{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "731a12e4-68df-42a8-a966-3044d4331dd3",
          "code": "85535-85-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=85535-85-9",
          "code_system": "CAS",
          "references": [
            "644db464-fd5d-43f0-87ac-33ef496cd020",
            "b72a5100-f9d8-4f29-a196-1e79b28b8662"
          ]
        },
        {
          "uuid": "56aef713-cf39-4a20-a729-3fc56422dca2",
          "code": "287-477-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.079.497",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "644db464-fd5d-43f0-87ac-33ef496cd020"
          ]
        },
        {
          "uuid": "891d02c5-ed6c-4a35-ae2d-622d1988ae21",
          "code": "HR6L4Z4XVY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "08f0e1fa-6f65-e6fd-65a8-c460dd59394c",
          "code": "121232961",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/121232961",
          "code_system": "PUBCHEM",
          "references": [
            "287b6826-28ff-9f28-7712-5c996603b2a1"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0dac0305-6cdc-4334-af34-02cdc84e72be",
          "name": "ALAIFLEX 50A3",
          "stdName": "ALAIFLEX 50A3",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fac97be-22cd-4305-9a1d-6b239e232abe",
            "c55a77bc-068f-4d3b-9367-74c7c8c19824"
          ],
          "display_name": false
        },
        {
          "uuid": "78287b69-e35d-4470-8048-8036a7ff832d",
          "name": "ALKANES, C14-17, CHLORO",
          "stdName": "ALKANES, C14-17, CHLORO",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "708b2627-b56e-43d9-8e03-f603228279e1",
            "c55a77bc-068f-4d3b-9367-74c7c8c19824"
          ],
          "display_name": false
        },
        {
          "uuid": "4a3bd7e7-76f4-4e1f-87b7-d836d475e75e",
          "name": "ALKANES, C14-17, CHLORO (MCCP, MEDIUM CHAINED CHLORINATED PARAFFINS)",
          "stdName": "ALKANES, C14-17, CHLORO (MCCP, MEDIUM CHAINED CHLORINATED PARAFFINS)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00c5cd9d-0ae6-4ae6-9900-0c8a6e9611bb",
            "c55a77bc-068f-4d3b-9367-74c7c8c19824"
          ],
          "display_name": false
        },
        {
          "uuid": "516e41c6-2c82-47ea-a247-6aee8d3d8635",
          "name": "C14-17, CHLORO ALKANES",
          "stdName": "C14-17, CHLORO ALKANES",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "708b2627-b56e-43d9-8e03-f603228279e1",
            "c55a77bc-068f-4d3b-9367-74c7c8c19824"
          ],
          "display_name": false
        },
        {
          "uuid": "2b5c49db-14dc-4f5a-b74c-d175bb64a440",
          "name": "CERCELOR S-52",
          "stdName": "CERCELOR S-52",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "708b2627-b56e-43d9-8e03-f603228279e1",
            "c55a77bc-068f-4d3b-9367-74c7c8c19824"
          ],
          "display_name": false
        },
        {
          "uuid": "5d0f4f2e-a8eb-44ca-9249-4bacddbb7a1b",
          "name": "CERCELOR S52",
          "stdName": "CERCELOR S52",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fac97be-22cd-4305-9a1d-6b239e232abe",
            "c55a77bc-068f-4d3b-9367-74c7c8c19824"
          ],
          "display_name": false
        },
        {
          "uuid": "5911317e-fbb3-4f6d-9fb5-20984a36da93",
          "name": "CHLORINATED PARAFFINS, C14-17",
          "stdName": "CHLORINATED PARAFFINS, C14-17",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00c5cd9d-0ae6-4ae6-9900-0c8a6e9611bb",
            "c55a77bc-068f-4d3b-9367-74c7c8c19824"
          ],
          "display_name": false
        },
        {
          "uuid": "a538cbb4-feb0-4f19-bea4-e68e766fc285",
          "name": "CHLOROALKANES, C14-17",
          "stdName": "CHLOROALKANES, C14-17",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "708b2627-b56e-43d9-8e03-f603228279e1",
            "c55a77bc-068f-4d3b-9367-74c7c8c19824"
          ],
          "display_name": false
        },
        {
          "uuid": "214d123f-d905-40ab-8203-08f130952257",
          "name": "CHLORPARAFFIN 52G",
          "stdName": "CHLORPARAFFIN 52G",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fac97be-22cd-4305-9a1d-6b239e232abe",
            "c55a77bc-068f-4d3b-9367-74c7c8c19824"
          ],
          "display_name": false
        },
        {
          "uuid": "48b4c7f0-3e63-4044-8534-dbd7cc4a0f99",
          "name": "CLOPARIN 50",
          "stdName": "CLOPARIN 50",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fac97be-22cd-4305-9a1d-6b239e232abe",
            "c55a77bc-068f-4d3b-9367-74c7c8c19824"
          ],
          "display_name": false
        },
        {
          "uuid": "cc64a899-f862-42a3-86b5-b13a2e482406",
          "name": "CW-52",
          "stdName": "CW-52",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fac97be-22cd-4305-9a1d-6b239e232abe",
            "c55a77bc-068f-4d3b-9367-74c7c8c19824"
          ],
          "display_name": false
        },
        {
          "uuid": "7317a08d-8378-4ffb-8661-9a5b783c2251",
          "name": "FLX-0008",
          "stdName": "FLX-0008",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fac97be-22cd-4305-9a1d-6b239e232abe",
            "c55a77bc-068f-4d3b-9367-74c7c8c19824"
          ],
          "display_name": false
        },
        {
          "uuid": "5beffe07-293d-4889-b087-803b521349fe",
          "name": "PAROIL 1048",
          "stdName": "PAROIL 1048",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "03d28c20-5668-4e0b-adc0-0f5549ffea37",
            "c55a77bc-068f-4d3b-9367-74c7c8c19824"
          ],
          "display_name": true
        },
        {
          "uuid": "e81f472a-32df-4786-81b8-c48c919bf906",
          "name": "PAROIL 152",
          "stdName": "PAROIL 152",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fac97be-22cd-4305-9a1d-6b239e232abe",
            "c55a77bc-068f-4d3b-9367-74c7c8c19824"
          ],
          "display_name": false
        },
        {
          "uuid": "4d7d546e-c319-4d37-8ffa-aa4b9c21cb49",
          "name": "UNICHLOR 50L-65",
          "stdName": "UNICHLOR 50L-65",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fac97be-22cd-4305-9a1d-6b239e232abe",
            "c55a77bc-068f-4d3b-9367-74c7c8c19824"
          ],
          "display_name": false
        },
        {
          "uuid": "869e834f-258f-4776-b44d-fa01f2551a04",
          "name": "WITACLOR 350",
          "stdName": "WITACLOR 350",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fac97be-22cd-4305-9a1d-6b239e232abe",
            "c55a77bc-068f-4d3b-9367-74c7c8c19824"
          ],
          "display_name": false
        },
        {
          "uuid": "63a3a73a-1d6d-47e4-b4eb-60ed23cd97ea",
          "name": "WITACLOR 352",
          "stdName": "WITACLOR 352",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fac97be-22cd-4305-9a1d-6b239e232abe",
            "c55a77bc-068f-4d3b-9367-74c7c8c19824"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "708b2627-b56e-43d9-8e03-f603228279e1",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c55a77bc-068f-4d3b-9367-74c7c8c19824",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fac97be-22cd-4305-9a1d-6b239e232abe",
          "citation": "http://www.inchem.org/documents/ehc/ehc/ehc181.htm#SubSectionNumber:2.1.2",
          "url": "http://www.inchem.org/documents/ehc/ehc/ehc181.htm#SubSectionNumber:2.1.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00c5cd9d-0ae6-4ae6-9900-0c8a6e9611bb",
          "citation": "http://echa.europa.eu/substance-information/-/substanceinfo/100.079.497",
          "url": "http://echa.europa.eu/substance-information/-/substanceinfo/100.079.497",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "03d28c20-5668-4e0b-adc0-0f5549ffea37",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "644db464-fd5d-43f0-87ac-33ef496cd020",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392338000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc75ad5c-b3cb-6d4f-e77e-91056914c1e0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=85535-85-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "287b6826-28ff-9f28-7712-5c996603b2a1",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "b72a5100-f9d8-4f29-a196-1e79b28b8662",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7b49cd18-207b-433e-a98b-ed16a5b1c44e",
          "id": "7b49cd18-207b-433e-a98b-ed16a5b1c44e",
          "molfile": "\n  Marvin  01132106242D          \n\n 21 20  0  0  0  0            999 V2000\n    0.0000   -1.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145   -0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.7145    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.4390   -1.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1535   -0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.1535    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.8780   -1.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5925   -0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.5925    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.3170   -1.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0315   -0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7459   -1.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4705   -0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.4705    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.1849   -1.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9095   -0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.9095    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.6239   -1.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3485   -0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   10.0629   -1.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3485    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\nM  END",
          "smiles": "CC(CC(CC(CCCC(CC(CC(C)Cl)Cl)Cl)Cl)Cl)Cl",
          "formula": "C15H26Cl6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cafcd014-0030-4d96-bf2e-61ce91250e11"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "419.0851",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "REPRESENTATIVE",
      "uuid": "c1fe50f7-ccd7-4110-afd2-0974d73c0c8b",
      "version": "6",
      "structure": {
        "id": "03177b81-a162-47d2-8b72-1dcf5977e79a",
        "molfile": "\n  Marvin  01132100282D          \n\n 21 20  0  0  0  0            999 V2000\n    0.7145   -0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4390   -1.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1535   -0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8780   -1.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5925   -0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3170   -1.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0315   -0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7459   -1.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4705   -0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1849   -1.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9095   -0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6239   -1.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3485   -0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0629   -1.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7145    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.5925    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.4705    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.3485    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    2.1535    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.9095    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1 16  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 20  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 17  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 18  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 21  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 19  1  0  0  0  0\nM  END",
        "smiles": "CC(CC(CC(CCCC(CC(CC(C)Cl)Cl)Cl)Cl)Cl)Cl",
        "formula": "C15H26Cl6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "UNKNOWN",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "419.0851",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "03d28c20-5668-4e0b-adc0-0f5549ffea37"
        ],
        "stereo_centers": 6
      },
      "unii": "HR6L4Z4XVY"
    }
  ]
}