{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e9477640-2d5b-4f3a-8747-9aa1666202a1", "code": "1109-15-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1109-15-5", "code_system": "CAS", "references": [ "64334c94-b20c-40df-97b3-8504eec6e33d", "5d5e7776-9317-4f0d-ad59-08d1a590269f" ] }, { "uuid": "0eea5494-46d7-41dd-a8eb-4c8119848bbc", "code": "TRIS(PENTAFLUOROPHENYL)BORANE", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Tris(pentafluorophenyl)borane", "code_system": "WIKIPEDIA", "references": [ "64334c94-b20c-40df-97b3-8504eec6e33d" ] }, { "uuid": "ab4e0e06-bf16-42c2-b30b-07bce8b7304a", "code": "582056", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/582056", "code_system": "PUBCHEM", "references": [ "64334c94-b20c-40df-97b3-8504eec6e33d" ] }, { "uuid": "bba9b25d-b429-4cec-bca3-8f63570deba8", "code": "DTXSID6074594", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6074594", "code_system": "EPA CompTox", "references": [ "aeebba5b-a014-d2b6-f275-fa6589d0c379" ] }, { "uuid": "89a71c20-66f2-4489-82f5-5a4d0839ad11", "code": "I3WU5E2578", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "0c52f4ac-79b8-4b98-8b54-b330a8aa76f1", "name": "BF-15", "stdName": "BF-15", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "3fb4d40c-de50-4556-85b1-9ec0e0cad305", "222ce381-b122-44df-884e-f3dc754d2556" ], "display_name": false }, { "uuid": "5af61f01-e1ae-47bc-a4e4-185ce1b2996e", "name": "ORANE, TRIS(2,3,4,5,6-PENTAFLUOROPHENYL)-", "stdName": "ORANE, TRIS(2,3,4,5,6-PENTAFLUOROPHENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3fb4d40c-de50-4556-85b1-9ec0e0cad305", "222ce381-b122-44df-884e-f3dc754d2556" ], "display_name": false }, { "uuid": "4214c8b3-6652-4170-a41b-be6c2d16e5b5", "name": "PERFLUOROTRIPHENYLBORON", "stdName": "PERFLUOROTRIPHENYLBORON", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3fb4d40c-de50-4556-85b1-9ec0e0cad305", "222ce381-b122-44df-884e-f3dc754d2556" ], "display_name": false }, { "uuid": "a4419e73-7977-4442-87b2-d5264acb2ae6", "name": "TRIS(2,3,4,5,6-PENTAFLUOROPHENYL)BORANE", "stdName": "TRIS(2,3,4,5,6-PENTAFLUOROPHENYL)BORANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3fb4d40c-de50-4556-85b1-9ec0e0cad305", "f1cf0d1b-72b0-4af5-83c3-f4557cf208bd", "222ce381-b122-44df-884e-f3dc754d2556" ], "display_name": false }, { "uuid": "3f3deb4c-1021-476b-bbc1-d03af55d2e72", "name": "TRIS(2,3,4,5,6-PENTAFLUOROPHENYL)BORANE [MI]", "stdName": "TRIS(2,3,4,5,6-PENTAFLUOROPHENYL)BORANE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3fb4d40c-de50-4556-85b1-9ec0e0cad305", "222ce381-b122-44df-884e-f3dc754d2556" ], "display_name": false }, { "uuid": "c24c34a3-cf92-4402-8e16-cb8b5e189e24", "name": "TRIS(PENTAFLUOROPHENYL)BORANE", "stdName": "TRIS(PENTAFLUOROPHENYL)BORANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "222ce381-b122-44df-884e-f3dc754d2556", "f6a6791b-1477-442e-9747-886f29a676a5" ], "display_name": true }, { "uuid": "c7b74164-94d5-42ce-8247-75000283fc28", "name": "TRIS(PENTAFLUOROPHENYL)BORON", "stdName": "TRIS(PENTAFLUOROPHENYL)BORON", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3fb4d40c-de50-4556-85b1-9ec0e0cad305", "222ce381-b122-44df-884e-f3dc754d2556" ], "display_name": false } ], "references": [ { "uuid": "75d4ff7f-cd90-40be-b18d-12403866d1a9", "citation": "SRS import [I3WU5E2578]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I3WU5E2578", "doc_type": "SRS", "public_domain": true, "document_date": 1493391458000, "tags": [ "NOMEN" ] }, { "uuid": "f1cf0d1b-72b0-4af5-83c3-f4557cf208bd", "citation": "TRIS(2,3,4,5,6-PENTAFLUOROPHENYL)BORANE [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3fb4d40c-de50-4556-85b1-9ec0e0cad305", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "222ce381-b122-44df-884e-f3dc754d2556", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f6a6791b-1477-442e-9747-886f29a676a5", "citation": "Wikipedia", "url": "https://en.wikipedia.org/wiki/Tris(pentafluorophenyl)borane", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "64334c94-b20c-40df-97b3-8504eec6e33d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391458000, "tags": [ "NOMEN" ] }, { "uuid": "aeebba5b-a014-d2b6-f275-fa6589d0c379", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1109-15-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5d5e7776-9317-4f0d-ad59-08d1a590269f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a78dbe9d-82d7-446f-8c38-44a4ecc0789f", "id": "a78dbe9d-82d7-446f-8c38-44a4ecc0789f", "molfile": "\n Marvin 01132108422D \n\n 34 36 0 0 0 0 999 V2000\n 7.2027 -1.7375 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2027 -2.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4882 -2.9749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7737 -2.5625 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4882 -3.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7737 -4.2125 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2027 -4.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2027 -5.7160 0.0000 B 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2381 -6.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5237 -5.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5237 -5.0354 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8092 -6.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0947 -5.8604 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8092 -7.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0947 -7.5104 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5237 -7.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5237 -8.3354 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2381 -7.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9526 -7.5104 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1672 -6.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8817 -5.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8817 -5.0354 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5962 -6.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3106 -5.8604 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5962 -7.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3106 -7.5104 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8817 -7.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8817 -8.3354 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1672 -7.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4527 -7.5104 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9172 -3.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6316 -4.2125 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9172 -2.9749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6316 -2.5625 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 33 2 2 0 0 0 0\n 3 4 1 0 0 0 0\n 5 3 2 0 0 0 0\n 5 6 1 0 0 0 0\n 7 5 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 31 2 0 0 0 0\n 8 9 1 0 0 0 0\n 8 20 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 18 2 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 14 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 16 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 29 2 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 27 25 2 0 0 0 0\n 27 28 1 0 0 0 0\n 29 27 1 0 0 0 0\n 29 30 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 1 0 0 0 0\n 33 34 1 0 0 0 0\nM END", "smiles": "c1(c(c(c(c(c1F)F)F)F)F)B(c2c(c(c(c(c2F)F)F)F)F)c3c(c(c(c(c3F)F)F)F)F", "formula": "C18BF15", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "81c6776f-a607-4aa3-8704-f815a15c0b8e" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "511.9803", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "2116aaf0-f237-40dc-805c-606e710b8adb", "version": "4", "structure": { "id": "abb53f7a-3fc3-4bc3-b543-c0f5bcb537e7", "molfile": "\n Marvin 01132108542D \n\n 34 36 0 0 0 0 999 V2000\n 7.2027 -5.7160 0.0000 B 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2027 -4.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4882 -3.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7737 -4.2125 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4882 -2.9749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7737 -2.5625 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2027 -2.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2027 -1.7375 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9172 -2.9749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6316 -2.5625 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9172 -3.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6316 -4.2125 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2381 -6.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5237 -5.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5237 -5.0354 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8092 -6.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0947 -5.8604 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8092 -7.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0947 -7.5104 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5237 -7.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5237 -8.3354 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2381 -7.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9526 -7.5104 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1672 -6.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8817 -5.8604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8817 -5.0354 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5962 -6.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3106 -5.8604 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5962 -7.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3106 -7.5104 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8817 -7.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8817 -8.3354 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1672 -7.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4527 -7.5104 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 7 2 0 0 0 0\n 9 10 1 0 0 0 0\n 11 9 1 0 0 0 0\n 11 12 1 0 0 0 0\n 2 11 2 0 0 0 0\n 1 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 18 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 20 1 0 0 0 0\n 22 23 1 0 0 0 0\n 13 22 2 0 0 0 0\n 1 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 31 29 2 0 0 0 0\n 31 32 1 0 0 0 0\n 33 31 1 0 0 0 0\n 33 34 1 0 0 0 0\n 24 33 2 0 0 0 0\nM END", "smiles": "c1(c(c(c(c(c1F)F)F)F)F)B(c2c(c(c(c(c2F)F)F)F)F)c3c(c(c(c(c3F)F)F)F)F", "formula": "C18BF15", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "511.9803", "optical_activity": "NONE", "references": [ "3fb4d40c-de50-4556-85b1-9ec0e0cad305", "75d4ff7f-cd90-40be-b18d-12403866d1a9" ], "stereo_centers": 0 }, "unii": "I3WU5E2578" } ] }