{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c88f076b-7f14-4215-863d-c77574c3452b",
          "code": "AB-FUBINACA",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/AB-FUBINACA",
          "code_system": "WIKIPEDIA",
          "references": [
            "e4a02449-0f65-b8f5-61c2-6c8a4e527f5f"
          ]
        },
        {
          "uuid": "e1c940fd-79a7-421e-9301-894931448e5a",
          "code": "1629062-56-1",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1629062-56-1",
          "code_system": "CAS",
          "references": [
            "2cbd785b-c884-44b8-ad45-49fa7605ebdb",
            "f7498c5f-ca87-431c-bc41-3635ebd064e4"
          ]
        },
        {
          "uuid": "7248ebe8-f154-4d76-be3c-82ae2b9fba52",
          "code": "7012",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I. |Hallucinogenic substances",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "2cbd785b-c884-44b8-ad45-49fa7605ebdb"
          ]
        },
        {
          "uuid": "9779bad1-c016-4638-afc1-a930aacd79f2",
          "code": "1185282-01-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1185282-01-2",
          "code_system": "CAS",
          "references": [
            "2cbd785b-c884-44b8-ad45-49fa7605ebdb",
            "d66bdb29-170c-4155-a51f-40cc8c3e015d"
          ]
        },
        {
          "uuid": "3fc1eeef-e7f6-4f89-927b-35233b12416a",
          "code": "58124325",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/58124325",
          "code_system": "PUBCHEM",
          "references": [
            "2cbd785b-c884-44b8-ad45-49fa7605ebdb"
          ]
        },
        {
          "uuid": "25c2a8b4-76b3-7edc-7ca5-3a1f092b3b6c",
          "code": "DTXSID70728845",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70728845",
          "code_system": "EPA CompTox",
          "references": [
            "0a01860d-c363-66f1-fb3d-db34e16d1869"
          ]
        },
        {
          "uuid": "f3934419-4c9c-4798-ad09-557d515a9471",
          "code": "I7PZF0KTFK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5653d96a-c431-e103-8bf0-4a75f92eb4ef",
          "code": "Designer-drugs-AB-FUBINACA",
          "comments": "Wikipedia|List of designer drugs|Synthetic cannabinoids|Indazole based",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "a61e5615-4d67-b45a-4844-bd4da125eb48"
          ]
        },
        {
          "uuid": "4efc8bb5-5143-7762-8161-10962227a30c",
          "code": "100000173990",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1ac7879e-44dd-1097-b70e-65e7a46c5531"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6c6105ff-e5f1-43c6-94d6-33bb20ef21f5",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ff437d54-5ba5-4f7f-a2fa-1af881316b90",
            "refuuid": "9e5e0203-4c1e-4511-9bf2-923c17b8a454",
            "name": "AB-FUBINACA",
            "unii": "I7PZF0KTFK",
            "linking_id": "I7PZF0KTFK",
            "ref_pname": "AB-FUBINACA",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e191ea58-c56b-49fe-9075-c79ea23b7dcb",
          "amount": {
            "uuid": "8e52552e-a6ad-48e7-93d0-f9661f63581c",
            "average": 1.8,
            "units": "NANOMOLAR"
          },
          "qualification": "EC50",
          "type": "TARGET->AGONIST",
          "references": [
            "f6a8630b-a93c-4005-be26-a3dfd9d9373e"
          ],
          "related_substance": {
            "uuid": "edb69791-3325-4245-aee8-80ae3209f1d3",
            "refuuid": "72b773c6-8217-42c9-82c1-8f9104a414b4",
            "name": "CANNABINOID RECEPTOR 1",
            "unii": "NJ1Q2Q7LO5",
            "linking_id": "NJ1Q2Q7LO5",
            "ref_pname": "CANNABINOID RECEPTOR 1"
          }
        },
        {
          "uuid": "0af91c84-afb9-4084-94a8-878682aebb3a",
          "amount": {
            "uuid": "bce8ceb7-f8a3-4c9a-bc99-d9b7411fc926",
            "average": 3.2,
            "units": "NANOMOLAR"
          },
          "qualification": "EC50",
          "type": "TARGET->AGONIST",
          "references": [
            "737e5b5a-34a5-4504-b07a-6eec6f335d88"
          ],
          "related_substance": {
            "uuid": "9f447a41-67fd-42fa-910a-39f1f6a72f55",
            "refuuid": "4da43617-82f9-4e30-b375-4d59d4f6fe58",
            "name": "CANNABINOID RECEPTOR 2",
            "unii": "SKEU5X23RI",
            "linking_id": "SKEU5X23RI",
            "ref_pname": "CANNABINOID RECEPTOR 2"
          }
        },
        {
          "uuid": "c8f8c613-9474-4852-b554-b1b2a14f3ba7",
          "amount": {
            "uuid": "33a3f6da-0b8e-4540-bb51-5ac29a473622"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "3bc4c54c-5be1-4fbb-a15a-86fbc438cbe1"
          ],
          "related_substance": {
            "uuid": "8a500946-b4e6-4417-acc9-386cf0a080fd",
            "refuuid": "c987fa5c-a03e-40d7-bd80-b8ea8ae4b7d4",
            "name": "N-((1-((4-FLUOROPHENYL)METHYL)-1H-INDAZOL-3-YL)CARBONYL)-L-VALINE",
            "unii": "CGP65B4RYW",
            "linking_id": "CGP65B4RYW",
            "ref_pname": "N-((1-((4-FLUOROPHENYL)METHYL)-1H-INDAZOL-3-YL)CARBONYL)-L-VALINE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bbfdea14-6ffd-4da2-aa05-da83a145145c",
          "name": "1H-INDAZOLE-3-CARBOXAMIDE, N-((1S)-1-(AMINOCARBONYL)-2-METHYLPROPYL)-1-((4-FLUOROPHENYL)METHYL)-",
          "stdName": "1H-INDAZOLE-3-CARBOXAMIDE, N-((1S)-1-(AMINOCARBONYL)-2-METHYLPROPYL)-1-((4-FLUOROPHENYL)METHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ef05efd-76e2-4cc2-82a5-353abf962464",
            "78fa9478-72bf-4904-a1d7-b53942256c37"
          ],
          "display_name": false
        },
        {
          "uuid": "f5846b7c-0f36-47ae-869b-73434d84177b",
          "name": "AB-FUBINACA",
          "stdName": "AB-FUBINACA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ef05efd-76e2-4cc2-82a5-353abf962464",
            "78fa9478-72bf-4904-a1d7-b53942256c37"
          ],
          "display_name": true
        },
        {
          "uuid": "6a7844a9-4448-4e79-b35f-07b99e856f1e",
          "name": "DEA NO. 7012",
          "stdName": "DEA NO. 7012",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5621e56b-15ff-4031-a849-1efb9a7a7522",
            "6ef05efd-76e2-4cc2-82a5-353abf962464"
          ],
          "display_name": false
        },
        {
          "uuid": "0fef3c06-1795-413a-9c71-488ceae46a95",
          "name": "N-((1S)-1-(AMINOCARBONYL)-2-METHYLPROPYL)-1-((4-FLUOROPHENYL)METHYL)-1H-INDAZOLE-3-CARBOXAMIDE",
          "stdName": "N-((1S)-1-(AMINOCARBONYL)-2-METHYLPROPYL)-1-((4-FLUOROPHENYL)METHYL)-1H-INDAZOLE-3-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5621e56b-15ff-4031-a849-1efb9a7a7522",
            "6ef05efd-76e2-4cc2-82a5-353abf962464"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5621e56b-15ff-4031-a849-1efb9a7a7522",
          "citation": "http://chem.sis.nlm.nih.gov/chemidplus/rn/startswith/1185282-01-2",
          "url": "http://chem.sis.nlm.nih.gov/chemidplus/rn/startswith/1185282-01-2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6ef05efd-76e2-4cc2-82a5-353abf962464",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78fa9478-72bf-4904-a1d7-b53942256c37",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2cbd785b-c884-44b8-ad45-49fa7605ebdb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393366000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5ec7c8a-259a-447b-a3c8-00ee821cbc8d",
          "citation": "SRS import [I7PZF0KTFK]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I7PZF0KTFK",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393366000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a01860d-c363-66f1-fb3d-db34e16d1869",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1185282-01-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e4a02449-0f65-b8f5-61c2-6c8a4e527f5f",
          "citation": "AB-FUBINACA",
          "url": "https://en.wikipedia.org/wiki/AB-FUBINACA",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d66bdb29-170c-4155-a51f-40cc8c3e015d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f7498c5f-ca87-431c-bc41-3635ebd064e4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "737e5b5a-34a5-4504-b07a-6eec6f335d88",
          "citation": "Banister, Samuel D., et al. \"Pharmacology of indole and indazole synthetic cannabinoid designer drugs ab-fubinaca, adb-fubinaca, ab-pinaca, adb-pinaca, 5f-ab-pinaca, 5f-adb-pinaca, adbica, and 5f-adbica.\" ACS chemical neuroscience 6.9 (2015): 1546-1559.",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "f6a8630b-a93c-4005-be26-a3dfd9d9373e",
          "citation": "Banister, Samuel D., et al. \"Pharmacology of indole and indazole synthetic cannabinoid designer drugs ab-fubinaca, adb-fubinaca, ab-pinaca, adb-pinaca, 5f-ab-pinaca, 5f-adb-pinaca, adbica, and 5f-adbica.\" ACS chemical neuroscience 6.9 (2015): 1546-1559.",
          "url": "https://pubs.acs.org/doi/pdf/10.1021/acschemneuro.5b00112",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "3bc4c54c-5be1-4fbb-a15a-86fbc438cbe1",
          "citation": "Synthetic-cannabinoids-in-Europe-EMCDDA-technical-report.pdf 103 / 126 100%",
          "url": "https://www.emcdda.europa.eu/system/files/publications/14035/Synthetic-cannabinoids-in-Europe-EMCDDA-technical-report.pdf",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a61e5615-4d67-b45a-4844-bd4da125eb48",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1ac7879e-44dd-1097-b70e-65e7a46c5531",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ee6fde79-9792-46ea-8a2a-53177a28578d",
          "id": "ee6fde79-9792-46ea-8a2a-53177a28578d",
          "molfile": "\n  Marvin  01132112212D          \n\n 27 29  0  0  1  0            999 V2000\n    8.2399   -9.0579    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.9844   -9.8419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1754  -10.0140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6220   -9.4020    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9199  -10.7982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4078  -11.4659    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9199  -12.1335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1754  -12.9223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9844  -13.0898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5376  -12.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3420  -12.6499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5975  -13.4340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4064  -13.6062    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0442  -14.0460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2399  -13.8785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1357  -11.8780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4205  -12.2948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7050  -11.8780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7050  -11.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4205  -10.6415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1357  -11.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6866   -8.4459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8776   -8.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9421   -7.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0442   -8.8857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5975   -9.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2998   -8.1016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1 22  1  0  0  0  0\n 25  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5 21  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 16  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 15  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 21 16  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  2  0  0  0  0\nM  END",
          "smiles": "CC(C)[C@@H](C(=O)N)NC(=O)c1c2ccccc2n(Cc3ccc(cc3)F)n1",
          "formula": "C20H21FN4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d278f1d9-c4ad-461a-a024-ac31390fc4a4"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "368.4055",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9e5e0203-4c1e-4511-9bf2-923c17b8a454",
      "version": "11",
      "structure": {
        "id": "f01ad569-62ac-4098-87b4-18000e2f668d",
        "molfile": "\n  Marvin  01132112272D          \n\n 27 29  0  0  1  0            999 V2000\n   14.6424   -5.3539    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1304   -4.6862    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6424   -4.0185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8582   -4.2741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1429   -3.8618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4274   -4.2741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4274   -5.0984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1429   -5.5152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8582   -5.0984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8980   -3.2342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3446   -2.6222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7071   -3.0621    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9625   -2.2781    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.7669   -2.1059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0225   -1.3217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3203   -2.7179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4092   -1.6661    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.6001   -1.8382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6647   -0.8819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8980   -6.1428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7071   -6.3103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2603   -5.6983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0647   -5.8703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3203   -6.6545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7669   -7.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9625   -7.0991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1292   -6.8267    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  1  9  1  0  0  0  0\n  4  9  2  0  0  0  0\n  3 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 13 17  1  1  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n  1 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 25 26  1  0  0  0  0\n 21 26  2  0  0  0  0\n 24 27  1  0  0  0  0\nM  END",
        "smiles": "CC(C)[C@@H](C(=O)N)NC(=O)c1c2ccccc2n(Cc3ccc(cc3)F)n1",
        "formula": "C20H21FN4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "368.4055",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "78fa9478-72bf-4904-a1d7-b53942256c37",
          "e5ec7c8a-259a-447b-a3c8-00ee821cbc8d"
        ],
        "stereo_centers": 1
      },
      "unii": "I7PZF0KTFK"
    }
  ]
}