{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d7cbbae5-5614-478c-82ef-662e461d9775",
          "code": "N03AX03",
          "comments": "ATC|NERVOUS SYSTEM|ANTIEPILEPTICS|ANTIEPILEPTICS|Other antiepileptics|sultiame",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N03AX03&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "4e883dbb-f992-4dd8-9676-c93f0cc23b14"
          ]
        },
        {
          "uuid": "fb4f0b85-ef74-4e5c-8f26-833cc89529d6",
          "code": "QN03AX03",
          "comments": "VATC|ANTIEPILEPTICS|ANTIEPILEPTICS|Other antiepileptics|sultiame",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN03AX03&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "4e883dbb-f992-4dd8-9676-c93f0cc23b14"
          ]
        },
        {
          "uuid": "e5b8b131-ce8c-41b4-aade-25c110220186",
          "code": "61-56-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=61-56-3",
          "code_system": "CAS",
          "references": [
            "4e883dbb-f992-4dd8-9676-c93f0cc23b14",
            "63412437-6d28-47c5-8a82-1e7376989f6c"
          ]
        },
        {
          "uuid": "5d603e8b-63d4-4700-8450-f7593b92b527",
          "code": "C084593",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67084593",
          "code_system": "MESH",
          "references": [
            "4e883dbb-f992-4dd8-9676-c93f0cc23b14"
          ]
        },
        {
          "uuid": "99291880-5018-44b7-9464-e3924925af52",
          "code": "SUB10762MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4e883dbb-f992-4dd8-9676-c93f0cc23b14"
          ]
        },
        {
          "uuid": "5f111cd2-d26c-498c-acda-6bf4ae11a339",
          "code": "1434",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1434",
          "code_system": "INN",
          "references": [
            "4e883dbb-f992-4dd8-9676-c93f0cc23b14"
          ]
        },
        {
          "uuid": "9ee2a693-7c38-48e4-bba7-5c428e4f004c",
          "code": "200-511-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.465",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4e883dbb-f992-4dd8-9676-c93f0cc23b14"
          ]
        },
        {
          "uuid": "ccbba3ad-0c7a-4ed3-8340-be6349d32246",
          "code": "10240",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/10240/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4e883dbb-f992-4dd8-9676-c93f0cc23b14"
          ]
        },
        {
          "uuid": "ac07fb8a-7a91-47e4-ac8a-0fdd8dc2051e",
          "code": "m10392",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10392?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4e883dbb-f992-4dd8-9676-c93f0cc23b14"
          ]
        },
        {
          "uuid": "0879eb46-cedc-44f5-b6c2-f75930eadde8",
          "code": "CHEMBL328560",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL328560",
          "code_system": "ChEMBL",
          "references": [
            "4e883dbb-f992-4dd8-9676-c93f0cc23b14"
          ]
        },
        {
          "uuid": "cf491c34-ca99-4f8e-a693-e5730b8988d6",
          "code": "5356",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5356",
          "code_system": "PUBCHEM",
          "references": [
            "4e883dbb-f992-4dd8-9676-c93f0cc23b14"
          ]
        },
        {
          "uuid": "099a1a47-bd04-7648-5005-126b7fc1db17",
          "code": "DTXSID4023626",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4023626",
          "code_system": "EPA CompTox",
          "references": [
            "bf23b7af-c9fb-6fc7-ec2a-d05ef9625ffa"
          ]
        },
        {
          "uuid": "5e1d63a6-1519-baba-b19e-7f2f8caef8f5",
          "code": "401213",
          "comments": "ORPHAN DRUG|Designated/Withdrawn|Treatment of patients with benign epilepsy of childhood with centrotemporal spikes (BECTS) also known as rolandic epilepsy",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=401213",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "3b17f290-a2a4-2a38-6eb0-c6ce8d2b1f6e",
          "code": "C152469",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C152469",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f72ede3a-0b42-d95e-c44c-4ce04be681d9"
          ]
        },
        {
          "uuid": "b990843a-1080-4976-9141-d4abbc664933",
          "code": "C264",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anticonvulsant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C264",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e76ddb3e-f9fc-8c95-9269-2be333bb50f8"
          ]
        },
        {
          "uuid": "466fe23f-e067-4f58-b566-aef803b92c20",
          "code": "I00Q766CZ2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c8e8cc62-0366-00a2-340b-fe921f277afb",
          "code": "2540",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2540",
          "code_system": "DRUG CENTRAL",
          "references": [
            "e76ddb3e-f9fc-8c95-9269-2be333bb50f8"
          ]
        },
        {
          "uuid": "8b0b7e3d-0941-e35a-d7da-aa2b89c6fe98",
          "code": "DB08329",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB08329",
          "code_system": "DRUG BANK",
          "references": [
            "e76ddb3e-f9fc-8c95-9269-2be333bb50f8"
          ]
        },
        {
          "uuid": "df4bef59-ee0b-1fb1-66ab-1ff9ca5af809",
          "code": "Sultiame",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sultiame",
          "code_system": "WIKIPEDIA",
          "references": [
            "f1f95cb9-f6ed-e9c6-1fb3-28b43f347191"
          ]
        },
        {
          "uuid": "1e12e2ed-834e-4c15-6c11-efc2087b2553",
          "code": "100000088819",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "830e05d5-1e42-c130-ae80-08410f991b7b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f2cfb3fb-9603-4a18-8aaf-b05192beb78d",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "01372103-7884-4cbf-b3cb-6a4d492f75a9",
            "refuuid": "0a5c8b0a-6e21-4a1b-af4d-cd8636b01dac",
            "name": "SULTHIAME",
            "unii": "I00Q766CZ2",
            "linking_id": "I00Q766CZ2",
            "ref_pname": "SULTHIAME",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b011a34e-7d4a-49e4-b291-334b5d2ec5a7",
          "name": "4-(Tetrahydro-2H-1,2-thiazin-2-yl)benzenesulfonamide, S,S-dioxide",
          "stdName": "4-(TETRAHYDRO-2H-1,2-THIAZIN-2-YL)BENZENESULFONAMIDE, S,S-DIOXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3692a028-9597-40f9-9c9b-4650184d3f1c"
          ],
          "display_name": false
        },
        {
          "uuid": "eace3826-84a0-4602-a47c-8d4e926f08cb",
          "name": "BENZENESULFONAMIDE, 4-(TETRAHYDRO-2H-1,2-THIAZIN-2-YL)-, S,S-DIOXIDE",
          "stdName": "BENZENESULFONAMIDE, 4-(TETRAHYDRO-2H-1,2-THIAZIN-2-YL)-, S,S-DIOXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f49c50e4-3e9d-4028-a0aa-6dc8e511bd62"
          ],
          "display_name": false
        },
        {
          "uuid": "f718589d-c9f7-4623-97d9-d8f2790dbc05",
          "name": "CONADIL",
          "stdName": "CONADIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f49c50e4-3e9d-4028-a0aa-6dc8e511bd62"
          ],
          "display_name": false
        },
        {
          "uuid": "5105340d-be1e-452b-b671-602c4c6f31e0",
          "name": "OSPOLOT",
          "stdName": "OSPOLOT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "df01c1f1-c519-43f1-a525-36630a6b9f7c",
            "e6e45ead-5ab1-4e68-89df-231e918ff0ad"
          ],
          "display_name": false
        },
        {
          "uuid": "72e56baf-fced-4dc4-b750-9058cc93d2cb",
          "name": "P-(TETRAHYDRO-2H-1,2-THIAZIN-2-YL)BENZENESULFONAMIDE, S,S-DIOXIDE",
          "stdName": "P-(TETRAHYDRO-2H-1,2-THIAZIN-2-YL)BENZENESULFONAMIDE, S,S-DIOXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f49c50e4-3e9d-4028-a0aa-6dc8e511bd62"
          ],
          "display_name": false
        },
        {
          "uuid": "e7e2db0f-82cc-4b1a-9036-2a28394e582c",
          "name": "RIKER 594",
          "stdName": "RIKER 594",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f49c50e4-3e9d-4028-a0aa-6dc8e511bd62"
          ],
          "display_name": false
        },
        {
          "uuid": "bf850993-96e4-4b11-a3fd-04dfd8a59547",
          "name": "RIKER-594",
          "stdName": "RIKER-594",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f49c50e4-3e9d-4028-a0aa-6dc8e511bd62"
          ],
          "display_name": false
        },
        {
          "uuid": "f8ca2ff2-cfe4-40b1-ad3c-63d49402d175",
          "name": "SULTHIAME",
          "stdName": "SULTHIAME",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a69affc-fe66-468e-a06f-117b95a5d6b7",
            "32d7b3a9-4de4-4993-b129-4611540cf683",
            "022816f4-992f-42c1-a9f8-c1854d993d81",
            "97f0c3c8-5735-45e3-808c-8b0a7252ae10",
            "887bb3fc-e9f7-490f-a599-2528da33ab48"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "4ff37fd0-03c9-4775-900e-df1efd4c87b6",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "199333fe-899e-48d8-9064-2a2aea133305",
          "name": "SULTHIAME [MI]",
          "stdName": "SULTHIAME [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97f0c3c8-5735-45e3-808c-8b0a7252ae10"
          ],
          "display_name": false
        },
        {
          "uuid": "a9ab6335-5bd7-4547-ac00-e8ecb694d377",
          "name": "SULTHIAME [USAN]",
          "stdName": "SULTHIAME [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a69affc-fe66-468e-a06f-117b95a5d6b7"
          ],
          "display_name": false
        },
        {
          "uuid": "092875ba-37cb-49b4-8c23-02f23fbe771e",
          "name": "SULTIAME",
          "stdName": "SULTIAME",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1164a7fa-d5b9-48c7-97ce-92d1c2e787a4",
            "b1b3b5c6-f6dc-428c-b258-265fec16746e",
            "d9d3c8a8-9f13-4425-8ad1-100ca2f9c698",
            "448a9e31-0d54-473f-816b-aceb3001db1c",
            "9114217c-27e7-4d0a-9532-d42784ba2821",
            "3768564c-59ef-44f3-9817-605fa2973f6d",
            "cc47f5c7-8ff1-4b4b-af6c-090b3506be40"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "81cccee0-191b-4075-8940-1f01916df706",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "08523925-49f7-4b54-9f5c-f2ff52e164fb",
          "name": "SULTIAME [JAN]",
          "stdName": "SULTIAME [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a086cd50-7d92-bffb-c105-88bb3a529484"
          ],
          "display_name": false
        },
        {
          "uuid": "18719c33-e595-4207-8a8a-627bb58f95d4",
          "name": "SULTIAME [MART.]",
          "stdName": "SULTIAME [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1b3b5c6-f6dc-428c-b258-265fec16746e"
          ],
          "display_name": false
        },
        {
          "uuid": "1ca96333-42dd-5b03-5a5e-56bb936c4074",
          "name": "Sultiame [WHO-DD]",
          "stdName": "SULTIAME [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c89e2002-041a-fa2a-2a36-fa253331427d"
          ],
          "display_name": false
        },
        {
          "uuid": "1fe3ba00-650b-447b-80a1-f0c28fb14855",
          "name": "TROLONE",
          "stdName": "TROLONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f49c50e4-3e9d-4028-a0aa-6dc8e511bd62"
          ],
          "display_name": false
        },
        {
          "uuid": "12184f9b-12fd-4361-8499-ac0dced81161",
          "name": "sultiame [INN]",
          "stdName": "SULTIAME [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc47f5c7-8ff1-4b4b-af6c-090b3506be40"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "887bb3fc-e9f7-490f-a599-2528da33ab48",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3692a028-9597-40f9-9c9b-4650184d3f1c",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f49c50e4-3e9d-4028-a0aa-6dc8e511bd62",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9114217c-27e7-4d0a-9532-d42784ba2821",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc47f5c7-8ff1-4b4b-af6c-090b3506be40",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0a69affc-fe66-468e-a06f-117b95a5d6b7",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1b3b5c6-f6dc-428c-b258-265fec16746e",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "97f0c3c8-5735-45e3-808c-8b0a7252ae10",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6e45ead-5ab1-4e68-89df-231e918ff0ad",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "df01c1f1-c519-43f1-a525-36630a6b9f7c",
          "citation": "D01787",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1164a7fa-d5b9-48c7-97ce-92d1c2e787a4",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e883dbb-f992-4dd8-9676-c93f0cc23b14",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389661000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e3c7e41-d339-4e1d-90db-3bfa1680d9e3",
          "citation": "SRS import [I00Q766CZ2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=I00Q766CZ2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389661000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3768564c-59ef-44f3-9817-605fa2973f6d",
          "citation": "SULTIAME [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "32d7b3a9-4de4-4993-b129-4611540cf683",
          "citation": "SULTHIAME [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d9d3c8a8-9f13-4425-8ad1-100ca2f9c698",
          "citation": "SULTIAME [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "022816f4-992f-42c1-a9f8-c1854d993d81",
          "citation": "SULTHIAME [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "448a9e31-0d54-473f-816b-aceb3001db1c",
          "citation": "SULTIAME [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a086cd50-7d92-bffb-c105-88bb3a529484",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bf23b7af-c9fb-6fc7-ec2a-d05ef9625ffa",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=61-56-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f72ede3a-0b42-d95e-c44c-4ce04be681d9",
          "citation": "NCIT",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e76ddb3e-f9fc-8c95-9269-2be333bb50f8",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "63412437-6d28-47c5-8a82-1e7376989f6c",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f1f95cb9-f6ed-e9c6-1fb3-28b43f347191",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "c89e2002-041a-fa2a-2a36-fa253331427d",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "830e05d5-1e42-c130-ae80-08410f991b7b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e55dcc22-ae5a-453c-8c35-f1eb2e99d52e",
          "id": "e55dcc22-ae5a-453c-8c35-f1eb2e99d52e",
          "molfile": "\n  Marvin  01132111522D          \n\n 18 19  0  0  0  0            999 V2000\n   14.1542   -7.5625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4417   -7.1500    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0292   -6.4292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8542   -6.4292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7333   -7.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0167   -7.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3042   -7.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3042   -8.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0167   -8.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7333   -8.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5917   -8.8042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5917   -9.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8750  -10.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1625   -9.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1667   -8.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8792   -8.3917    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2875   -7.6750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4625   -7.6750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  2  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 11  1  0  0  0  0\n 10  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 16  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 16  2  0  0  0  0\nM  END",
          "smiles": "C1CCS(=O)(=O)N(C1)c2ccc(cc2)S(=O)(=O)N",
          "formula": "C10H14N2O4S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2a525923-376d-460e-a951-8bb5ae9e6874"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "290.3617",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0a5c8b0a-6e21-4a1b-af4d-cd8636b01dac",
      "version": "16",
      "structure": {
        "id": "d93a1c09-7838-4fd9-a4c0-37d618e8b71b",
        "molfile": "\n  Marvin  01132111162D          \n\n 18 19  0  0  0  0            999 V2000\n    9.8792   -8.3917    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4417   -7.1500    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5917   -8.8042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7333   -7.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2875   -7.6750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4625   -7.6750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3042   -8.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0292   -6.4292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8542   -6.4292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1542   -7.5625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1667   -8.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0167   -7.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7333   -8.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3042   -7.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0167   -8.8083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5917   -9.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1625   -9.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8750  -10.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  4  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4 12  2  0  0  0  0\n  5  1  2  0  0  0  0\n  6  1  2  0  0  0  0\n  7  3  1  0  0  0  0\n  8  2  2  0  0  0  0\n  9  2  2  0  0  0  0\n 10  2  1  0  0  0  0\n 11  1  1  0  0  0  0\n 12 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 14  7  2  0  0  0  0\n 15  7  1  0  0  0  0\n 16  3  1  0  0  0  0\n 17 11  1  0  0  0  0\n 18 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n  4 13  1  0  0  0  0\nM  END",
        "smiles": "C1CCS(=O)(=O)N(C1)c2ccc(cc2)S(=O)(=O)N",
        "formula": "C10H14N2O4S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "290.3617",
        "optical_activity": "NONE",
        "references": [
          "3e3c7e41-d339-4e1d-90db-3bfa1680d9e3",
          "f49c50e4-3e9d-4028-a0aa-6dc8e511bd62",
          "cc47f5c7-8ff1-4b4b-af6c-090b3506be40"
        ],
        "stereo_centers": 0
      },
      "unii": "I00Q766CZ2"
    }
  ]
}