{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bf048b01-ee74-4a22-88ee-e0737dde7f24",
          "code": "5009-05-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5009-05-2",
          "code_system": "CAS",
          "references": [
            "8c1c5f71-1b9f-47af-b65a-e0e5c29cba66",
            "935859df-2988-4121-b32f-6c737ef9360f"
          ]
        },
        {
          "uuid": "62c927cd-2f88-42df-bdb4-1f684fd0e3c7",
          "code": "7375-66-8",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7375-66-8",
          "code_system": "CAS",
          "references": [
            "8c1c5f71-1b9f-47af-b65a-e0e5c29cba66",
            "87e11970-fbe5-4133-a7b7-d1e33b0fb75c"
          ]
        },
        {
          "uuid": "32d8e972-cdef-d428-e3fb-a83aceed998d",
          "code": "59518515",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/59518515",
          "code_system": "PUBCHEM",
          "references": [
            "bb640934-8b08-43dc-e8a7-b84d9890ac80"
          ]
        },
        {
          "uuid": "0e570420-feb5-4e06-88a1-9d4a0edd7313",
          "code": "I1GHU5G4KJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f9d72774-40f2-fd34-c689-7d73805b20b5",
          "code": "DTXSID90732303",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90732303",
          "code_system": "EPA CompTox",
          "references": [
            "857cf893-9444-9421-7a89-78c989778650"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "894b62e1-b0ae-4b56-ad46-b5f9f6f25cfa",
          "name": "1,3,5-Cyclohexanetrione, 2,2,4,4-tetramethyl-6-(2-methyl-1-oxobutyl)-",
          "stdName": "1,3,5-CYCLOHEXANETRIONE, 2,2,4,4-TETRAMETHYL-6-(2-METHYL-1-OXOBUTYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f8c2c55-d919-4333-b607-4c4cdf18d649",
            "96f6308e-fc2d-4b3a-ba23-3a192e4832f2"
          ],
          "display_name": false
        },
        {
          "uuid": "9121ab48-6652-479f-bd2f-b90c7e11587e",
          "name": "2,2,4,4-Tetramethyl-6-(2-methyl-1-oxobutyl)-1,3,5-cyclohexanetrione",
          "stdName": "2,2,4,4-TETRAMETHYL-6-(2-METHYL-1-OXOBUTYL)-1,3,5-CYCLOHEXANETRIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "935859df-2988-4121-b32f-6c737ef9360f"
          ],
          "display_name": false
        },
        {
          "uuid": "8b6f86d9-9e95-449a-8ab4-cb99f5296453",
          "name": "Adleptospermone",
          "stdName": "ADLEPTOSPERMONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f8c2c55-d919-4333-b607-4c4cdf18d649",
            "96f6308e-fc2d-4b3a-ba23-3a192e4832f2"
          ],
          "display_name": false
        },
        {
          "uuid": "9c122548-4546-45ff-88e1-5036f6b78168",
          "name": "Isoleptospermone",
          "stdName": "ISOLEPTOSPERMONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f8c2c55-d919-4333-b607-4c4cdf18d649",
            "24b603d8-f830-4fb5-a608-6f3ff37ae830",
            "b5f10c5f-8769-4dd2-a149-b89376b5d447"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3a963481-4a4f-4c9c-938d-bb4da80f49ff",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "82496cf4-34eb-4cea-b4ac-b50cb7779bfd",
          "name": "iso-Leptospermone",
          "stdName": "ISO-LEPTOSPERMONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87e11970-fbe5-4133-a7b7-d1e33b0fb75c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8c1c5f71-1b9f-47af-b65a-e0e5c29cba66",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393313000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab3608e1-1e8e-490e-8cc1-e221e743e902",
          "citation": "SRS import [I1GHU5G4KJ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I1GHU5G4KJ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393313000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24b603d8-f830-4fb5-a608-6f3ff37ae830",
          "citation": "ISOLEPTOSPERMONE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b5f10c5f-8769-4dd2-a149-b89376b5d447",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2f8c2c55-d919-4333-b607-4c4cdf18d649",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96f6308e-fc2d-4b3a-ba23-3a192e4832f2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb640934-8b08-43dc-e8a7-b84d9890ac80",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "935859df-2988-4121-b32f-6c737ef9360f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "87e11970-fbe5-4133-a7b7-d1e33b0fb75c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "857cf893-9444-9421-7a89-78c989778650",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "b7680cdc-a2c1-0662-ee8b-fb6f7a890959",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "97c23665-a6ba-48a6-bc9e-f44925e96ffb",
          "id": "97c23665-a6ba-48a6-bc9e-f44925e96ffb",
          "molfile": "\n  Marvin  01132107532D          \n\n 19 19  0  0  0  0            999 V2000\n   15.8246   -9.1951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1102   -8.7826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3958   -9.1952    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   14.3958  -10.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6813   -8.7826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6813   -7.9577    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9668   -9.1952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9668  -10.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6813  -10.4327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2524  -10.4327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7220  -11.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7827  -11.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5379  -10.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8234  -10.4327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5379   -9.1952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2557   -8.4198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7254   -9.3384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2524   -8.7826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2524   -7.9577    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 18  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 13  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 18 15  1  0  0  0  0\n 18 19  2  0  0  0  0\nM  END",
          "smiles": "CCC(C)C(=O)C1C(=O)C(C)(C)C(=O)C(C)(C)C1=O",
          "formula": "C15H22O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "336d1913-f0c8-47d9-8870-4dafe23fe76c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "266.3334",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9fad452a-6ecb-4ce3-a431-5432f1b81889",
      "version": "10",
      "structure": {
        "id": "04a7ddf7-f8a8-42ab-82e0-f09a9df6fd61",
        "molfile": "\n  Marvin  01132100322D          \n\n 19 19  0  0  0  0            999 V2000\n   13.6813   -8.7826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9668   -9.1952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9668  -10.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6813  -10.4327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2524  -10.4327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7220  -11.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7827  -11.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5379  -10.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8234  -10.4327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5379   -9.1952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2557   -8.4198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7254   -9.3384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2524   -8.7826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2524   -7.9577    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6813   -7.9577    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3958   -9.1952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3958  -10.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1102   -8.7826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8246   -9.1951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  8  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 13 10  1  0  0  0  0\n  2 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n  1 15  2  0  0  0  0\n  1 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
        "smiles": "CCC(C)C(=O)C1C(=O)C(C)(C)C(=O)C(C)(C)C1=O",
        "formula": "C15H22O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "266.3334",
        "optical_activity": "( + / - )",
        "references": [
          "ab3608e1-1e8e-490e-8cc1-e221e743e902",
          "96f6308e-fc2d-4b3a-ba23-3a192e4832f2"
        ],
        "stereo_centers": 1
      },
      "unii": "I1GHU5G4KJ"
    }
  ]
}