{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c9c886c1-e119-43d5-aeb1-1adc593414bc",
          "code": "10377-66-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10377-66-9",
          "code_system": "CAS",
          "references": [
            "4a234b0e-7be7-4c1a-b149-34ca7f79bd50",
            "583dbc0f-24b2-45d2-b602-e7a1c7446a6f"
          ]
        },
        {
          "uuid": "8519dfc5-10c9-4698-8846-417b247de54e",
          "code": "m7068",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7068?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4a234b0e-7be7-4c1a-b149-34ca7f79bd50"
          ]
        },
        {
          "uuid": "3fddbdce-7b53-4321-9567-d9880fb3e7e5",
          "code": "233-828-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.030.741",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4a234b0e-7be7-4c1a-b149-34ca7f79bd50"
          ]
        },
        {
          "uuid": "362f7516-2fce-46f9-ba75-7af0b093cb20",
          "code": "61511",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/61511",
          "code_system": "PUBCHEM",
          "references": [
            "4a234b0e-7be7-4c1a-b149-34ca7f79bd50"
          ]
        },
        {
          "uuid": "09914524-7f0b-1bd6-16fc-6b20f093fa7b",
          "code": "Manganese nitrate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Manganese_nitrate",
          "code_system": "WIKIPEDIA",
          "references": [
            "b30b502e-e61a-2cc1-bf19-f50ede65fa9e"
          ]
        },
        {
          "uuid": "31ecd310-985e-41b2-bb07-c541c020f8a6",
          "code": "I389H78514",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d372bcad-70a6-32c2-794c-a1b2798758ec",
          "code": "DTXSID90890659",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90890659",
          "code_system": "EPA CompTox"
        }
      ],
      "relationships": [
        {
          "uuid": "23fbae5d-96dc-4594-9d79-9dca2bf86f13",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "9b90329a-edc0-4da0-9877-aa620c7a2f11",
            "refuuid": "8248332c-8739-4872-8639-9ac1fb9d7f19",
            "name": "MANGANOUS CATION",
            "unii": "H6EP7W5457",
            "linking_id": "H6EP7W5457",
            "ref_pname": "MANGANOUS CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e71a1b4f-cf5f-4b8e-850f-364300b7d34f",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "44adf036-7c22-4ced-bd63-4f8ff00eeade"
          ],
          "related_substance": {
            "uuid": "2eb52e76-d012-4f28-9edd-fa3794a072eb",
            "refuuid": "29a75a23-5a3c-488c-ae92-ec167b8eed89",
            "name": "MANGANESE NITRATE TETRAHYDRATE",
            "unii": "03M0G68R5F",
            "linking_id": "03M0G68R5F",
            "ref_pname": "MANGANESE NITRATE TETRAHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "983e7aac-9ee3-4b57-bca2-d11fd5ca5e8c",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "0f03ab8d-c9f6-46fa-bebb-36030899867a"
          ],
          "related_substance": {
            "uuid": "32ca3039-2fc9-4f67-8205-34503af9a1e5",
            "refuuid": "c4ae8bfd-8997-4e15-871f-dbbc6f034222",
            "name": "MANGANESE DINITRATE HEXAHYDRATE",
            "unii": "W5UG18WBJA",
            "linking_id": "W5UG18WBJA",
            "ref_pname": "MANGANESE DINITRATE HEXAHYDRATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c3de5758-6bbf-4ce2-bcb5-bec5b07b37cf",
          "name": "MANGANESE DINITRATE",
          "stdName": "MANGANESE DINITRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e69ddece-bf4d-494a-9378-afd9def9e23f",
            "453cd7cc-a171-42fe-9c49-c6c998b644ca"
          ],
          "display_name": false
        },
        {
          "uuid": "2fecc50d-d1e0-437f-b6fa-0e3b255899f5",
          "name": "MANGANESE NITRATE",
          "stdName": "MANGANESE NITRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e69ddece-bf4d-494a-9378-afd9def9e23f",
            "919357dc-cc68-4dc3-b945-6abf62771ada",
            "319b7b7e-c2e9-4e65-8023-f038a0acec21",
            "453cd7cc-a171-42fe-9c49-c6c998b644ca"
          ],
          "display_name": true
        },
        {
          "uuid": "d1839f93-ba6a-4cd8-a327-15dfa06d7057",
          "name": "MANGANESE NITRATE [MI]",
          "stdName": "MANGANESE NITRATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e69ddece-bf4d-494a-9378-afd9def9e23f",
            "919357dc-cc68-4dc3-b945-6abf62771ada"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "453cd7cc-a171-42fe-9c49-c6c998b644ca",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e69ddece-bf4d-494a-9378-afd9def9e23f",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "919357dc-cc68-4dc3-b945-6abf62771ada",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a234b0e-7be7-4c1a-b149-34ca7f79bd50",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391022000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b09be4f-a740-4f24-8831-407b5bd0661e",
          "citation": "SRS import [I389H78514]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I389H78514",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391022000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b8e559a6-f8b9-4918-8c3b-b0f7e610eda4",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "319b7b7e-c2e9-4e65-8023-f038a0acec21",
          "citation": "MANGANESE NITRATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b30b502e-e61a-2cc1-bf19-f50ede65fa9e",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Manganese_nitrate",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0f03ab8d-c9f6-46fa-bebb-36030899867a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "44adf036-7c22-4ced-bd63-4f8ff00eeade",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "583dbc0f-24b2-45d2-b602-e7a1c7446a6f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1e9a8a31-064a-40c0-bae5-52a5471088ef",
          "id": "1e9a8a31-064a-40c0-bae5-52a5471088ef",
          "molfile": "\n  Marvin  01132101452D          \n\n  1  0  0  0  0  0            999 V2000\n    2.5088   -2.0560    0.0000 Mn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Mn+2]",
          "formula": "Mn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8c38952f-2aae-45b4-acbe-3c9dcad95a25"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "54.938",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "aa98e9b4-79f3-4bd8-b7cc-cf0c57836ed9",
          "id": "aa98e9b4-79f3-4bd8-b7cc-cf0c57836ed9",
          "molfile": "\n  Marvin  01132108512D          \n\n  4  3  0  0  0  0            999 V2000\n   -2.8276   -2.9570    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -2.1079   -2.5426    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -2.1079   -1.7180    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -1.3921   -2.9528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\nM  CHG  3   1  -1   2   1   3  -1\nM  END",
          "smiles": "[N+](=O)([O-])[O-]",
          "formula": "NO3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "fe02e370-822a-4b1a-acce-9c3d41f44859"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "62.0049",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b3b5f726-80e5-46c3-a2a6-514ca217ab68",
      "version": "6",
      "structure": {
        "id": "83ac98fb-ffed-41f0-ac86-ec4044eccbc2",
        "molfile": "\n  Marvin  01132106502D          \n\n  9  6  0  0  0  0            999 V2000\n    2.5088   -2.0560    0.0000 Mn  0  2  0  0  0  0  0  0  0  0  0  0\n   -2.1079   -2.5426    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -2.8276   -2.9570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3921   -2.9528    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -2.1079   -1.7180    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -2.1079   -2.5426    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   -2.8276   -2.9570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3921   -2.9528    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -2.1079   -1.7180    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  1  0  0  0  0\nM  CHG  7   1   2   2   1   4  -1   5  -1   6   1   8  -1   9  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  8   2   3   4   5   6   7   8   9\nM  SPA   1  4   2   3   4   5\nM  SDI   1  4   -3.2476   -3.3770   -3.2476   -1.2980\nM  SDI   1  4   -0.9721   -1.2980   -0.9721   -3.3770\nM  SMT   1 2\nM  END",
        "smiles": "[Mn+2].[N+](=O)([O-])[O-].[N+](=O)([O-])[O-]",
        "formula": "Mn.2NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "178.9479",
        "optical_activity": "NONE",
        "references": [
          "7b09be4f-a740-4f24-8831-407b5bd0661e",
          "b8e559a6-f8b9-4918-8c3b-b0f7e610eda4"
        ],
        "stereo_centers": 0
      },
      "unii": "I389H78514"
    }
  ]
}