{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a303b73f-e21a-4a94-bd93-950b95b34e23",
          "code": "85-83-6",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=85-83-6",
          "code_system": "CAS",
          "references": [
            "758ac40b-a094-4197-9e39-c7f52a0f8f7a",
            "a7827a5c-56e9-469d-b0ca-b3340183e60c"
          ]
        },
        {
          "uuid": "4719d8c8-f7f9-4cc5-b88c-d6d942205700",
          "code": "SUDAN IV",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sudan_IV",
          "code_system": "WIKIPEDIA",
          "references": [
            "758ac40b-a094-4197-9e39-c7f52a0f8f7a"
          ]
        },
        {
          "uuid": "4e41cba4-fd86-4ff0-9e6e-ef007c59f130",
          "code": "201-635-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.487",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "758ac40b-a094-4197-9e39-c7f52a0f8f7a"
          ]
        },
        {
          "uuid": "b1353e69-d61a-4e01-b1d1-853e517ff9ba",
          "code": "36224",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/36224/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "758ac40b-a094-4197-9e39-c7f52a0f8f7a"
          ]
        },
        {
          "uuid": "9c6c0d9d-15b6-4beb-9d46-e1ee5810e138",
          "code": "m9800",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9800?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "758ac40b-a094-4197-9e39-c7f52a0f8f7a"
          ]
        },
        {
          "uuid": "6eae3a81-c551-4c79-942b-2e95b32e6616",
          "code": "SUB15201MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "758ac40b-a094-4197-9e39-c7f52a0f8f7a"
          ]
        },
        {
          "uuid": "6f87f28b-62ef-42fe-b05c-4255fc96ed19",
          "code": "CHEMBL1707454",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1707454",
          "code_system": "ChEMBL",
          "references": [
            "758ac40b-a094-4197-9e39-c7f52a0f8f7a"
          ]
        },
        {
          "uuid": "3ead7f22-f8f5-00ce-7dfb-1d434e39d6b3",
          "code": "DTXSID8041743",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8041743",
          "code_system": "EPA CompTox",
          "references": [
            "3d333682-6402-2e00-65ef-16b4f8eec5af"
          ]
        },
        {
          "uuid": "3956004d-549e-4c50-ece7-81467c6e2f26",
          "code": "3543",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3543",
          "code_system": "DRUG CENTRAL",
          "references": [
            "d0b629ff-328f-e319-a1f2-9b67ff114c3a"
          ]
        },
        {
          "uuid": "18e212ee-17e9-4fd7-8323-8fe110b95b97",
          "code": "I35E9QU96C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1a4065f4-9a4c-52f0-346e-8e061e7fad4b",
          "code": "88014",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:88014",
          "code_system": "CHEBI",
          "references": [
            "d0b629ff-328f-e319-a1f2-9b67ff114c3a"
          ]
        },
        {
          "uuid": "f7c7f75b-c47e-2801-ae7d-9a78bf1b659d",
          "code": "I35E9QU96C",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=I35E9QU96C",
          "code_system": "DAILYMED",
          "references": [
            "36c61824-2ff0-fac4-76db-cc939e7945b4"
          ]
        },
        {
          "uuid": "6975348b-46f6-ce54-9f2d-3829bf2afb80",
          "code": "100000078399",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8b78f9df-777b-a994-6d8c-1481acc03389"
          ]
        },
        {
          "uuid": "089345b4-d7ff-8cb1-08fc-24f0f641fc13",
          "code": "10472",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=10472",
          "code_system": "NSC",
          "references": [
            "ea8ecdd4-ed92-bba6-b3c8-5c44a5ca9712"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "30d24ccf-3c8f-476e-a793-1b533fcdb87a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "923970e5-40f9-4d1f-9a56-5d1b5774a654",
            "refuuid": "295a73b9-511f-4707-a66d-68e9bc4981bd",
            "name": "SOLVENT RED 24",
            "unii": "I35E9QU96C",
            "linking_id": "I35E9QU96C",
            "ref_pname": "SOLVENT RED 24",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a92ecb30-788d-4cd3-b470-e6b6e938aa61",
          "name": "1-((2-METHYL-4-((2-METHYLPHENYL)AZO)PHENYL)AZO)-2-NAPHTHALENOL",
          "stdName": "1-((2-METHYL-4-((2-METHYLPHENYL)AZO)PHENYL)AZO)-2-NAPHTHALENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "239dde76-6e7a-4164-8e89-73fdca9fb971",
            "f0c23a03-c0a8-4920-9f26-28dcf0e9491b"
          ],
          "display_name": false
        },
        {
          "uuid": "ce263f74-e6ce-4489-a47a-a480e29d6280",
          "name": "2',3-DIMETHYL-4-(2-HYDROXYNAPHTHYLAZO) AZOBENZENE",
          "stdName": "2',3-DIMETHYL-4-(2-HYDROXYNAPHTHYLAZO) AZOBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "239dde76-6e7a-4164-8e89-73fdca9fb971",
            "f0c23a03-c0a8-4920-9f26-28dcf0e9491b"
          ],
          "display_name": false
        },
        {
          "uuid": "d734c589-0145-4eb4-b6df-ed3e409ffb5c",
          "name": "2-NAPHTHALENOL, 1-((2-METHYL-4-((2-METHYLPHENYL)AZO)PHENYL)AZO)-",
          "stdName": "2-NAPHTHALENOL, 1-((2-METHYL-4-((2-METHYLPHENYL)AZO)PHENYL)AZO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "239dde76-6e7a-4164-8e89-73fdca9fb971",
            "f0c23a03-c0a8-4920-9f26-28dcf0e9491b"
          ],
          "display_name": false
        },
        {
          "uuid": "d749271e-6878-4d6e-a107-3ae00caa4805",
          "name": "2-NAPHTHOL, 1-(4-O-TOLYLAZO-O-TOLYLAZO)-",
          "stdName": "2-NAPHTHOL, 1-(4-O-TOLYLAZO-O-TOLYLAZO)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "239dde76-6e7a-4164-8e89-73fdca9fb971",
            "f0c23a03-c0a8-4920-9f26-28dcf0e9491b"
          ],
          "display_name": false
        },
        {
          "uuid": "294a0c06-a170-4bc2-9fc2-dd359f0aec8a",
          "name": "AKA501",
          "stdName": "AKA501",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "239dde76-6e7a-4164-8e89-73fdca9fb971",
            "62b95a17-6f2f-4164-a181-7bff81823035",
            "f0c23a03-c0a8-4920-9f26-28dcf0e9491b"
          ],
          "display_name": false,
          "name_orgs": [
            {
              "uuid": "adb9c9d4-46a6-48aa-aefd-8393863366a4",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "2ffecd9c-0189-4c63-aa92-50baf85ec82b",
          "name": "C.I. 26105",
          "stdName": "C.I. 26105",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "239dde76-6e7a-4164-8e89-73fdca9fb971",
            "746a8be5-7c76-4698-8872-b1101ada340b"
          ],
          "display_name": false
        },
        {
          "uuid": "d2eb3f5c-9b87-4e91-b1ec-aed04f93c4cf",
          "name": "C.I. SOLVENT RED 24",
          "stdName": "C.I. SOLVENT RED 24",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "239dde76-6e7a-4164-8e89-73fdca9fb971",
            "746a8be5-7c76-4698-8872-b1101ada340b"
          ],
          "display_name": false
        },
        {
          "uuid": "e8a75216-ad05-f4ef-7f4d-4afd375d6414",
          "name": "CI 26105",
          "stdName": "CI 26105",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e64ac1ed-2ea3-edc5-90dc-dc3673f29bea"
          ],
          "display_name": false
        },
        {
          "uuid": "7da247a3-e3cc-4cbb-b66e-64bbc73c2078",
          "name": "CI-26105",
          "stdName": "CI-26105",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93a67a7f-2423-4bf6-8c2c-099b3ba1558e",
            "239dde76-6e7a-4164-8e89-73fdca9fb971"
          ],
          "display_name": false
        },
        {
          "uuid": "6c77885c-b8c3-4cf8-b31e-62097e49ce7c",
          "name": "FAST OIL RED B",
          "stdName": "FAST OIL RED B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "239dde76-6e7a-4164-8e89-73fdca9fb971",
            "746a8be5-7c76-4698-8872-b1101ada340b"
          ],
          "display_name": false
        },
        {
          "uuid": "e95b9ad0-ac6d-4c76-908e-48df6e32461e",
          "name": "GRASAL BRILLIANT RED B",
          "stdName": "GRASAL BRILLIANT RED B",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "239dde76-6e7a-4164-8e89-73fdca9fb971",
            "746a8be5-7c76-4698-8872-b1101ada340b"
          ],
          "display_name": false
        },
        {
          "uuid": "fe795365-0d44-4acb-a75d-b40772aad111",
          "name": "NSC-10472",
          "stdName": "NSC-10472",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "239dde76-6e7a-4164-8e89-73fdca9fb971",
            "fde7e9c9-ba4a-49b7-b477-48d21c0c369a"
          ],
          "display_name": false
        },
        {
          "uuid": "2323a2a7-c181-4dbc-931e-ccc64c17ab73",
          "name": "OIL RED B",
          "stdName": "OIL RED B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "239dde76-6e7a-4164-8e89-73fdca9fb971",
            "746a8be5-7c76-4698-8872-b1101ada340b"
          ],
          "display_name": false
        },
        {
          "uuid": "a542ec38-ef96-4bcd-8bf7-354de892145f",
          "name": "SCARLET OIL",
          "stdName": "SCARLET OIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "239dde76-6e7a-4164-8e89-73fdca9fb971",
            "746a8be5-7c76-4698-8872-b1101ada340b"
          ],
          "display_name": false
        },
        {
          "uuid": "95b72123-dea2-4be7-bc8c-0cf695fd8463",
          "name": "SCARLET RED",
          "stdName": "SCARLET RED",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "67181fe4-f0ae-4dc8-9c42-6109a2a7ee01",
            "239dde76-6e7a-4164-8e89-73fdca9fb971",
            "1e704153-8f87-41c4-871f-7cf65136636c",
            "e1cbb121-136f-4f93-b56d-e058936bb7cb",
            "0208593c-8886-428b-9370-26cd2ec8f217",
            "709c0d14-d0b7-4b70-b597-21a6523e7330",
            "e9e9b505-6af8-41a2-b3b5-e721353c459e",
            "22ac24a7-9e48-4f6a-ace1-416bae21d985",
            "cf031876-a4db-4fd6-a75e-ba39a285e671"
          ],
          "display_name": false
        },
        {
          "uuid": "fd7c6bc5-c756-7c3c-219e-65a672faac1b",
          "name": "SCARLET RED [IARC]",
          "stdName": "SCARLET RED [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "892db0f3-1f74-d511-1db0-3ee956c2e29f"
          ],
          "display_name": false
        },
        {
          "uuid": "e201f6be-3a21-4427-ab0d-06b4a27598c3",
          "name": "SCARLET RED [MI]",
          "stdName": "SCARLET RED [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "239dde76-6e7a-4164-8e89-73fdca9fb971",
            "cf031876-a4db-4fd6-a75e-ba39a285e671"
          ],
          "display_name": false
        },
        {
          "uuid": "18682666-6cb6-443c-99c7-4cc5b86ce1b9",
          "name": "SCARLET RED [VANDF]",
          "stdName": "SCARLET RED [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67181fe4-f0ae-4dc8-9c42-6109a2a7ee01",
            "239dde76-6e7a-4164-8e89-73fdca9fb971"
          ],
          "display_name": false
        },
        {
          "uuid": "3282c7e4-c2d3-3bba-8455-5ceecb4d20f4",
          "name": "SOLVENT RED 24",
          "stdName": "SOLVENT RED 24",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e64ac1ed-2ea3-edc5-90dc-dc3673f29bea"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "1ec7a8c2-9ce4-4c5c-b6a0-131fbaf25e26",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "d1b5985a-5c76-4f34-a13c-42bc3d775a91",
          "name": "SOLVENT RED 24 (SCARLET RED)",
          "stdName": "SOLVENT RED 24 (SCARLET RED)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "239dde76-6e7a-4164-8e89-73fdca9fb971",
            "e1cbb121-136f-4f93-b56d-e058936bb7cb"
          ],
          "display_name": false
        },
        {
          "uuid": "a2fa187d-3532-42b9-bf64-9ce392eebb7d",
          "name": "SUDAN IV",
          "stdName": "SUDAN IV",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "239dde76-6e7a-4164-8e89-73fdca9fb971",
            "746a8be5-7c76-4698-8872-b1101ada340b"
          ],
          "display_name": false
        },
        {
          "uuid": "d63558df-b15e-a4c1-83ef-a7e001d42e69",
          "name": "Scarlet red [WHO-DD]",
          "stdName": "SCARLET RED [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae7a40af-d93f-444a-02e5-d7f68a8829e8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e1cbb121-136f-4f93-b56d-e058936bb7cb",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "709c0d14-d0b7-4b70-b597-21a6523e7330",
          "citation": "USAN",
          "doc_type": "SWISS MEDIC",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf031876-a4db-4fd6-a75e-ba39a285e671",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "239dde76-6e7a-4164-8e89-73fdca9fb971",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0c23a03-c0a8-4920-9f26-28dcf0e9491b",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "746a8be5-7c76-4698-8872-b1101ada340b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1e704153-8f87-41c4-871f-7cf65136636c",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93a67a7f-2423-4bf6-8c2c-099b3ba1558e",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67181fe4-f0ae-4dc8-9c42-6109a2a7ee01",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fde7e9c9-ba4a-49b7-b477-48d21c0c369a",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "758ac40b-a094-4197-9e39-c7f52a0f8f7a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391774000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3c8e1ab-884e-494a-a452-917402df3179",
          "citation": "SRS import [I35E9QU96C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I35E9QU96C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391774000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9e9b505-6af8-41a2-b3b5-e721353c459e",
          "citation": "SCARLET RED [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "62b95a17-6f2f-4164-a181-7bff81823035",
          "citation": "AKA501 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0208593c-8886-428b-9370-26cd2ec8f217",
          "citation": "SCARLET RED [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "22ac24a7-9e48-4f6a-ace1-416bae21d985",
          "citation": "SCARLET RED [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3d333682-6402-2e00-65ef-16b4f8eec5af",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=85-83-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "892db0f3-1f74-d511-1db0-3ee956c2e29f",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "e64ac1ed-2ea3-edc5-90dc-dc3673f29bea",
          "citation": "PCPC",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a7827a5c-56e9-469d-b0ca-b3340183e60c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d0b629ff-328f-e319-a1f2-9b67ff114c3a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ea8ecdd4-ed92-bba6-b3c8-5c44a5ca9712",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "36c61824-2ff0-fac4-76db-cc939e7945b4",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "ae7a40af-d93f-444a-02e5-d7f68a8829e8",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8b78f9df-777b-a994-6d8c-1481acc03389",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a1c4aee9-eab9-43dd-9f72-cd664b438880",
          "id": "a1c4aee9-eab9-43dd-9f72-cd664b438880",
          "molfile": "\n  Marvin  01132108242D          \n\n 29 32  0  0  0  0            999 V2000\n    0.0000    2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    2.0625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    1.6500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145   -1.6500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145   -3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289   -4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145   -3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 29 10  2  0  0  0  0\n 11 12  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 27  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 26  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 26  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 25 26  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccccc1/N=N/c2ccc(c(C)c2)/N=N/c3c4ccccc4ccc3O",
          "formula": "C24H20N4O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1cb62597-433f-428c-9170-9678698a9e19"
          },
          "defined_stereo": 0,
          "ez_centers": 2,
          "molecular_weight": "380.4427",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "295a73b9-511f-4707-a66d-68e9bc4981bd",
      "version": "14",
      "structure": {
        "id": "bacee9f4-858a-4767-b6b3-f2658c042399",
        "molfile": "\n  Marvin  01132109402D          \n\n 29 32  0  0  0  0            999 V2000\n    0.0000   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145   -3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289   -4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1434   -3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4289   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145   -3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.0625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145   -1.6500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    1.6500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    2.0625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4289    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1434    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7145   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n  1 10  2  0  0  0  0\n  5 10  1  0  0  0  0\n  2 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 14 19  2  0  0  0  0\n 20 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 22 27  2  0  0  0  0\n 23 28  1  0  0  0  0\n 21 22  1  0  0  0  0\n 17 20  1  0  0  0  0\n 15 29  1  0  0  0  0\n 13 14  1  0  0  0  0\n  1 12  1  0  0  0  0\nM  END",
        "smiles": "Cc1ccccc1/N=N/c2ccc(c(C)c2)/N=N/c3c4ccccc4ccc3O",
        "formula": "C24H20N4O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 2,
        "molecular_weight": "380.4427",
        "optical_activity": "NONE",
        "references": [
          "a3c8e1ab-884e-494a-a452-917402df3179",
          "746a8be5-7c76-4698-8872-b1101ada340b"
        ],
        "stereo_centers": 0
      },
      "unii": "I35E9QU96C"
    }
  ]
}