{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "caeb7144-ce1f-441b-aa52-0dc14dbfb22b",
          "code": "14783-68-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14783-68-7",
          "code_system": "CAS",
          "references": [
            "63c78057-b0ca-426d-ab10-4267dce335dc",
            "21550896-180e-4c91-b9b1-6881a9647f8b"
          ]
        },
        {
          "uuid": "08fdda49-f1be-4a0a-b2b6-ce64ad4b8e32",
          "code": "C091418",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67091418",
          "code_system": "MESH",
          "references": [
            "63c78057-b0ca-426d-ab10-4267dce335dc"
          ]
        },
        {
          "uuid": "4bf9536c-2da3-455a-94b5-9467bf0f7536",
          "code": "21 CFR 331.11",
          "comments": "PART 331 -- ANTACID PRODUCTS FOR OVER-THE-COUNTER (OTC) HUMAN USE|Subpart B--Active Ingredients|Sec. 331.11 Listing of specific active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=331.11",
          "code_system": "CFR",
          "references": [
            "63c78057-b0ca-426d-ab10-4267dce335dc"
          ]
        },
        {
          "uuid": "c593ed86-f5f4-452a-9c9a-8d407182ae9d",
          "code": "21 CFR 331.15",
          "comments": "PART 331 -- ANTACID PRODUCTS FOR OVER-THE-COUNTER (OTC) HUMAN USE|Subpart B--Active Ingredients|Sec. 331.15 Combination with nonantacid active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=331.15",
          "code_system": "CFR",
          "references": [
            "63c78057-b0ca-426d-ab10-4267dce335dc"
          ]
        },
        {
          "uuid": "ae84bc68-5926-4e5e-84ee-e55c28339eb1",
          "code": "238-852-2",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "63c78057-b0ca-426d-ab10-4267dce335dc"
          ]
        },
        {
          "uuid": "12143e71-4759-4a71-bbc0-fcce39aafb6c",
          "code": "C76082",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76082",
          "code_system": "NCI_THESAURUS",
          "references": [
            "63c78057-b0ca-426d-ab10-4267dce335dc"
          ]
        },
        {
          "uuid": "2101481b-1396-4646-b017-fda515b5784f",
          "code": "476818",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/476818/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "63c78057-b0ca-426d-ab10-4267dce335dc"
          ]
        },
        {
          "uuid": "60b2aa32-19b2-451f-a085-1395c108960c",
          "code": "SUB20731",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "63c78057-b0ca-426d-ab10-4267dce335dc"
          ]
        },
        {
          "uuid": "7d4bcfd3-3334-46ad-a36d-acad59f71135",
          "code": "CHEMBL2108424",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2108424",
          "code_system": "ChEMBL",
          "references": [
            "63c78057-b0ca-426d-ab10-4267dce335dc"
          ]
        },
        {
          "uuid": "e048699f-654d-60d6-9839-85116fb0f882",
          "code": "DTXSID90163815",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90163815",
          "code_system": "EPA CompTox",
          "references": [
            "5e54e38c-0aca-0ff3-315d-78b848792bd9"
          ]
        },
        {
          "uuid": "9da75ebd-fb61-15b7-8bbc-0727b7367e4b",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6efc4356-f849-6a7f-e908-9a904b2c2123"
          ]
        },
        {
          "uuid": "ca092934-4408-f8fc-7194-3fd658e3158e",
          "code": "84645",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/84645",
          "code_system": "PUBCHEM",
          "references": [
            "2edf675d-37b7-a4d4-0247-40aed34091b3"
          ]
        },
        {
          "uuid": "3cf2a51f-d0e8-6973-00b7-2e0dd7df7f60",
          "code": "DB11189",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11189",
          "code_system": "DRUG BANK",
          "references": [
            "6efc4356-f849-6a7f-e908-9a904b2c2123"
          ]
        },
        {
          "uuid": "0fa69262-7e37-4af2-9b7b-9e080daaf2ca",
          "code": "IFN18A4Y6B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e592e45d-203f-d666-29f4-a6d92f1d8c44",
          "code": "Magnesium glycinate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Magnesium_glycinate",
          "code_system": "WIKIPEDIA",
          "references": [
            "1ce407f1-15d6-9b77-896e-32c1c7e1d3d6"
          ]
        },
        {
          "uuid": "5cc8b615-8951-1ead-ea9b-c4adc93bf2db",
          "code": "IFN18A4Y6B",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=IFN18A4Y6B",
          "code_system": "DAILYMED",
          "references": [
            "a8a5891c-8d7c-4dce-8166-a59b8f31945a"
          ]
        },
        {
          "uuid": "284aa6a6-6c54-739c-1984-ca961ff5b61d",
          "code": "100000086503",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8348539b-2297-e289-beba-be373a4f5de5"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "9395ad07-3658-497a-8674-65d8154bc732",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "69ea3509-7be1-4683-af6c-4711beb557ea",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0898630-8425-4936-b952-0faa0be563ca",
          "citation": "STN 2008",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe71ddd0-7179-4ebf-8e15-6b4fddfa1ace",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea083b56-7f46-4fe3-a515-815d6aef0fc7",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6eb4660-847e-4a4f-820c-cdab91fbbe4d",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc47d543-80de-4acf-a96a-4cb0e2a01234",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d014231-fb38-4b72-ac7c-d59f25ce48b1",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fef9e39-7c1c-4a14-a46e-b6c9a5365172",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "63c78057-b0ca-426d-ab10-4267dce335dc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390163000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9112f8e-2634-4132-b02e-5d1722e74100",
          "citation": "SRS import [IFN18A4Y6B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IFN18A4Y6B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390163000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ba22cd6-dfd7-49bf-b63f-921cec78eaa7",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20daffc4-f357-405e-a1dc-dbd55bf9a33b",
          "citation": "MAGNESIUM GLYCINATE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0e888d76-ffca-4f76-baf7-cee87858f3f3",
          "citation": "MAGNESIUM GLYCINATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "de424da4-1b3e-4d98-9cd0-c1812dc43db0",
          "citation": "MAGNESIUM GLYCINATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ab08ad94-c8f8-45bb-aea7-659d80e17ba5",
          "citation": "MAGNESIUM GLYCINATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5e54e38c-0aca-0ff3-315d-78b848792bd9",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=14783-68-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "aa22fa09-3a65-4217-b9eb-3ef0cef49850",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6efc4356-f849-6a7f-e908-9a904b2c2123",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "2edf675d-37b7-a4d4-0247-40aed34091b3",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "21550896-180e-4c91-b9b1-6881a9647f8b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1ce407f1-15d6-9b77-896e-32c1c7e1d3d6",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "a8a5891c-8d7c-4dce-8166-a59b8f31945a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e84cfca5-c6f6-e2c2-e96b-f00fe402643a",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8348539b-2297-e289-beba-be373a4f5de5",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "c0d811f7-a698-4aa5-8a29-649a1e9fdabc",
          "citation": "MHRA",
          "doc_type": "MHRSA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "841ac2d7-2254-4a5c-9575-777a2618f4ae",
          "id": "841ac2d7-2254-4a5c-9575-777a2618f4ae",
          "molfile": "\n  Marvin  05042209442D          \n\n  1  0  0  0  0  0            999 V2000\n   15.4482   -4.2069    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Mg+2]",
          "formula": "Mg",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e680c488-86f9-45b7-8336-bf9c11267758"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "24.3051",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "bb5b1905-3403-467b-bc03-f42262473bf1",
          "id": "bb5b1905-3403-467b-bc03-f42262473bf1",
          "molfile": "\n  Marvin  05042209442D          \n\n  5  4  0  0  0  0            999 V2000\n   11.5906   -4.3321    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3044   -4.7414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0184   -4.3280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7323   -4.7372    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   13.0141   -3.5014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\nM  CHG  1   4  -1\nM  END",
          "smiles": "C(C(=O)[O-])N",
          "formula": "C2H4NO2",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "7154e88d-6cdd-4e91-87fb-153654eaeb62"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "74.0587",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "23b9b5f5-751b-4ee3-8ac4-85a46b2a9c73",
      "version": "16",
      "structure": {
        "id": "7671bc87-80fa-4546-8967-7a6e5581b804",
        "molfile": "\n   JSDraw205042209442D\n\n 11  8  0  0  0  0              0 V2000\n   21.9178   -8.1920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2676   -8.9659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6177   -8.1842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9677   -8.9580    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   24.6097   -6.6211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2124   -7.9553    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\n   21.9178   -8.1920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2676   -8.9659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6177   -8.1842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9677   -8.9580    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   24.6097   -6.6211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\nM  STY  1   1 MUL\nM  SAL   1  8   1   2   3   4   5   7   8   9\nM  SAL   1  2  10  11\nM  SPA   1  5   1   2   3   4   5\nM  SDI   1  4   19.8120  -10.1920   19.8120   -5.7200\nM  SDI   1  4   27.8200   -5.7200   27.8200  -10.1920\nM  SMT   1 2\nM  CHG  3   4  -1   6   2  10  -1\nM  END",
        "smiles": "C(C(=O)[O-])N.C(C(=O)[O-])N.[Mg+2]",
        "formula": "2C2H4NO2.Mg",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "172.4225",
        "optical_activity": "NONE",
        "references": [
          "f9112f8e-2634-4132-b02e-5d1722e74100",
          "1ba22cd6-dfd7-49bf-b63f-921cec78eaa7"
        ],
        "stereo_centers": 0
      },
      "unii": "IFN18A4Y6B",
      "relationships": [
        {
          "uuid": "1a6c3351-b8df-47c3-b4bb-55c7d6513cc1",
          "amount": {
            "uuid": "ffaa21fb-3c2b-4706-9285-1f22105402f9"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "7354d00e-45a3-4a78-b3f0-281f3ca6ba37",
            "refuuid": "66b2f71b-ed33-477e-a787-234966de5e31",
            "name": "MAGNESIUM CATION",
            "unii": "T6V3LHY838",
            "linking_id": "T6V3LHY838",
            "ref_pname": "MAGNESIUM CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "668de59b-2b5a-4158-8667-6b09d3f623e6",
          "amount": {
            "uuid": "b3b24415-9c05-4308-b13e-62ad6a665bd7"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "0c7f0a16-aab8-4805-a7b3-a41a3ce82c8b",
            "refuuid": "bb33ce2a-adb7-4088-ad4a-1e259b21b5f0",
            "name": "Glycine",
            "unii": "TE7660XO1C",
            "linking_id": "TE7660XO1C",
            "ref_pname": "Glycine",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0096e789-3b83-4a84-b23d-a97f4ed4604d",
          "amount": {
            "uuid": "0319602e-f3b0-4584-b100-b5f4fc8bcea1"
          },
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "aa22fa09-3a65-4217-b9eb-3ef0cef49850"
          ],
          "related_substance": {
            "uuid": "94ca8407-2924-413b-b0bf-2cd02877ae24",
            "refuuid": "1aaafd09-4394-492a-b7af-b0b50cbfafac",
            "name": "Magnesium glycinate dihydrate",
            "unii": "UR2UMM2CWZ",
            "linking_id": "UR2UMM2CWZ",
            "ref_pname": "Magnesium glycinate dihydrate",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "49521e93-ad80-4ce6-95e4-dfaf5a553fee",
          "name": "BIS(GLYCINATO-N,O)MAGNESIUM",
          "stdName": "BIS(GLYCINATO-N,O)MAGNESIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a0898630-8425-4936-b952-0faa0be563ca",
            "69ea3509-7be1-4683-af6c-4711beb557ea"
          ],
          "display_name": false
        },
        {
          "uuid": "7ab368cc-9f5d-4010-994c-d71d5f91c200",
          "name": "MAGNESIUM 2-AMINOACETATE",
          "stdName": "MAGNESIUM 2-AMINOACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6eb4660-847e-4a4f-820c-cdab91fbbe4d",
            "1d014231-fb38-4b72-ac7c-d59f25ce48b1"
          ],
          "display_name": false
        },
        {
          "uuid": "64d4464d-37da-43b9-8761-d6b8c8ac5ca7",
          "name": "MAGNESIUM BISGLYCINATE",
          "stdName": "MAGNESIUM BISGLYCINATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0d811f7-a698-4aa5-8a29-649a1e9fdabc"
          ],
          "display_name": false
        },
        {
          "uuid": "c15a452d-3336-401a-958f-935b401d3001",
          "name": "MAGNESIUM DIGLYCINATE",
          "stdName": "MAGNESIUM DIGLYCINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a0898630-8425-4936-b952-0faa0be563ca",
            "69ea3509-7be1-4683-af6c-4711beb557ea"
          ],
          "display_name": false
        },
        {
          "uuid": "a5c281c4-f873-48b3-b9bf-24693e3a7e26",
          "name": "MAGNESIUM GLYCINATE",
          "stdName": "MAGNESIUM GLYCINATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20daffc4-f357-405e-a1dc-dbd55bf9a33b",
            "9395ad07-3658-497a-8674-65d8154bc732",
            "0e888d76-ffca-4f76-baf7-cee87858f3f3",
            "fe71ddd0-7179-4ebf-8e15-6b4fddfa1ace",
            "b6eb4660-847e-4a4f-820c-cdab91fbbe4d",
            "de424da4-1b3e-4d98-9cd0-c1812dc43db0",
            "4fef9e39-7c1c-4a14-a46e-b6c9a5365172",
            "ab08ad94-c8f8-45bb-aea7-659d80e17ba5",
            "ea083b56-7f46-4fe3-a515-815d6aef0fc7",
            "dc47d543-80de-4acf-a96a-4cb0e2a01234"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "62892327-500b-4371-b6ff-df5307623c25",
              "name_org": "USAN"
            },
            {
              "uuid": "ab61fa05-7b46-4cba-be24-17d655619b02",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "bd81ac4e-1828-46f8-9996-70496f74ad73",
          "name": "MAGNESIUM GLYCINATE [USAN]",
          "stdName": "MAGNESIUM GLYCINATE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe71ddd0-7179-4ebf-8e15-6b4fddfa1ace"
          ],
          "display_name": false
        },
        {
          "uuid": "aed9f572-3e63-4194-8425-e47cd81d0592",
          "name": "MAGNESIUM GLYCINATE [VANDF]",
          "stdName": "MAGNESIUM GLYCINATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6eb4660-847e-4a4f-820c-cdab91fbbe4d",
            "4fef9e39-7c1c-4a14-a46e-b6c9a5365172"
          ],
          "display_name": false
        },
        {
          "uuid": "9c34d7b3-603d-8604-502b-34c14d786184",
          "name": "Magnesium glycinate [WHO-DD]",
          "stdName": "MAGNESIUM GLYCINATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e84cfca5-c6f6-e2c2-e96b-f00fe402643a"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "d9f6849f-3baf-4656-b59d-fc35ae637cae"
      }
    }
  ]
}