{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "371bd7f3-42f9-4a2d-827a-47a4c1acd46d", "code": "6358-69-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6358-69-6", "code_system": "CAS", "references": [ "8de04ce2-62a6-4acf-9d50-d7016e9ec105", "37d51b43-d284-4c7d-91cb-5a0caf22ac38" ] }, { "uuid": "4e3e5cbf-9ace-400d-92de-27823aef7426", "code": "C71649", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C71649", "code_system": "NCI_THESAURUS", "references": [ "8de04ce2-62a6-4acf-9d50-d7016e9ec105" ] }, { "uuid": "4ab80f61-555a-443f-aeaa-0c880ce7d913", "code": "D&C GREEN NO. 8", "comments": "PART 74 -- LISTING OF COLOR ADDITIVES SUBJECT TO CERTIFICATION|Subpart B--Drugs|Sec. 74.1208 D&C Green No. 8.", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=74.1208", "code_system": "CFR", "references": [ "8de04ce2-62a6-4acf-9d50-d7016e9ec105" ] }, { "uuid": "69d6c75e-8a7a-48d8-91cf-21188e35c02d", "code": "1426464", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426464/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "8de04ce2-62a6-4acf-9d50-d7016e9ec105" ] }, { "uuid": "95426e4c-bd8e-4b9b-8afd-6495740b5d4f", "code": "m9335", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m9335?q=authorize", "code_system": "MERCK INDEX", "references": [ "8de04ce2-62a6-4acf-9d50-d7016e9ec105" ] }, { "uuid": "d1701257-690e-4ff5-b6bb-7decbb4a5c81", "code": "228-783-6", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.166", "code_system": "ECHA (EC/EINECS)", "references": [ "8de04ce2-62a6-4acf-9d50-d7016e9ec105" ] }, { "uuid": "cc9160ef-31a3-6045-e094-49cd0938052b", "code": "DTXSID4041739", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4041739", "code_system": "EPA CompTox", "references": [ "0ab84352-ccd5-a879-60d8-26ecbf99727d" ] }, { "uuid": "de31595a-00d0-1730-c18a-1950c1678937", "code": "C461", "comments": "Industrial Aid[C45678]|Dye", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461", "code_system": "NCI_THESAURUS", "references": [ "f5514206-4812-ab1e-93c2-2a74f6a38920" ] }, { "uuid": "db241f4e-8c80-06b5-fd2f-a173761ddd86", "code": "61388", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/61388", "code_system": "PUBCHEM", "references": [ "72170932-74f8-6459-3bc6-06231a5a15d6" ] }, { "uuid": "438f08e2-a157-40bb-bea9-d6a61c08c4b1", "code": "I2W85YOX9L", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "6892d9ce-a2fc-1a41-f9d5-73d71403d9e5", "code": "52083", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:52083", "code_system": "CHEBI", "references": [ "f5514206-4812-ab1e-93c2-2a74f6a38920" ] }, { "uuid": "08c07c0d-9902-a8e2-d77e-f2d223055b62", "code": "Pyranine", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Pyranine", "code_system": "WIKIPEDIA", "references": [ "b427481f-5207-fa72-fc4e-5471916c24a7" ] }, { "uuid": "99b36fc8-e7ff-26c8-f7eb-7da50b166c75", "code": "97285", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=97285", "code_system": "NSC", "references": [ "4dff994e-19ac-1966-2998-1c9f6b004730" ] }, { "uuid": "4ef75d32-1271-48d0-f03b-69b125151806", "code": "I2W85YOX9L", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=I2W85YOX9L", "code_system": "DAILYMED", "references": [ "b2f625ba-ec3f-5be8-593f-aef3f2bb4a6a" ] } ], "substance_class": "chemical", "references": [ { "uuid": "9270941e-1ac7-4726-a947-dcb57a6d6035", "citation": "21CFR74.1206", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "f6a96374-39c7-468a-915b-db6d86da984e", "citation": "CTFA 2006", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "12ddf389-a034-4642-9d61-d807d36701b8", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e18a718c-cd2f-46da-95a9-8f2f2c621186", "citation": "CFR", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "02d08f14-0595-4a78-b02a-e2a03295a153", "citation": "ACD 8.0(21CFR74.1206", "doc_type": "CFR", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a24141a4-911f-4f30-8934-fc8a24770321", "citation": "21CFR74.1208", "doc_type": "CFR", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "69234ce6-7085-4ca7-a1c9-be0dad8edd01", "citation": "CTFA 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f9c05c94-771c-4079-b60f-5823944ead05", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "749e27d7-efff-43f1-a194-97e699ad2034", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fbb3ba34-145f-418f-a72c-0171865894b2", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "49fbe598-b7f3-45ad-9c7e-4262f7e57d9a", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "29c3b892-5a62-4a51-bf4a-c5c11b62f269", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8de04ce2-62a6-4acf-9d50-d7016e9ec105", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389952000, "tags": [ "NOMEN" ] }, { "uuid": "dcc090f2-4d7a-416a-9602-fc78040582db", "citation": "SRS import [I2W85YOX9L]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I2W85YOX9L", "doc_type": "SRS", "public_domain": true, "document_date": 1493389952000, "tags": [ "NOMEN" ] }, { "uuid": "cfd466d0-61be-47a9-bfcf-af0771c1284f", "citation": "GREEN 8 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1f2b48bf-7b12-404e-89a2-efb8f8700878", "citation": "CI 59040 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "df7f3d96-3131-4cd5-947d-808788786ccf", "citation": "MIDORI204 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f9515e76-8812-4bf7-8dfb-06628702263e", "citation": "SOLVENT GREEN 7 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "0ab84352-ccd5-a879-60d8-26ecbf99727d", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6358-69-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f5514206-4812-ab1e-93c2-2a74f6a38920", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "72170932-74f8-6459-3bc6-06231a5a15d6", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "37d51b43-d284-4c7d-91cb-5a0caf22ac38", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "b427481f-5207-fa72-fc4e-5471916c24a7", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "b2f625ba-ec3f-5be8-593f-aef3f2bb4a6a", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "4dff994e-19ac-1966-2998-1c9f6b004730", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a0873b69-0b24-47f4-9985-3d4b2aed854d", "id": "a0873b69-0b24-47f4-9985-3d4b2aed854d", "molfile": "\n Marvin 01132108202D \n\n 1 0 0 0 0 0 999 V2000\n 6.1052 -0.7072 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 3, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 3, "units": "MOL RATIO", "uuid": "f039dd10-8f43-4f6c-82dc-0c29c44dc02f" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "d00f2cb7-b0ba-4bc2-962d-b1cba1b4173c", "id": "d00f2cb7-b0ba-4bc2-962d-b1cba1b4173c", "molfile": "\n Marvin 01132110452D \n\n 29 32 0 0 0 0 999 V2000\n 3.4584 -3.5543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8753 -2.8437 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5897 -3.2476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2910 -2.1285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1604 -2.4319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4461 -2.8444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7333 -2.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7333 -1.6099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0182 -1.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0189 -0.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7316 0.0411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7243 0.8650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0053 1.2801 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 2.4405 1.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1576 0.8701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1628 0.0464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8803 -0.3710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8791 -1.1994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1620 -1.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4476 -1.1975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4488 -0.3691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8723 1.2859 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2819 0.5688 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.5801 1.7051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4584 2.0042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0141 -2.8407 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6100 -2.1192 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 0.3019 -3.2547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4227 -3.5634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 2 0 0 0 0\n 5 2 1 0 0 0 0\n 6 5 1 0 0 0 0\n 5 19 2 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 7 26 1 0 0 0 0\n 9 8 1 0 0 0 0\n 20 8 2 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 21 2 0 0 0 0\n 12 13 1 0 0 0 0\n 14 12 2 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 15 22 1 0 0 0 0\n 17 16 1 0 0 0 0\n 21 16 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 2 0 0 0 0\n 22 25 2 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 2 0 0 0 0\n 26 29 2 0 0 0 0\nM CHG 3 13 -1 23 -1 27 -1\nM END", "smiles": "c1cc2c(cc(c3ccc4c(cc(c1c4c23)[O-])S(=O)(=O)[O-])S(=O)(=O)O)S(=O)(=O)[O-]", "formula": "C16H7O10S3", "atropisomerism": "No", "charge": -3, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "057f5817-200e-4ae3-88f6-f2300ea5180d" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "455.4197", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "a3c200a7-71db-4788-b059-13cf6f152ab1", "version": "11", "structure": { "id": "d968c93d-503a-4007-abf0-81b495cf0881", "molfile": "\n Marvin 01132111162D \n\n 32 32 0 0 0 0 999 V2000\n 6.1052 -0.7072 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 1.0189 -0.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0182 -1.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7316 0.0411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1576 0.8701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4405 1.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7243 0.8650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4488 -0.3691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8791 -1.1994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8803 -0.3710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1628 0.0464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4476 -1.1975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7333 -1.6099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7333 -2.4303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4461 -2.8444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1604 -2.4319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1620 -1.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0053 1.2801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8723 1.2859 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0141 -2.8407 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8753 -2.8437 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2819 0.5688 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.5801 1.7051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4584 2.0042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6100 -2.1192 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 0.3019 -3.2547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4227 -3.5634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4584 -3.5543 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.5897 -3.2476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2910 -2.1285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1052 -0.7072 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 6.1052 -0.7072 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 11 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 12 17 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 18 1 0 0 0 0\n 8 12 1 0 0 0 0\n 5 19 1 0 0 0 0\n 3 13 1 0 0 0 0\n 14 20 1 0 0 0 0\n 4 2 1 0 0 0 0\n 16 21 1 0 0 0 0\n 4 8 2 0 0 0 0\n 8 11 1 0 0 0 0\n 19 22 1 0 0 0 0\n 19 23 2 0 0 0 0\n 19 24 2 0 0 0 0\n 17 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 20 25 1 0 0 0 0\n 20 26 2 0 0 0 0\n 20 27 2 0 0 0 0\n 12 13 2 0 0 0 0\n 21 28 1 0 0 0 0\n 21 29 2 0 0 0 0\n 21 30 2 0 0 0 0\n 2 3 2 0 0 0 0\n 4 7 1 0 0 0 0\nM CHG 6 1 1 22 -1 25 -1 28 -1 31 1 32 1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 3 1 31 32\nM SPA 1 1 1\nM SDI 1 4 5.6852 -1.1272 5.6852 -0.2872\nM SDI 1 4 6.5252 -0.2872 6.5252 -1.1272\nM SMT 1 3\nM END", "smiles": "c1cc2c(cc(c3ccc4c(cc(c1c4c23)O)S(=O)(=O)[O-])S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+].[Na+]", "formula": "C16H7O10S3.3Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "524.389", "optical_activity": "NONE", "references": [ "9270941e-1ac7-4726-a947-dcb57a6d6035", "dcc090f2-4d7a-416a-9602-fc78040582db" ], "stereo_centers": 0 }, "unii": "I2W85YOX9L", "relationships": [ { "uuid": "f53eabec-3bf7-42c3-b727-a849474998c2", "amount": { "uuid": "f0340968-65f3-429a-a80a-9ab36918ac06" }, "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "5d42611f-0c42-4902-9d9a-872f40cee393", "refuuid": "a983704f-0a7e-426b-a4b7-d4ee43cd8106", "name": "D&C GREEN NO. 8 FREE ACID", "unii": "63Z73E2H7M", "linking_id": "63Z73E2H7M", "ref_pname": "D&C GREEN NO. 8 FREE ACID", "substance_class": "reference" } } ], "names": [ { "uuid": "ce10a1ab-a52a-43d0-822d-2ec6d5467022", "name": "1,3,6-PYRENETRISULFONIC ACID, 8-HYDROXY-, TRISODIUM SALT", "stdName": "1,3,6-PYRENETRISULFONIC ACID, 8-HYDROXY-, TRISODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e18a718c-cd2f-46da-95a9-8f2f2c621186", "02d08f14-0595-4a78-b02a-e2a03295a153" ], "display_name": false }, { "uuid": "4580ca50-785c-47b9-b60d-7bff8b89f4e1", "name": "C.I. 59040", "stdName": "C.I. 59040", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f6a96374-39c7-468a-915b-db6d86da984e", "12ddf389-a034-4642-9d61-d807d36701b8" ], "display_name": false }, { "uuid": "663a25ab-64d7-48eb-a0cf-3a9c45d47486", "name": "CI 59040", "stdName": "CI 59040", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "12ddf389-a034-4642-9d61-d807d36701b8", "1f2b48bf-7b12-404e-89a2-efb8f8700878", "69234ce6-7085-4ca7-a1c9-be0dad8edd01", "f9c05c94-771c-4079-b60f-5823944ead05" ], "display_name": false, "name_orgs": [ { "uuid": "1cc3f0ee-102e-488f-b742-12240f0ff312", "name_org": "INCI" } ] }, { "uuid": "35b0b22d-3689-4089-8614-22e71b76ebd7", "name": "D&C GREEN NO. 8", "stdName": "D&C GREEN NO. 8", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9270941e-1ac7-4726-a947-dcb57a6d6035" ], "display_name": true }, { "uuid": "937ba90f-af9c-4b0f-a860-826628233ec9", "name": "DC GREEN NO. 8", "stdName": "DC GREEN NO. 8", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fbb3ba34-145f-418f-a72c-0171865894b2", "f9c05c94-771c-4079-b60f-5823944ead05" ], "display_name": false }, { "uuid": "9580f80f-fa79-4197-8520-0e329fcda5bc", "name": "GREEN 8", "stdName": "GREEN 8", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "12ddf389-a034-4642-9d61-d807d36701b8", "69234ce6-7085-4ca7-a1c9-be0dad8edd01", "f9c05c94-771c-4079-b60f-5823944ead05", "cfd466d0-61be-47a9-bfcf-af0771c1284f" ], "display_name": false, "name_orgs": [ { "uuid": "4b1ff9bd-8981-4b0e-a8fc-120a5c4ca6ff", "name_org": "INCI" } ] }, { "uuid": "ded5facb-d8fd-4a8f-b92e-be0cf2126d58", "name": "MIDORI204", "stdName": "MIDORI204", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "f9c05c94-771c-4079-b60f-5823944ead05", "df7f3d96-3131-4cd5-947d-808788786ccf", "49fbe598-b7f3-45ad-9c7e-4262f7e57d9a" ], "display_name": false, "name_orgs": [ { "uuid": "c90d8cb5-86fa-40e6-a363-5a53de2e8c92", "name_org": "INCI" } ] }, { "uuid": "e4a52fe6-a624-4bef-9832-a81056eeccc8", "name": "NSC-97285", "stdName": "NSC-97285", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "f9c05c94-771c-4079-b60f-5823944ead05", "29c3b892-5a62-4a51-bf4a-c5c11b62f269" ], "display_name": false }, { "uuid": "99c69132-ce29-464f-8d30-467ca35000d2", "name": "PYRANINE [MI]", "stdName": "PYRANINE [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "749e27d7-efff-43f1-a194-97e699ad2034", "f9c05c94-771c-4079-b60f-5823944ead05" ], "display_name": false }, { "uuid": "99e002b2-d57a-4a39-9466-af66ae381e8f", "name": "SOLVENT GREEN 7", "stdName": "SOLVENT GREEN 7", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "f6a96374-39c7-468a-915b-db6d86da984e", "f9515e76-8812-4bf7-8dfb-06628702263e", "f9c05c94-771c-4079-b60f-5823944ead05", "49fbe598-b7f3-45ad-9c7e-4262f7e57d9a" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "dab65e68-c4dc-4bb4-989f-e8d860f5ebdc", "name_org": "INCI" } ] }, { "uuid": "2c207884-0078-46a2-862a-4c0f02208653", "name": "TRISODIUM SALT OF 8-HYDROXY-1,3,6-PYRENE-TRISULFONIC ACID", "stdName": "TRISODIUM SALT OF 8-HYDROXY-1,3,6-PYRENE-TRISULFONIC ACID", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e18a718c-cd2f-46da-95a9-8f2f2c621186", "a24141a4-911f-4f30-8934-fc8a24770321" ], "display_name": false }, { "uuid": "576ed95a-8ccb-45cd-b472-5094d72883c9", "name": "VIBRACOLOR GREEN SGR7", "stdName": "VIBRACOLOR GREEN SGR7", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "f9c05c94-771c-4079-b60f-5823944ead05", "49fbe598-b7f3-45ad-9c7e-4262f7e57d9a" ], "display_name": false } ], "modifications": { "uuid": "2fcf0caf-b0b3-4937-8162-0d19a6533bb3" } } ] }