{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7187d48c-05e1-4bb2-b6d2-bb58be3e5b50", "code": "127474-91-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=127474-91-3", "code_system": "CAS", "references": [ "72b1084d-ba9a-40d9-8445-fa7016c3622a", "e20e3ec5-5371-4087-9323-8dfaf797cfac" ] }, { "uuid": "fcc9fdc3-eb67-4a22-801f-41eba89aae88", "code": "1363596", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1363596/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "72b1084d-ba9a-40d9-8445-fa7016c3622a" ] }, { "uuid": "37492625-2a4f-434f-89f5-73593feca0ae", "code": "9954918", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9954918", "code_system": "PUBCHEM", "references": [ "72b1084d-ba9a-40d9-8445-fa7016c3622a" ] }, { "uuid": "abd3cee4-304f-4c67-ba7a-0ddc80496508", "code": "I0DQJ7YGXM", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "327512d1-cdc4-f1b5-d5be-0d53845d771b", "code": "DTXSID20869752", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20869752", "code_system": "EPA CompTox" }, { "uuid": "bd5b0fa8-b491-c2b4-575e-1d3f4b9e04c4", "code": "I0DQJ7YGXM", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=I0DQJ7YGXM", "code_system": "DAILYMED", "references": [ "95bac0ba-f601-3ca2-c0ea-10adbc2ff241" ] } ], "substance_class": "chemical", "names": [ { "uuid": "5c139920-972e-44a2-a9d8-e53c6f007ad7", "name": "2,6-NAPHTHALENEDICARBOXYLIC ACID, 2,6-BIS(2-ETHYLHEXYL) ESTER", "stdName": "2,6-NAPHTHALENEDICARBOXYLIC ACID, 2,6-BIS(2-ETHYLHEXYL) ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "aec6e6e0-ff2d-4f0d-9168-f0e3fea08919", "4155e74a-7d81-4090-9473-48eb8ec1a5ed" ], "display_name": false }, { "uuid": "24f151ff-547b-4a73-a479-c4f998c8c46f", "name": "CORAPAN TQ 182585", "stdName": "CORAPAN TQ 182585", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "0bf316da-94b4-4971-b366-ac994101b20a", "4155e74a-7d81-4090-9473-48eb8ec1a5ed" ], "display_name": false }, { "uuid": "003900b5-9320-479b-8f33-90b7309aae39", "name": "DIETHYLHEXYL 2,6-NAPHTHALATE", "stdName": "DIETHYLHEXYL 2,6-NAPHTHALATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "fbf957a6-588a-46d4-b0db-6340ac674670", "7d852cf5-3743-4bfe-8900-21b8a7c21924", "0bf316da-94b4-4971-b366-ac994101b20a", "4155e74a-7d81-4090-9473-48eb8ec1a5ed" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "25cfe255-2bb7-4f1c-8ad4-b3f99cb3ea91", "name_org": "INCI" } ] }, { "uuid": "92f06d2a-c695-4454-8713-3e03e2bcffe1", "name": "DIOCTYL 2,6-NAPHTHALATE", "stdName": "DIOCTYL 2,6-NAPHTHALATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "0bf316da-94b4-4971-b366-ac994101b20a", "4155e74a-7d81-4090-9473-48eb8ec1a5ed" ], "display_name": false } ], "references": [ { "uuid": "0bf316da-94b4-4971-b366-ac994101b20a", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "4155e74a-7d81-4090-9473-48eb8ec1a5ed", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "aec6e6e0-ff2d-4f0d-9168-f0e3fea08919", "citation": "stn", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fbf957a6-588a-46d4-b0db-6340ac674670", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "72b1084d-ba9a-40d9-8445-fa7016c3622a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390945000, "tags": [ "NOMEN" ] }, { "uuid": "c5050034-f239-491b-9305-cca4e8d0b664", "citation": "SRS import [I0DQJ7YGXM]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I0DQJ7YGXM", "doc_type": "SRS", "public_domain": true, "document_date": 1493390945000, "tags": [ "NOMEN" ] }, { "uuid": "7d852cf5-3743-4bfe-8900-21b8a7c21924", "citation": "DIETHYLHEXYL 2,6-NAPHTHALATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "e20e3ec5-5371-4087-9323-8dfaf797cfac", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "95bac0ba-f601-3ca2-c0ea-10adbc2ff241", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "816e9ad1-61ea-931a-2d47-993e16b41509", "citation": "STARI", "doc_type": "CFSAN", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "57520f4a-36ff-afdb-9e7f-cde74dda8689", "id": "57520f4a-36ff-afdb-9e7f-cde74dda8689", "molfile": "\n Marvin 01132104322D \n\n 32 33 0 0 0 0 999 V2000\n 22.4072 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6927 -3.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9782 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2638 -3.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5493 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 19.5493 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2638 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8348 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1204 -3.6574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4059 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4059 -2.4200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6914 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6914 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9770 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2625 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5480 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8336 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8336 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5480 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2625 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9770 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1191 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1191 -5.7200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4046 -4.4824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6902 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9757 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 10.9757 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2612 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2612 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5468 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8323 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1178 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 8 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 21 2 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 20 15 2 0 0 0 0\n 16 17 2 0 0 0 0\n 18 17 1 0 0 0 0\n 17 22 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 23 2 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 29 1 0 0 0 0\n 27 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\nM END", "smiles": "CCCCC(CC)COC(=O)c1ccc2cc(ccc2c1)C(=O)OCC(CC)CCCC", "formula": "C28H40O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a5922b7f-5a74-413d-9cf3-5f4626474bf3" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "440.6159", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "61c6f66b-ebf3-4e50-88f6-052dac26a243", "version": "7", "structure": { "id": "e2cb7bb3-70fa-411b-a02a-ba0c7c6267a8", "molfile": "2,6-Naphthalenedicarboxylic acid, 2,6-bis(2-ethylhexyl) ester\n Marvin 01132111442D \n\n 32 33 0 0 0 0 999 V2000\n 17.4059 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1204 -3.6574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8348 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5493 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2638 -3.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9782 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6927 -3.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.4072 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5493 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2638 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4059 -2.4200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6914 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9770 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2625 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2625 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9770 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6914 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5480 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8336 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8336 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5480 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1191 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4046 -4.4824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6902 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9757 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2612 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5468 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8323 -4.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1178 -4.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9757 -3.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2612 -3.2450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1191 -5.7200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 4 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 1 11 2 0 0 0 0\n 1 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 12 17 1 0 0 0 0\n 15 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 20 19 2 0 0 0 0\n 21 20 1 0 0 0 0\n 14 21 2 0 0 0 0\n 19 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 25 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 22 32 2 0 0 0 0\nM END", "smiles": "CCCCC(CC)COC(=O)c1ccc2cc(ccc2c1)C(=O)OCC(CC)CCCC", "formula": "C28H40O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "440.6159", "optical_activity": "UNSPECIFIED", "references": [ "c5050034-f239-491b-9305-cca4e8d0b664", "0bf316da-94b4-4971-b366-ac994101b20a" ], "stereo_centers": 2 }, "unii": "I0DQJ7YGXM" } ] }