{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "eb1b8f28-0749-4dd6-8719-e108313e0d52", "code": "H02AB11", "comments": "ATC|SYSTEMIC HORMONAL PREPARATIONS, EXCL. SEX HORMONES AND INSULINS|CORTICOSTEROIDS FOR SYSTEMIC USE|CORTICOSTEROIDS FOR SYSTEMIC USE, PLAIN|Glucocorticoids|prednylidene", "type": "PRIMARY", "url": "http://www.whocc.no/atc_ddd_index/?code=H02AB11&showdescription=yes", "code_system": "WHO-ATC", "references": [ "4661a5d0-12a6-435f-a2cd-5c0a09004de3" ] }, { "uuid": "3161becf-8639-4213-b908-7281e34171da", "code": "QH02AB11", "comments": "VATC|CORTICOSTEROIDS FOR SYSTEMIC USE|CORTICOSTEROIDS FOR SYSTEMIC USE, PLAIN|Glucocorticoids|prednylidene", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QH02AB11&showdescription=yes", "code_system": "WHO-VATC", "references": [ "4661a5d0-12a6-435f-a2cd-5c0a09004de3" ] }, { "uuid": "022a49cc-daa0-49b2-bc19-bb6c2b9572a9", "code": "599-33-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=599-33-7", "code_system": "CAS", "references": [ "4661a5d0-12a6-435f-a2cd-5c0a09004de3", "b8bfaad2-c80a-4133-8530-658ae7b827b4" ] }, { "uuid": "f77e4cd6-c50e-49ab-88ff-8d37dc5e5a3c", "code": "C80268", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80268", "code_system": "NCI_THESAURUS", "references": [ "4661a5d0-12a6-435f-a2cd-5c0a09004de3" ] }, { "uuid": "1d75e86e-db83-4cb2-bdc1-8eed0b531f8b", "code": "C036266", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67036266", "code_system": "MESH", "references": [ "4661a5d0-12a6-435f-a2cd-5c0a09004de3" ] }, { "uuid": "ce59018d-cb3f-4af9-ad62-3fef313befba", "code": "PREDNYLIDENE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Prednylidene", "code_system": "WIKIPEDIA", "references": [ "4661a5d0-12a6-435f-a2cd-5c0a09004de3" ] }, { "uuid": "27e6b8e2-3fd7-4cd4-972f-d57f59781bfa", "code": "SUB10021MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "4661a5d0-12a6-435f-a2cd-5c0a09004de3" ] }, { "uuid": "f9f76c38-62b4-4b68-8d88-6516f95eb734", "code": "1457", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1457", "code_system": "INN", "references": [ "4661a5d0-12a6-435f-a2cd-5c0a09004de3" ] }, { "uuid": "89cfb7ce-efb5-4465-a7d6-5246502e524f", "code": "12473", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/12473/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "4661a5d0-12a6-435f-a2cd-5c0a09004de3" ] }, { "uuid": "c2e9bdf3-fad7-4c80-a450-03d70000099b", "code": "m1234", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m1234?q=authorize", "code_system": "MERCK INDEX", "references": [ "4661a5d0-12a6-435f-a2cd-5c0a09004de3" ] }, { "uuid": "de106653-c92b-49cf-a9bb-9736047766e0", "code": "CHEMBL2105359", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2105359", "code_system": "ChEMBL", "references": [ "4661a5d0-12a6-435f-a2cd-5c0a09004de3" ] }, { "uuid": "269485e1-6cc8-4ad9-aa41-0af73ab16833", "code": "209-964-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.009.060", "code_system": "ECHA (EC/EINECS)", "references": [ "4661a5d0-12a6-435f-a2cd-5c0a09004de3" ] }, { "uuid": "662fc47a-6aa6-461c-9d61-f46af250d73a", "code": "20055008", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/20055008", "code_system": "PUBCHEM", "references": [ "4661a5d0-12a6-435f-a2cd-5c0a09004de3" ] }, { "uuid": "3a0b06a4-6d2a-e1c7-5392-e536b468dd53", "code": "C521", "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Therapeutic Steroid Hormone[C1636]|Adrenal Agent[C2364]|Therapeutic Corticosteroid[C211]|Therapeutic Glucocorticoid", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C521", "code_system": "NCI_THESAURUS", "references": [ "aa1b401f-eea3-ef75-8363-d5d2f4c5f009" ] }, { "uuid": "e146968a-a55e-4fc5-9b94-16cb4dd8d0ed", "code": "IF8PQP966U", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "076dae1f-23ea-1502-b14c-204985390201", "code": "2254", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/2254", "code_system": "DRUG CENTRAL", "references": [ "aa1b401f-eea3-ef75-8363-d5d2f4c5f009" ] }, { "uuid": "e7770036-e72b-9200-88bc-bf219c335c4c", "code": "DB13208", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB13208", "code_system": "DRUG BANK", "references": [ "aa1b401f-eea3-ef75-8363-d5d2f4c5f009" ] }, { "uuid": "e164f2a8-421a-5508-2e94-d9582c8ab89d", "code": "100000081406", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "54a92618-f15b-579a-97d4-9395ee13f70f" ] }, { "uuid": "e012df5c-adec-4db6-aadd-b544e5ecc0b4", "code": "DTXSID50208610", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50208610", "code_system": "EPA CompTox", "references": [ "6cde5ece-6707-c460-e24e-fc1e436073b2" ] } ], "relationships": [ { "uuid": "91f4ca53-cda2-467d-a65b-0f856874baf1", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "1443e50d-16a5-4680-a287-a1ac846be8ef", "refuuid": "f0ac4fe8-00bd-46ac-bd30-89ae913ad65b", "name": "PREDNYLIDENE", "unii": "IF8PQP966U", "linking_id": "IF8PQP966U", "ref_pname": "PREDNYLIDENE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "845d3001-576e-4e48-871c-2358d5c813c4", "name": "11.BETA.,17,21-TRIHYDROXY-16-METHYLENEPREGNA-1,4-DIENE-3,20-DIONE", "stdName": "11.BETA.,17,21-TRIHYDROXY-16-METHYLENEPREGNA-1,4-DIENE-3,20-DIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5176c2ff-5a84-4848-8284-a3916d9e275c" ], "display_name": false }, { "uuid": "10ad592b-0fe8-4966-9433-c28652e7ed0b", "name": "METHYLENPREDNISOLONE", "stdName": "METHYLENPREDNISOLONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5176c2ff-5a84-4848-8284-a3916d9e275c" ], "display_name": false }, { "uuid": "21d39064-e2c5-432d-883c-350437b88a23", "name": "PREDNYLIDENE", "stdName": "PREDNYLIDENE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "0d58ada5-e8ac-4fc7-8ae7-2ce061f3e7d6", "74b19c8f-ac5b-4aa4-b020-c69291fc4163", "7f3b43f8-6d1a-4c95-b316-b34d8140afe4", "a8dc6640-5a69-4d11-9513-a7709d2f5921", "c63b1659-529d-44e5-8e09-bc620d86c27f", "5176c2ff-5a84-4848-8284-a3916d9e275c", "25578142-5f28-4559-841e-f336455ae85b", "3e77ad5f-5680-410d-9940-7513807f3bfd", "fcc6df25-5874-4c26-b4bd-ab54f30ebe97" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "6b0978b0-d5b6-4e7e-b4e7-f242269e0270", "name_org": "INN" } ] }, { "uuid": "49b57b0d-a6cf-4b15-a98b-89a0a1cb3176", "name": "PREDNYLIDENE [MART.]", "stdName": "PREDNYLIDENE [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "25578142-5f28-4559-841e-f336455ae85b" ], "display_name": false }, { "uuid": "bee625b0-a685-4f7e-bf52-1b53794e770a", "name": "PREDNYLIDENE [MI]", "stdName": "PREDNYLIDENE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7f3b43f8-6d1a-4c95-b316-b34d8140afe4" ], "display_name": false }, { "uuid": "fe7718ec-e7ba-b491-e81a-b137b7caad29", "name": "Prednylidene [WHO-DD]", "stdName": "PREDNYLIDENE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ffb782ee-aa8a-6657-f3c5-c92a008b613f" ], "display_name": false }, { "uuid": "30849a18-2742-462c-b585-e7a2e9e5420a", "name": "prednylidene [INN]", "stdName": "PREDNYLIDENE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a8dc6640-5a69-4d11-9513-a7709d2f5921" ], "display_name": false } ], "references": [ { "uuid": "5176c2ff-5a84-4848-8284-a3916d9e275c", "citation": "USP Dictionary 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "a8dc6640-5a69-4d11-9513-a7709d2f5921", "citation": "INN Proposed List 13", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "25578142-5f28-4559-841e-f336455ae85b", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7f3b43f8-6d1a-4c95-b316-b34d8140afe4", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0d58ada5-e8ac-4fc7-8ae7-2ce061f3e7d6", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4661a5d0-12a6-435f-a2cd-5c0a09004de3", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389704000, "tags": [ "NOMEN" ] }, { "uuid": "f9135a9b-f55d-4b8d-80d2-6682ba212e51", "citation": "SRS import [IF8PQP966U]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=IF8PQP966U", "doc_type": "SRS", "public_domain": true, "document_date": 1493389704000, "tags": [ "NOMEN" ] }, { "uuid": "74b19c8f-ac5b-4aa4-b020-c69291fc4163", "citation": "PREDNYLIDENE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "c63b1659-529d-44e5-8e09-bc620d86c27f", "citation": "PREDNYLIDENE [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "fcc6df25-5874-4c26-b4bd-ab54f30ebe97", "citation": "PREDNYLIDENE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3e77ad5f-5680-410d-9940-7513807f3bfd", "citation": "PREDNYLIDENE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "697d068f-714c-0d90-a6d4-4d732f10d9b7", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=599-33-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "aa1b401f-eea3-ef75-8363-d5d2f4c5f009", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "b8bfaad2-c80a-4133-8530-658ae7b827b4", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "ffb782ee-aa8a-6657-f3c5-c92a008b613f", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "6cde5ece-6707-c460-e24e-fc1e436073b2", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "54a92618-f15b-579a-97d4-9395ee13f70f", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "2625fc03-5419-457f-93c1-91e427e41a89", "id": "2625fc03-5419-457f-93c1-91e427e41a89", "molfile": "\n Marvin 01132102072D \n\n 27 30 0 0 1 0 999 V2000\n 5.3072 -4.4416 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 6.0916 -4.7089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5884 -4.0465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4104 -4.0465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1120 -3.3697 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 6.8208 -2.9542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1090 -2.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3945 -2.1380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8149 -2.1293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5237 -2.5447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3248 -3.6108 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 5.3218 -2.7858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6101 -3.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8839 -3.5934 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 3.1693 -3.1810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8751 -4.4241 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 4.5869 -4.8455 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 4.5869 -5.6675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8723 -6.0771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1576 -5.6588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4488 -6.0742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7401 -5.6588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0255 -6.0683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7401 -4.8338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4488 -4.4213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1605 -4.8338 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 3.1576 -4.0117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 11 1 0 0 0 0\n 17 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 5 3 1 0 0 0 0\n 5 6 1 6 0 0 0\n 5 7 1 0 0 0 0\n 11 5 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 7 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 12 1 1 0 0 0\n 11 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 1 0 0 0\n 16 14 1 1 0 0 0\n 16 17 1 0 0 0 0\n 16 26 1 0 0 0 0\n 17 18 1 6 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 21 20 2 0 0 0 0\n 26 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 2 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 1 1 0 0 0\nM END", "smiles": "C=C1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@H](C[C@]2(C)[C@]1(C(=O)CO)O)O", "formula": "C22H28O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e7dfb9ed-491b-4689-91c9-4934703579fe" }, "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "372.4556", "optical_activity": "UNSPECIFIED", "stereo_centers": 7 } ], "definition_level": "COMPLETE", "uuid": "f0ac4fe8-00bd-46ac-bd30-89ae913ad65b", "version": "14", "structure": { "id": "6593912d-9e2f-4930-8a5b-c93027199190", "molfile": "\n Marvin 01132105172D \n\n 30 33 0 0 1 0 999 V2000\n 5.3332 -3.6165 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.3156 -4.4486 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.1216 -3.3750 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.1655 -4.8414 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.5988 -4.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5941 -4.8531 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.8812 -4.4311 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.1626 -5.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6174 -3.1946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1012 -4.7163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8900 -3.5991 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.4527 -4.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4527 -6.0838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1186 -2.5516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5941 -5.6764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7428 -4.8414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7428 -5.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8784 -6.0867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4221 -4.0529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4030 -2.1414 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0271 -6.0779 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8315 -2.9589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3302 -2.7902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1743 -3.1860 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1626 -4.0180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8256 -2.1327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5356 -2.5487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3070 -5.2720 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5912 -4.0297 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8784 -5.2517 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 7 1 0 0 0 0\n 5 3 1 0 0 0 0\n 6 2 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 4 1 0 0 0 0\n 9 1 1 0 0 0 0\n 10 2 1 0 0 0 0\n 11 9 1 0 0 0 0\n 12 4 1 0 0 0 0\n 13 8 2 0 0 0 0\n 3 14 1 1 0 0 0\n 15 6 1 0 0 0 0\n 16 12 2 0 0 0 0\n 17 13 1 0 0 0 0\n 18 15 1 0 0 0 0\n 19 5 2 0 0 0 0\n 20 14 2 0 0 0 0\n 21 17 2 0 0 0 0\n 3 22 1 6 0 0 0\n 1 23 1 1 0 0 0\n 11 24 1 1 0 0 0\n 4 25 1 1 0 0 0\n 26 14 1 0 0 0 0\n 27 26 1 0 0 0 0\n 2 28 1 6 0 0 0\n 6 29 1 1 0 0 0\n 7 30 1 6 0 0 0\n 5 10 1 0 0 0 0\n 11 7 1 0 0 0 0\n 18 8 1 0 0 0 0\n 17 16 1 0 0 0 0\nM END", "smiles": "C=C1C[C@@]2([H])[C@]3([H])CCC4=CC(=O)C=C[C@]4(C)[C@@]3([H])[C@H](C[C@]2(C)[C@]1(C(=O)CO)O)O", "formula": "C22H28O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 7, "ez_centers": 0, "molecular_weight": "372.4556", "optical_activity": "UNSPECIFIED", "references": [ "5176c2ff-5a84-4848-8284-a3916d9e275c", "f9135a9b-f55d-4b8d-80d2-6682ba212e51", "a8dc6640-5a69-4d11-9513-a7709d2f5921" ], "stereo_centers": 7 }, "unii": "IF8PQP966U" } ] }