{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d24b2723-cbf1-4d6e-8d9f-913a3c7a550c",
          "code": "QV04CH03",
          "comments": "VATC|DIAGNOSTIC AGENTS|OTHER DIAGNOSTIC AGENTS|Tests for renal function and ureteral injuries|phenolsulfonphthalein",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QV04CH03&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "52379d14-7c3b-40e6-a796-30ba01fad9bb"
          ]
        },
        {
          "uuid": "3508a7a4-0bb8-4f66-95cd-69adb3a5c082",
          "code": "143-74-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=143-74-8",
          "code_system": "CAS",
          "references": [
            "52379d14-7c3b-40e6-a796-30ba01fad9bb",
            "bc9e6610-115d-4c54-862c-e6973d5ade22"
          ]
        },
        {
          "uuid": "d2a752f0-386b-4bb6-8601-42988e5f0653",
          "code": "C76641",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76641",
          "code_system": "NCI_THESAURUS",
          "references": [
            "52379d14-7c3b-40e6-a796-30ba01fad9bb"
          ]
        },
        {
          "uuid": "2f0b6f0e-fdfa-4422-998d-1881a8f5cb9d",
          "code": "D010637",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68010637",
          "code_system": "MESH",
          "references": [
            "52379d14-7c3b-40e6-a796-30ba01fad9bb"
          ]
        },
        {
          "uuid": "3e3df4b2-4c13-44cc-885b-7732c1b189d2",
          "code": "PHENOL RED",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Phenol_red",
          "code_system": "WIKIPEDIA",
          "references": [
            "52379d14-7c3b-40e6-a796-30ba01fad9bb"
          ]
        },
        {
          "uuid": "6a89a99f-3377-4757-a5bc-1e464225bd28",
          "code": "V04CH03",
          "comments": "ATC|VARIOUS|DIAGNOSTIC AGENTS|OTHER DIAGNOSTIC AGENTS|Tests for renal function and ureteral injuries|phenolsulfonphthalein",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=V04CH03&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "52379d14-7c3b-40e6-a796-30ba01fad9bb"
          ]
        },
        {
          "uuid": "583bc72e-a2f3-4f15-bf98-eb3dffd10172",
          "code": "8141",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/8141/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "52379d14-7c3b-40e6-a796-30ba01fad9bb"
          ]
        },
        {
          "uuid": "5c209b42-a380-401e-987a-d7503fd09b4e",
          "code": "m8630",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8630?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "52379d14-7c3b-40e6-a796-30ba01fad9bb"
          ]
        },
        {
          "uuid": "b062ca17-e1cb-4028-aaf0-fc7cff154ef7",
          "code": "CHEMBL258921",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL258921",
          "code_system": "ChEMBL",
          "references": [
            "52379d14-7c3b-40e6-a796-30ba01fad9bb"
          ]
        },
        {
          "uuid": "850719e9-6ed8-4961-b18a-30ae7db12b6a",
          "code": "SUB14835MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "52379d14-7c3b-40e6-a796-30ba01fad9bb"
          ]
        },
        {
          "uuid": "f64c72d7-f597-4f7e-8dd5-9fd64a891dd1",
          "code": "205-609-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.100",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "52379d14-7c3b-40e6-a796-30ba01fad9bb"
          ]
        },
        {
          "uuid": "7dd8b488-03be-48cf-80e5-5d858e45b326",
          "code": "4766",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4766",
          "code_system": "PUBCHEM",
          "references": [
            "52379d14-7c3b-40e6-a796-30ba01fad9bb"
          ]
        },
        {
          "uuid": "d231382f-7789-23a5-5db9-019d407be8d8",
          "code": "DTXSID8022408",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8022408",
          "code_system": "EPA CompTox",
          "references": [
            "dd7a194b-7ed5-cc66-d5cc-cb0975633ff5"
          ]
        },
        {
          "uuid": "7c9fdab7-9011-91de-f909-e8d57f678d64",
          "code": "C1937",
          "comments": "Industrial Aid[C45678]|Reagent[C802]|Diagnostic Reagent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1937",
          "code_system": "NCI_THESAURUS",
          "references": [
            "fc3921fe-382e-c866-eeb7-eb9256694004"
          ]
        },
        {
          "uuid": "d20dd21d-590d-379b-248f-722acc7164b6",
          "code": "DB13212",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13212",
          "code_system": "DRUG BANK",
          "references": [
            "fc3921fe-382e-c866-eeb7-eb9256694004"
          ]
        },
        {
          "uuid": "6168f64c-d259-4c6d-8109-18f6090d7909",
          "code": "I6G9Y0J1OJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b3f197cb-f8a7-f5dc-67f0-98117010a6b4",
          "code": "3439",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3439",
          "code_system": "DRUG CENTRAL",
          "references": [
            "fc3921fe-382e-c866-eeb7-eb9256694004"
          ]
        },
        {
          "uuid": "b55fa0fd-ef90-cb78-74b6-aee068a4a3b2",
          "code": "31991",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:31991",
          "code_system": "CHEBI",
          "references": [
            "fc3921fe-382e-c866-eeb7-eb9256694004"
          ]
        },
        {
          "uuid": "3d72b694-002e-25d4-98b6-87aded3a3682",
          "code": "I6G9Y0J1OJ",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=I6G9Y0J1OJ",
          "code_system": "DAILYMED",
          "references": [
            "f3e73726-c5ce-5e26-94d9-df4b9efb9bc2"
          ]
        },
        {
          "uuid": "f9be7efd-df7e-bc4f-87b3-feff95b19ab7",
          "code": "100000092523",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a9d72028-5418-01f3-0d1e-ac72e08ede71"
          ]
        },
        {
          "uuid": "d38a77f0-7e67-c9fa-50e3-de5406909dad",
          "code": "10459",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=10459",
          "code_system": "NSC",
          "references": [
            "dc4f6f47-b33d-678c-54b3-a45799369315"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5d118d17-a08f-4359-8183-a313b6f33760",
          "name": "3,3-BIS(4-HYDROXYPHENYL)-3H-2,1-BENZOXATHIOLE 1,1-DIOXIDE",
          "stdName": "3,3-BIS(4-HYDROXYPHENYL)-3H-2,1-BENZOXATHIOLE 1,1-DIOXIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d57c1b4e-c53e-432b-a876-0aa51866a968"
          ],
          "display_name": false
        },
        {
          "uuid": "54eaf3d9-22a5-4982-ace8-e2e86b1a938d",
          "name": "NSC-10459",
          "stdName": "NSC-10459",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f18423fe-eb5c-410c-9bb4-dccf0badfe74",
            "affb6d24-0620-42cf-8fbe-6e5c4089d2ad"
          ],
          "display_name": false
        },
        {
          "uuid": "b0e488eb-87cf-452d-8975-35ade100c380",
          "name": "PHENOL RED",
          "stdName": "PHENOL RED",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d57c1b4e-c53e-432b-a876-0aa51866a968"
          ],
          "display_name": false
        },
        {
          "uuid": "213ebab1-ddff-4333-b90e-b6ad0a34d4c4",
          "name": "PHENOL, 4,4'-(3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS-, (S,S-DIOXIDE)",
          "stdName": "PHENOL, 4,4'-(3H-2,1-BENZOXATHIOL-3-YLIDENE)BIS-, (S,S-DIOXIDE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "baedb420-aec5-40dc-855a-ec50941f3672"
          ],
          "display_name": false
        },
        {
          "uuid": "126f8504-99e8-43f5-94b8-019e19069461",
          "name": "PHENOLSULFONPHTHALEIN",
          "stdName": "PHENOLSULFONPHTHALEIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5078925-711d-4441-acd8-771cb4f94549",
            "3945b558-273d-46d9-bab7-6c89b63e880c",
            "781dc9b9-c151-4286-b03f-58bc80c816e6",
            "8f2e905e-c27b-4a26-939a-faed0c26fdc7",
            "7b6eff0b-05e7-48d2-ada8-b384bd87ca77",
            "473a3f25-d8ae-4630-b21c-1c7ecf63b448",
            "bd407619-d6ab-47bd-89e6-ebde3e09d981",
            "ccf24fe7-3b8c-435b-8492-e72acd5b5645",
            "08b98902-1b84-4c48-b07c-65901dfac341",
            "40ee79f3-cd97-474b-a4c8-d5d0b7794e97",
            "b1778338-e751-4171-8fce-839c9a3490ac",
            "affb6d24-0620-42cf-8fbe-6e5c4089d2ad",
            "1870661c-f125-4944-8b6a-f5bdd8020776",
            "677b8964-5b55-4e1c-bee1-70f829016830"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b90d0c1d-1820-4015-bbce-e777d0840161",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1c4ed25b-8296-9000-e896-467f7338a384",
          "name": "PHENOLSULFONPHTHALEIN [EP MONOGRAPH]",
          "stdName": "PHENOLSULFONPHTHALEIN [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f19185e1-bfd0-c931-1843-dd6aedf83fff"
          ],
          "display_name": false
        },
        {
          "uuid": "7a2f04a8-eb4e-4675-9a77-d0a8aa8a6a45",
          "name": "PHENOLSULFONPHTHALEIN [JAN]",
          "stdName": "PHENOLSULFONPHTHALEIN [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbe75ac8-62ab-8c44-c781-b56b8230e267"
          ],
          "display_name": false
        },
        {
          "uuid": "41e70827-8e38-46f1-894d-44338c43bff7",
          "name": "PHENOLSULFONPHTHALEIN [MART.]",
          "stdName": "PHENOLSULFONPHTHALEIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40ee79f3-cd97-474b-a4c8-d5d0b7794e97"
          ],
          "display_name": false
        },
        {
          "uuid": "075d3c79-ae09-427d-a214-b08e05df0d4c",
          "name": "PHENOLSULFONPHTHALEIN [MI]",
          "stdName": "PHENOLSULFONPHTHALEIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bd407619-d6ab-47bd-89e6-ebde3e09d981",
            "affb6d24-0620-42cf-8fbe-6e5c4089d2ad"
          ],
          "display_name": false
        },
        {
          "uuid": "bb273f37-a3a9-4b9e-ab9d-b6df3d623944",
          "name": "PHENOLSULFONPHTHALEIN [VANDF]",
          "stdName": "PHENOLSULFONPHTHALEIN [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1870661c-f125-4944-8b6a-f5bdd8020776",
            "affb6d24-0620-42cf-8fbe-6e5c4089d2ad"
          ],
          "display_name": false
        },
        {
          "uuid": "37a91b50-2094-8659-2cbb-3a77129893a0",
          "name": "Phenolsulfonphthalein [WHO-DD]",
          "stdName": "PHENOLSULFONPHTHALEIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af358a9c-5685-19df-0df7-d2f1e471a1df"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a5078925-711d-4441-acd8-771cb4f94549",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d57c1b4e-c53e-432b-a876-0aa51866a968",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "baedb420-aec5-40dc-855a-ec50941f3672",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "781dc9b9-c151-4286-b03f-58bc80c816e6",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40ee79f3-cd97-474b-a4c8-d5d0b7794e97",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bd407619-d6ab-47bd-89e6-ebde3e09d981",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "affb6d24-0620-42cf-8fbe-6e5c4089d2ad",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3945b558-273d-46d9-bab7-6c89b63e880c",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "473a3f25-d8ae-4630-b21c-1c7ecf63b448",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1870661c-f125-4944-8b6a-f5bdd8020776",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f18423fe-eb5c-410c-9bb4-dccf0badfe74",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52379d14-7c3b-40e6-a796-30ba01fad9bb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389655000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "892d6d2b-e3d9-4ec3-993d-4d5bd9423a7d",
          "citation": "SRS import [I6G9Y0J1OJ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I6G9Y0J1OJ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389655000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ccf24fe7-3b8c-435b-8492-e72acd5b5645",
          "citation": "PHENOLSULFONPHTHALEIN [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8f2e905e-c27b-4a26-939a-faed0c26fdc7",
          "citation": "PHENOLSULFONPHTHALEIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7b6eff0b-05e7-48d2-ada8-b384bd87ca77",
          "citation": "PHENOLSULFONPHTHALEIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "677b8964-5b55-4e1c-bee1-70f829016830",
          "citation": "PHENOLSULFONPHTHALEIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b1778338-e751-4171-8fce-839c9a3490ac",
          "citation": "PHENOLSULFONPHTHALEIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "08b98902-1b84-4c48-b07c-65901dfac341",
          "citation": "PHENOLSULFONPHTHALEIN [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cbe75ac8-62ab-8c44-c781-b56b8230e267",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dd7a194b-7ed5-cc66-d5cc-cb0975633ff5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=143-74-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fc3921fe-382e-c866-eeb7-eb9256694004",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "bc9e6610-115d-4c54-862c-e6973d5ade22",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f19185e1-bfd0-c931-1843-dd6aedf83fff",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "dc4f6f47-b33d-678c-54b3-a45799369315",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f3e73726-c5ce-5e26-94d9-df4b9efb9bc2",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "af358a9c-5685-19df-0df7-d2f1e471a1df",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a9d72028-5418-01f3-0d1e-ac72e08ede71",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ba2eff0f-3dca-4965-be1e-47d1df2d3b15",
          "id": "ba2eff0f-3dca-4965-be1e-47d1df2d3b15",
          "molfile": "\n  Marvin  01132109382D          \n\n 25 28  0  0  0  0            999 V2000\n    4.2141   -5.1127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8850   -4.3509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0486   -4.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7299   -3.5145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1958   -2.8517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0172   -2.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3613   -3.6907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8699   -2.1003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3724   -1.4297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8699   -0.7613    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1958    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1392   -0.3420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6467   -1.0022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3691   -0.5985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0816   -1.0022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0816   -1.8339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3691   -2.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6467   -1.8339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1703   -2.5123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1703   -3.3357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4401   -3.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7302   -3.3357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.7529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7302   -2.5252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4401   -2.1003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  7  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n 18  8  1  0  0  0  0\n 19  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 10  2  0  0  0  0\n 13 10  1  0  0  0  0\n 14 13  1  0  0  0  0\n 18 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 25 19  2  0  0  0  0\n 21 20  2  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 22 24  2  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)C(c3ccc(cc3)O)(c4ccc(cc4)O)OS2(=O)=O",
          "formula": "C19H14O5S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3debe52c-affe-4de7-a692-4261bceb2245"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "354.3783",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "baeff7f0-b043-45e2-adf3-9e884391d47f",
      "version": "16",
      "structure": {
        "id": "adf9af2c-4390-453d-8e2e-1da0e727fa45",
        "molfile": "\n  Marvin  01132109022D          \n\n 25 28  0  0  0  0            999 V2000\n    2.8701   -0.7614    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3726   -1.4298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8701   -2.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6470   -1.8340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6470   -1.0023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1961    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1394   -0.3420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1705   -2.5125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1961   -2.8519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1705   -3.3360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4402   -2.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7301   -3.5148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0175   -2.9296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3695   -2.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8853   -4.3513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7303   -3.3360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0488   -4.2688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4402   -3.7532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3617   -3.6910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7303   -2.5254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3695   -0.5985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2144   -5.1131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.7532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0820   -1.8340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0820   -1.0023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  1  2  0  0  0  0\n  7  1  2  0  0  0  0\n  8  3  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  8  2  0  0  0  0\n 12  9  2  0  0  0  0\n 13  9  1  0  0  0  0\n 14  4  1  0  0  0  0\n 15 19  1  0  0  0  0\n 16 20  2  0  0  0  0\n 17 12  1  0  0  0  0\n 18 10  2  0  0  0  0\n 19 13  2  0  0  0  0\n 20 11  1  0  0  0  0\n 21  5  1  0  0  0  0\n 22 15  1  0  0  0  0\n 23 16  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 21  2  0  0  0  0\n  4  3  1  0  0  0  0\n 24 14  2  0  0  0  0\n 15 17  2  0  0  0  0\n 18 16  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)C(c3ccc(cc3)O)(c4ccc(cc4)O)OS2(=O)=O",
        "formula": "C19H14O5S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "354.3783",
        "optical_activity": "NONE",
        "references": [
          "a5078925-711d-4441-acd8-771cb4f94549",
          "892d6d2b-e3d9-4ec3-993d-4d5bd9423a7d"
        ],
        "stereo_centers": 0
      },
      "unii": "I6G9Y0J1OJ"
    }
  ]
}