{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c6137454-bbec-4a35-8c28-e307088fd2c9",
          "code": "335-57-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=335-57-9",
          "code_system": "CAS",
          "references": [
            "b04d7d6a-2e66-4c4f-8158-b3f7f628697f",
            "4daad287-f3d1-4aa8-8afd-bfb34da60d8b"
          ]
        },
        {
          "uuid": "d2d523fb-c8f4-450d-94cd-5ca2003b5ce5",
          "code": "C528185",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67528185",
          "code_system": "MESH",
          "references": [
            "b04d7d6a-2e66-4c4f-8158-b3f7f628697f"
          ]
        },
        {
          "uuid": "51586712-e9fe-4177-9e58-33ee5ea09a36",
          "code": "206-392-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.812",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b04d7d6a-2e66-4c4f-8158-b3f7f628697f"
          ]
        },
        {
          "uuid": "1c06a29f-53c2-4479-bf91-2e1c1142afca",
          "code": "9553",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9553",
          "code_system": "PUBCHEM",
          "references": [
            "b04d7d6a-2e66-4c4f-8158-b3f7f628697f"
          ]
        },
        {
          "uuid": "f4b48a3c-6773-9f7d-1efa-abf46b370412",
          "code": "Perfluoroheptane",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Perfluoroheptane",
          "code_system": "WIKIPEDIA",
          "references": [
            "008b40e7-b403-4ca4-e52a-68d12b384379"
          ]
        },
        {
          "uuid": "2c94825d-8ead-84f2-e18b-3fd15b578bc3",
          "code": "DTXSID8052019",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8052019",
          "code_system": "EPA CompTox",
          "references": [
            "b711b4ed-0ea2-6c8e-59d1-52149181b90a"
          ]
        },
        {
          "uuid": "42ab3c96-8b26-47cf-9297-2aded2a06713",
          "code": "I23ZVD1P1L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b693e76b-3811-0039-3d48-9f174cd219b5",
          "code": "38847",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38847",
          "code_system": "CHEBI",
          "references": [
            "9a343ef0-97bd-7df8-5d15-bbd8a1ab4f84"
          ]
        },
        {
          "uuid": "498b6f65-dc34-45ed-46eb-b28761b415ff",
          "code": "79256",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=79256",
          "code_system": "NSC",
          "references": [
            "4e3c6e5f-0233-8fbb-6076-00d2f01dec65"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c383eb00-e80d-458c-997b-a4832b194bfe",
          "name": "FIFLOW 78",
          "stdName": "FIFLOW 78",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3d2235c-06e4-4b36-97cd-d882ee07fafe",
            "44faf32d-cb30-47c2-b11e-1e276d3a8ba1"
          ],
          "display_name": false
        },
        {
          "uuid": "70f607cc-bb93-4f6a-9820-42841d0f0137",
          "name": "FLUORINERT PF 5070",
          "stdName": "FLUORINERT PF 5070",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "44faf32d-cb30-47c2-b11e-1e276d3a8ba1",
            "64cbc428-a384-484d-b9b7-a4b3b3bbcf3f"
          ],
          "display_name": false
        },
        {
          "uuid": "07ec30fa-e106-49b1-b5d9-b5d216f3a4bb",
          "name": "HEPTANE, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-HEXADECAFLUORO-",
          "stdName": "HEPTANE, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-HEXADECAFLUORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "44faf32d-cb30-47c2-b11e-1e276d3a8ba1",
            "64cbc428-a384-484d-b9b7-a4b3b3bbcf3f"
          ],
          "display_name": false
        },
        {
          "uuid": "024ba349-f45f-4feb-8c3b-971b6ef69079",
          "name": "HEPTANE, HEXADECAFLUORO-",
          "stdName": "HEPTANE, HEXADECAFLUORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "44faf32d-cb30-47c2-b11e-1e276d3a8ba1",
            "64cbc428-a384-484d-b9b7-a4b3b3bbcf3f"
          ],
          "display_name": false
        },
        {
          "uuid": "7e821406-ab54-4c5e-9130-acdb96ed6b66",
          "name": "HEXADECAFLUOROHEPTANE",
          "stdName": "HEXADECAFLUOROHEPTANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "44faf32d-cb30-47c2-b11e-1e276d3a8ba1",
            "64cbc428-a384-484d-b9b7-a4b3b3bbcf3f"
          ],
          "display_name": false
        },
        {
          "uuid": "57643652-a6f7-40fb-a7bf-71a8d6bf0d68",
          "name": "NSC-79256",
          "stdName": "NSC-79256",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "44faf32d-cb30-47c2-b11e-1e276d3a8ba1",
            "64cbc428-a384-484d-b9b7-a4b3b3bbcf3f"
          ],
          "display_name": false
        },
        {
          "uuid": "27be6ea3-1af0-4894-8a25-0d28cf9387a3",
          "name": "PERFLUORO-N-HEPTANE",
          "stdName": "PERFLUORO-N-HEPTANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "44faf32d-cb30-47c2-b11e-1e276d3a8ba1",
            "64cbc428-a384-484d-b9b7-a4b3b3bbcf3f"
          ],
          "display_name": false
        },
        {
          "uuid": "da0561c1-1ba4-4842-8c33-523a2707911a",
          "name": "PERFLUOROHEPTANE",
          "stdName": "PERFLUOROHEPTANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7bee22e-147e-4d1d-b845-b018bfe39929",
            "a3d2235c-06e4-4b36-97cd-d882ee07fafe",
            "44faf32d-cb30-47c2-b11e-1e276d3a8ba1"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6ea82173-ce64-402f-9ccc-ed7e370cff60",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "a3d2235c-06e4-4b36-97cd-d882ee07fafe",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "44faf32d-cb30-47c2-b11e-1e276d3a8ba1",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64cbc428-a384-484d-b9b7-a4b3b3bbcf3f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b04d7d6a-2e66-4c4f-8158-b3f7f628697f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390707000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bfea629c-0b69-4f68-a116-2f396e643585",
          "citation": "SRS import [I23ZVD1P1L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I23ZVD1P1L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390707000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7bee22e-147e-4d1d-b845-b018bfe39929",
          "citation": "PERFLUOROHEPTANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "008b40e7-b403-4ca4-e52a-68d12b384379",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Perfluoroheptane",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b711b4ed-0ea2-6c8e-59d1-52149181b90a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=335-57-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9a343ef0-97bd-7df8-5d15-bbd8a1ab4f84",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4e3c6e5f-0233-8fbb-6076-00d2f01dec65",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "4daad287-f3d1-4aa8-8afd-bfb34da60d8b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1361117a-89d2-437d-9728-b3d6c7f8bc5d",
          "id": "1361117a-89d2-437d-9728-b3d6c7f8bc5d",
          "molfile": "\n  Marvin  01132101132D          \n\n 23 22  0  0  0  0            999 V2000\n   10.4643   -4.6482    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8325   -4.1845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5118   -3.6776    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5262   -4.9695    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1681   -3.6970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7634   -3.0715    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9222   -2.8731    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4672   -4.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0516   -4.6482    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0875   -4.8790    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8589   -3.5805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3593   -2.9227    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5483   -2.8149    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1644   -3.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4793   -4.7064    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6597   -4.6008    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5367   -3.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2283   -2.6056    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0457   -2.7243    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7991   -3.7575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2427   -3.1406    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1507   -4.4929    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3506   -4.4390    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  8  5  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 11  8  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 20 23  1  0  0  0  0\nM  END",
          "smiles": "C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F",
          "formula": "C7F16",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "aa89ad54-0f8b-4b63-977c-a5a161fcba96"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "388.0496",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "efce4864-2279-4c42-b36f-971c3383a0aa",
      "version": "7",
      "structure": {
        "id": "6e8a726d-7a17-4753-bae2-da31cea68600",
        "molfile": "\n  Marvin  01132105442D          \n\n 23 22  0  0  0  0            999 V2000\n   10.4643   -4.6482    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5118   -3.6776    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5262   -4.9695    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2427   -3.1406    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1507   -4.4929    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3506   -4.4390    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7634   -3.0715    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9222   -2.8731    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8325   -4.1845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2283   -2.6056    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0457   -2.7243    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7991   -3.7575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0516   -4.6482    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0875   -4.8790    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1681   -3.6970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4793   -4.7064    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6597   -4.6008    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5367   -3.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3593   -2.9227    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5483   -2.8149    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4672   -4.1240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1644   -3.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8589   -3.5805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  9  1  1  0  0  0  0\n  9  2  1  0  0  0  0\n  9  3  1  0  0  0  0\n 12  4  1  0  0  0  0\n 12  5  1  0  0  0  0\n 12  6  1  0  0  0  0\n 15  7  1  0  0  0  0\n 15  8  1  0  0  0  0\n 15  9  1  0  0  0  0\n 18 10  1  0  0  0  0\n 18 11  1  0  0  0  0\n 18 12  1  0  0  0  0\n 21 13  1  0  0  0  0\n 21 14  1  0  0  0  0\n 21 15  1  0  0  0  0\n 22 16  1  0  0  0  0\n 22 17  1  0  0  0  0\n 22 18  1  0  0  0  0\n 23 19  1  0  0  0  0\n 23 20  1  0  0  0  0\n 23 21  1  0  0  0  0\n 23 22  1  0  0  0  0\nM  END",
        "smiles": "C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(C(F)(F)F)(F)F)(F)F)(F)F",
        "formula": "C7F16",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "388.0496",
        "optical_activity": "NONE",
        "references": [
          "bfea629c-0b69-4f68-a116-2f396e643585",
          "64cbc428-a384-484d-b9b7-a4b3b3bbcf3f"
        ],
        "stereo_centers": 0
      },
      "unii": "I23ZVD1P1L"
    }
  ]
}