{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1ac31031-35c7-4c55-b0d5-fde7f4f6f566",
          "code": "369-77-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=369-77-7",
          "code_system": "CAS",
          "references": [
            "ed049e95-25ca-4a38-8f4c-f6b96b472948",
            "e4a56cc5-000e-4700-b76c-f0def895a937"
          ]
        },
        {
          "uuid": "3a2d780a-a2e4-4702-b51c-f4d4a4353446",
          "code": "C47457",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47457",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ed049e95-25ca-4a38-8f4c-f6b96b472948"
          ]
        },
        {
          "uuid": "4a662924-0e5d-4530-9a56-030b87d872e9",
          "code": "C005055",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005055",
          "code_system": "MESH",
          "references": [
            "ed049e95-25ca-4a38-8f4c-f6b96b472948"
          ]
        },
        {
          "uuid": "246685dc-ea99-4892-86c1-e0be813e6ba9",
          "code": "SUB07996MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "ed049e95-25ca-4a38-8f4c-f6b96b472948"
          ]
        },
        {
          "uuid": "4f1f4ddc-0a39-4fa2-85ab-9d73a3c49657",
          "code": "2128",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2128",
          "code_system": "INN",
          "references": [
            "ed049e95-25ca-4a38-8f4c-f6b96b472948"
          ]
        },
        {
          "uuid": "73f69220-b5f5-48f4-8f02-c118ef399b99",
          "code": "m3642",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3642?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ed049e95-25ca-4a38-8f4c-f6b96b472948"
          ]
        },
        {
          "uuid": "3afcc942-2cac-4d0d-af03-a93522bb4c23",
          "code": "CHEMBL1981438",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1981438",
          "code_system": "ChEMBL",
          "references": [
            "ed049e95-25ca-4a38-8f4c-f6b96b472948"
          ]
        },
        {
          "uuid": "153a592d-d126-4481-bad7-28b7e3759abe",
          "code": "206-724-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.113",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ed049e95-25ca-4a38-8f4c-f6b96b472948"
          ]
        },
        {
          "uuid": "99bbc84a-2ad8-4c02-a736-1fd0338f4170",
          "code": "9719",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9719",
          "code_system": "PUBCHEM",
          "references": [
            "ed049e95-25ca-4a38-8f4c-f6b96b472948"
          ]
        },
        {
          "uuid": "715accee-bc39-afac-5285-b631a76ddc64",
          "code": "DTXSID0048684",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0048684",
          "code_system": "EPA CompTox",
          "references": [
            "ec2786ba-d8b4-831c-44d9-7c64db2101e3"
          ]
        },
        {
          "uuid": "0a7be4a9-c657-8dfa-bd0e-34c0ff9f6d77",
          "code": "C28394",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Topical Anti-Infective Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28394",
          "code_system": "NCI_THESAURUS",
          "references": [
            "cbe95fe1-79bd-29f7-0856-e637850a74dc"
          ]
        },
        {
          "uuid": "6660eab2-08f7-42a7-b9e4-bda2e8620813",
          "code": "I5ZZY3DC5G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "23449fb6-cbf1-a738-ac78-ab1bbf02a311",
          "code": "3108",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3108",
          "code_system": "DRUG CENTRAL",
          "references": [
            "cbe95fe1-79bd-29f7-0856-e637850a74dc"
          ]
        },
        {
          "uuid": "ea7fde8f-1448-d87e-4239-24f5ed8b7a7f",
          "code": "135477",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:135477",
          "code_system": "CHEBI",
          "references": [
            "cbe95fe1-79bd-29f7-0856-e637850a74dc"
          ]
        },
        {
          "uuid": "87411f2e-81ca-3ebb-2fe8-082d6667ceb3",
          "code": "Halocarban",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Halocarban",
          "code_system": "WIKIPEDIA",
          "references": [
            "dfb35765-d773-e3d9-1bec-3d49ddc4f6e6"
          ]
        },
        {
          "uuid": "9069ec70-e050-d1b4-70d2-f8ef8b431c4d",
          "code": "114133",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=114133",
          "code_system": "NSC",
          "references": [
            "e95d40b0-b742-b972-dbe0-159c6bcf3dff"
          ]
        },
        {
          "uuid": "416c878a-31ab-6c7f-79a4-d3967f2d5168",
          "code": "100000084479",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c935ba67-9474-45ac-2fa9-c65b0f8bb5dd"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "5c269c14-4c8d-4b92-ad7a-5c01f0132106",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "9163cf75-cef1-4bc4-b062-78fc0a11dde1",
            "refuuid": "b7c2ee49-74e0-4980-a42f-b321ec043702",
            "name": "CLOFLUCARBAN",
            "unii": "I5ZZY3DC5G",
            "linking_id": "I5ZZY3DC5G",
            "ref_pname": "CLOFLUCARBAN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "be8d0d0e-0b4c-4e26-96ac-c4d526d15634",
          "name": "4,4'-DICHLORO-3-(TRIFLUOROMETHYL)CARBANILIDE",
          "stdName": "4,4'-DICHLORO-3-(TRIFLUOROMETHYL)CARBANILIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46222817-033d-48cb-a845-33a31517198f"
          ],
          "display_name": false
        },
        {
          "uuid": "8c9b8771-eb85-4dad-8656-c3fbafa14c31",
          "name": "CLOFLUCARBAN",
          "stdName": "CLOFLUCARBAN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "654e6297-6bed-4433-96dc-8db313ac57c2",
            "edec7be7-1686-4c03-bd8a-f2904ecf1632",
            "3c3dced1-b10a-4323-9ce5-a39f774ef7aa",
            "98545d40-fa6d-4bdf-adc9-108333388f28",
            "466f9eef-c798-4671-a560-890ebb505ee8",
            "3da3cdfb-9c8d-48e4-8ed9-f00d54a48896",
            "8c25a135-d43e-4dfc-8e6c-d1271644a791"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4442c9c7-ed5d-4f9b-958e-586599a7f039",
              "name_org": "USAN"
            },
            {
              "uuid": "f67ff4bb-a10c-4942-9a48-33a677704821",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1d6577fc-3d40-4375-be3e-a69d4fd2f620",
          "name": "CLOFLUCARBAN [MI]",
          "stdName": "CLOFLUCARBAN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "654e6297-6bed-4433-96dc-8db313ac57c2"
          ],
          "display_name": false
        },
        {
          "uuid": "bae7ee74-2359-43b9-8343-5978485f3501",
          "name": "CLOFLUCARBAN [USAN]",
          "stdName": "CLOFLUCARBAN [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3da3cdfb-9c8d-48e4-8ed9-f00d54a48896"
          ],
          "display_name": false
        },
        {
          "uuid": "785eed69-e456-4f22-acaf-438b1fc9ec96",
          "name": "HALOCARBAN",
          "stdName": "HALOCARBAN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "111ab147-1b54-47ad-b3ab-ef60bf513543",
            "8202b14f-ecb4-40d9-9c5a-b66df585c302",
            "7606e88a-c51e-4355-8664-4e51e569cc5b",
            "a32feb1e-71dc-45ce-ae01-ff0a55092c1a",
            "7a564905-4758-401f-8697-a02e0c47e1fb"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "17fb35c8-94d3-4656-bc6b-98be21710e6d",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "f51f127f-5e2d-17c4-2df0-eff818709f1c",
          "name": "Halocarban [WHO-DD]",
          "stdName": "HALOCARBAN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18481994-2a5d-b430-9382-46bf12172e02"
          ],
          "display_name": false
        },
        {
          "uuid": "cd880f60-504d-4e6b-a3cb-021fd9593e2a",
          "name": "NSC-114133",
          "stdName": "NSC-114133",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a7f2590-4ede-4cdd-a744-115fa0709a3f"
          ],
          "display_name": false
        },
        {
          "uuid": "80d2f417-9bb5-44a6-b52a-b17c5001e560",
          "name": "UREA, N-(4-CHLOROPHENYL)-N'-(4-CHLORO-3-(TRIFLUOROMETHYL)PHENYL)-",
          "stdName": "UREA, N-(4-CHLOROPHENYL)-N'-(4-CHLORO-3-(TRIFLUOROMETHYL)PHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46222817-033d-48cb-a845-33a31517198f"
          ],
          "display_name": false
        },
        {
          "uuid": "12570309-1081-407c-9f59-cf5da493945e",
          "name": "halocarban [INN]",
          "stdName": "HALOCARBAN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a564905-4758-401f-8697-a02e0c47e1fb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3c3dced1-b10a-4323-9ce5-a39f774ef7aa",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "111ab147-1b54-47ad-b3ab-ef60bf513543",
          "citation": "EMEA 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a564905-4758-401f-8697-a02e0c47e1fb",
          "citation": "INN Proposed List 16",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL16.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "46222817-033d-48cb-a845-33a31517198f",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3da3cdfb-9c8d-48e4-8ed9-f00d54a48896",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "654e6297-6bed-4433-96dc-8db313ac57c2",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "edec7be7-1686-4c03-bd8a-f2904ecf1632",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a32feb1e-71dc-45ce-ae01-ff0a55092c1a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a7f2590-4ede-4cdd-a744-115fa0709a3f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed049e95-25ca-4a38-8f4c-f6b96b472948",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389696000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2fedc6cc-7ca9-40cb-9474-55eb762d6ff6",
          "citation": "SRS import [I5ZZY3DC5G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I5ZZY3DC5G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389696000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7216216a-0347-40f6-a74a-a55c783760c8",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7606e88a-c51e-4355-8664-4e51e569cc5b",
          "citation": "HALOCARBAN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8c25a135-d43e-4dfc-8e6c-d1271644a791",
          "citation": "CLOFLUCARBAN [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "98545d40-fa6d-4bdf-adc9-108333388f28",
          "citation": "CLOFLUCARBAN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "466f9eef-c798-4671-a560-890ebb505ee8",
          "citation": "CLOFLUCARBAN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8202b14f-ecb4-40d9-9c5a-b66df585c302",
          "citation": "HALOCARBAN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ec2786ba-d8b4-831c-44d9-7c64db2101e3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=369-77-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cbe95fe1-79bd-29f7-0856-e637850a74dc",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e4a56cc5-000e-4700-b76c-f0def895a937",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "dfb35765-d773-e3d9-1bec-3d49ddc4f6e6",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "e95d40b0-b742-b972-dbe0-159c6bcf3dff",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "18481994-2a5d-b430-9382-46bf12172e02",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c935ba67-9474-45ac-2fa9-c65b0f8bb5dd",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "850634d2-ec5e-4f6e-a364-1fd78e6a493c",
          "id": "850634d2-ec5e-4f6e-a364-1fd78e6a493c",
          "molfile": "\n  Marvin  01132106542D          \n\n 22 23  0  0  0  0            999 V2000\n    7.9369   -1.9422    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1559   -1.6552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5050   -0.9181    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9438   -2.4517    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4421   -1.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7206   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0068   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2930   -1.6552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5792   -1.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5792   -0.4190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8655   -1.6474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1491   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4353   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7060   -1.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7060   -0.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.0078    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4276    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1491   -0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0068   -0.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7283   -0.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4421   -0.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1559   -0.0078    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n 21  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n 19  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 18 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1Cl)NC(=O)Nc2ccc(c(c2)C(F)(F)F)Cl",
          "formula": "C14H9Cl2F3N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "771a8b25-fc72-49ac-83a4-a768cac817e4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "349.1357",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b7c2ee49-74e0-4980-a42f-b321ec043702",
      "version": "13",
      "structure": {
        "id": "66435569-ac79-4330-98a7-c17400824f0a",
        "molfile": "\n  Marvin  01132105192D          \n\n 22 23  0  0  0  0            999 V2000\n    6.4421   -1.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1559   -1.6552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5792   -1.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2930   -1.6552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4421   -0.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8655   -1.6474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7206   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0068   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5792   -0.4190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9369   -1.9422    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5050   -0.9181    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9438   -2.4517    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7283   -0.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1491   -1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0068   -0.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1559   -0.0078    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.7060   -0.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.0078    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4353   -1.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1491   -0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7060   -1.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4276    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  8  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  3  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  3  2  0  0  0  0\n 10  2  1  0  0  0  0\n 11  2  1  0  0  0  0\n 12  2  1  0  0  0  0\n 13  5  1  0  0  0  0\n 14  6  1  0  0  0  0\n 15  8  1  0  0  0  0\n 16  5  1  0  0  0  0\n 17 22  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 14  2  0  0  0  0\n 20 14  1  0  0  0  0\n 21 19  1  0  0  0  0\n 22 20  2  0  0  0  0\n 15 13  2  0  0  0  0\n 21 17  2  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1Cl)NC(=O)Nc2ccc(c(c2)C(F)(F)F)Cl",
        "formula": "C14H9Cl2F3N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "349.1357",
        "optical_activity": "NONE",
        "references": [
          "7216216a-0347-40f6-a74a-a55c783760c8",
          "2fedc6cc-7ca9-40cb-9474-55eb762d6ff6",
          "7a564905-4758-401f-8697-a02e0c47e1fb"
        ],
        "stereo_centers": 0
      },
      "unii": "I5ZZY3DC5G"
    }
  ]
}