{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f43d1db6-9b8e-441b-a1ab-7d4373b95bf1",
          "code": "BROMACIL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bromacil",
          "code_system": "WIKIPEDIA",
          "references": [
            "c894e27d-5efa-44c3-8db2-6e24dffa234a"
          ]
        },
        {
          "uuid": "ce0628f0-11a7-4fff-8309-276dacae0dae",
          "code": "12301",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1586",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "c894e27d-5efa-44c3-8db2-6e24dffa234a"
          ]
        },
        {
          "uuid": "b912640d-a71a-4f8c-ba1a-8e9576907ba8",
          "code": "m2658",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2658?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c894e27d-5efa-44c3-8db2-6e24dffa234a"
          ]
        },
        {
          "uuid": "ca8020d5-bbca-4611-8d61-a9e3c20ec016",
          "code": "206-245-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.679",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c894e27d-5efa-44c3-8db2-6e24dffa234a"
          ]
        },
        {
          "uuid": "a3f7f066-87d8-4675-af27-74f79fbf7706",
          "code": "9411",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9411",
          "code_system": "PUBCHEM",
          "references": [
            "c894e27d-5efa-44c3-8db2-6e24dffa234a"
          ]
        },
        {
          "uuid": "ceeb3ab3-c97d-4c9a-a2aa-d19879dd9c09",
          "code": "314-40-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=314-40-9",
          "code_system": "CAS",
          "references": [
            "c894e27d-5efa-44c3-8db2-6e24dffa234a",
            "be37e3e5-f06f-4bc7-bc38-e7c239ae5b24"
          ]
        },
        {
          "uuid": "6d7002d9-d80b-4d55-8c22-ec241c2fcef9",
          "code": "C004590",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67004590",
          "code_system": "MESH",
          "references": [
            "c894e27d-5efa-44c3-8db2-6e24dffa234a"
          ]
        },
        {
          "uuid": "3b755fed-c12e-bb7f-449e-080086eb0194",
          "code": "1522",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1522",
          "code_system": "HSDB",
          "references": [
            "8e0d62b8-5659-acd8-992d-1943f1fdb665"
          ]
        },
        {
          "uuid": "6305acb8-1165-8f35-ceae-c1e0fd8b832e",
          "code": "DTXSID4022020",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4022020",
          "code_system": "EPA CompTox",
          "references": [
            "56e9c65d-e929-4a05-536e-e10afb2dccf1"
          ]
        },
        {
          "uuid": "5cf0fbea-0e1b-4740-8932-b737d5c65844",
          "code": "I048FFR2J0",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "31505d90-ad1a-57c3-56b4-6cb57e13812b",
          "code": "3177",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3177",
          "code_system": "CHEBI",
          "references": [
            "dca3f7e6-d1b9-8174-9065-94604f339a9d"
          ]
        },
        {
          "uuid": "b29bf9dc-902f-f891-fb48-3ac7de5c2a3a",
          "code": "100000176882",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1014647a-7912-178e-630f-d0a68d57d173"
          ]
        },
        {
          "uuid": "b7e0c466-7c44-2da6-9d18-e36e89ecea6b",
          "code": "bromacil",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/bromacil.html",
          "code_system": "ALANWOOD",
          "references": [
            "1f841e10-19df-bd3e-add1-d5ce2f14f6f4"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "3c26a4b6-c440-4527-84ec-ce0f6ef5098f",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "906d4eb6-9f7b-4682-9bc1-971da3c2842d",
            "refuuid": "fcb87e19-2e2e-41ee-b32e-9d88c79619e8",
            "name": "BROMACIL",
            "unii": "I048FFR2J0",
            "linking_id": "I048FFR2J0",
            "ref_pname": "BROMACIL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2fb2f7e6-9551-4983-a3d3-3766682fea18",
          "name": "(RS)-5-BROMO-3-SEC-BUTYL-6-METHYLURACIL",
          "stdName": "(RS)-5-BROMO-3-SEC-BUTYL-6-METHYLURACIL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc912380-806f-4142-85bf-2b101593ade3",
            "644d2505-4cd7-4228-8a95-35915e56d383"
          ],
          "display_name": false
        },
        {
          "uuid": "e9f258d7-6968-47a0-8c7a-63c819acf90e",
          "name": "(±)-BROMACIL",
          "stdName": "(+/-)-BROMACIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64d91c16-82fd-42f5-ab47-866669f819b6"
          ],
          "display_name": false
        },
        {
          "uuid": "8650164e-7ce8-4603-9600-2402b2924693",
          "name": "5-BROMO-6-METHYL-3-(1-METHYLPROPYL)-2,4(1H,3H)-PYRIMIDINEDIONE",
          "stdName": "5-BROMO-6-METHYL-3-(1-METHYLPROPYL)-2,4(1H,3H)-PYRIMIDINEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b413a95f-8446-4b33-b56c-92b7bdacec87",
            "644d2505-4cd7-4228-8a95-35915e56d383"
          ],
          "display_name": false
        },
        {
          "uuid": "8304e660-1c90-4a0f-8aa0-e3becabfbf85",
          "name": "BROMACIL",
          "stdName": "BROMACIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b9eac44-d24c-4b5e-9971-e9a4009bd22e",
            "eed0ad67-e19d-4ffe-8f86-ea305bddf109",
            "b6861105-6646-43bc-8126-ad47d2328a1a",
            "3e81b1d5-0ee1-426f-87db-7d110b6b0199",
            "92de57f9-a991-4b12-88a7-6dc0f10ac0be",
            "262ec523-a433-46f9-97d3-29302124f485",
            "c6904fc4-72b5-4b3b-bc13-f37a03b3af22"
          ],
          "display_name": true
        },
        {
          "uuid": "f2d57dd7-1bdc-4b3f-b960-2d4085818783",
          "name": "BROMACIL [HSDB]",
          "stdName": "BROMACIL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e81b1d5-0ee1-426f-87db-7d110b6b0199"
          ],
          "display_name": false
        },
        {
          "uuid": "9e49e973-e203-422d-92ce-c643d1e92eee",
          "name": "BROMACIL [ISO]",
          "stdName": "BROMACIL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6904fc4-72b5-4b3b-bc13-f37a03b3af22"
          ],
          "display_name": false
        },
        {
          "uuid": "3500c94c-044f-4f78-aeb9-10d664ffe1b2",
          "name": "BROMACIL [MI]",
          "stdName": "BROMACIL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "262ec523-a433-46f9-97d3-29302124f485"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9b9eac44-d24c-4b5e-9971-e9a4009bd22e",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "644d2505-4cd7-4228-8a95-35915e56d383",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dc912380-806f-4142-85bf-2b101593ade3",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b413a95f-8446-4b33-b56c-92b7bdacec87",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "262ec523-a433-46f9-97d3-29302124f485",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e81b1d5-0ee1-426f-87db-7d110b6b0199",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64d91c16-82fd-42f5-ab47-866669f819b6",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6904fc4-72b5-4b3b-bc13-f37a03b3af22",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c894e27d-5efa-44c3-8db2-6e24dffa234a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391927000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46580c76-b323-46bb-a86f-f484f7c103dd",
          "citation": "SRS import [I048FFR2J0]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I048FFR2J0",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391927000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20ab245c-0b76-441e-9c64-7e5df28ba2f1",
          "citation": "MI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6861105-6646-43bc-8126-ad47d2328a1a",
          "citation": "BROMACIL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eed0ad67-e19d-4ffe-8f86-ea305bddf109",
          "citation": "BROMACIL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "92de57f9-a991-4b12-88a7-6dc0f10ac0be",
          "citation": "BROMACIL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8e0d62b8-5659-acd8-992d-1943f1fdb665",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+314-40-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "56e9c65d-e929-4a05-536e-e10afb2dccf1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=314-40-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1f841e10-19df-bd3e-add1-d5ce2f14f6f4",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "be37e3e5-f06f-4bc7-bc38-e7c239ae5b24",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "dca3f7e6-d1b9-8174-9065-94604f339a9d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1014647a-7912-178e-630f-d0a68d57d173",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c483f77b-e6b0-492e-ab8b-4860ad07e5c1",
          "id": "c483f77b-e6b0-492e-ab8b-4860ad07e5c1",
          "molfile": "\n  Marvin  01132110102D          \n\n 14 14  0  0  0  0            999 V2000\n    1.7766   -0.6155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4904   -1.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4904   -1.8568    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.7766   -2.2680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2041   -2.2680    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2041   -3.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4904   -3.5093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9179   -3.5093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6290   -3.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3454   -3.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6290   -2.2680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3454   -1.8568    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    3.9179   -1.8568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9179   -1.0318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n 13  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  2  0  0  0  0\nM  END",
          "smiles": "CCC(C)n1c(=O)c(c(C)[nH]c1=O)Br",
          "formula": "C9H13BrN2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "967fb75e-6eee-4ce9-aa4d-4b569557b2e0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "261.1156",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fcb87e19-2e2e-41ee-b32e-9d88c79619e8",
      "version": "7",
      "structure": {
        "id": "c5cb3bdd-c445-49e0-acf1-0102594d2f50",
        "molfile": "\n  Marvin  01132110132D          \n\n 14 14  0  0  0  0            999 V2000\n    3.2041   -2.2680    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9179   -1.8568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2041   -3.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6290   -2.2680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9179   -3.5093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6290   -3.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4904   -3.5093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9179   -1.0318    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4904   -1.8568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3454   -1.8568    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    5.3454   -3.5093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4904   -1.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7766   -2.2680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7766   -0.6155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  3  2  0  0  0  0\n  8  2  2  0  0  0  0\n  9  1  1  0  0  0  0\n 10  4  1  0  0  0  0\n 11  6  1  0  0  0  0\n  9 12  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14 12  1  0  0  0  0\n  4  6  2  0  0  0  0\nM  END",
        "smiles": "CCC(C)n1c(=O)c(c(C)[nH]c1=O)Br",
        "formula": "C9H13BrN2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "261.1156",
        "optical_activity": "( + / - )",
        "references": [
          "46580c76-b323-46bb-a86f-f484f7c103dd",
          "20ab245c-0b76-441e-9c64-7e5df28ba2f1"
        ],
        "stereo_centers": 1
      },
      "unii": "I048FFR2J0"
    }
  ]
}