{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2e246993-3c09-4754-baa2-56fd9a00ceee",
          "code": "14324-55-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14324-55-1",
          "code_system": "CAS",
          "references": [
            "2992bac4-e0ab-417d-bec9-32e699aa2602",
            "aa55e2bd-12bc-4aa7-8a16-aef9b9827c8c"
          ]
        },
        {
          "uuid": "e8add887-ed3e-4172-bfeb-1347612189cb",
          "code": "N0000185508",
          "comments": "Established Pharmacologic Class [EPC]|Standardized Chemical Allergen [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000185508",
          "code_system": "NDF-RT",
          "references": [
            "2992bac4-e0ab-417d-bec9-32e699aa2602"
          ]
        },
        {
          "uuid": "3469f74a-38cc-4768-b3ca-9920c0942c3e",
          "code": "238-270-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.034.776",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2992bac4-e0ab-417d-bec9-32e699aa2602"
          ]
        },
        {
          "uuid": "8a32183f-dc85-4aec-869b-725dbceaa979",
          "code": "SUB61026",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "2992bac4-e0ab-417d-bec9-32e699aa2602"
          ]
        },
        {
          "uuid": "b1bee8a9-c6e6-464d-b2d7-a9a5e2a07140",
          "code": "N0000175629",
          "comments": "Increased Histamine Release [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175629",
          "code_system": "NDF-RT",
          "references": [
            "2992bac4-e0ab-417d-bec9-32e699aa2602"
          ]
        },
        {
          "uuid": "7a08a74c-db55-496a-89d5-9d1d1b92937b",
          "code": "N0000171131",
          "comments": "Allergens [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000171131",
          "code_system": "NDF-RT",
          "references": [
            "2992bac4-e0ab-417d-bec9-32e699aa2602"
          ]
        },
        {
          "uuid": "4cbac57a-5441-43e8-b6fd-3282ca4f121f",
          "code": "N0000184306",
          "comments": "Cell-mediated Immunity [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000184306",
          "code_system": "NDF-RT",
          "references": [
            "2992bac4-e0ab-417d-bec9-32e699aa2602"
          ]
        },
        {
          "uuid": "edfcce9c-1a64-76c6-9479-7e823c24e9f9",
          "code": "2907",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2907",
          "code_system": "HSDB",
          "references": [
            "4fe076c1-f1bb-878f-aa81-7bbd6bc87090"
          ]
        },
        {
          "uuid": "4ff2546c-7d26-e2e8-2529-b68a71c50ea1",
          "code": "DTXSID5021463",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5021463",
          "code_system": "EPA CompTox",
          "references": [
            "29545192-ee69-1cf7-6c9f-23d6fd1e2e88"
          ]
        },
        {
          "uuid": "196bd123-6f45-bc06-2b64-c61438b41cb3",
          "code": "26633",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/26633",
          "code_system": "PUBCHEM",
          "references": [
            "fa8ea03d-0df5-251d-4f0b-4c1d64b86533"
          ]
        },
        {
          "uuid": "cab6d414-7685-909f-e0cb-5f60097f5d69",
          "code": "DB14193",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB14193",
          "code_system": "DRUG BANK",
          "references": [
            "e55ee8b6-8f7c-7a40-5100-7f3d8bd13b56"
          ]
        },
        {
          "uuid": "54561e3b-ebc7-411c-8630-54a8f238a9bd",
          "code": "ICW4708Z8G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a0b9b770-9e62-674e-fdee-2396fd74c880",
          "code": "144351",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:144351",
          "code_system": "CHEBI",
          "references": [
            "e55ee8b6-8f7c-7a40-5100-7f3d8bd13b56"
          ]
        },
        {
          "uuid": "e705971e-ddbc-cb08-76e1-f7df9c098483",
          "code": "100000134267",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c7286391-c4c8-5d9f-e829-107466ca2e98"
          ]
        },
        {
          "uuid": "7adc0444-c044-7928-09bc-804a18a55b96",
          "code": "ICW4708Z8G",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=ICW4708Z8G",
          "code_system": "DAILYMED",
          "references": [
            "7d04bbc1-446b-f4f4-885f-475db754dc02"
          ]
        },
        {
          "uuid": "74b2be2d-d9dc-1183-1847-d04214f7b7c1",
          "code": "177699",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=177699",
          "code_system": "NSC",
          "references": [
            "600a47e6-63b3-a149-f0d5-01a365829102"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "80f436ee-a964-4ee2-86b3-00d70d765dd2",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "8a71388c-19ae-4644-a869-df4dbe8113d5",
            "refuuid": "78c68007-7240-4b21-8ece-fb0d5fd05d17",
            "name": "DITIOCARB",
            "unii": "99Z2744345",
            "linking_id": "99Z2744345",
            "ref_pname": "DITIOCARB",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8f7dffd0-f368-4f0e-a02d-52512dd5343a",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "c92557f0-b58d-4488-ba98-800b9ed5719b",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e241d440-edc1-4a69-b724-e56545f48abf",
          "name": "BIS(DIETHYLDITHIOCARBAMATO)ZINC",
          "stdName": "BIS(DIETHYLDITHIOCARBAMATO)ZINC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdd5b5ba-a694-4c7e-953b-22b617e34bba",
            "171f8e88-d616-4258-b37e-2555d5b8ef76"
          ],
          "display_name": false
        },
        {
          "uuid": "553cd10f-3330-4251-bf95-8a8b74135f7a",
          "name": "DIETHYLCARBAMIC ACID, ZINC SALT",
          "stdName": "DIETHYLCARBAMIC ACID, ZINC SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdd5b5ba-a694-4c7e-953b-22b617e34bba",
            "171f8e88-d616-4258-b37e-2555d5b8ef76"
          ],
          "display_name": false
        },
        {
          "uuid": "54c4a358-754e-44ad-b6a4-1bddee7e24a0",
          "name": "DIETHYLDITHIOCARBAMIC ACID ZINC SALT [HSDB]",
          "stdName": "DIETHYLDITHIOCARBAMIC ACID ZINC SALT [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "14d08ea1-1ee3-42ff-90ed-0b26bf4767b3",
            "171f8e88-d616-4258-b37e-2555d5b8ef76"
          ],
          "display_name": false
        },
        {
          "uuid": "ad0b8190-b8ce-479c-87cc-d58ae9eb2730",
          "name": "DITIOCARB ZINC",
          "stdName": "DITIOCARB ZINC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e71c6a2e-659b-4a07-a842-83ddf5696820",
            "171f8e88-d616-4258-b37e-2555d5b8ef76"
          ],
          "display_name": true
        },
        {
          "uuid": "906408b4-b67d-4a53-ba53-c94382a373df",
          "name": "ETHYLZIMATE",
          "stdName": "ETHYLZIMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdd5b5ba-a694-4c7e-953b-22b617e34bba",
            "171f8e88-d616-4258-b37e-2555d5b8ef76"
          ],
          "display_name": false
        },
        {
          "uuid": "d9d9a678-abd5-49ca-b335-c32e5c014f74",
          "name": "ETHYLZIRAM",
          "stdName": "ETHYLZIRAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdd5b5ba-a694-4c7e-953b-22b617e34bba",
            "171f8e88-d616-4258-b37e-2555d5b8ef76"
          ],
          "display_name": false
        },
        {
          "uuid": "950b8c93-b033-41ec-aaf8-3ec93f067a8e",
          "name": "NSC-177699",
          "stdName": "NSC-177699",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "171f8e88-d616-4258-b37e-2555d5b8ef76",
            "9d0938f0-55ae-4be7-82ac-5560c0ea10b7"
          ],
          "display_name": false
        },
        {
          "uuid": "4b318997-fb59-49db-89ac-a7f28f5cd778",
          "name": "ZINC DIETHYLDITHIOCARBAMATE",
          "stdName": "ZINC DIETHYLDITHIOCARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdd5b5ba-a694-4c7e-953b-22b617e34bba",
            "42d77923-8252-4146-ba68-572503142cfa"
          ],
          "display_name": false
        },
        {
          "uuid": "38fbcaba-977e-4447-bc38-071dc5c28cdf",
          "name": "ZINC N,N-DIETHYLDITHIOCARBAMATE",
          "stdName": "ZINC N,N-DIETHYLDITHIOCARBAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdd5b5ba-a694-4c7e-953b-22b617e34bba",
            "171f8e88-d616-4258-b37e-2555d5b8ef76"
          ],
          "display_name": false
        },
        {
          "uuid": "4186bda0-3541-43e2-b882-dd84b3372ae9",
          "name": "ZINCDIETHYLDITHIOCARBAMATE",
          "stdName": "ZINCDIETHYLDITHIOCARBAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e86c5a75-b752-49b2-b148-55afc00cbd7e",
            "171f8e88-d616-4258-b37e-2555d5b8ef76"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cdd5b5ba-a694-4c7e-953b-22b617e34bba",
          "citation": "DOSE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "42d77923-8252-4146-ba68-572503142cfa",
          "citation": "DL",
          "doc_type": "DOSE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "171f8e88-d616-4258-b37e-2555d5b8ef76",
          "citation": "DOSE",
          "doc_type": "DOSE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14d08ea1-1ee3-42ff-90ed-0b26bf4767b3",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e71c6a2e-659b-4a07-a842-83ddf5696820",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e86c5a75-b752-49b2-b148-55afc00cbd7e",
          "citation": "BLA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d0938f0-55ae-4be7-82ac-5560c0ea10b7",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2992bac4-e0ab-417d-bec9-32e699aa2602",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389916000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c22396f-43c8-4e45-930b-17152860855d",
          "citation": "SRS import [ICW4708Z8G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=ICW4708Z8G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389916000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fe076c1-f1bb-878f-aa81-7bbd6bc87090",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+14324-55-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "29545192-ee69-1cf7-6c9f-23d6fd1e2e88",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=14324-55-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fa8ea03d-0df5-251d-4f0b-4c1d64b86533",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "aa55e2bd-12bc-4aa7-8a16-aef9b9827c8c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e55ee8b6-8f7c-7a40-5100-7f3d8bd13b56",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "600a47e6-63b3-a149-f0d5-01a365829102",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7d04bbc1-446b-f4f4-885f-475db754dc02",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "c7286391-c4c8-5d9f-e829-107466ca2e98",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3d8dcd8e-811a-4cf0-b263-52f230db2639",
          "id": "3d8dcd8e-811a-4cf0-b263-52f230db2639",
          "molfile": "\n  Marvin  01132103162D          \n\n  1  0  0  0  0  0            999 V2000\n    2.9095   -2.4898    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7dae4865-0ed3-4711-8243-0bbea3f23540"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "bb0a6055-5b14-4d90-a7e3-9e6830063886",
          "id": "bb0a6055-5b14-4d90-a7e3-9e6830063886",
          "molfile": "\n  Marvin  01132109402D          \n\n  8  7  0  0  0  0            999 V2000\n   -1.0233   -1.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1983   -1.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2187   -2.4169    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1983   -3.1282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0233   -3.1282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0408   -2.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4518   -3.1340    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4518   -1.6967    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  6  1  0  0  0  0\n  5  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  2  0  0  0  0\nM  END",
          "smiles": "CCN(CC)C(=S)S",
          "formula": "C5H11NS2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "70705562-7899-4701-a7f8-cf802bd2eb21"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "149.2799",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f7c4170d-933e-47e4-8345-b982241433b8",
      "version": "10",
      "structure": {
        "id": "e7da6380-e5e0-4fab-b1e8-c7fbf658abf0",
        "molfile": "\n  Marvin  01132112002D          \n\n 17 14  0  0  0  0            999 V2000\n    1.0408   -2.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4518   -3.1340    0.0000 S   0  5  0  0  0  0  0  0  0  0  0  0\n    1.4518   -1.6967    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2187   -2.4169    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1983   -1.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1983   -3.1282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0233   -1.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0233   -3.1282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9095   -2.4898    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    1.0408   -2.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4518   -3.1340    0.0000 S   0  5  0  0  0  0  0  0  0  0  0  0\n    1.4518   -1.6967    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2187   -2.4169    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1983   -1.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1983   -3.1282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0233   -1.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0233   -3.1282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  6  1  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\n 13 10  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 15  1  0  0  0  0\nM  CHG  3   2  -1   9   2  11  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   1   2   3   4   5   6   7   8  10  11  12  13  14  15  16\nM  SAL   1  1  17\nM  SPA   1  8   1   2   3   4   5   6   7   8\nM  SDI   1  4   -1.4433   -3.5540   -1.4433   -1.2767\nM  SDI   1  4    1.8718   -1.2767    1.8718   -3.5540\nM  SMT   1 2\nM  END",
        "smiles": "CCN(CC)C(=S)[S-].CCN(CC)C(=S)[S-].[Zn+2]",
        "formula": "2C5H10NS2.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "361.9395",
        "optical_activity": "NONE",
        "references": [
          "7c22396f-43c8-4e45-930b-17152860855d",
          "cdd5b5ba-a694-4c7e-953b-22b617e34bba"
        ],
        "stereo_centers": 0
      },
      "unii": "ICW4708Z8G"
    }
  ]
}