{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "6bb4322b-79be-41c5-bdf4-1b721d6128a5", "code": "1393-48-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1393-48-2", "code_system": "CAS", "references": [ "fca2792d-2f74-4249-9b0e-17eed4b81373", "2c09dc8a-9c49-48d0-9e64-d8df04f6f30a" ] }, { "uuid": "615ee955-038a-411c-aaa2-6e05297ade9f", "code": "THIOSTREPTON", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Thiostrepton", "code_system": "WIKIPEDIA", "references": [ "fca2792d-2f74-4249-9b0e-17eed4b81373" ] }, { "uuid": "1484f00e-fa1e-4098-aae0-f522d50ede33", "code": "215-734-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.014.304", "code_system": "ECHA (EC/EINECS)", "references": [ "fca2792d-2f74-4249-9b0e-17eed4b81373" ] }, { "uuid": "cc51142f-591b-45d5-83d0-45d5b2effc56", "code": "1365970", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1365970/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "fca2792d-2f74-4249-9b0e-17eed4b81373" ] }, { "uuid": "a5cda340-b545-43df-8c52-a08f1accbc9e", "code": "m10787", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m10787?q=authorize", "code_system": "MERCK INDEX", "references": [ "fca2792d-2f74-4249-9b0e-17eed4b81373" ] }, { "uuid": "6e48c918-3805-4356-9f9c-5d647c1c3f16", "code": "21 CFR 524.1600A", "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 524 OPHTHALMIC AND TOPICAL DOSAGE FORM NEW ANIMAL DRUGS|SEC. 524.1600a Nystatin, neomycin, thiostrepton, and triamcinolone ointment.", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=524.1600a", "code_system": "CFR", "references": [ "fca2792d-2f74-4249-9b0e-17eed4b81373" ] }, { "uuid": "07d2542b-7da4-448d-b8f5-50c39595d427", "code": "21 CFR 524.1600B", "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 524 OPHTHALMIC AND TOPICAL DOSAGE FORM NEW ANIMAL DRUGS|SEC. 524.1600b Nystatin, neomycin, thiostrepton, and triamcinolone ophthalmic ointment.", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=524.1600b", "code_system": "CFR", "references": [ "fca2792d-2f74-4249-9b0e-17eed4b81373" ] }, { "uuid": "685115ec-eac0-4f80-a711-df11b3f04119", "code": "CHEMBL2303629", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2303629", "code_system": "ChEMBL", "references": [ "fca2792d-2f74-4249-9b0e-17eed4b81373" ] }, { "uuid": "65844295-ada0-40df-94f1-212cebf1c513", "code": "16154490", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16154490", "code_system": "PUBCHEM", "references": [ "fca2792d-2f74-4249-9b0e-17eed4b81373" ] }, { "uuid": "536b000e-9347-e5b4-dc0f-3a55cdb76962", "code": "DTXSID5040625", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5040625", "code_system": "EPA CompTox", "references": [ "a1175f7a-0dd6-9b52-4fbe-1716a0f1cb42" ] }, { "uuid": "081b3a2c-bfef-589a-64a1-295b704e2f7b", "code": "DB11467", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DB11467", "code_system": "DRUG BANK", "references": [ "41b4fe29-7ad7-15f5-8e50-e85efd688d39" ] }, { "uuid": "cf8269f6-b8a2-4e8a-8b33-fb2c94c56cf8", "code": "HR4S203Y18", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "1ebe33b3-8fb0-6faf-f272-143d70cb3ae7", "code": "1663700", "type": "PRIMARY", "url": "https://store.usp.org/product/1663700", "code_system": "RS_ITEM_NUM", "references": [ "41b4fe29-7ad7-15f5-8e50-e85efd688d39" ] }, { "uuid": "910f5edf-ec6f-d6c5-549c-3fa32919baa4", "code": "29693", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:29693", "code_system": "CHEBI", "references": [ "41b4fe29-7ad7-15f5-8e50-e85efd688d39" ] }, { "uuid": "3e098871-fe3b-107e-7675-15b647f1427e", "code": "C187031", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C187031", "code_system": "NCI_THESAURUS", "references": [ "bc5f7c09-3cdf-e3b3-3e9a-deef97d46533" ] }, { "uuid": "01c6204c-7d2b-d390-cba5-fd47b17e4005", "code": "81722", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=81722", "code_system": "NSC", "references": [ "59b084bb-b81b-aee2-2ca7-bb54b3d79720" ] }, { "uuid": "53a42ca1-e189-0290-17d7-dbb4c2570ff2", "code": "851321", "comments": "ORPHAN DRUG|Designated|Treatment of Mesothelioma", "type": "PRIMARY", "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=851321", "code_system": "FDA ORPHAN DRUG", "references": [ "41b4fe29-7ad7-15f5-8e50-e85efd688d39" ] }, { "uuid": "597f512d-8625-b560-3bdc-af1d250fa6c7", "code": "HR4S203Y18", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=HR4S203Y18", "code_system": "DAILYMED", "references": [ "1975b3d4-0941-065a-fcf7-72de0c2ffe8b" ] }, { "uuid": "f5866576-1c50-dcf8-d866-bd5d476f432f", "code": "170365", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=170365", "code_system": "NSC", "references": [ "59b084bb-b81b-aee2-2ca7-bb54b3d79720" ] }, { "uuid": "48525a7c-6926-c4d6-de80-e29ee0ed50eb", "code": "300000023712", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "72a2fa9b-6abb-f768-3e14-bae736eb2271" ] } ], "relationships": [ { "uuid": "0af206e5-a82e-4433-a319-e67d532a478a", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "5bce60ae-57cb-451a-be7c-295970dff105", "refuuid": "17488612-4f7b-4d8d-a7e9-68936a4c6a5f", "name": "THIOSTREPTON", "unii": "HR4S203Y18", "linking_id": "HR4S203Y18", "ref_pname": "THIOSTREPTON", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "ba7de377-3dc4-4b5a-adeb-217f38515ffa", "name": "BRYAMYCIN", "stdName": "BRYAMYCIN", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "a7c8eab8-5114-4e29-9ed2-d979f1a394dd", "533227f1-6dcd-4e33-97a9-8e4ecab06956" ], "display_name": false }, { "uuid": "4f9170a6-361d-42ae-92d2-0ce285d304c2", "name": "GARGON", "stdName": "GARGON", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a7c8eab8-5114-4e29-9ed2-d979f1a394dd", "533227f1-6dcd-4e33-97a9-8e4ecab06956" ], "display_name": false }, { "uuid": "9df1aa22-4b9d-419f-9b3b-5a3dec3af8f5", "name": "NSC-170365", "stdName": "NSC-170365", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "a7c8eab8-5114-4e29-9ed2-d979f1a394dd", "533227f1-6dcd-4e33-97a9-8e4ecab06956" ], "display_name": false }, { "uuid": "0a5d2882-ec38-4110-9c85-d55f79a46cf0", "name": "NSC-81722", "stdName": "NSC-81722", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "a7c8eab8-5114-4e29-9ed2-d979f1a394dd", "533227f1-6dcd-4e33-97a9-8e4ecab06956" ], "display_name": false }, { "uuid": "43bc1f1a-e5ad-45ee-9484-9beb98e52241", "name": "THIACTIN", "stdName": "THIACTIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a7c8eab8-5114-4e29-9ed2-d979f1a394dd", "533227f1-6dcd-4e33-97a9-8e4ecab06956" ], "display_name": false }, { "uuid": "359a89f8-c2af-4463-9980-ce4e97b3d7fa", "name": "THIOSTREPTON", "stdName": "THIOSTREPTON", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c957e3aa-079b-4171-aedf-1676df25e336", "c5008d3b-507d-4127-9bcf-30e3ba7f374a", "e1b18c7a-4a35-4488-a884-e345b7fac12c", "f75d902b-1b42-4b49-a8ee-1e3f4188403b", "a7c8eab8-5114-4e29-9ed2-d979f1a394dd", "f5fdb22c-1f17-4592-b188-11a519d96202", "eab8eec8-0429-4110-9911-15e152e60bcf", "9cf0d7af-bdca-4850-a5b2-01478129ee0e", "046e3b7b-ab27-41d4-a5c4-9d456b4cc621", "aad025fd-f0a2-4b12-a7f0-f61c92e30da9", "01257190-3040-4213-a245-f95cc8cd8de8", "2295e7fb-6b6c-4e18-a69e-8b8e6f81ce36" ], "display_name": true }, { "uuid": "c23e4832-d528-4d46-abc3-5283bb357114", "name": "THIOSTREPTON (ANTIBIOTIC OF A STREPTOMYCES SPECIES)", "stdName": "THIOSTREPTON (ANTIBIOTIC OF A STREPTOMYCES SPECIES)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "10d8226f-c60b-420d-92e7-dce1143ab8c3", "a7c8eab8-5114-4e29-9ed2-d979f1a394dd" ], "display_name": false }, { "uuid": "b80c6e78-563d-4567-9600-bd49763df01c", "name": "THIOSTREPTON A", "stdName": "THIOSTREPTON A", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a7c8eab8-5114-4e29-9ed2-d979f1a394dd", "533227f1-6dcd-4e33-97a9-8e4ecab06956" ], "display_name": false }, { "uuid": "7006caa2-6088-4d80-9057-12fa7bc29b19", "name": "THIOSTREPTON [GREEN BOOK]", "stdName": "THIOSTREPTON [GREEN BOOK]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "eab8eec8-0429-4110-9911-15e152e60bcf" ], "display_name": false }, { "uuid": "7267a8e2-7bd7-48b7-98a1-ca7c45fe4695", "name": "THIOSTREPTON [MART.]", "stdName": "THIOSTREPTON [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f5fdb22c-1f17-4592-b188-11a519d96202", "a7c8eab8-5114-4e29-9ed2-d979f1a394dd" ], "display_name": false }, { "uuid": "bb3b231a-8669-44c8-9be3-663cc82ca09f", "name": "THIOSTREPTON [MI]", "stdName": "THIOSTREPTON [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c957e3aa-079b-4171-aedf-1676df25e336", "a7c8eab8-5114-4e29-9ed2-d979f1a394dd" ], "display_name": false }, { "uuid": "4dcdfcfd-d660-3f48-d261-3b6e7963a1d6", "name": "THIOSTREPTON [USP MONOGRAPH]", "stdName": "THIOSTREPTON [USP MONOGRAPH]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "169400dc-956e-6a84-0029-78b935dc4e5b" ], "display_name": false }, { "uuid": "e8c41516-1d5f-4c18-beb6-d8e5eb02cb87", "name": "THIOSTREPTON [USP-RS]", "stdName": "THIOSTREPTON [USP-RS]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "01257190-3040-4213-a245-f95cc8cd8de8", "a7c8eab8-5114-4e29-9ed2-d979f1a394dd" ], "display_name": false } ], "references": [ { "uuid": "c5008d3b-507d-4127-9bcf-30e3ba7f374a", "citation": "USP DICTIONARY 2008", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "046e3b7b-ab27-41d4-a5c4-9d456b4cc621", "citation": "USP 33", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c957e3aa-079b-4171-aedf-1676df25e336", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a7c8eab8-5114-4e29-9ed2-d979f1a394dd", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "eab8eec8-0429-4110-9911-15e152e60bcf", "citation": "FDA SRS 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f5fdb22c-1f17-4592-b188-11a519d96202", "citation": "MARTINDALE", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "01257190-3040-4213-a245-f95cc8cd8de8", "citation": "USP/NF", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "533227f1-6dcd-4e33-97a9-8e4ecab06956", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "10d8226f-c60b-420d-92e7-dce1143ab8c3", "citation": "HC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fca2792d-2f74-4249-9b0e-17eed4b81373", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391315000, "tags": [ "NOMEN" ] }, { "uuid": "e3a87188-78db-4b48-a222-7617c2891518", "citation": "SRS import [HR4S203Y18]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HR4S203Y18", "doc_type": "SRS", "public_domain": true, "document_date": 1493391315000, "tags": [ "NOMEN" ] }, { "uuid": "1b313df4-a680-43cf-a3ef-cdf1e2f24d90", "citation": "MERCK", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f75d902b-1b42-4b49-a8ee-1e3f4188403b", "citation": "THIOSTREPTON [USP]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "aad025fd-f0a2-4b12-a7f0-f61c92e30da9", "citation": "THIOSTREPTON [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2295e7fb-6b6c-4e18-a69e-8b8e6f81ce36", "citation": "THIOSTREPTON [GREEN BOOK]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "e1b18c7a-4a35-4488-a884-e345b7fac12c", "citation": "THIOSTREPTON [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "9cf0d7af-bdca-4850-a5b2-01478129ee0e", "citation": "THIOSTREPTON [USP-RS]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "a1175f7a-0dd6-9b52-4fbe-1716a0f1cb42", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1393-48-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "bc5f7c09-3cdf-e3b3-3e9a-deef97d46533", "citation": "NCIT", "doc_type": "NCI THESAURUS", "public_domain": true }, { "uuid": "41b4fe29-7ad7-15f5-8e50-e85efd688d39", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "169400dc-956e-6a84-0029-78b935dc4e5b", "citation": "USP 10/2020", "doc_type": "USPNF", "public_domain": true }, { "uuid": "2c09dc8a-9c49-48d0-9e64-d8df04f6f30a", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "59b084bb-b81b-aee2-2ca7-bb54b3d79720", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "1975b3d4-0941-065a-fcf7-72de0c2ffe8b", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "72a2fa9b-6abb-f768-3e14-bae736eb2271", "citation": "EMA 2023", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a542191b-fecf-4493-aef6-2ac96f627ea0", "id": "a542191b-fecf-4493-aef6-2ac96f627ea0", "molfile": "\n Marvin 01132108352D \n\n114123 0 0 1 0 999 V2000\n 14.8889 -15.3294 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 14.0929 -15.7237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5904 -15.7173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8889 -14.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2049 -14.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2049 -13.2630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8621 -12.8282 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6043 -13.2630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6043 -14.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2871 -14.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9883 -14.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9883 -13.2630 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 17.7245 -12.3789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7245 -11.6302 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 17.0562 -11.0881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3722 -11.2897 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0562 -10.2731 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2932 -9.7782 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 15.7116 -10.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2932 -8.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9679 -8.4668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7037 -8.4668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0545 -8.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0545 -9.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3134 -8.4055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3657 -7.5574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6374 -8.8405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9943 -8.4055 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 13.0307 -7.4548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3654 -8.8074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3654 -9.4898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1748 -7.1841 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6333 -7.6568 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 10.6333 -6.9284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2322 -6.4176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8911 -6.9284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8911 -7.6568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2685 -8.0177 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 11.2685 -9.1682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6538 -9.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8554 -10.3456 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5979 -10.3456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8183 -9.5970 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3323 -10.7066 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 12.3323 -11.9454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4371 -12.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7137 -11.8447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4371 -13.0549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1118 -13.5296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8516 -14.3128 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0415 -14.3128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8082 -13.5296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5875 -15.0679 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.5361 -14.6801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7276 -15.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7276 -16.1382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1792 -14.7542 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.4265 -13.9645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7505 -13.5027 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1294 -13.9645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3753 -14.7542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2658 -13.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2658 -12.1125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1011 -11.5829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9584 -11.9171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1011 -10.6340 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.0578 -10.2526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0578 -9.2549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1562 -8.8405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5794 -8.5330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3856 -7.8048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9342 -7.4296 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5379 -7.8048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3297 -8.5330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1253 -10.2986 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 6.1253 -9.3226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2348 -10.5727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4696 -13.7504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8164 -13.1262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5875 -16.1317 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.5371 -16.8898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5884 -17.2389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5094 -16.4738 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 11.5094 -17.3030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3654 -16.0591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1615 -10.4324 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 13.1615 -9.6709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7840 -11.7043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4703 -12.7809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7470 -13.0218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5057 -6.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2457 -5.4436 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8888 -5.0480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4639 -5.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2433 -6.1387 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8888 -4.3262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5430 -3.9244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1795 -3.9244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1795 -2.7863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4702 -2.2394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8606 -2.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8606 -1.5228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5098 -2.7863 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1591 -2.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1591 -1.5098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8085 -2.7863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8085 -3.5161 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5699 -2.2046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5345 -11.1620 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 18.5345 -10.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2296 -11.6035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0193 -11.1211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2727 -12.8282 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 16.2255 -12.0921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 3 1 1 0 0 0\n 4 1 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 9 2 0 0 0 0\n 6 5 2 0 0 0 0\n 6 7 1 0 0 0 0\n 89 6 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n113 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 6 0 0 0\n 12113 1 0 0 0 0\n 14 13 1 6 0 0 0\n 14 15 1 0 0 0 0\n 14109 1 0 0 0 0\n 15 16 2 0 0 0 0\n 17 15 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 1 0 0 0\n 20 18 1 0 0 0 0\n 20 21 2 0 0 0 0\n 22 20 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 2 0 0 0 0\n 25 23 1 0 0 0 0\n 25 26 2 0 0 0 0\n 27 25 1 0 0 0 0\n 28 27 1 0 0 0 0\n 28 29 1 6 0 0 0\n 28 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 32 30 1 0 0 0 0\n 33 32 1 0 0 0 0\n 33 34 1 0 0 0 0\n 33 38 1 0 0 0 0\n 33 73 1 6 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 37 36 2 0 0 0 0\n 36 91 1 0 0 0 0\n 38 37 1 6 0 0 0\n 38 39 1 0 0 0 0\n 39 40 2 0 0 0 0\n 39 43 1 0 0 0 0\n 40 41 1 0 0 0 0\n 42 41 1 0 0 0 0\n 43 42 2 0 0 0 0\n 44 42 1 6 0 0 0\n 44 45 1 0 0 0 0\n 44 86 1 0 0 0 0\n 45 46 1 0 0 0 0\n 46 47 2 0 0 0 0\n 46 48 1 0 0 0 0\n 48 49 2 0 0 0 0\n 48 52 1 0 0 0 0\n 49 50 1 0 0 0 0\n 51 50 1 0 0 0 0\n 52 51 2 0 0 0 0\n 53 51 1 6 0 0 0\n 53 54 1 0 0 0 0\n 80 53 1 0 0 0 0\n 54 55 2 0 0 0 0\n 55 56 1 0 0 0 0\n 57 55 1 0 0 0 0\n 57 58 1 0 0 0 0\n 57 61 1 6 0 0 0\n 59 58 1 0 0 0 0\n 60 59 1 0 0 0 0\n 60 61 2 0 0 0 0\n 62 60 1 0 0 0 0\n 63 62 1 0 0 0 0\n 62 78 2 0 0 0 0\n 64 63 1 0 0 0 0\n 64 65 2 0 0 0 0\n 66 64 1 0 0 0 0\n 66 67 1 6 0 0 0\n 75 66 1 0 0 0 0\n 68 67 1 0 0 0 0\n 68 69 2 0 0 0 0\n 70 68 1 0 0 0 0\n 70 71 2 0 0 0 0\n 74 70 1 0 0 0 0\n 72 71 1 0 0 0 0\n 73 72 1 0 0 0 0\n 73 74 2 0 0 0 0\n 75 76 1 0 0 0 0\n 75 77 1 6 0 0 0\n 78 79 1 0 0 0 0\n 80 81 1 0 0 0 0\n 80 82 1 1 0 0 0\n 83 80 1 0 0 0 0\n 83 84 1 0 0 0 0\n 83 85 1 6 0 0 0\n 86 87 1 1 0 0 0\n 86 88 1 0 0 0 0\n 88 89 1 0 0 0 0\n 89 90 2 0 0 0 0\n 91 92 2 0 0 0 0\n 91 95 1 0 0 0 0\n 92 93 1 0 0 0 0\n 93 94 2 0 0 0 0\n 93 96 1 0 0 0 0\n 95 94 1 0 0 0 0\n 96 97 1 0 0 0 0\n 96 98 2 3 0 0 0\n 98 99 1 0 0 0 0\n 99100 2 0 0 0 0\n 99101 1 0 0 0 0\n101102 1 0 0 0 0\n101103 2 3 0 0 0\n103104 1 0 0 0 0\n104105 2 0 0 0 0\n104106 1 0 0 0 0\n106107 1 0 0 0 0\n106108 2 0 0 0 0\n109110 1 1 0 0 0\n109111 1 0 0 0 0\n111112 1 0 0 0 0\n113114 1 1 0 0 0\nM END", "smiles": "CC[C@H](C)[C@H]1C(=O)N[C@@H](C)C(=O)NC(=C)C(=O)N[C@@H](C)C(=O)N[C@@]23CCC(=N[C@@H]3c4csc([C@H]([C@@H](C)OC(=O)c5cc([C@H](C)O)c6C=C[C@H]([C@@H](c6n5)O)N1)NC(=O)c7csc([C@H]([C@@](C)([C@@H](C)O)O)/N=C(/[C@H]8CSC(=N8)/C(=C/C)/NC(=O)[C@H]([C@@H](C)O)NC(=O)c9csc2n9)\\O)n7)n4)c%10nc(cs%10)C(=NC(=C)C(=NC(=C)C(=O)N)O)O", "formula": "C72H85N19O18S5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "811dd80f-44fd-4ec0-aad9-02f55c31614e" }, "defined_stereo": 17, "ez_centers": 2, "molecular_weight": "1664.895", "optical_activity": "UNSPECIFIED", "stereo_centers": 17 } ], "definition_level": "COMPLETE", "uuid": "17488612-4f7b-4d8d-a7e9-68936a4c6a5f", "version": "18", "structure": { "id": "8c409302-cfe5-4320-9af4-882a07139b66", "molfile": "\n Marvin 01132107172D \n\n117126 0 0 1 0 999 V2000\n 16.9883 -13.2630 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.8889 -15.3294 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.1615 -10.4324 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.3323 -10.7066 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.6333 -7.6568 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.1011 -10.6340 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.1253 -10.2986 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.5875 -15.0679 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.5875 -16.1317 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.5094 -16.4738 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.9943 -8.4055 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.2932 -9.7782 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 17.7245 -11.6302 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 18.5345 -11.1620 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.2727 -12.8282 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.2685 -8.0177 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.1792 -14.7542 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.9883 -14.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2871 -14.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6043 -14.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8889 -14.4658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5904 -15.7173 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0929 -15.7237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2049 -14.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2049 -13.2630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4703 -12.7809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7470 -13.0218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7840 -11.7043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1615 -9.6709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5979 -10.3456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8554 -10.3456 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6538 -9.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2685 -9.1682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8183 -9.5970 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8911 -7.6568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8911 -6.9284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2322 -6.4176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6333 -6.9284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5379 -7.8048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9342 -7.4296 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3856 -7.8048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5794 -8.5330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0578 -9.2549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0578 -10.2526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1253 -9.3226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2348 -10.5727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1011 -11.5829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9584 -11.9171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2658 -12.1125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2658 -13.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1294 -13.9645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7505 -13.5027 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4265 -13.9645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3753 -14.7542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7276 -15.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7276 -16.1382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5361 -14.6801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0415 -14.3128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8082 -13.5296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4371 -13.0549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4371 -12.2321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7137 -11.8447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3323 -11.9454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1118 -13.5296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8516 -14.3128 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5884 -17.2389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5371 -16.8898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5094 -17.3030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3654 -16.0591 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4696 -13.7504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8164 -13.1262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1562 -8.8405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3297 -8.5330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1748 -7.1841 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3654 -8.8074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3654 -9.4898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6374 -8.8405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3134 -8.4055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0545 -8.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0545 -9.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7037 -8.4668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2932 -8.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7116 -10.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0562 -10.2731 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.0562 -11.0881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5345 -10.2922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2296 -11.6035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.0193 -11.1211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7245 -12.3789 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.9730 -10.7029 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3722 -11.2897 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9679 -8.4668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3657 -7.5574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0307 -7.4548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5057 -6.1387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2457 -5.4436 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8888 -5.0480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8888 -4.3262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5430 -3.9244 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1795 -3.9244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1795 -2.7863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4702 -2.2394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8606 -2.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8606 -1.5228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5098 -2.7863 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1591 -2.3261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8085 -2.7863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5699 -2.2046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8085 -3.5161 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1591 -1.5098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4639 -5.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2433 -6.1387 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8621 -12.8282 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6043 -13.2630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2255 -12.0921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2465 -8.6783 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6358 -16.0134 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4 3 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 1 1 0 0 0 0\n 5 16 1 0 0 0 0\n 1 18 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 21 2 1 0 0 0 0\n 2 22 1 1 0 0 0\n 2 23 1 0 0 0 0\n 24 21 2 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 2 0 0 0 0\n 28 26 1 0 0 0 0\n 3 28 1 0 0 0 0\n 3 29 1 1 0 0 0\n 30 4 1 0 0 0 0\n 30 31 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 2 0 0 0 0\n 16 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 30 2 0 0 0 0\n 16 35 1 0 0 0 0\n 35 36 2 0 0 0 0\n 37 36 1 0 0 0 0\n 38 37 1 0 0 0 0\n 5 38 1 0 0 0 0\n 5 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 42 41 2 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 6 44 1 6 0 0 0\n 7 45 1 0 0 0 0\n 7 46 1 6 0 0 0\n 6 47 1 0 0 0 0\n 47 48 2 0 0 0 0\n 47 49 1 0 0 0 0\n 49 50 1 0 0 0 0\n 50 51 1 0 0 0 0\n 51 52 1 0 0 0 0\n 52 53 1 0 0 0 0\n 17 53 1 0 0 0 0\n 54 17 1 0 0 0 0\n 51 54 2 0 0 0 0\n 17 55 1 0 0 0 0\n 55 56 2 0 0 0 0\n 57 55 1 0 0 0 0\n 8 57 1 6 0 0 0\n 58 8 1 0 0 0 0\n 59 58 2 0 0 0 0\n 60 59 1 0 0 0 0\n 61 60 1 0 0 0 0\n 61 62 2 0 0 0 0\n 63 61 1 0 0 0 0\n 4 63 1 6 0 0 0\n 60 64 2 0 0 0 0\n 64 65 1 0 0 0 0\n 58 65 1 0 0 0 0\n 9 66 1 1 0 0 0\n 9 67 1 6 0 0 0\n 10 68 1 0 0 0 0\n 10 69 1 6 0 0 0\n 50 70 2 0 0 0 0\n 70 71 1 0 0 0 0\n 43 72 2 0 0 0 0\n 73 42 1 0 0 0 0\n 39 73 2 0 0 0 0\n 5 74 1 6 0 0 0\n 74 75 1 0 0 0 0\n 75 11 1 0 0 0 0\n 75 76 2 0 0 0 0\n 11 77 1 0 0 0 0\n 77 78 1 0 0 0 0\n 78 79 1 0 0 0 0\n 79 80 2 0 0 0 0\n 79 81 1 0 0 0 0\n 81 82 1 0 0 0 0\n 82 12 1 0 0 0 0\n 12 83 1 1 0 0 0\n 12 84 1 0 0 0 0\n 84 85 1 0 0 0 0\n 85 13 1 0 0 0 0\n 14 86 1 1 0 0 0\n 14 87 1 0 0 0 0\n 87 88 1 0 0 0 0\n 13 89 1 0 0 0 0\n 1 89 1 6 0 0 0\n 13 90 1 1 0 0 0\n 85 91 2 0 0 0 0\n 82 92 2 0 0 0 0\n 78 93 2 0 0 0 0\n 11 94 1 6 0 0 0\n 36 95 1 0 0 0 0\n 95 96 2 0 0 0 0\n 96 97 1 0 0 0 0\n 97 98 1 0 0 0 0\n 98 99 2 0 0 0 0\n 98100 1 0 0 0 0\n100101 1 0 0 0 0\n101102 2 0 0 0 0\n101103 1 0 0 0 0\n103104 2 0 0 0 0\n103105 1 0 0 0 0\n105106 1 0 0 0 0\n106107 1 0 0 0 0\n107108 2 0 0 0 0\n107109 1 0 0 0 0\n106110 2 0 0 0 0\n 97111 2 0 0 0 0\n112111 1 0 0 0 0\n 95112 1 0 0 0 0\n 25113 2 0 0 0 0\n113114 1 0 0 0 0\n114 15 1 0 0 0 0\n114 20 2 0 0 0 0\n 15115 1 1 0 0 0\n 16116 1 1 0 0 0\n 17117 1 1 0 0 0\nM END", "smiles": "CC[C@H](C)[C@@]1([H])C(=O)N[C@@H](C)C(=O)NC(=C)C(=O)N[C@@H](C)C(=O)N[C@@]23CCC(=N[C@]3([H])c4csc([C@H]([C@@H](C)OC(=O)c5cc([C@H](C)O)c6C=C[C@H]([C@@H](c6n5)O)N1)NC(=O)c7csc([C@H]([C@@](C)([C@@H](C)O)O)NC(=O)[C@@]8([H])CSC(=N8)/C(=C/C)/NC(=O)[C@H]([C@@H](C)O)NC(=O)c9csc2n9)n7)n4)c%10nc(cs%10)C(=O)NC(=C)C(=O)NC(=C)C(=O)N", "formula": "C72H85N19O18S5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 17, "ez_centers": 1, "molecular_weight": "1664.895", "optical_activity": "UNSPECIFIED", "references": [ "e3a87188-78db-4b48-a222-7617c2891518", "1b313df4-a680-43cf-a3ef-cdf1e2f24d90" ], "stereo_centers": 17 }, "unii": "HR4S203Y18" } ] }