{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7ad1860f-59bf-4c0a-994e-95324593bb91",
          "code": "94944-70-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=94944-70-4",
          "code_system": "CAS",
          "references": [
            "ba0c6f30-9351-40fe-bfe4-109a9b0f07a2",
            "d19decf9-cacf-49a2-b1e4-76c604790af8"
          ]
        },
        {
          "uuid": "1e3e02f4-5930-4e98-9142-1d9332936046",
          "code": "95120-07-3",
          "type": "NON-SPECIFIC STEREOCHEMISTRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=95120-07-3",
          "code_system": "CAS",
          "references": [
            "ba0c6f30-9351-40fe-bfe4-109a9b0f07a2",
            "9c110ee5-1eb1-4629-bd19-804f30458b28"
          ]
        },
        {
          "uuid": "2daa913e-2cc7-4f7e-8cd6-f95fe8290c17",
          "code": "108037",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/108037",
          "code_system": "PUBCHEM",
          "references": [
            "ba0c6f30-9351-40fe-bfe4-109a9b0f07a2"
          ]
        },
        {
          "uuid": "4dfe5190-6601-4d91-3478-64c147aada92",
          "code": "DTXSID20241695",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20241695",
          "code_system": "EPA CompTox",
          "references": [
            "8b1bbccb-0525-02f9-f9e3-ea0279b1ddb6"
          ]
        },
        {
          "uuid": "efd7df11-e87d-4c7a-a812-f08ada58d5d1",
          "code": "HW195J55G1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "48e71eee-f4aa-46a7-aa24-ff0753d6be7d",
          "name": "1-(5-((1R,2S,3R)-1,2,3,4-TETRAHYDROXYBUTYL)-1H-IMIDAZOL-2-YL)ETHANONE",
          "stdName": "1-(5-((1R,2S,3R)-1,2,3,4-TETRAHYDROXYBUTYL)-1H-IMIDAZOL-2-YL)ETHANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8563a99a-b6e9-464b-9429-7b4729fa6f73"
          ],
          "display_name": false
        },
        {
          "uuid": "3e245822-52db-41ee-ab5a-adf5d6f1fd49",
          "name": "2-ACETYL-4(5)-TETRAHYDROXYBUTYLIMIDAZOLE",
          "stdName": "2-ACETYL-4(5)-TETRAHYDROXYBUTYLIMIDAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2992dc23-0f08-4317-90b1-9e7213daa20d"
          ],
          "display_name": false
        },
        {
          "uuid": "74883989-60f9-4c5c-a67f-72b563eff67b",
          "name": "2-ACETYL-4(5)-TETRAHYDROXYBUTYLIMIDAZOLE, (1R,2S,3R)-",
          "stdName": "2-ACETYL-4(5)-TETRAHYDROXYBUTYLIMIDAZOLE, (1R,2S,3R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0614433f-e54c-4de7-bbe6-c001233dbb40"
          ],
          "display_name": false
        },
        {
          "uuid": "556f27ab-a5f2-4e7e-be82-d20d3e6baaf3",
          "name": "2-ACETYL-4(5)-TETRAHYDROXYBUTYLIMIDAZOLE, (1R,2S,3R)-(-)-",
          "stdName": "2-ACETYL-4(5)-TETRAHYDROXYBUTYLIMIDAZOLE, (1R,2S,3R)-(-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0614433f-e54c-4de7-bbe6-c001233dbb40"
          ],
          "display_name": false
        },
        {
          "uuid": "303d9fdb-2066-4946-9852-d04c3b97f5a0",
          "name": "2-ACETYL-4-(1,2,3,4-TETRAHYDROXYBUTYL)IMIDAZOLE",
          "stdName": "2-ACETYL-4-(1,2,3,4-TETRAHYDROXYBUTYL)IMIDAZOLE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4169c37c-59eb-46de-934f-1a4438740f7c"
          ],
          "display_name": false
        },
        {
          "uuid": "8dbdd2ad-a06b-48c1-ae23-bb86e44ed2d3",
          "name": "2-ACETYLTETRAHYDROXYBUTYLIMIDAZOLE, (1R,2S,3R)-",
          "stdName": "2-ACETYLTETRAHYDROXYBUTYLIMIDAZOLE, (1R,2S,3R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0614433f-e54c-4de7-bbe6-c001233dbb40"
          ],
          "display_name": true
        },
        {
          "uuid": "9b022d8a-7421-4a30-8252-2bc7d454ffe1",
          "name": "ETHANONE, 1-(4-(1,2,3,4-TETRAHYDROXYBUTYL)-1H-IMIDAZOL-2-YL)-, (1R-(1R*,2S*,3R*))-",
          "stdName": "ETHANONE, 1-(4-(1,2,3,4-TETRAHYDROXYBUTYL)-1H-IMIDAZOL-2-YL)-, (1R-(1R*,2S*,3R*))-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8563a99a-b6e9-464b-9429-7b4729fa6f73"
          ],
          "display_name": false
        },
        {
          "uuid": "94633ff5-6aaf-41ce-9f33-0960add8eec9",
          "name": "ETHANONE, 1-(5-((1R,2S,3R)-1,2,3,4-TETRAHYDROXYBUTYL)-1H-IMIDAZOL-2-YL)-",
          "stdName": "ETHANONE, 1-(5-((1R,2S,3R)-1,2,3,4-TETRAHYDROXYBUTYL)-1H-IMIDAZOL-2-YL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8563a99a-b6e9-464b-9429-7b4729fa6f73"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4169c37c-59eb-46de-934f-1a4438740f7c",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2992dc23-0f08-4317-90b1-9e7213daa20d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8563a99a-b6e9-464b-9429-7b4729fa6f73",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0614433f-e54c-4de7-bbe6-c001233dbb40",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba0c6f30-9351-40fe-bfe4-109a9b0f07a2",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391969000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "102bda10-dd5a-4b5d-a806-e2aafd02a685",
          "citation": "SRS import [HW195J55G1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HW195J55G1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391969000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b1bbccb-0525-02f9-f9e3-ea0279b1ddb6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=94944-70-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9c110ee5-1eb1-4629-bd19-804f30458b28",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d19decf9-cacf-49a2-b1e4-76c604790af8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0086ff1a-f823-450d-8bca-34f20f84437c",
          "id": "0086ff1a-f823-450d-8bca-34f20f84437c",
          "molfile": "\n  Marvin  01132100202D          \n\n 16 16  0  0  1  0            999 V2000\n   15.2539   -6.4852    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   15.2539   -5.6603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9683   -6.8978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6827   -6.4852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5394   -6.8978    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   14.5394   -7.7227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8250   -6.4852    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   13.8250   -5.6603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1105   -6.8978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0243   -7.7183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2173   -7.8897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8049   -7.1753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3569   -6.5622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9844   -7.0891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4995   -7.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6488   -6.3354    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 13  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)c1[nH]cc([C@H]([C@@H]([C@@H](CO)O)O)O)n1",
          "formula": "C9H14N2O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "67a7c7a5-d16a-4854-a828-768329491bae"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "230.2182",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "86d8f1eb-04f7-4200-ad60-4af542e4e9c9",
      "version": "3",
      "structure": {
        "id": "f4bc5877-2d06-41a2-99a7-9485e2981323",
        "molfile": "\n  Marvin  01132112412D          \n\n 16 16  0  0  1  0            999 V2000\n   13.8250   -6.4852    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.5394   -6.8978    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.2539   -6.4852    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.1105   -6.8978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0243   -7.7183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2173   -7.8897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8049   -7.1753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9844   -7.0891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6488   -6.3354    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4995   -7.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3569   -6.5622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8250   -5.6603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5394   -7.7227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2539   -5.6603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9683   -6.8978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6827   -6.4852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11  7  2  0  0  0  0\n  4 11  1  0  0  0  0\n  1 12  1  1  0  0  0\n  2 13  1  1  0  0  0\n  3 14  1  6  0  0  0\n  3 15  1  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)c1[nH]cc([C@H]([C@@H]([C@@H](CO)O)O)O)n1",
        "formula": "C9H14N2O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "230.2182",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "102bda10-dd5a-4b5d-a806-e2aafd02a685",
          "2992dc23-0f08-4317-90b1-9e7213daa20d"
        ],
        "stereo_centers": 3
      },
      "unii": "HW195J55G1"
    }
  ]
}