{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "11716769-ffa6-46de-a058-7e68d234661a",
          "code": "B01AA07",
          "comments": "ATC|BLOOD AND BLOOD FORMING ORGANS|ANTITHROMBOTIC AGENTS|ANTITHROMBOTIC AGENTS|Vitamin K antagonists|acenocoumarol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=B01AA07&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "c2bfabce-e79f-4fdf-b87d-55bda1ab780e"
          ]
        },
        {
          "uuid": "fc2cc791-8006-4773-97a4-fd0ea6cbaf46",
          "code": "QB01AA07",
          "comments": "VATC|ANTITHROMBOTIC AGENTS|ANTITHROMBOTIC AGENTS|Vitamin K antagonists|acenocoumarol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QB01AA07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "c2bfabce-e79f-4fdf-b87d-55bda1ab780e"
          ]
        },
        {
          "uuid": "12f8978b-ccc0-4a9b-ab83-5760a858e9c5",
          "code": "152-72-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=152-72-7",
          "code_system": "CAS",
          "references": [
            "c2bfabce-e79f-4fdf-b87d-55bda1ab780e",
            "fa4c8950-6061-4310-b818-da42b5c3571f"
          ]
        },
        {
          "uuid": "4d706b32-84e3-4a5e-b0e6-66d1be4cb300",
          "code": "C75152",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C75152",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c2bfabce-e79f-4fdf-b87d-55bda1ab780e"
          ]
        },
        {
          "uuid": "e5760439-758b-4fb2-b87e-41eb5825dd87",
          "code": "D000074",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68000074",
          "code_system": "MESH",
          "references": [
            "c2bfabce-e79f-4fdf-b87d-55bda1ab780e"
          ]
        },
        {
          "uuid": "110049ba-e3da-4fbf-9f14-c5fbb9998ea9",
          "code": "ACENOCOUMAROL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Acenocoumarol",
          "code_system": "WIKIPEDIA",
          "references": [
            "c2bfabce-e79f-4fdf-b87d-55bda1ab780e"
          ]
        },
        {
          "uuid": "faf007f7-20be-4b42-bbad-2afa41eecc06",
          "code": "SUB05211MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c2bfabce-e79f-4fdf-b87d-55bda1ab780e"
          ]
        },
        {
          "uuid": "e1eb56ed-d5a5-4320-9b33-8e45be30e0fe",
          "code": "503",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=503",
          "code_system": "INN",
          "references": [
            "c2bfabce-e79f-4fdf-b87d-55bda1ab780e"
          ]
        },
        {
          "uuid": "c065d65c-cad0-4100-ac11-0dc51683bda4",
          "code": "205-807-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.281",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c2bfabce-e79f-4fdf-b87d-55bda1ab780e"
          ]
        },
        {
          "uuid": "a1446bdb-abff-4b8e-bfcb-72a7fbb2df67",
          "code": "154",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/154/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c2bfabce-e79f-4fdf-b87d-55bda1ab780e"
          ]
        },
        {
          "uuid": "70b95fe0-d711-4ba9-bf8b-ade809b53072",
          "code": "m1300",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1300?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c2bfabce-e79f-4fdf-b87d-55bda1ab780e"
          ]
        },
        {
          "uuid": "b59c3de4-ebd9-41f2-a6b5-d5a7f494262e",
          "code": "DB01418",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01418",
          "code_system": "DRUG BANK",
          "references": [
            "c2bfabce-e79f-4fdf-b87d-55bda1ab780e"
          ]
        },
        {
          "uuid": "571d1d21-29ca-4e69-9b6b-baa137b17e2e",
          "code": "CHEMBL397420",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL397420",
          "code_system": "ChEMBL",
          "references": [
            "c2bfabce-e79f-4fdf-b87d-55bda1ab780e"
          ]
        },
        {
          "uuid": "8100264a-1502-4fcf-8b44-01b784903d1b",
          "code": "54676537",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/54676537",
          "code_system": "PUBCHEM",
          "references": [
            "c2bfabce-e79f-4fdf-b87d-55bda1ab780e"
          ]
        },
        {
          "uuid": "b3090363-ec75-2318-d213-cbfb4ce4c328",
          "code": "3201",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3201",
          "code_system": "HSDB",
          "references": [
            "cc3cd636-ae7f-ba18-64b8-852ee930c9f9"
          ]
        },
        {
          "uuid": "bb73c15f-6f4c-eaa5-9d41-7528cf196f6d",
          "code": "DTXSID2022541",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2022541",
          "code_system": "EPA CompTox",
          "references": [
            "48f44e0a-2224-e595-94e0-e23f7fd7c604"
          ]
        },
        {
          "uuid": "bfe5bece-bdda-dd72-36fd-a3654e81ae4a",
          "code": "C263",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Anticoagulant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C263",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b817bbf0-2430-8b52-7d0f-5d5944cc157a"
          ]
        },
        {
          "uuid": "4f5de358-f639-4b1f-8e8f-d6f6ab708d08",
          "code": "I6WP63U32H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c8f46b2e-12d6-7a59-9459-e463eab16be2",
          "code": "Acenocoumarol",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM619/",
          "code_system": "LACTMED",
          "references": [
            "b817bbf0-2430-8b52-7d0f-5d5944cc157a"
          ]
        },
        {
          "uuid": "5bc55c60-c02b-c548-4c7b-f86c1df6ff90",
          "code": "48",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/48",
          "code_system": "DRUG CENTRAL",
          "references": [
            "b817bbf0-2430-8b52-7d0f-5d5944cc157a"
          ]
        },
        {
          "uuid": "fb880e9c-7cec-b481-4248-6745e636bb9f",
          "code": "53766",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:53766",
          "code_system": "CHEBI",
          "references": [
            "b817bbf0-2430-8b52-7d0f-5d5944cc157a"
          ]
        },
        {
          "uuid": "f1da4805-204b-403d-908b-1ceb250f5541",
          "code": "100000091427",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9ce98e8e-b363-5d5e-0a24-35a773f6da60"
          ]
        },
        {
          "uuid": "1addce5d-03cd-f96c-dc56-9bb56e3fd773",
          "code": "760052",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=760052",
          "code_system": "NSC",
          "references": [
            "2ed025ff-aae9-87ad-4c4e-01e1c2520951"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3c6dd298-29e6-4d24-997c-ac1ca75ab8a6",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3ad61b50-581a-4ab2-bda2-a0d7c97ec5f5",
            "refuuid": "0d6728b8-072e-46a5-80c1-ef35facda733",
            "name": "ACENOCOUMAROL",
            "unii": "I6WP63U32H",
            "linking_id": "I6WP63U32H",
            "ref_pname": "ACENOCOUMAROL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "149cad5d-7bd7-4c55-b4e8-43979ce85484",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "f3641712-1edb-4381-8fc8-00b32a41b915",
            "refuuid": "d53448d6-89db-4e8b-88e2-435a85af2d59",
            "name": "ACENOCOUMAROL, (R)-",
            "unii": "JRD7912W79",
            "linking_id": "JRD7912W79",
            "ref_pname": "ACENOCOUMAROL, (R)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e0d3e549-c1be-4fdd-8314-589b1b70d7fd",
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "7accb72c-4441-466c-b15a-e15ef0fb2203",
            "refuuid": "4d740889-9720-4cb0-bc8c-f4c6934305ef",
            "name": "ACENOCOUMAROL, (S)-",
            "unii": "4O90VF03HV",
            "linking_id": "4O90VF03HV",
            "ref_pname": "ACENOCOUMAROL, (S)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3cbbd8d9-0095-4261-ad8b-42c76d8ff988",
          "name": "2H-1-BENZOPYRAN-2-ONE, 4-HYDROXY-3-(1-(4-NITROPHENYL)-3-OXOBUTYL)-",
          "stdName": "2H-1-BENZOPYRAN-2-ONE, 4-HYDROXY-3-(1-(4-NITROPHENYL)-3-OXOBUTYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5987e4ac-5c19-43dd-982c-8e4ea6b17ce9"
          ],
          "display_name": false
        },
        {
          "uuid": "3f3c8b92-b480-4b8d-8171-b8cb0c687555",
          "name": "3-(.ALPHA.-ACETONYL-P-NITROBENZYL)-4-HYDROXYCOUMARIN",
          "stdName": "3-(.ALPHA.-ACETONYL-P-NITROBENZYL)-4-HYDROXYCOUMARIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5987e4ac-5c19-43dd-982c-8e4ea6b17ce9"
          ],
          "display_name": false
        },
        {
          "uuid": "c75ac4c1-d9dc-4000-9015-574dfa08bbdb",
          "name": "ACENOCOUMARIN",
          "stdName": "ACENOCOUMARIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e4c9975-e43b-4c75-8907-91b5cb5982f1"
          ],
          "display_name": false
        },
        {
          "uuid": "66d14af8-438f-43ee-94fa-c5ddd2b35663",
          "name": "ACENOCOUMAROL",
          "stdName": "ACENOCOUMAROL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a0120d51-8872-4819-96ee-5638af3f55e8",
            "2fda446a-80d8-489d-8dfc-32df56958618",
            "0a0d8b3d-17cf-4f89-8e37-47b642376ebc",
            "b505becd-4bae-43f9-9dc0-b3a304dbe737",
            "5b5984d3-e92f-47af-bd3a-a3fb301e2df1",
            "9267fa80-5cab-4569-9614-1d98a26d8825",
            "a655e27b-9c82-46e8-bdc2-7eed1783aef0",
            "472726c1-28e0-4e3a-a277-d6f0b16b5e7e",
            "c2a9f64d-a605-4c7f-8781-caa3d8e6cb6e",
            "f455ea61-c423-4b0e-a8b0-3702a5742107",
            "4853bcde-dc5a-458d-bdf8-e33238dce064",
            "56b1349e-16b3-4faa-92b6-d27c3c39248d",
            "9130081a-58ec-4ff1-badf-aa3230243983"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "066d3c3d-43ed-440f-81c0-20f5ae4d9fad",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "55a3d1b7-962c-49a8-b7f4-4966097173bf",
          "name": "ACENOCOUMAROL [HSDB]",
          "stdName": "ACENOCOUMAROL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a0d8b3d-17cf-4f89-8e37-47b642376ebc"
          ],
          "display_name": false
        },
        {
          "uuid": "95f68668-e1f5-4259-bec5-6c7928b7d02e",
          "name": "ACENOCOUMAROL [MART.]",
          "stdName": "ACENOCOUMAROL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2fda446a-80d8-489d-8dfc-32df56958618"
          ],
          "display_name": false
        },
        {
          "uuid": "e264380f-2cf3-42a2-825b-a1f83889111b",
          "name": "ACENOCOUMAROL [MI]",
          "stdName": "ACENOCOUMAROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56b1349e-16b3-4faa-92b6-d27c3c39248d"
          ],
          "display_name": false
        },
        {
          "uuid": "562fdd48-59f8-fbd6-3e9a-e39366bd04e2",
          "name": "Acenocoumarol [WHO-DD]",
          "stdName": "ACENOCOUMAROL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79b45000-e54f-6bae-69db-de0819852045"
          ],
          "display_name": false
        },
        {
          "uuid": "10f12294-80ef-4b50-b754-db2f24bf4c40",
          "name": "MINI-SINTROM",
          "stdName": "MINI-SINTROM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bcf8dff0-8ba1-406e-9301-9642b4da6b95",
            "6d38c898-8132-4fdf-993a-8ebedd06cb22"
          ],
          "display_name": false
        },
        {
          "uuid": "e2d1a814-5fee-470a-ad64-ae22fe53e449",
          "name": "NICOUMALONE",
          "stdName": "NICOUMALONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e4c9975-e43b-4c75-8907-91b5cb5982f1"
          ],
          "display_name": false
        },
        {
          "uuid": "2a0b856f-a837-ac81-d2c2-8140dc11f263",
          "name": "NSC-760052",
          "stdName": "NSC-760052",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ed025ff-aae9-87ad-4c4e-01e1c2520951"
          ],
          "display_name": false
        },
        {
          "uuid": "a4990a3b-740d-49c4-a276-effec20156dc",
          "name": "acenocoumarol [INN]",
          "stdName": "ACENOCOUMAROL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a655e27b-9c82-46e8-bdc2-7eed1783aef0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9130081a-58ec-4ff1-badf-aa3230243983",
          "citation": "USP Dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3e4c9975-e43b-4c75-8907-91b5cb5982f1",
          "citation": "USP DICTIONARY 2014",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5987e4ac-5c19-43dd-982c-8e4ea6b17ce9",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a655e27b-9c82-46e8-bdc2-7eed1783aef0",
          "citation": "INN Proposed List 6",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2fda446a-80d8-489d-8dfc-32df56958618",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56b1349e-16b3-4faa-92b6-d27c3c39248d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bcf8dff0-8ba1-406e-9301-9642b4da6b95",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d38c898-8132-4fdf-993a-8ebedd06cb22",
          "citation": "D07064",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a0d8b3d-17cf-4f89-8e37-47b642376ebc",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "472726c1-28e0-4e3a-a277-d6f0b16b5e7e",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b505becd-4bae-43f9-9dc0-b3a304dbe737",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c2bfabce-e79f-4fdf-b87d-55bda1ab780e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390751000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6134d5ec-68d3-4ece-bd4c-262baad99947",
          "citation": "SRS import [I6WP63U32H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I6WP63U32H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390751000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1bada7b4-1e0d-4625-8a17-11f21aaef926",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b5984d3-e92f-47af-bd3a-a3fb301e2df1",
          "citation": "ACENOCOUMAROL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9267fa80-5cab-4569-9614-1d98a26d8825",
          "citation": "ACENOCOUMAROL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a0120d51-8872-4819-96ee-5638af3f55e8",
          "citation": "ACENOCOUMAROL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c2a9f64d-a605-4c7f-8781-caa3d8e6cb6e",
          "citation": "ACENOCOUMAROL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f455ea61-c423-4b0e-a8b0-3702a5742107",
          "citation": "ACENOCOUMAROL [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4853bcde-dc5a-458d-bdf8-e33238dce064",
          "citation": "ACENOCOUMAROL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cc3cd636-ae7f-ba18-64b8-852ee930c9f9",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+152-72-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "48f44e0a-2224-e595-94e0-e23f7fd7c604",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=152-72-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2c5fe179-ebc2-934f-f423-295749144444",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+152-72-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b817bbf0-2430-8b52-7d0f-5d5944cc157a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fa4c8950-6061-4310-b818-da42b5c3571f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2ed025ff-aae9-87ad-4c4e-01e1c2520951",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e3379e62-29cf-2629-b091-a3480d94d923",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "79b45000-e54f-6bae-69db-de0819852045",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "9ce98e8e-b363-5d5e-0a24-35a773f6da60",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4f7c45ba-ca7f-435f-87ff-62db380a4f9d",
          "id": "4f7c45ba-ca7f-435f-87ff-62db380a4f9d",
          "molfile": "\n  Marvin  01132104092D          \n\n 26 28  0  0  0  0            999 V2000\n    5.6876   -2.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6876   -3.3522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3947   -3.7573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9857   -3.7573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2580   -3.3522    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.2580   -2.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5509   -2.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5509   -1.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2580   -0.8903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9857   -1.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9857   -2.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2580   -0.0645    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.8592    0.4490    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.5509    0.3535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5509   -3.7573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5509   -4.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2580   -5.0038    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8490   -5.0038    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1419   -4.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4245   -5.0038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7148   -4.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7148   -3.7573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4245   -3.3522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1419   -3.7573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8490   -3.3522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8490   -2.5109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 15  1  0  0  0  0\n  7  6  1  0  0  0  0\n 11  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 12  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  2  0  0  0  0\n 16 15  2  0  0  0  0\n 25 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 24 19  2  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 26 25  2  0  0  0  0\nM  CHG  2  12   1  13  -1\nM  END",
          "smiles": "CC(=O)CC(c1ccc(cc1)[N+](=O)[O-])c2c(=O)c3ccccc3oc2O",
          "formula": "C19H15NO6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b0ae90c2-9ec6-44a9-b4b6-0885239b59f0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "353.3262",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0d6728b8-072e-46a5-80c1-ef35facda733",
      "version": "20",
      "structure": {
        "id": "cd95d2eb-685b-4909-82e5-3a5ec8547ce3",
        "molfile": "\n  Marvin  01132110372D          \n\n 26 28  0  0  0  0            999 V2000\n    3.5509   -3.7573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8490   -3.3522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5509   -4.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2580   -3.3522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2580   -0.0645    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    2.8490   -5.0038    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1419   -3.7573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1419   -4.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2580   -0.8903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2580   -2.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8592    0.4490    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.2580   -5.0038    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9857   -3.7573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5509    0.3535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8490   -2.5109    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5509   -1.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9857   -1.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5509   -2.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9857   -2.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6876   -3.3522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3947   -3.7573    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4245   -3.3522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4245   -5.0038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6876   -2.5109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7148   -3.7573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7148   -4.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  9  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9 17  2  0  0  0  0\n  4 10  1  0  0  0  0\n 11  5  1  0  0  0  0\n 12  3  2  0  0  0  0\n 13  4  1  0  0  0  0\n 14  5  2  0  0  0  0\n 15  2  1  0  0  0  0\n 16 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 18 10  1  0  0  0  0\n 19 10  2  0  0  0  0\n 20 13  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22  7  2  0  0  0  0\n 23  8  2  0  0  0  0\n 24 20  1  0  0  0  0\n 25 22  1  0  0  0  0\n 26 23  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 16  1  0  0  0  0\n 25 26  2  0  0  0  0\nM  CHG  2   5   1  11  -1\nM  END",
        "smiles": "CC(=O)CC(c1ccc(cc1)[N+](=O)[O-])c2c(c3ccccc3oc2=O)O",
        "formula": "C19H15NO6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "353.3262",
        "optical_activity": "( + / - )",
        "references": [
          "1bada7b4-1e0d-4625-8a17-11f21aaef926",
          "6134d5ec-68d3-4ece-bd4c-262baad99947",
          "a655e27b-9c82-46e8-bdc2-7eed1783aef0"
        ],
        "stereo_centers": 1
      },
      "unii": "I6WP63U32H"
    }
  ]
}