{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "64a3cd6d-006e-4746-91de-69a9ab73a209", "code": "25876-10-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=25876-10-2", "code_system": "CAS", "references": [ "83de61cf-0b20-43f9-a919-86408c7c45e7", "3e74e984-940b-480f-933e-9822cf08eea6" ] }, { "uuid": "de0ffcc5-0fcb-45f9-ba72-bda193638f2b", "code": "C76148", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76148", "code_system": "NCI_THESAURUS", "references": [ "83de61cf-0b20-43f9-a919-86408c7c45e7" ] }, { "uuid": "6ebbd0d7-0ae8-4573-a26d-1584e5b60237", "code": "C100093", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67100093", "code_system": "MESH", "references": [ "83de61cf-0b20-43f9-a919-86408c7c45e7" ] }, { "uuid": "e948ec07-6dcf-4348-9bd5-53274c046ff4", "code": "m5697", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m5697?q=authorize", "code_system": "MERCK INDEX", "references": [ "83de61cf-0b20-43f9-a919-86408c7c45e7" ] }, { "uuid": "bff99f6b-c475-4872-863d-52f8a82170d8", "code": "72395", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72395", "code_system": "PUBCHEM", "references": [ "83de61cf-0b20-43f9-a919-86408c7c45e7" ] }, { "uuid": "af9e7308-4cb4-b465-b323-6bc332e055d8", "code": "DTXSID9023091", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9023091", "code_system": "EPA CompTox", "references": [ "871f7580-bdde-1b14-af86-2fc925e5c510" ] }, { "uuid": "ae221169-01dc-f272-ff74-e286cff4407e", "code": "C2363", "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antibiotic[C258]|Aminoglycoside Antibiotic", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2363", "code_system": "NCI_THESAURUS", "references": [ "b7b9c4e9-ea6e-5bb8-89c7-12df7ccda377" ] }, { "uuid": "b82f772c-94bb-46fc-a2be-98893d0db91a", "code": "I904Y9FPPV", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "380afee4-e7c5-1a3d-579b-bb21cb101122", "code": "27412", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:27412", "code_system": "CHEBI", "references": [ "b7b9c4e9-ea6e-5bb8-89c7-12df7ccda377" ] } ], "relationships": [ { "uuid": "0533b89e-aa7d-499a-878c-5242c32df329", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "0855bb89-7427-4b71-9145-4f68c591f4dc", "refuuid": "478c0ed0-d46d-4929-9c5a-d199e256e819", "name": "GENTAMICIN C1", "unii": "I904Y9FPPV", "linking_id": "I904Y9FPPV", "ref_pname": "GENTAMICIN C1", "substance_class": "reference" } }, { "uuid": "e8a13666-0a69-4d58-9a45-e48477d84a52", "type": "SALT/SOLVATE->PARENT", "related_substance": { "uuid": "5f60b43a-a6e3-42d7-9f58-3c52a17ceefd", "refuuid": "7ca07749-c36e-497b-8bea-9e0d91bf1851", "name": "GENTAMICIN C1 SULFATE", "unii": "WLI0S741IL", "linking_id": "WLI0S741IL", "ref_pname": "GENTAMICIN C1 SULFATE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "2be6f8b4-c4ce-481c-9e89-d5774747d8ec", "name": "GENTAMICIN C1", "stdName": "GENTAMICIN C1", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "76355c7a-b996-4a65-982c-f29d1a06ca2f", "06cda42b-033c-47bd-ba43-e2488ea9d0dd", "1df04353-feef-4892-a483-31a9f2e0e584", "5d133ce5-677b-4bba-a76a-428766b312a6" ], "display_name": true }, { "uuid": "1f165b88-a9d1-4336-bac5-6535b07664f6", "name": "GENTAMICIN C1 [MI]", "stdName": "GENTAMICIN C1 [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "06cda42b-033c-47bd-ba43-e2488ea9d0dd", "5d133ce5-677b-4bba-a76a-428766b312a6" ], "display_name": false } ], "references": [ { "uuid": "76355c7a-b996-4a65-982c-f29d1a06ca2f", "citation": "ChemIDplus 2008", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "5d133ce5-677b-4bba-a76a-428766b312a6", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "06cda42b-033c-47bd-ba43-e2488ea9d0dd", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "83de61cf-0b20-43f9-a919-86408c7c45e7", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389742000, "tags": [ "NOMEN" ] }, { "uuid": "dc3d5f36-cd15-4552-b0a3-c36923b80ba7", "citation": "SRS import [I904Y9FPPV]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I904Y9FPPV", "doc_type": "SRS", "public_domain": true, "document_date": 1493389742000, "tags": [ "NOMEN" ] }, { "uuid": "1df04353-feef-4892-a483-31a9f2e0e584", "citation": "GENTAMICIN C1 [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "871f7580-bdde-1b14-af86-2fc925e5c510", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=25876-10-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b7b9c4e9-ea6e-5bb8-89c7-12df7ccda377", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "3e74e984-940b-480f-933e-9822cf08eea6", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "da67a105-a208-4f54-b046-6219b52b96fb", "id": "da67a105-a208-4f54-b046-6219b52b96fb", "molfile": "\n Marvin 01132111202D \n\n 33 35 0 0 1 0 999 V2000\n -2.4605 -3.6312 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n -3.1781 -4.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7459 -4.0438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0371 -3.6255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4576 -2.8092 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n -3.1636 -2.3996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1636 -1.5746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4576 -1.1562 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n -2.4605 -0.3341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7372 -1.5746 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n -1.0255 -1.1562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3195 -1.5716 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n -0.3195 -2.3966 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n -1.0313 -2.8062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3951 -2.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1068 -2.3966 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 1.8214 -2.8062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1068 -1.5716 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 1.8157 -1.1562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5245 -1.5716 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 2.5245 -2.3966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2391 -2.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9508 -2.3966 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 4.6655 -2.8092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6597 -1.9812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9508 -1.5716 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 4.6597 -1.1562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3743 -1.5687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2391 -1.1533 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 3.2362 -0.3312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3951 -1.1533 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 0.3922 -0.3312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7372 -2.3996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 5 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 33 1 6 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 1 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 1 0 0 0\n 33 10 1 0 0 0 0\n 12 11 1 1 0 0 0\n 12 13 1 0 0 0 0\n 31 12 1 0 0 0 0\n 13 14 1 6 0 0 0\n 13 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 6 0 0 0\n 18 16 1 0 0 0 0\n 18 19 1 1 0 0 0\n 31 18 1 0 0 0 0\n 20 19 1 6 0 0 0\n 20 21 1 0 0 0 0\n 20 29 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 1 1 0 0 0\n 26 23 1 0 0 0 0\n 26 27 1 1 0 0 0\n 29 26 1 0 0 0 0\n 28 27 1 0 0 0 0\n 29 30 1 6 0 0 0\n 31 32 1 6 0 0 0\nM END", "smiles": "C[C@H]([C@@H]1CC[C@H]([C@H](O1)O[C@@H]2[C@H](C[C@H]([C@@H]([C@H]2O)O[C@@H]3[C@@H]([C@H]([C@](C)(CO3)O)NC)O)N)N)N)NC", "formula": "C21H43N5O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "26d25dcb-e9b2-4b3d-b4dd-4659a6ca1380" }, "defined_stereo": 13, "ez_centers": 0, "molecular_weight": "477.5963", "optical_activity": "UNSPECIFIED", "stereo_centers": 13 } ], "definition_level": "COMPLETE", "uuid": "478c0ed0-d46d-4929-9c5a-d199e256e819", "version": "5", "structure": { "id": "37d0c542-90e2-4c72-a4ff-b3cfc8993f19", "molfile": "\n Marvin 01132102582D \n\n 36 38 0 0 1 0 999 V2000\n 1.1068 -1.5716 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -0.3195 -1.5716 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 0.3951 -1.1533 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 3.2391 -1.1533 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 2.5245 -1.5716 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.9508 -1.5716 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -1.7372 -1.5746 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 1.8157 -1.1562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0255 -1.1562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7372 -2.3996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9508 -2.3966 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 1.1068 -2.3966 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -0.3195 -2.3966 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 2.5245 -2.3966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3951 -2.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4576 -2.8092 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 3.2391 -2.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4576 -1.1562 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.6597 -1.1562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1636 -2.3996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1636 -1.5746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2362 -0.3312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3922 -0.3312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8214 -2.8062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0313 -2.8062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4605 -3.6312 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.6597 -1.9812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7459 -4.0438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.4605 -0.3341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6655 -2.8092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3743 -1.5687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0371 -3.6255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1781 -4.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5245 -0.7495 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0226 -1.9870 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7459 -3.2216 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2 3 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 8 1 0 0 0 0\n 6 4 1 0 0 0 0\n 7 9 1 0 0 0 0\n 1 8 1 1 0 0 0\n 2 9 1 1 0 0 0\n 10 7 1 0 0 0 0\n 11 6 1 0 0 0 0\n 12 1 1 0 0 0 0\n 13 2 1 0 0 0 0\n 14 5 1 0 0 0 0\n 15 12 1 0 0 0 0\n 16 10 1 0 0 0 0\n 17 14 1 0 0 0 0\n 18 7 1 0 0 0 0\n 6 19 1 1 0 0 0\n 20 16 1 0 0 0 0\n 21 18 1 0 0 0 0\n 4 22 1 6 0 0 0\n 3 23 1 6 0 0 0\n 12 24 1 6 0 0 0\n 13 25 1 6 0 0 0\n 26 16 1 0 0 0 0\n 11 27 1 1 0 0 0\n 26 28 1 6 0 0 0\n 18 29 1 1 0 0 0\n 11 30 1 6 0 0 0\n 31 19 1 0 0 0 0\n 32 28 1 0 0 0 0\n 33 26 1 0 0 0 0\n 5 34 1 1 0 0 0\n 7 35 1 6 0 0 0\n 16 36 1 1 0 0 0\n 15 13 1 0 0 0 0\n 11 17 1 0 0 0 0\n 20 21 1 0 0 0 0\nM END", "smiles": "C[C@H]([C@]1([H])CC[C@H]([C@]([H])(O1)O[C@@H]2[C@H](C[C@H]([C@@H]([C@H]2O)O[C@]3([H])[C@@H]([C@H]([C@](C)(CO3)O)NC)O)N)N)N)NC", "formula": "C21H43N5O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 13, "ez_centers": 0, "molecular_weight": "477.5963", "optical_activity": "UNSPECIFIED", "references": [ "76355c7a-b996-4a65-982c-f29d1a06ca2f", "dc3d5f36-cd15-4552-b0a3-c36923b80ba7" ], "stereo_centers": 13 }, "unii": "I904Y9FPPV" } ] }