{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1ccc3737-137b-4cf5-afc9-70fcecce11c6",
          "code": "I599WFR5KW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "92d47bbf-34aa-c266-cf9f-973299c7cb2c",
          "code": "91936883",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91936883",
          "code_system": "PUBCHEM",
          "references": [
            "7b566737-5a31-3e8c-4b4e-6cfcd53e8dd2"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5da449bc-aa8a-4417-938b-62b8c91e8726",
          "name": "DISODIUM PHLORETIN 3',3-DISULFONATE",
          "stdName": "DISODIUM PHLORETIN 3',3-DISULFONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e48abc2d-f62c-4700-90c6-aa79d7047cac",
            "b8c4c7c8-b85e-48b3-8338-f8d88eec1f13"
          ],
          "display_name": true
        },
        {
          "uuid": "d79baf5c-ae38-4c74-8340-fc54a75e4029",
          "name": "DISODIUM PHLORETIN DISULFONATE",
          "stdName": "DISODIUM PHLORETIN DISULFONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "eaad3faf-11ed-4044-a92c-4def4e53cf65",
            "b8c4c7c8-b85e-48b3-8338-f8d88eec1f13",
            "d6424edc-5e89-45ad-996e-dc37062d03ea"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6dacc5d0-2b17-4735-8776-be555c0ccc83",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "e48abc2d-f62c-4700-90c6-aa79d7047cac",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b8c4c7c8-b85e-48b3-8338-f8d88eec1f13",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eaad3faf-11ed-4044-a92c-4def4e53cf65",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0de9b4db-458b-47cc-8fa3-322c6fd15687",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393333000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4cabfe4-9ffd-4acf-a574-98fdde19cbb6",
          "citation": "SRS import [I599WFR5KW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I599WFR5KW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393333000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f38cc083-94b2-46e1-8dbb-f76ecf216258",
          "citation": "http://www.ncbi.nlm.nih.gov/pmc/articles/PMC4227253/pdf/ijms-15-18919.pdf",
          "url": "http://www.ncbi.nlm.nih.gov/pmc/articles/PMC4227253/pdf/ijms-15-18919.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6424edc-5e89-45ad-996e-dc37062d03ea",
          "citation": "DISODIUM PHLORETIN DISULFONATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7b566737-5a31-3e8c-4b4e-6cfcd53e8dd2",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f5aee42e-fbd6-4be0-b410-935e69a20621",
          "id": "f5aee42e-fbd6-4be0-b410-935e69a20621",
          "molfile": "\n  Marvin  01132112442D          \n\n  1  0  0  0  0  0            999 V2000\n   23.5736   -8.9691    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "780b40e0-fd37-47cc-94f3-c72bef7237dc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "472699ec-da4d-46ed-a772-6e4721f5d537",
          "id": "472699ec-da4d-46ed-a772-6e4721f5d537",
          "molfile": "\n  Marvin  01132103442D          \n\n 28 29  0  0  0  0            999 V2000\n   18.9715   -6.4285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.6859   -6.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4004   -6.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1148   -6.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8293   -6.4285    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   21.1148   -7.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8293   -8.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8293   -8.9035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5438   -7.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5438   -6.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2582   -6.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9727   -6.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6870   -6.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6870   -5.6036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.4015   -5.1911    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   23.9727   -5.1911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2582   -5.6036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9727   -4.3661    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9727   -3.5412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7976   -4.3661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1476   -4.3661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4004   -8.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4004   -8.9035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.6859   -7.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9715   -8.0785    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   18.2570   -8.4909    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5591   -7.3641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3840   -8.7930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 24  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n 22  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 17 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 18 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 22  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  2  0  0  0  0\n 25 28  2  0  0  0  0\nM  CHG  2   5  -1  15  -1\nM  END",
          "smiles": "c1cc(c(cc1CCC(=O)c2c(cc(c(c2O)S(=O)(=O)O)O)[O-])S(=O)(=O)O)[O-]",
          "formula": "C15H12O11S2",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5694708a-3667-4d41-8136-a9b6dc9ab4c7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "432.382",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7643bfd1-3ebb-4968-80fe-acbecfbf4c5c",
      "version": "5",
      "structure": {
        "id": "d55299e7-5c84-4650-9bb3-35e9f81276ca",
        "molfile": "\n  Marvin  01132111032D          \n\n 30 29  0  0  0  0            999 V2000\n   21.1148   -7.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8293   -8.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5438   -7.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.5438   -6.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2582   -6.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9727   -6.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6870   -6.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.6870   -5.6036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.4015   -5.1911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9727   -5.1911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9727   -4.3661    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9727   -3.5412    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   24.7976   -4.3661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1476   -4.3661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2582   -5.6036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8293   -8.9035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4004   -8.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4004   -8.9035    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.6859   -7.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9715   -8.0785    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   18.2570   -8.4909    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   18.5591   -7.3641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3840   -8.7930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.6859   -6.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.9715   -6.4285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   20.4004   -6.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1148   -6.8410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8293   -6.4285    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5736   -8.9691    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n   23.5736   -8.9691    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  2  0  0  0  0\n 10 15  2  0  0  0  0\n 15  5  1  0  0  0  0\n 16  2  2  0  0  0  0\n 17  1  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  2  0  0  0  0\n 20 23  2  0  0  0  0\n 24 19  1  0  0  0  0\n 25 24  1  0  0  0  0\n 24 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 27  1  2  0  0  0  0\n 28 27  1  0  0  0  0\nM  CHG  4  12  -1  21  -1  29   1  30   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  29  30\nM  SPA   1  1  29\nM  SDI   1  4   23.1536   -9.3891   23.1536   -8.5491\nM  SDI   1  4   23.9936   -8.5491   23.9936   -9.3891\nM  SMT   1 2\nM  END",
        "smiles": "c1cc(c(cc1CCC(=O)c2c(cc(c(c2O)S(=O)(=O)[O-])O)O)S(=O)(=O)[O-])O.[Na+].[Na+]",
        "formula": "C15H12O11S2.2Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "478.3615",
        "optical_activity": "NONE",
        "references": [
          "c4cabfe4-9ffd-4acf-a574-98fdde19cbb6",
          "f38cc083-94b2-46e1-8dbb-f76ecf216258"
        ],
        "stereo_centers": 0
      },
      "unii": "I599WFR5KW"
    }
  ]
}