{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "946ee168-1f19-4499-8191-b224e14fd139",
          "code": "142880-36-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=142880-36-2",
          "code_system": "CAS",
          "references": [
            "f45ae709-42b6-4e82-b917-f7ef11c3eada",
            "cb451629-3ce1-489b-aae4-b84a03b7465d"
          ]
        },
        {
          "uuid": "2aae2d04-138f-4cfd-a09a-b5f6f037bc62",
          "code": "C96286",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C96286",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f45ae709-42b6-4e82-b917-f7ef11c3eada"
          ]
        },
        {
          "uuid": "65db9ced-070c-4afd-9b31-87f273c7760c",
          "code": "C119203",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67119203",
          "code_system": "MESH",
          "references": [
            "f45ae709-42b6-4e82-b917-f7ef11c3eada"
          ]
        },
        {
          "uuid": "16023d22-5d09-4133-970e-709975390e50",
          "code": "GM6001",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/GM6001",
          "code_system": "WIKIPEDIA",
          "references": [
            "f45ae709-42b6-4e82-b917-f7ef11c3eada"
          ]
        },
        {
          "uuid": "259dd125-c61e-4ba6-ab3a-c8f900d4909a",
          "code": "SUB08133MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f45ae709-42b6-4e82-b917-f7ef11c3eada"
          ]
        },
        {
          "uuid": "c985510f-56bd-4d98-8bde-dc5c5bc3f23e",
          "code": "7383",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=7383",
          "code_system": "INN",
          "references": [
            "f45ae709-42b6-4e82-b917-f7ef11c3eada"
          ]
        },
        {
          "uuid": "ad17eec2-e8c1-4c97-b2b3-b09dcef7d5b4",
          "code": "1368877",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1368877/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "f45ae709-42b6-4e82-b917-f7ef11c3eada"
          ]
        },
        {
          "uuid": "a56356f7-f479-41ce-af68-f3280caf777d",
          "code": "CHEMBL19611",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL19611",
          "code_system": "ChEMBL",
          "references": [
            "f45ae709-42b6-4e82-b917-f7ef11c3eada"
          ]
        },
        {
          "uuid": "c9cf97fe-69c6-4954-af60-880f47dd484f",
          "code": "132519",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/132519",
          "code_system": "PUBCHEM",
          "references": [
            "f45ae709-42b6-4e82-b917-f7ef11c3eada"
          ]
        },
        {
          "uuid": "fa9da079-43f7-2d2f-3676-605b1aacec63",
          "code": "DTXSID0046353",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0046353",
          "code_system": "EPA CompTox",
          "references": [
            "345f8c9c-31fc-2913-fedb-5e7fea0b4153"
          ]
        },
        {
          "uuid": "324b7760-5c65-9817-9512-9afd15630a8a",
          "code": "63991",
          "comments": "ORPHAN DRUG|Designated|Treatment of corneal ulcers.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=63991",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "af240d6b-ad7c-53c0-9b3a-06810ead2d63",
          "code": "C1970",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Angiogenesis Inhibitor[C1742]|Matrix Metalloproteinase Inhibitor",
          "codeText": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Angiogenesis Inhibitor[C1742]|Matrix Metalloproteinase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1970",
          "code_system": "NCI_THESAURUS",
          "references": [
            "986c13e7-c5b8-d802-71d3-0151214ba804"
          ]
        },
        {
          "uuid": "c3d0c66e-56e1-471a-8c25-340f17d75df9",
          "code": "I0403ML141",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "916f4576-8d4c-195a-8156-c9723bc30ee0",
          "code": "DB02255",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB02255",
          "code_system": "DRUG BANK",
          "references": [
            "986c13e7-c5b8-d802-71d3-0151214ba804"
          ]
        },
        {
          "uuid": "333f7d08-5168-9764-87cb-8b38e2d08cb3",
          "code": "137236",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:137236",
          "code_system": "CHEBI",
          "references": [
            "986c13e7-c5b8-d802-71d3-0151214ba804"
          ]
        },
        {
          "uuid": "95646767-d471-ddfe-a1b2-1e1ff0cc8a51",
          "code": "GG-32",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/GG-32/relevant/1/",
          "code_system": "USAN",
          "references": [
            "cfa826d3-8c80-ca07-fbb8-d76935858192"
          ]
        },
        {
          "uuid": "d40e4416-c02a-e365-93c1-9c30227c0f8c",
          "code": "100000083685",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2f5e9f01-3cb2-eea6-f74c-25b6d7646815"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b679f3eb-048f-4aac-b114-c9d98516ca56",
          "amount": {
            "uuid": "ce6bbac1-e056-4d76-a4ac-d6b9b482db7d"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "9e9fd203-56b8-4d92-bb7c-2bdb7f16b459",
            "refuuid": "896bfb3f-cb07-4b70-838f-d2b727307d0c",
            "name": "ILOMASTAT",
            "unii": "I0403ML141",
            "linking_id": "I0403ML141",
            "ref_pname": "ILOMASTAT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "946d09c4-abaf-484d-877c-cbcb70855c30",
          "amount": {
            "uuid": "984737b2-a036-4900-8b2a-f5ef722e12b7",
            "average": 13.4,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "423986c7-49b0-434e-9ab2-5d7670de35e9"
          ],
          "related_substance": {
            "uuid": "28697ac3-c581-4017-b807-020d093c951a",
            "refuuid": "b872a5f4-2ef8-4d14-aa5f-497bcb2899eb",
            "name": "MATRIX METALLOPROTEINASE-14",
            "unii": "WB7H35ST8W",
            "linking_id": "WB7H35ST8W",
            "ref_pname": "MATRIX METALLOPROTEINASE-14",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c98ac4c3-1f15-4776-b524-075592e99a4b",
          "amount": {
            "uuid": "5897df14-8f45-494c-815a-2bbe3e5bea4a",
            "average": 0.5,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "423986c7-49b0-434e-9ab2-5d7670de35e9"
          ],
          "related_substance": {
            "uuid": "21caebef-8136-4138-9a21-dd940fd70897",
            "refuuid": "cf4cdac5-1903-4137-ab4d-c713d155f97f",
            "name": "MATRIX METALLOPROTEINASE-9",
            "unii": "8G0WF52PHC",
            "linking_id": "8G0WF52PHC",
            "ref_pname": "MATRIX METALLOPROTEINASE-9",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b26bb1ad-9a8b-44a7-aa86-6515654cfa62",
          "amount": {
            "uuid": "c7530b1f-ea45-403d-a630-0fc44e0bddf7",
            "average": 1.9,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "423986c7-49b0-434e-9ab2-5d7670de35e9"
          ],
          "related_substance": {
            "uuid": "3ff07bf8-496e-4d9b-b143-312f95944b67",
            "refuuid": "16bdb576-a97d-4186-bbd8-52682e0c0160",
            "name": "STROMELYSIN-1",
            "unii": "5J92C3EKX9",
            "linking_id": "5J92C3EKX9",
            "ref_pname": "STROMELYSIN-1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f1e19e5a-a393-44ff-8ae1-a6685a02a7ab",
          "amount": {
            "uuid": "0912411e-7ae2-428a-8177-8a98e195fc3a",
            "average": 1.1,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "423986c7-49b0-434e-9ab2-5d7670de35e9"
          ],
          "related_substance": {
            "uuid": "f53f31dd-35d8-45b2-a2cc-4639882ae46b",
            "refuuid": "b59f48ed-91e1-4a1a-bb2a-45ad0a9f84c5",
            "name": "72 KDA TYPE IV COLLAGENASE",
            "unii": "CHL7O0O94A",
            "linking_id": "CHL7O0O94A",
            "ref_pname": "72 KDA TYPE IV COLLAGENASE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "582a9356-2a0f-4bbb-8138-554018fbb331",
          "amount": {
            "uuid": "96ce9b68-c406-46d7-9f65-290648403f59",
            "average": 1.5,
            "units": "NANOMOLAR"
          },
          "qualification": "IC50",
          "type": "TARGET->INHIBITOR",
          "references": [
            "423986c7-49b0-434e-9ab2-5d7670de35e9"
          ],
          "related_substance": {
            "uuid": "2f69b159-fb14-413b-9247-4e78e7195148",
            "refuuid": "ed79e7ff-6bb1-468d-b152-fc220b716b72",
            "name": "INTERSTITIAL COLLAGENASE",
            "unii": "20Q1PNI82X",
            "linking_id": "20Q1PNI82X",
            "ref_pname": "INTERSTITIAL COLLAGENASE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1358fcf9-9c75-4d15-86b3-323ffda0fbe2",
          "name": "(R)-N(SUP 1)-HYDROXY-N-((S)-2-INDOL-3-YL-1-(METHYLCARBAMOYL)ETHYL)-2-ISOBUTYLSUCCINAMIDE",
          "stdName": "(R)-N(SUP 1)-HYDROXY-N-((S)-2-INDOL-3-YL-1-(METHYLCARBAMOYL)ETHYL)-2-ISOBUTYLSUCCINAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cf3c0a3-1dc3-422f-bd5b-a84a8e2efbca"
          ],
          "display_name": false
        },
        {
          "uuid": "f229237e-87ca-4cf1-8a48-e05ba929cad5",
          "name": "(S-(R*,S*))-N(SUP 4)-HYDROXY-N(SUP 1)-(1H-INDOL-3-YLMETHYL)-2-(METHYLAMINO)-2-OXOETHYL)-2-(2-METHYLOPROPYL)BUTANEDIAMIDE",
          "stdName": "(S-(R*,S*))-N(SUP 4)-HYDROXY-N(SUP 1)-(1H-INDOL-3-YLMETHYL)-2-(METHYLAMINO)-2-OXOETHYL)-2-(2-METHYLOPROPYL)BUTANEDIAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cf3c0a3-1dc3-422f-bd5b-a84a8e2efbca"
          ],
          "display_name": false
        },
        {
          "uuid": "2380a06e-268d-4147-99b4-3aa36fb9f8a3",
          "name": "GALARDIN",
          "stdName": "GALARDIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c28a125f-8094-41b1-8160-910f2349a947",
            "cae0a349-4ee5-4622-95ea-c86e8e05cf03"
          ],
          "display_name": false
        },
        {
          "uuid": "9bd4b377-1d59-4112-9946-da8fa2e38bb8",
          "name": "GM6001",
          "stdName": "GM6001",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c28a125f-8094-41b1-8160-910f2349a947",
            "cae0a349-4ee5-4622-95ea-c86e8e05cf03"
          ],
          "display_name": false
        },
        {
          "uuid": "2bf92d26-c3ba-4f37-86eb-643145dcb37f",
          "name": "ILOMASTAT",
          "stdName": "ILOMASTAT",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4c7afc5-980c-4c66-9e48-0136321343b6",
            "e5c84669-2a3d-4482-ac67-95129498ff9d",
            "13cdf03d-e40f-4266-9ca9-543dcdac9e68",
            "57355047-ffd3-4cba-b453-52cecbc018b6",
            "dcbf229b-664b-4e15-bc2a-36c90d37a2ec",
            "cae0a349-4ee5-4622-95ea-c86e8e05cf03",
            "4850ee49-5b4b-4395-9a28-95e9ee3569f5",
            "2135d4ce-7d07-4d84-b0d5-37c48dfdcb3a"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "24b1cb8f-0579-4fdf-a130-d44655d2f010",
              "name_org": "INN"
            },
            {
              "uuid": "fa50ae3b-58bb-46be-9c18-5591babb55f2",
              "name_org": "USAN"
            },
            {
              "uuid": "4f55c573-6c96-4a26-b77d-90993e5e6638",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "c2a0eb38-c564-4da9-b823-e249c4d44a29",
          "name": "ILOMASTAT [USAN]",
          "stdName": "ILOMASTAT [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2135d4ce-7d07-4d84-b0d5-37c48dfdcb3a"
          ],
          "display_name": false
        },
        {
          "uuid": "224a39a8-3b4a-418a-9063-aacb4ffb3365",
          "name": "ilomastat [INN]",
          "stdName": "ILOMASTAT [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4c7afc5-980c-4c66-9e48-0136321343b6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e5c84669-2a3d-4482-ac67-95129498ff9d",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1cf3c0a3-1dc3-422f-bd5b-a84a8e2efbca",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4c7afc5-980c-4c66-9e48-0136321343b6",
          "citation": "INN Proposed List 73",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL73.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2135d4ce-7d07-4d84-b0d5-37c48dfdcb3a",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dcbf229b-664b-4e15-bc2a-36c90d37a2ec",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cae0a349-4ee5-4622-95ea-c86e8e05cf03",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c28a125f-8094-41b1-8160-910f2349a947",
          "citation": "http://en.wikipedia.org/wiki/GM6001",
          "url": "http://en.wikipedia.org/wiki/GM6001",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f45ae709-42b6-4e82-b917-f7ef11c3eada",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389912000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58efc10a-1439-4ba1-8a59-49281c188dfc",
          "citation": "SRS import [I0403ML141]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I0403ML141",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389912000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13cdf03d-e40f-4266-9ca9-543dcdac9e68",
          "citation": "ILOMASTAT [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "57355047-ffd3-4cba-b453-52cecbc018b6",
          "citation": "ILOMASTAT [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4850ee49-5b4b-4395-9a28-95e9ee3569f5",
          "citation": "ILOMASTAT [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "345f8c9c-31fc-2913-fedb-5e7fea0b4153",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=142880-36-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "986c13e7-c5b8-d802-71d3-0151214ba804",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "cb451629-3ce1-489b-aae4-b84a03b7465d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "cfa826d3-8c80-ca07-fbb8-d76935858192",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "6f9b0033-3dbe-c0c8-53b6-9bfa4af6aa01",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "2f5e9f01-3cb2-eea6-f74c-25b6d7646815",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "423986c7-49b0-434e-9ab2-5d7670de35e9",
          "citation": "https://www.sciencedirect.com/topics/chemistry/ilomastat",
          "url": "https://www.sciencedirect.com/topics/chemistry/ilomastat",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "720728b2-bb0d-488b-9b8b-6371c4c1b3ff",
          "id": "720728b2-bb0d-488b-9b8b-6371c4c1b3ff",
          "molfile": "\n  Marvin  01132105552D          \n\n 28 29  0  0  1  0            999 V2000\n    3.5001   -1.0951    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.5001   -0.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2146    0.1365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9292   -0.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2146    0.9586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7856   -1.5047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0711   -1.0951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0711   -0.2730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3565   -1.5047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6389   -1.0922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2146   -1.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2117   -2.3325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9292   -1.1009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6437   -1.5134    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.6380   -2.3383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3525   -2.7508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0205   -2.2686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6887   -2.7536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4331   -3.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8484   -4.2554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4360   -4.9729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6052   -4.9729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1928   -4.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6081   -3.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3583   -1.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3583   -0.2818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0728   -1.5134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7874   -1.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  6  1  1  0  0  0  0\n  1 11  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 13  1  0  0  0  0\n 14 13  1  6  0  0  0\n 14 15  1  0  0  0  0\n 14 25  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 24 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 24  2  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 25  1  0  0  0  0\n 28 27  1  0  0  0  0\nM  END",
          "smiles": "CC(C)C[C@H](CC(=O)NO)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NC",
          "formula": "C20H28N4O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ece4b002-643f-4bbf-8a78-96f48f93e49c"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "388.4615",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "896bfb3f-cb07-4b70-838f-d2b727307d0c",
      "version": "18",
      "structure": {
        "id": "9904cc1c-c8ac-4a77-948e-f437f8631608",
        "molfile": "\n  Marvin  01132107572D          \n\n 28 29  0  0  1  0            999 V2000\n    6.3525   -2.7508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2146   -1.5104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6887   -2.7536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9292   -1.1009    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0205   -2.2686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6437   -1.5134    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.3583   -1.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6081   -3.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6380   -2.3383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5001   -1.0951    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.4331   -3.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0711   -1.0951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7856   -1.5047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2117   -2.3325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3583   -0.2818    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5001   -0.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0711   -0.2730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0728   -1.5134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3565   -1.5047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6389   -1.0922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1928   -4.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2146    0.1365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8484   -4.2554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7874   -1.1038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9292   -0.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2146    0.9586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6052   -4.9729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4360   -4.9729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  9  1  6  0  0  0\n  7  6  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  8  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 10  1  0  0  0  0\n 14  2  2  0  0  0  0\n 15  7  2  0  0  0  0\n 10 16  1  1  0  0  0\n 17 12  2  0  0  0  0\n 18  7  1  0  0  0  0\n 19 12  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21  8  1  0  0  0  0\n 22 16  1  0  0  0  0\n 23 11  1  0  0  0  0\n 24 18  1  0  0  0  0\n 25 22  1  0  0  0  0\n 26 22  1  0  0  0  0\n 27 21  2  0  0  0  0\n 28 23  2  0  0  0  0\n 11  3  1  0  0  0  0\n 27 28  1  0  0  0  0\nM  END",
        "smiles": "CC(C)C[C@H](CC(=O)NO)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NC",
        "formula": "C20H28N4O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "388.4615",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "58efc10a-1439-4ba1-8a59-49281c188dfc",
          "2135d4ce-7d07-4d84-b0d5-37c48dfdcb3a",
          "e4c7afc5-980c-4c66-9e48-0136321343b6"
        ],
        "stereo_centers": 2
      },
      "unii": "I0403ML141"
    }
  ]
}