{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f262d65d-4577-4182-aaeb-e128e0e09b7a",
          "code": "54200-50-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=54200-50-9",
          "code_system": "CAS",
          "references": [
            "f689c691-8fb1-4400-b446-7c626aee2cb5",
            "9f322bfa-3a99-4ba4-85e3-ed5be62fad6f"
          ]
        },
        {
          "uuid": "310af415-d4ef-4bd9-9338-82b2938749eb",
          "code": "259-025-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.053.642",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f689c691-8fb1-4400-b446-7c626aee2cb5"
          ]
        },
        {
          "uuid": "d4939b49-82e6-4f4e-9898-597e6a9d827a",
          "code": "171324",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/171324",
          "code_system": "PUBCHEM",
          "references": [
            "f689c691-8fb1-4400-b446-7c626aee2cb5"
          ]
        },
        {
          "uuid": "27de7c8a-43fb-4025-87f3-20a17cd67f09",
          "code": "I0S2JS6HIS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "db9d023d-8e9a-72c6-4992-5048669bfcf5",
          "code": "DTXSID40904391",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40904391",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e204c295-4b45-45fd-aa10-2582d83c47cf",
          "name": "1-PHENANTHRENEMETHANOL, 1,2,3,4,4A,4B,5,6,10,10A-DECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-, 1-ACETATE, (1R,4AR,4BR,10AR)-",
          "stdName": "1-PHENANTHRENEMETHANOL, 1,2,3,4,4A,4B,5,6,10,10A-DECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-, 1-ACETATE, (1R,4AR,4BR,10AR)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b110e60a-6d81-4919-8002-f6a38d8a78a4"
          ],
          "display_name": false
        },
        {
          "uuid": "1cb4dae2-aa6d-4517-9938-5b06b13d6485",
          "name": "1-PHENANTHRENEMETHANOL, 1,2,3,4,4A,4B,5,6,10,10A-DECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-, ACETATE, (1R-(1.ALPHA.,4A.BETA.,4B.ALPHA.,10A.ALPHA.))-",
          "stdName": "1-PHENANTHRENEMETHANOL, 1,2,3,4,4A,4B,5,6,10,10A-DECAHYDRO-1,4A-DIMETHYL-7-(1-METHYLETHYL)-, ACETATE, (1R-(1.ALPHA.,4A.BETA.,4B.ALPHA.,10A.ALPHA.))-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0baf5fda-44b9-49e8-a017-49109435f89b"
          ],
          "display_name": false
        },
        {
          "uuid": "b56d7434-297f-4b74-8c53-320c61a42b02",
          "name": "ABIETYL ACETATE",
          "stdName": "ABIETYL ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0baf5fda-44b9-49e8-a017-49109435f89b"
          ],
          "display_name": true
        },
        {
          "uuid": "960456a9-2374-4897-ad10-4bc734f3ad7a",
          "name": "ABIETYL ALCOHOL, ACETATE",
          "stdName": "ABIETYL ALCOHOL, ACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0baf5fda-44b9-49e8-a017-49109435f89b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b110e60a-6d81-4919-8002-f6a38d8a78a4",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0baf5fda-44b9-49e8-a017-49109435f89b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f689c691-8fb1-4400-b446-7c626aee2cb5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392085000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99701782-84ec-42ae-bb12-e6af35d58ead",
          "citation": "SRS import [I0S2JS6HIS]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I0S2JS6HIS",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392085000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f322bfa-3a99-4ba4-85e3-ed5be62fad6f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8e277d53-3bf4-460f-8732-752c48d7a553",
          "id": "8e277d53-3bf4-460f-8732-752c48d7a553",
          "molfile": "\n  Marvin  01132107232D          \n\n 24 26  0  0  1  0            999 V2000\n    6.4714   -4.0674    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.4714   -3.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1859   -2.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9003   -3.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9003   -4.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1859   -4.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1859   -5.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4714   -5.7173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7569   -5.3049    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.0425   -5.7173    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.5728   -6.3493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5122   -6.3493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7943   -7.1246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2640   -7.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5462   -8.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4516   -7.6133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3280   -5.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3280   -4.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0425   -4.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7569   -4.4799    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.7569   -3.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6148   -2.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3293   -3.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6148   -2.0049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1  6  1  1  0  0  0\n  1 20  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n 22  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  1  0  0  0\n 10  9  1  0  0  0  0\n  9 20  1  0  0  0  0\n 10 11  1  1  0  0  0\n 10 12  1  0  0  0  0\n 17 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  1  0  0  0\n 23 22  1  0  0  0  0\n 24 22  1  0  0  0  0\nM  END",
          "smiles": "CC(C)C1=CC2=CC[C@H]3[C@@](C)(CCC[C@]3(C)[C@H]2CC1)COC(=O)C",
          "formula": "C22H34O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5d0ac097-8f99-4723-ba89-02acb24e40ff"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "330.505",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "03dcd590-4985-40d8-a68e-a9126f3d8a60",
      "version": "3",
      "structure": {
        "id": "e81385c9-6338-4c21-8579-ba4c09d65999",
        "molfile": "\n  Marvin  01132112012D          \n\n 26 28  0  0  1  0            999 V2000\n    5.7569   -4.4799    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4714   -4.0674    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.7569   -5.3049    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.0425   -5.7173    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.7569   -3.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4714   -4.8923    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4714   -3.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1859   -2.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9003   -3.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6148   -2.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3293   -3.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6148   -2.0049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9003   -4.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1859   -4.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1859   -5.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4714   -5.7173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7569   -6.1299    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5728   -6.3493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3280   -5.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3280   -4.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0425   -4.0674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5122   -6.3493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7943   -7.1246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2640   -7.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4516   -7.6133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5462   -8.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  1  5  1  1  0  0  0\n  2  6  1  6  0  0  0\n  7  2  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  1  0  0  0  0\n  9 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14  2  1  0  0  0  0\n 15 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16  3  1  0  0  0  0\n  3 17  1  6  0  0  0\n  4 18  1  1  0  0  0\n 19  4  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21  1  1  0  0  0  0\n 20 21  1  0  0  0  0\n  4 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 24 26  1  0  0  0  0\nM  END",
        "smiles": "CC(C)C1=CC2=CC[C@@]3([H])[C@@](C)(CCC[C@]3(C)[C@@]2([H])CC1)COC(=O)C",
        "formula": "C22H34O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "330.505",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b110e60a-6d81-4919-8002-f6a38d8a78a4",
          "99701782-84ec-42ae-bb12-e6af35d58ead"
        ],
        "stereo_centers": 4
      },
      "unii": "I0S2JS6HIS"
    }
  ]
}