{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "80da6ba1-39ba-4644-a789-6436429559f0", "code": "QA02AB06", "comments": "VATC|DRUGS FOR ACID RELATED DISORDERS|ANTACIDS|Aluminium compounds|aloglutamol", "type": "PRIMARY", "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA02AB06&showdescription=yes", "code_system": "WHO-VATC", "references": [ "669c5017-c204-4125-bb15-d378b024a661" ] }, { "uuid": "98b28615-b175-42f1-b1e5-b6d9ef8e30e3", "code": "13755-41-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=13755-41-4", "code_system": "CAS", "references": [ "669c5017-c204-4125-bb15-d378b024a661", "9718770c-b9c2-4579-999f-b531508dfeef" ] }, { "uuid": "bc419e91-4681-4c23-a855-0071ad7f0389", "code": "A02AB06", "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|DRUGS FOR ACID RELATED DISORDERS|ANTACIDS|Aluminium compounds|aloglutamol", "type": "PRIMARY", "code_system": "WHO-ATC", "references": [ "669c5017-c204-4125-bb15-d378b024a661" ] }, { "uuid": "1573ae39-225a-49bc-a26b-bf94471a9e4b", "code": "17392", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/17392/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "669c5017-c204-4125-bb15-d378b024a661" ] }, { "uuid": "a631fd01-ed75-4590-8c16-62fe68bf2b2f", "code": "SUB12794MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "669c5017-c204-4125-bb15-d378b024a661" ] }, { "uuid": "b6386c4e-c30e-4b22-80c6-d0029ce325c2", "code": "CHEMBL3707300", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL3707300", "code_system": "ChEMBL", "references": [ "669c5017-c204-4125-bb15-d378b024a661" ] }, { "uuid": "591e5674-3354-4f10-88a7-1ff3d34706df", "code": "72941505", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72941505", "code_system": "PUBCHEM", "references": [ "669c5017-c204-4125-bb15-d378b024a661" ] }, { "uuid": "6dd83c27-8331-b98f-56bc-a55a425bc21c", "code": "Aloglutamol", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Aloglutamol", "code_system": "WIKIPEDIA", "references": [ "ff8ad63e-3ab8-64a0-09a7-531f411ce061" ] }, { "uuid": "f12c5292-3b8b-6cca-008f-ecfc87076aa7", "code": "4759", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/4759", "code_system": "DRUG CENTRAL", "references": [ "53246f3a-b906-cdbf-e09d-e3e867ecd0b9" ] }, { "uuid": "652a2219-4524-14aa-c9a4-088d9128c887", "code": "DB13650", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB13650", "code_system": "DRUG BANK", "references": [ "53246f3a-b906-cdbf-e09d-e3e867ecd0b9" ] }, { "uuid": "5dda7b5b-9d3a-46fa-b1db-562f32a27125", "code": "I670EI8M2N", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "1fa89019-5691-ae62-620c-e24836e8f835", "code": "DTXSID601027584", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID601027584", "code_system": "EPA CompTox", "references": [ "53246f3a-b906-cdbf-e09d-e3e867ecd0b9" ] }, { "uuid": "f731d503-e5b3-c14d-752a-402f9bf2490b", "code": "100000078208", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "229bd623-e4bc-5c08-c227-7e81c4e1be46" ] } ], "relationships": [ { "uuid": "a3444547-766a-49a3-878b-7168fb8dc907", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "9b805812-1503-4bae-b8e1-dc41dc5783c2", "refuuid": "9018b025-0038-4bfe-b1e0-8616734a4b97", "name": "DIHYDROXYALUMINUM GLUCONATE", "unii": "5G1JDI469J", "linking_id": "5G1JDI469J", "ref_pname": "DIHYDROXYALUMINUM GLUCONATE", "substance_class": "reference" } }, { "uuid": "b24ce548-ed01-433b-b514-3ee8cdc316e0", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "b3ef23bc-59d8-40f9-920a-245329ccc76d", "refuuid": "9018b025-0038-4bfe-b1e0-8616734a4b97", "name": "DIHYDROXYALUMINUM GLUCONATE", "unii": "5G1JDI469J", "linking_id": "5G1JDI469J", "ref_pname": "DIHYDROXYALUMINUM GLUCONATE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "b648b29a-ca9c-421a-95d4-633a4b2b36e7", "name": "ALOGLUTAMOL", "stdName": "ALOGLUTAMOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "af11c28e-7bab-407e-a424-3d09676df85d", "2e34787b-b61a-42f3-8db5-d599b75c2d6b", "66dadfc0-6b81-43cd-9976-467463d8936e" ], "display_name": true }, { "uuid": "0e45c3ed-89e1-41e9-bc57-a74b41a1f242", "name": "ALTRIS", "stdName": "ALTRIS", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "66dadfc0-6b81-43cd-9976-467463d8936e" ], "display_name": false }, { "uuid": "3955cc51-ace1-05e9-8dd3-d1c31f2fff85", "name": "Aloglutamol [WHO-DD]", "stdName": "ALOGLUTAMOL [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "60c60b9c-83f7-f5a0-8aa9-f2bf53b218c0" ], "display_name": false }, { "uuid": "024500c5-cb33-46ad-9400-a71bb2ffcf71", "name": "DIHYDROXYALUMINUM GLUCONATE, TRIS(HYDROXYMETHYL)AMINOMETHANE (1:1)", "stdName": "DIHYDROXYALUMINUM GLUCONATE, TRIS(HYDROXYMETHYL)AMINOMETHANE (1:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "aba77fd8-0eba-4a83-b138-46d3c450061f" ], "display_name": false }, { "uuid": "c27ce197-55c4-4f2e-803e-f3c9bf7b0701", "name": "PYRESES", "stdName": "PYRESES", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "66dadfc0-6b81-43cd-9976-467463d8936e" ], "display_name": false }, { "uuid": "64b5bc17-0874-4e8e-a16c-322b708761c0", "name": "SABRO", "stdName": "SABRO", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "66dadfc0-6b81-43cd-9976-467463d8936e" ], "display_name": false }, { "uuid": "aa5040be-f9b8-4100-80f5-3f99b05fe239", "name": "TASTO", "stdName": "TASTO", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "66dadfc0-6b81-43cd-9976-467463d8936e" ], "display_name": false } ], "references": [ { "uuid": "66dadfc0-6b81-43cd-9976-467463d8936e", "citation": "http://en.wikipedia.org/wiki/Aloglutamol", "url": "http://en.wikipedia.org/wiki/Aloglutamol", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "aba77fd8-0eba-4a83-b138-46d3c450061f", "citation": "WIKIPEDIA", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "af11c28e-7bab-407e-a424-3d09676df85d", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "669c5017-c204-4125-bb15-d378b024a661", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392282000, "tags": [ "NOMEN" ] }, { "uuid": "c13d9961-30c9-4f74-af27-89c5d1446c56", "citation": "SRS import [I670EI8M2N]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I670EI8M2N", "doc_type": "SRS", "public_domain": true, "document_date": 1493392282000, "tags": [ "NOMEN" ] }, { "uuid": "2e34787b-b61a-42f3-8db5-d599b75c2d6b", "citation": "ALOGLUTAMOL [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "ff8ad63e-3ab8-64a0-09a7-531f411ce061", "citation": "WIKI", "url": "https://en.wikipedia.org/wiki/Aloglutamol", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "53246f3a-b906-cdbf-e09d-e3e867ecd0b9", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "9718770c-b9c2-4579-999f-b531508dfeef", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "60c60b9c-83f7-f5a0-8aa9-f2bf53b218c0", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "229bd623-e4bc-5c08-c227-7e81c4e1be46", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "53ef31bb-9d82-45db-9a4c-5064e6cfe93b", "id": "53ef31bb-9d82-45db-9a4c-5064e6cfe93b", "molfile": "\n Marvin 01132104222D \n\n 1 0 0 0 1 0 999 V2000\n 12.3291 -4.0544 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 -1\nM END", "smiles": "[OH-]", "formula": "HO", "atropisomerism": "No", "charge": -1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "928773fc-6067-4d22-86b4-baddbcb4c513" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "17.0073", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "757c620b-ed88-4158-b400-9077a226bf37", "id": "757c620b-ed88-4158-b400-9077a226bf37", "molfile": "\n Marvin 01132106062D \n\n 1 0 0 0 1 0 999 V2000\n 11.0495 -2.2027 0.0000 Al 0 1 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 3\nM END", "smiles": "[Al+3]", "formula": "Al", "atropisomerism": "No", "charge": 3, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4aa5f473-511f-42ff-9371-467f9fe92aa3" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "26.9815", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "98af14de-2be6-4895-a6a1-044c71dcee4e", "id": "98af14de-2be6-4895-a6a1-044c71dcee4e", "molfile": "\n Marvin 01132107562D \n\n 8 7 0 0 1 0 999 V2000\n 2.5523 -1.9605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5523 -3.3529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4245 -4.3682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0925 -4.9016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3433 -3.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0065 -3.7486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8892 -3.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0982 -3.3112 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 5 1 0 0 0 0\n 7 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 8 7 1 0 0 0 0\nM CHG 1 8 -1\nM END", "smiles": "C(C(CO)(C[O-])N)O", "formula": "C4H10NO3", "atropisomerism": "No", "charge": -1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "40bb175b-f1cd-45fa-8c73-f3e3352f0e8a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "120.1273", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "69e9008e-a6cf-4f74-950c-73489dc1efbb", "id": "69e9008e-a6cf-4f74-950c-73489dc1efbb", "molfile": "\n Marvin 01132105302D \n\n 13 12 0 0 1 0 999 V2000\n 7.3200 -4.1574 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.3200 -4.9824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6073 -3.7472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8901 -4.1574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0325 -3.7471 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.0325 -2.9221 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7497 -4.1574 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 8.7497 -4.9824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4621 -3.7471 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 9.4621 -2.9221 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1794 -4.1574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8921 -3.7471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1794 -4.9824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 5 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 6 1 1 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 1 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 1 0 0 0\n 9 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 11 2 0 0 0 0\nM END", "smiles": "C([C@H]([C@H]([C@@H]([C@H](C(=O)O)O)O)O)O)O", "formula": "C6H12O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b7a156ca-ee9b-40de-8dda-12aff1900b3b" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "196.1555", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "f0e4149b-6bf7-456c-a58a-6a6bc380b9f6", "version": "12", "structure": { "id": "9cb869fd-9eea-4f00-a257-255a14b8e3e1", "molfile": "\n Marvin 01132108092D \n\n 24 19 0 0 1 0 999 V2000\n 1.0684 -3.2214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8380 -2.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4831 -3.2620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3587 -4.2497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0086 -4.7686 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2526 -3.1328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8978 -3.6469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4831 -1.9073 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0495 -2.2027 0.0000 Al 0 1 0 0 0 0 0 0 0 0 0 0\n 9.4759 -3.7526 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.7624 -4.1634 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.0442 -3.7526 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.3306 -4.1634 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.6169 -3.7527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8987 -4.1634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3306 -4.9896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0442 -2.9264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7624 -4.9896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4759 -2.9264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1942 -4.1634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9079 -3.7526 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 10.1942 -4.9896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3291 -4.0544 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 12.3291 -4.0544 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 3 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 3 8 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 13 16 1 6 0 0 0\n 12 17 1 1 0 0 0\n 11 18 1 1 0 0 0\n 10 19 1 1 0 0 0\n 20 10 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 20 2 0 0 0 0\n 1 2 1 0 0 0 0\nM CHG 4 9 3 21 -1 23 -1 24 -1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 2 23 24\nM SPA 1 1 23\nM SDI 1 4 11.9091 -4.4744 11.9091 -3.6344\nM SDI 1 4 12.7491 -3.6344 12.7491 -4.4744\nM SMT 1 2\nM END", "smiles": "C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.C(C(CO)(CO)N)O.[Al+3].[OH-].[OH-]", "formula": "C6H11O7.C4H11NO3.Al.2HO", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "377.279", "optical_activity": "UNSPECIFIED", "references": [ "aba77fd8-0eba-4a83-b138-46d3c450061f", "c13d9961-30c9-4f74-af27-89c5d1446c56" ], "stereo_centers": 4 }, "unii": "I670EI8M2N" } ] }