{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e3d44481-87da-41f8-8dc0-267249fa32d4",
          "code": "481-53-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=481-53-8",
          "code_system": "CAS",
          "references": [
            "f5fc7194-1662-47df-83f9-f5980c490729",
            "12c3280c-85b4-4c25-bb42-4b60ae25d45b"
          ]
        },
        {
          "uuid": "b45b8824-03bb-441a-b99c-4a56d503667c",
          "code": "C059006",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67059006",
          "code_system": "MESH",
          "references": [
            "f5fc7194-1662-47df-83f9-f5980c490729"
          ]
        },
        {
          "uuid": "c17a702e-cd78-4dde-bf9c-e1b550c7994c",
          "code": "TANGERITIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tangeritin",
          "code_system": "WIKIPEDIA",
          "references": [
            "f5fc7194-1662-47df-83f9-f5980c490729"
          ]
        },
        {
          "uuid": "86d1dafb-a508-4bd6-8c04-a3cd302b2601",
          "code": "207-570-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.883",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f5fc7194-1662-47df-83f9-f5980c490729"
          ]
        },
        {
          "uuid": "816a81bc-4b40-48dc-92f6-f29fcc33ef9d",
          "code": "C68468",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68468",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f5fc7194-1662-47df-83f9-f5980c490729"
          ]
        },
        {
          "uuid": "74545017-c9b1-47eb-a154-cbbe48040e18",
          "code": "68077",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/68077",
          "code_system": "PUBCHEM",
          "references": [
            "f5fc7194-1662-47df-83f9-f5980c490729"
          ]
        },
        {
          "uuid": "0a83c7fb-cf61-e94f-114d-39165ebea102",
          "code": "DTXSID30197417",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30197417",
          "code_system": "EPA CompTox",
          "references": [
            "356aa5c5-5375-b775-4b2c-286950e7911a"
          ]
        },
        {
          "uuid": "19ee14d2-965f-dbd6-3aef-677c38da1f76",
          "code": "C68464",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Polyphenol[C70553]|Dietary Flavonoid[C70554]|Flavone",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68464",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7a8997fe-4d6f-b885-d232-412a13b332f8"
          ]
        },
        {
          "uuid": "2e134cf7-0d58-4af5-976c-9575934f6906",
          "code": "I4TLA1DLX6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "98b87a37-d48e-043a-44b3-8acbf533402f",
          "code": "9400",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9400",
          "code_system": "CHEBI",
          "references": [
            "7a8997fe-4d6f-b885-d232-412a13b332f8"
          ]
        },
        {
          "uuid": "322ff68b-6db5-5db0-0d59-7447c36516fc",
          "code": "53909",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=53909",
          "code_system": "NSC",
          "references": [
            "fef61682-1751-b4e4-72b8-97684c70fe83"
          ]
        },
        {
          "uuid": "96a32334-7e35-25c6-c5f7-17a85427faf3",
          "code": "300000037347",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "37aacce8-b69a-c9f9-2123-7c3df51ffdd2"
          ]
        },
        {
          "uuid": "f3bf0922-dded-b1e9-9fbb-3b42441589c8",
          "code": "618905",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=618905",
          "code_system": "NSC",
          "references": [
            "fef61682-1751-b4e4-72b8-97684c70fe83"
          ]
        },
        {
          "uuid": "e842391d-5d72-f3e0-6c05-7d6946ffab25",
          "code": "I4TLA1DLX6",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(I4TLA1DLX6)",
          "code_system": "DAILYMED",
          "references": [
            "ed9b6c18-01c5-0138-b6e9-81c942fa5f4b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6bf8efdb-f828-4d60-a96a-4ab915925695",
          "amount": {
            "uuid": "57f4d1df-c276-464a-a788-675202d89151"
          },
          "comments": "48% Cell growth rate of mouse myeloid leukemia M1 cells at 50 uM of compound vs control",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "1d4ea674-14c2-4ad2-836e-30330e8991b5"
          ],
          "related_substance": {
            "uuid": "cc41e8a5-3117-4f5f-9ca8-a7fb55f54030",
            "refuuid": "7147e1a0-0c1a-4a31-87fd-ba5f0a85d5d8",
            "name": "TANGERINE PEEL",
            "unii": "JU3D414057",
            "linking_id": "JU3D414057",
            "ref_pname": "TANGERINE PEEL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a31d282e-42db-4997-99ac-a47e33980059",
          "amount": {
            "uuid": "888ff110-03fb-4348-89bf-ce74ab70a0f4"
          },
          "comments": "26% Cell growth rate of human acute promyelocytic leukemia HL-60 cells at 50 uM of compound vs control",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "1d4ea674-14c2-4ad2-836e-30330e8991b5"
          ],
          "related_substance": {
            "uuid": "e0ab9e38-fba9-4e7e-b2e6-64ac306f38b9",
            "refuuid": "f0c781b9-482b-457c-8c0c-f6d19a4ea7fc",
            "name": "CITRUS AURANTIUM FRUIT RIND",
            "unii": "055456JHI7",
            "linking_id": "055456JHI7",
            "ref_pname": "CITRUS AURANTIUM FRUIT RIND",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "dd3a3365-e624-43c5-be05-8013ac4abb7f",
          "amount": {
            "uuid": "e57549ec-d1db-480c-9dac-681d57fbb837"
          },
          "type": "TRANSPORTER->INHIBITOR",
          "references": [
            "b3f92c21-d1fc-4d0f-a521-4669086ada52"
          ],
          "related_substance": {
            "uuid": "a8a5e7d0-fe92-42ef-9515-06889905f64e",
            "refuuid": "3921aa0b-fd6d-40ec-9c07-d83e5c6f124a",
            "name": "MULTIDRUG RESISTANCE PROTEIN 1",
            "unii": "22ES734693",
            "linking_id": "22ES734693",
            "ref_pname": "MULTIDRUG RESISTANCE PROTEIN 1",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e4f25751-53ca-4bcb-8f31-78893762c5f1",
          "name": "4',5,6,7,8-PENTAMETHOXYFLAVONE",
          "stdName": "4',5,6,7,8-PENTAMETHOXYFLAVONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f74e35d-a99c-4bd6-8776-4b6d92e453d6",
            "2a480167-b110-451b-9837-4a68638f86be"
          ],
          "display_name": false
        },
        {
          "uuid": "87eade88-81a3-495b-91f3-a74183ba6dcb",
          "name": "4H-1-BENZOPYRAN-4-ONE, 5,6,7,8-TETRAMETHOXY-2-(4-METHOXYPHENYL)-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 5,6,7,8-TETRAMETHOXY-2-(4-METHOXYPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f74e35d-a99c-4bd6-8776-4b6d92e453d6",
            "2a480167-b110-451b-9837-4a68638f86be"
          ],
          "display_name": false
        },
        {
          "uuid": "f9178fd6-22f9-411a-a720-8cf7702194a8",
          "name": "5,6,7,8,4'-PENTAMETHOXYFLAVONE",
          "stdName": "5,6,7,8,4'-PENTAMETHOXYFLAVONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f74e35d-a99c-4bd6-8776-4b6d92e453d6",
            "2a480167-b110-451b-9837-4a68638f86be"
          ],
          "display_name": false
        },
        {
          "uuid": "a6e265cb-8b61-46e7-990f-2e68ccc57a5a",
          "name": "5,6,7,8-TETRAMETHOXY-2-(4-METHOXYPHENYL)-4H-1-BENZOPYRAN-4-ONE",
          "stdName": "5,6,7,8-TETRAMETHOXY-2-(4-METHOXYPHENYL)-4H-1-BENZOPYRAN-4-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f74e35d-a99c-4bd6-8776-4b6d92e453d6",
            "2a480167-b110-451b-9837-4a68638f86be"
          ],
          "display_name": false
        },
        {
          "uuid": "7b110816-eea7-4de7-a89e-85db577712e9",
          "name": "FLAVONE, 4',5,6,7,8-PENTAMETHOXY-",
          "stdName": "FLAVONE, 4',5,6,7,8-PENTAMETHOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f74e35d-a99c-4bd6-8776-4b6d92e453d6",
            "2a480167-b110-451b-9837-4a68638f86be"
          ],
          "display_name": false
        },
        {
          "uuid": "b2f56fad-e94c-43ab-922d-b72ccfea547c",
          "name": "NSC-53909",
          "stdName": "NSC-53909",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f74e35d-a99c-4bd6-8776-4b6d92e453d6",
            "2a480167-b110-451b-9837-4a68638f86be"
          ],
          "display_name": false
        },
        {
          "uuid": "25175e61-20b6-4bfb-8ca3-894af41f3321",
          "name": "NSC-618905",
          "stdName": "NSC-618905",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f74e35d-a99c-4bd6-8776-4b6d92e453d6",
            "2a480167-b110-451b-9837-4a68638f86be"
          ],
          "display_name": false
        },
        {
          "uuid": "cd2060a3-2a3b-4e1b-bb37-4badea6d6307",
          "name": "PONKANETIN",
          "stdName": "PONKANETIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f74e35d-a99c-4bd6-8776-4b6d92e453d6",
            "2a480167-b110-451b-9837-4a68638f86be"
          ],
          "display_name": false
        },
        {
          "uuid": "5807d29a-72a5-4495-b395-425d820197a0",
          "name": "TANGERETIN",
          "stdName": "TANGERETIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f74e35d-a99c-4bd6-8776-4b6d92e453d6",
            "dd025c9f-071d-452c-93dd-e1914c98a185",
            "4e09d097-bbc1-45f7-b7ef-e05c3f19a62f",
            "10466e51-6869-45a8-9a99-7b40d1da6fd7"
          ],
          "display_name": true
        },
        {
          "uuid": "ff05944e-3f26-48f7-8b25-1c5823f98f7b",
          "name": "TANGERITIN",
          "stdName": "TANGERITIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "2f74e35d-a99c-4bd6-8776-4b6d92e453d6",
            "a097ece5-2be1-440d-baaa-b9ec794d1688",
            "2a480167-b110-451b-9837-4a68638f86be",
            "b347f424-3535-4c07-bcf4-70556e583844"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "06d57cfa-7b26-4fc9-b4aa-65df612e8fec",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "4d5718f6-d3ae-dd23-4ac6-0e98dbf8279c",
          "name": "Tangeretin [WHO-DD]",
          "stdName": "TANGERETIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4db78d2b-e409-8845-fdc1-d9df3e77d233"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4e09d097-bbc1-45f7-b7ef-e05c3f19a62f",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2f74e35d-a99c-4bd6-8776-4b6d92e453d6",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a480167-b110-451b-9837-4a68638f86be",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a097ece5-2be1-440d-baaa-b9ec794d1688",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd025c9f-071d-452c-93dd-e1914c98a185",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5fc7194-1662-47df-83f9-f5980c490729",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390701000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1d4ea674-14c2-4ad2-836e-30330e8991b5",
          "citation": "SUGIYAMA S, CHEM PHARM BULL 41(4)714-19(1993)",
          "url": "https://www.jstage.jst.go.jp/article/cpb1958/41/4/41_4_714/_pdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b8ee609f-c0c2-44e5-b132-3e79372452f0",
          "citation": "SRS import [I4TLA1DLX6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I4TLA1DLX6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390701000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b347f424-3535-4c07-bcf4-70556e583844",
          "citation": "TANGERITIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "10466e51-6869-45a8-9a99-7b40d1da6fd7",
          "citation": "TANGERETIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "356aa5c5-5375-b775-4b2c-286950e7911a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=481-53-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7a8997fe-4d6f-b885-d232-412a13b332f8",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "12c3280c-85b4-4c25-bb42-4b60ae25d45b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b3f92c21-d1fc-4d0f-a521-4669086ada52",
          "citation": "Engle, Kritika, and Gautam Kumar. \"Cancer multidrug-resistance reversal by ABCB1 inhibition: A recent update.\" European Journal of Medicinal Chemistry (2022): 114542.",
          "url": "https://reader.elsevier.com/reader/sd/pii/S0223523422004445?token=B3EF98BA0FAAF433D381FC1940C0A0821598B2CD02A38085CDCBCDC6820386D96F5F5C32DDBD9012577502F3F6A9B6C9&originRegion=us-east-1&originCreation=20220716171256",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "4db78d2b-e409-8845-fdc1-d9df3e77d233",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "fef61682-1751-b4e4-72b8-97684c70fe83",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "37aacce8-b69a-c9f9-2123-7c3df51ffdd2",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "ed9b6c18-01c5-0138-b6e9-81c942fa5f4b",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "912ed6ec-24aa-4eaa-97fb-21a921fd289c",
          "id": "912ed6ec-24aa-4eaa-97fb-21a921fd289c",
          "molfile": "\n  Marvin  01132107312D          \n\n 27 29  0  0  0  0            999 V2000\n    0.7228   -3.9189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4372   -3.5064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4372   -2.6814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7221   -2.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7184   -1.4493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4338   -1.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1490   -1.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1485   -2.2721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318   -0.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7140    0.2046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7140    1.0296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    1.4428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318    1.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318    2.2671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7167    2.6785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7154    3.5035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1413    2.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1392    3.5046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8527    3.9189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8590    2.2671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5731    2.6803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2880    2.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8590    1.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5731    1.0289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5723    0.2039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1413    1.0296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1413    0.2046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  8  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  9  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 27  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 26 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 17 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 20 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 23 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 24  1  0  0  0  0\n 26 23  1  0  0  0  0\n 24 25  1  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
          "smiles": "COc1ccc(cc1)-c2cc(=O)c3c(c(c(c(c3o2)OC)OC)OC)OC",
          "formula": "C20H20O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7923a302-f0e2-46c8-8fee-afae90a22aec"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "372.3694",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d3e7a81c-d63a-496e-96f9-3abc22a729a5",
      "version": "15",
      "structure": {
        "id": "cc02e58c-b62b-4f62-8e89-b4aad6617c30",
        "molfile": "\n  Marvin  01132110322D          \n\n 27 29  0  0  0  0            999 V2000\n    4.2880    2.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5731    2.6803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8590    2.2671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1413    2.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1392    3.5046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8527    3.9189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318    2.2671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7167    2.6785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7154    3.5035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318    1.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7140    1.0296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    1.4428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7140    0.2046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4318   -0.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4338   -1.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7184   -1.4493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7221   -2.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4372   -2.6814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4372   -3.5064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7228   -3.9189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1485   -2.2721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1490   -1.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1413    0.2046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1413    1.0296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8590    1.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5731    1.0289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5723    0.2039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  4  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 18 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 15  2  0  0  0  0\n 14 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 10  2  0  0  0  0\n 24 25  1  0  0  0  0\n 25  3  2  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
        "smiles": "COc1ccc(cc1)-c2cc(=O)c3c(c(c(c(c3o2)OC)OC)OC)OC",
        "formula": "C20H20O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "372.3694",
        "optical_activity": "NONE",
        "references": [
          "b8ee609f-c0c2-44e5-b132-3e79372452f0",
          "2a480167-b110-451b-9837-4a68638f86be"
        ],
        "stereo_centers": 0
      },
      "unii": "I4TLA1DLX6"
    }
  ]
}