{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "331d007c-3c18-45c1-9735-623917de900f",
          "code": "6860-47-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6860-47-5",
          "code_system": "CAS",
          "references": [
            "75548f64-4807-4960-9f20-b922c544b8b5",
            "ce2a2355-ede8-489d-b836-443e362afe55"
          ]
        },
        {
          "uuid": "039fb0b2-4631-4988-822b-867d37569e14",
          "code": "160873",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/160873",
          "code_system": "PUBCHEM",
          "references": [
            "75548f64-4807-4960-9f20-b922c544b8b5"
          ]
        },
        {
          "uuid": "487286c4-2b68-847a-9fdc-7854eaebb86d",
          "code": "Xylobiose",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Xylobiose",
          "code_system": "WIKIPEDIA",
          "references": [
            "bb457a9f-ee01-d1b1-2be8-b4bd48da268f"
          ]
        },
        {
          "uuid": "caa6672f-8a6e-488e-9eda-484e34a717c0",
          "code": "ID02R0EG7P",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "995f4138-f92c-17e0-6ce3-f640b41b3374",
          "code": "28309",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28309",
          "code_system": "CHEBI",
          "references": [
            "a9b73cd5-a8ea-770c-2cad-85bce403635e"
          ]
        },
        {
          "uuid": "4b420231-afc3-f935-734a-99c086a35783",
          "code": "DTXSID10905097",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10905097",
          "code_system": "EPA CompTox",
          "references": [
            "a9b73cd5-a8ea-770c-2cad-85bce403635e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4ceece81-01bd-4e67-905f-096290e24fa0",
          "name": "1,4-.BETA.-XYLOBIOSE",
          "stdName": "1,4-.BETA.-XYLOBIOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "572a02a4-34ea-488d-9417-2fed9ccdd2ef"
          ],
          "display_name": false
        },
        {
          "uuid": "9d10b2d4-f927-4110-85c9-7e1bddf54a12",
          "name": "4-O-.BETA.-D-XYLOPYRANOSYL-D-XYLOSE",
          "stdName": "4-O-.BETA.-D-XYLOPYRANOSYL-D-XYLOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "572a02a4-34ea-488d-9417-2fed9ccdd2ef"
          ],
          "display_name": false
        },
        {
          "uuid": "c054617f-9009-4fa9-84a8-fe5d3b453c1c",
          "name": "D-XYLOSE, 4-O-.BETA.-D-XYLOPYRANOSYL-",
          "stdName": "D-XYLOSE, 4-O-.BETA.-D-XYLOPYRANOSYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "572a02a4-34ea-488d-9417-2fed9ccdd2ef"
          ],
          "display_name": false
        },
        {
          "uuid": "3aaa5bd6-e9d3-44b8-a125-aa866214a38e",
          "name": "D-XYLOSE, 4-O-BETA-D-XYLOPYRANOSYL-",
          "stdName": "D-XYLOSE, 4-O-BETA-D-XYLOPYRANOSYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ac5f63a-a7a0-49e9-9348-a40ed188d289"
          ],
          "display_name": false
        },
        {
          "uuid": "72a2562f-81fc-4c6f-b739-9e9d4589de01",
          "name": "XYLOBIOSE",
          "stdName": "XYLOBIOSE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8865d4a9-fba8-400b-a7f6-5775fff91b46",
            "c1bbf175-6612-41c3-9ef4-d3b9629db3c7"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "06838061-219f-487f-bc65-bbe0642ba685",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "3ac5f63a-a7a0-49e9-9348-a40ed188d289",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c1bbf175-6612-41c3-9ef4-d3b9629db3c7",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "572a02a4-34ea-488d-9417-2fed9ccdd2ef",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "75548f64-4807-4960-9f20-b922c544b8b5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392137000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "700a1d52-0e79-4cd9-b5d3-0f390eadabdd",
          "citation": "SRS import [ID02R0EG7P]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ID02R0EG7P",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392137000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8865d4a9-fba8-400b-a7f6-5775fff91b46",
          "citation": "XYLOBIOSE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bb457a9f-ee01-d1b1-2be8-b4bd48da268f",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/gamma-Glutamylcysteine",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a9b73cd5-a8ea-770c-2cad-85bce403635e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ce2a2355-ede8-489d-b836-443e362afe55",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f6771352-d3a7-4f11-8bb5-412bcb637f68",
          "id": "f6771352-d3a7-4f11-8bb5-412bcb637f68",
          "molfile": "\n  Marvin  01132112462D          \n\n 19 19  0  0  1  0            999 V2000\n    4.2890   -1.2362    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.0047   -0.8258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2890   -2.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5733   -2.4774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5733   -0.8258    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.5733    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8577   -1.2362    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.1470   -0.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1470    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8577   -2.0619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1470   -2.4774    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    1.4314   -2.0619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7157   -2.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7157   -3.3031    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    0.0000   -3.7135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4314   -3.7135    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    1.4314   -4.5393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1470   -3.3031    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.8577   -3.7135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  6  1  6  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 10  1  6  0  0  0\n  8  9  1  0  0  0  0\n 11 10  1  1  0  0  0\n 11 12  1  0  0  0  0\n 18 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  6  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  1  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  6  0  0  0\nM  END",
          "smiles": "C(=O)[C@@H]([C@H]([C@@H](CO)O[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O)O",
          "formula": "C10H18O9",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b10bb984-11c9-4bdb-b15f-676745ede062"
          },
          "defined_stereo": 7,
          "ez_centers": 0,
          "molecular_weight": "282.2449",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 7
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "11fd454d-a102-4cf7-8055-997e13fe29ad",
      "version": "7",
      "structure": {
        "id": "1dc41955-c20b-43e8-a338-e5db827f6a5a",
        "molfile": "\n  Marvin  01132101432D          \n\n 19 19  0  0  1  0            999 V2000\n    3.5733   -2.4774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2890   -2.0619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2890   -1.2362    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.0047   -0.8258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5733   -0.8258    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.5733    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8577   -1.2362    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.8577   -2.0619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1470   -0.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1470    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1470   -2.4774    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.1470   -3.3031    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.8577   -3.7135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4314   -3.7135    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.4314   -4.5393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7157   -3.3031    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.0000   -3.7135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7157   -2.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4314   -2.0619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  1  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  6  0  0  0\n  7  9  1  0  0  0  0\n 11  8  1  1  0  0  0\n  9 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 19  1  0  0  0  0\n 12 13  1  6  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  1  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  6  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
        "smiles": "C(=O)[C@@H]([C@H]([C@@H](CO)O[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O)O",
        "formula": "C10H18O9",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 7,
        "ez_centers": 0,
        "molecular_weight": "282.2449",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3ac5f63a-a7a0-49e9-9348-a40ed188d289",
          "700a1d52-0e79-4cd9-b5d3-0f390eadabdd"
        ],
        "stereo_centers": 7
      },
      "unii": "ID02R0EG7P"
    }
  ]
}