-ebbc-6d31-f72648c4b2e4",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "19bb4930-789a-a06e-3b08-5ed3b33fa252",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3ae975d8-0bb6-43fc-b062-f3a38e10e089",
          "id": "3ae975d8-0bb6-43fc-b062-f3a38e10e089",
          "molfile": "\n  Marvin  01132103072D          \n\n 11 12  0  0  0  0            999 V2000\n    6.8865   -5.9694    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.4740   -5.2549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8865   -4.5404    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.0614   -4.5404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6489   -3.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6489   -5.2549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0614   -5.9694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6489   -6.6838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2990   -5.2549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9309   -5.7852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9309   -4.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  7  1  0  0  0  0\n  1  9  1  0  0  0  0\n  3  2  1  1  0  0  0\n  3  4  1  0  0  0  0\n  3  9  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  1  0  0  0  0\nM  END",
          "smiles": "CC1=CC(=O)[C@@H]2C[C@H]1C2(C)C",
          "formula": "C10H14O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "755ab960-b0a7-4dd1-af06-0c07ffee9826"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "150.2179",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "577fe639-c200-49f9-a213-65264a38a872",
      "version": "15",
      "structure": {
        "id": "8e8f66ce-623d-4160-b609-ace079a6e63e",
        "molfile": "\n  Marvin  01132107242D          \n\n 11 12  0  0  0  0            999 V2000\n    5.6489   -6.6838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0614   -5.9694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6489   -5.2549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0614   -4.5404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6489   -3.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8865   -4.5404    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4740   -5.2549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8865   -5.9694    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.2990   -5.2549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9309   -5.7852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9309   -4.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  1  0  0  0\n  8  7  1  1  0  0  0\n  8  2  1  0  0  0  0\n  6  9  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  1  0  0  0  0\nM  END",
        "smiles": "CC1=CC(=O)[C@@H]2C[C@H]1C2(C)C",
        "formula": "C10H14O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "150.2179",
        "optical_activity": "( + / - )",
        "references": [
          "f1bc38c0-cf96-48d1-b6a9-36a14004cab2",
          "a7b176bf-b171-43d8-9eea-17ab540d33ea"
        ],
        "stereo_centers": 2
      },
      "unii": "IFV46DXC6U"
    }
  ]
}