{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "4feddcbb-2e92-4180-a165-cc7b350288cc", "code": "5280-66-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=5280-66-0", "code_system": "CAS", "references": [ "c1ed248e-93ab-4ed9-958f-5b18e8d0e6a8", "c68d18ef-2021-43a5-83fe-529aebf14ac4" ] }, { "uuid": "f822284c-e0de-4391-972e-fc75a090b104", "code": "I2845W1HBQ", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "e0451703-c214-ad18-7d4f-92fa87c5316d", "code": "DTXSID90904982", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90904982", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "7b28bca9-036f-46e3-8eb1-fa3ef45a8e4a", "name": "C.I. 15865:4", "stdName": "C.I. 15865:4", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "24b35ffd-7fdb-4ea5-b346-cff73643927a", "a1f61144-e4a0-4cb3-8854-b11d2736707b" ], "display_name": false }, { "uuid": "61f58e8c-6712-427f-be68-f34415e915cf", "name": "C.I. PIGMENT RED 48, MANGANESE(2+) SALT", "stdName": "C.I. PIGMENT RED 48, MANGANESE(2+) SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "24b35ffd-7fdb-4ea5-b346-cff73643927a", "a1f61144-e4a0-4cb3-8854-b11d2736707b" ], "display_name": false }, { "uuid": "d52e2c8b-618a-4a1b-a5aa-e94b888b57ad", "name": "C.I. PIGMENT RED 48:4", "stdName": "C.I. PIGMENT RED 48:4", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2c21beb7-225d-4dcb-9e09-937fbb2e9b4f", "a1f61144-e4a0-4cb3-8854-b11d2736707b" ], "display_name": false }, { "uuid": "b0d095b5-324a-464f-828f-468cfb164636", "name": "CI 15865:4", "stdName": "CI 15865:4", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "24b35ffd-7fdb-4ea5-b346-cff73643927a", "a1f61144-e4a0-4cb3-8854-b11d2736707b" ], "display_name": false }, { "uuid": "27286839-ae71-4f99-ae7f-7831dfa28e57", "name": "FUJI FAST RED 5R7807", "stdName": "FUJI FAST RED 5R7807", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "24b35ffd-7fdb-4ea5-b346-cff73643927a", "a1f61144-e4a0-4cb3-8854-b11d2736707b" ], "display_name": false }, { "uuid": "67969605-2a6f-44cb-a883-5786c104f6bd", "name": "MANGANATE(1-), (4-(2-(5-CHLORO-4-METHYL-2-(SULFO-.KAPPA.O)PHENYL)DIAZENYL-.KAPPA.N1)-3-(HYDROXY-.KAPPA.O)-2-NAPHTHALENECARBOXYLATO(3-))-, HYDROGEN (1:1)", "stdName": "MANGANATE(1-), (4-(2-(5-CHLORO-4-METHYL-2-(SULFO-.KAPPA.O)PHENYL)DIAZENYL-.KAPPA.N1)-3-(HYDROXY-.KAPPA.O)-2-NAPHTHALENECARBOXYLATO(3-))-, HYDROGEN (1:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "24b35ffd-7fdb-4ea5-b346-cff73643927a", "a1f61144-e4a0-4cb3-8854-b11d2736707b" ], "display_name": false }, { "uuid": "85221466-512f-4636-b9b5-f83d77e7ee77", "name": "PIGMENT RED 48 MANGANESE", "stdName": "PIGMENT RED 48 MANGANESE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a1f61144-e4a0-4cb3-8854-b11d2736707b", "c2356971-5b8e-48ba-853c-aba14184401c" ], "display_name": true } ], "references": [ { "uuid": "24b35ffd-7fdb-4ea5-b346-cff73643927a", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "a1f61144-e4a0-4cb3-8854-b11d2736707b", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c2356971-5b8e-48ba-853c-aba14184401c", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2c21beb7-225d-4dcb-9e09-937fbb2e9b4f", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c1ed248e-93ab-4ed9-958f-5b18e8d0e6a8", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392890000, "tags": [ "NOMEN" ] }, { "uuid": "a2504773-f8f8-4984-ac23-71d2e5907af9", "citation": "SRS import [I2845W1HBQ]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I2845W1HBQ", "doc_type": "SRS", "public_domain": true, "document_date": 1493392890000, "tags": [ "NOMEN" ] }, { "uuid": "013a73e3-3a24-4d79-aa63-3d911c12865f", "citation": "CHEMID RECORD 5280-66-0", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c68d18ef-2021-43a5-83fe-529aebf14ac4", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "51f58820-4370-46af-9a40-ff437f592e8b", "id": "51f58820-4370-46af-9a40-ff437f592e8b", "molfile": "\n Marvin 01132104162D \n\n 1 0 0 0 0 0 999 V2000\n 4.3150 -10.2381 0.0000 Mn 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END", "smiles": "[Mn+2]", "formula": "Mn", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a6618be8-4b43-4ce5-98dd-ab3250052c20" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "54.938", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "b5346f47-4fdb-4c12-9096-1123e9e2eb5f", "id": "b5346f47-4fdb-4c12-9096-1123e9e2eb5f", "molfile": "\n Marvin 01132109232D \n\n 28 30 0 0 0 0 999 V2000\n 8.2313 -7.5634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2313 -8.3830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9512 -8.7894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9512 -9.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2386 -10.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5187 -9.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5187 -8.7987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8029 -8.3889 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2386 -10.8568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5265 -11.2712 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5265 -12.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8192 -12.5069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1035 -12.0966 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.8192 -13.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5265 -13.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2460 -13.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9604 -13.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6732 -13.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6732 -12.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9542 -12.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2460 -12.5069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1035 -13.7456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3858 -13.3307 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.1035 -14.5632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6640 -10.0245 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3812 -10.4369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2568 -10.7471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0758 -9.3072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 7 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 4 25 1 0 0 0 0\n 5 6 2 0 0 0 0\n 9 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 21 11 2 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 14 22 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 16 21 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 2 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 2 0 0 0 0\n 25 28 2 0 0 0 0\nM CHG 2 13 -1 23 -1\nM END", "smiles": "Cc1cc(c(cc1Cl)/N=N/c2c3ccccc3cc(c2[O-])C(=O)[O-])S(=O)(=O)O", "formula": "C18H11ClN2O6S", "atropisomerism": "No", "charge": -2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "665af3ca-e216-43ba-844f-a71c8372a227" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "418.8095", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "5b03b823-5df1-4df9-b8a7-7b82f60f3434", "version": "5", "structure": { "id": "853dedc0-f8d0-4d88-821c-5af3b43b4a49", "molfile": "\n Marvin 01132106552D \n\n 29 30 0 0 0 0 999 V2000\n 8.2460 -12.5069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5265 -12.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5265 -11.2712 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2386 -10.8568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2386 -10.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5187 -9.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5187 -8.7987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8029 -8.3889 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2313 -8.3830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2313 -7.5634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9512 -8.7894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9512 -9.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6640 -10.0245 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2568 -10.7471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0758 -9.3072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3812 -10.4369 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 6.8192 -12.5069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1035 -12.0966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8192 -13.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1035 -13.7456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3858 -13.3307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1035 -14.5632 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 7.5265 -13.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2460 -13.3308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9604 -13.7451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6732 -13.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6732 -12.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9542 -12.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3150 -10.2381 0.0000 Mn 0 2 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 5 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 13 15 2 0 0 0 0\n 13 16 1 0 0 0 0\n 2 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 19 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 1 2 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 1 1 0 0 0 0\nM CHG 3 16 -1 22 -1 29 2\nM END", "smiles": "Cc1cc(c(cc1Cl)/N=N/c2c3ccccc3cc(c2O)C(=O)[O-])S(=O)(=O)[O-].[Mn+2]", "formula": "C18H11ClN2O6S.Mn", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "473.7475", "optical_activity": "NONE", "references": [ "a2504773-f8f8-4984-ac23-71d2e5907af9", "013a73e3-3a24-4d79-aa63-3d911c12865f" ], "stereo_centers": 0 }, "unii": "I2845W1HBQ" } ] }