{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "69d23398-86fb-41ae-a4d1-8a0e7f9a344e",
          "code": "50773-31-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=50773-31-4",
          "code_system": "CAS",
          "references": [
            "22bca19a-c328-4788-8dc1-5c2a579a52bd",
            "566fc9a2-4514-4da8-8e12-4afde8e1759b"
          ]
        },
        {
          "uuid": "28447389-0830-4857-ace2-ac067b313559",
          "code": "COMPOUND 4",
          "type": "PRIMARY",
          "url": "https://bestherbalextract.wordpress.com/2014/02/27/chemical-constituents-of-sophora-tonkinensis/",
          "code_system": "MANUFACTURER PRODUCT INFORMATION",
          "references": [
            "22bca19a-c328-4788-8dc1-5c2a579a52bd"
          ]
        },
        {
          "uuid": "a7476a0c-b643-4ca0-802b-05bb3bdd60bc",
          "code": "133082530",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/133082530",
          "code_system": "PUBCHEM",
          "references": [
            "cb52664a-f987-8546-6ed2-d802603c1f1c"
          ]
        },
        {
          "uuid": "9d5fd440-75bb-4e6b-9e1a-c3e2d486e247",
          "code": "HNA24018E7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "19c74f26-503a-419a-993d-351328213943",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "ce4cbc33-0345-4626-8750-ad940c4962eb"
          ],
          "related_substance": {
            "uuid": "c0d7d95c-6060-4d00-8507-cf9c96474086",
            "refuuid": "ea3e5747-515e-4647-b5a5-dc3804fae493",
            "name": "SOPHORA TONKINENSIS ROOT",
            "unii": "77J6094Z2H",
            "linking_id": "77J6094Z2H",
            "ref_pname": "SOPHORA TONKINENSIS ROOT",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f122920b-c530-48d6-b38a-4cbdb00fcca0",
          "name": "(2S)-2-(2,4-DIHYDROXYPHENYL)-7-HYDROXY-6,8-BIS(3-METHYLBUT-2-ENYL)CHROMAN-4-ONE",
          "stdName": "(2S)-2-(2,4-DIHYDROXYPHENYL)-7-HYDROXY-6,8-BIS(3-METHYLBUT-2-ENYL)CHROMAN-4-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2242caed-67cf-4254-bea6-8eaba91073f2"
          ],
          "display_name": false
        },
        {
          "uuid": "0466cf72-540d-412d-ac07-b8e1f549a7b4",
          "name": "2',4',7-TRIHYDROXY-6,8-BIS(3-METHYL-2-BUTENYL)FLAVANONE",
          "stdName": "2',4',7-TRIHYDROXY-6,8-BIS(3-METHYL-2-BUTENYL)FLAVANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2b60108-cfc6-4106-939f-a28b28a55138"
          ],
          "display_name": true
        },
        {
          "uuid": "5d9799f8-3d86-47e7-b234-4a10e3ec27e2",
          "name": "4H-1-BENZOPYRAN-4-ONE, 2-(2,4-DIHYDROXYPHENYL)-2,3-DIHYDRO-7-HYDROXY-6,8-BIS(3-METHYL-2-BUTENYL)-, (S)-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 2-(2,4-DIHYDROXYPHENYL)-2,3-DIHYDRO-7-HYDROXY-6,8-BIS(3-METHYL-2-BUTENYL)-, (S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "80b2ccd5-f008-45fe-86ab-7d6b62eb4be2"
          ],
          "display_name": false
        },
        {
          "uuid": "5eeb09df-91b1-4443-9bca-93764ab69010",
          "name": "COMPOUND 4",
          "stdName": "COMPOUND 4",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9318374c-95d3-4161-bf0a-933ece47593a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c2b60108-cfc6-4106-939f-a28b28a55138",
          "citation": "Phytochemistry Letters , Volume 1(3), Pages 163-167, 3 November 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80b2ccd5-f008-45fe-86ab-7d6b62eb4be2",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2242caed-67cf-4254-bea6-8eaba91073f2",
          "citation": "CHEMDRAW",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9318374c-95d3-4161-bf0a-933ece47593a",
          "citation": "http://www.sciencedirect.com/science/article/pii/S1874390008000578",
          "url": "http://www.sciencedirect.com/science/article/pii/S1874390008000578",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22bca19a-c328-4788-8dc1-5c2a579a52bd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391576000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce4cbc33-0345-4626-8750-ad940c4962eb",
          "citation": "PHYTOCHEMISTRY LETTERS , VOLUME 1(3), PAGES 163-167, 3 NOVEMBER 2008",
          "url": "http://www.sciencedirect.com/science/article/pii/S1874390008000578",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb52664a-f987-8546-6ed2-d802603c1f1c",
          "citation": "PUBCHEM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "566fc9a2-4514-4da8-8e12-4afde8e1759b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b597765c-04da-4629-ba0e-6b577aadbae5",
          "id": "b597765c-04da-4629-ba0e-6b577aadbae5",
          "molfile": "\n  Marvin  01132109242D          \n\n 30 32  0  0  1  0            999 V2000\n    7.8528   -5.3755    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.8528   -6.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1383   -6.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1383   -7.4381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4239   -6.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7094   -6.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9949   -6.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2805   -6.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5660   -6.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8515   -6.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8515   -7.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1371   -6.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9949   -5.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2805   -4.9631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7094   -4.9631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7094   -4.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9949   -3.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9949   -2.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2805   -2.4881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7094   -2.4881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4239   -5.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1383   -4.9631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5673   -4.9631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5673   -4.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2818   -3.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9963   -4.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7108   -3.7255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9963   -4.9631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2818   -5.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2818   -6.2005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 22  1  6  0  0  0\n  1 23  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n 21  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n 13  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 13  2  0  0  0  0\n 16 15  1  0  0  0  0\n 15 21  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 29  2  0  0  0  0\n 24 25  2  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 28 26  2  0  0  0  0\n 29 28  1  0  0  0  0\n 29 30  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCc1cc2C(=O)C[C@@H](c3ccc(cc3O)O)Oc2c(CC=C(C)C)c1O)C",
          "formula": "C25H28O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "903b7983-0295-4732-9d26-fca00ab2f86b"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "408.4878",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c4359b95-c862-4ceb-943b-5ed786548d3b",
      "version": "7",
      "structure": {
        "id": "0f319737-144d-46e2-b1f7-e6859c217f4f",
        "molfile": "\n  Marvin  01132101012D          \n\n 30 32  0  0  1  0            999 V2000\n    5.7094   -4.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7094   -4.9631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9949   -5.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2805   -4.9631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9949   -6.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2805   -6.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5660   -6.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8515   -6.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8515   -7.4381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1371   -6.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7094   -6.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4239   -6.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1383   -6.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8528   -6.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8528   -5.3755    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.5673   -4.9631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5673   -4.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2818   -3.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9963   -4.1381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7108   -3.7255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9963   -4.9631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2818   -5.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2818   -6.2005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1383   -4.9631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4239   -5.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1383   -7.4381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9949   -3.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9949   -2.9005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2805   -2.4881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7094   -2.4881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  5 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  6  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 19  2  0  0  0  0\n 22 21  1  0  0  0  0\n 16 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 24 15  1  0  0  0  0\n 25 24  1  0  0  0  0\n 25 12  1  0  0  0  0\n  2 25  2  0  0  0  0\n 13 26  2  0  0  0  0\n  1 27  1  0  0  0  0\n 27 28  2  0  0  0  0\n 28 29  1  0  0  0  0\n 28 30  1  0  0  0  0\nM  END",
        "smiles": "CC(=CCc1cc2C(=O)C[C@@H](c3ccc(cc3O)O)Oc2c(CC=C(C)C)c1O)C",
        "formula": "C25H28O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "408.4878",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "c2b60108-cfc6-4106-939f-a28b28a55138"
        ],
        "stereo_centers": 1
      },
      "unii": "HNA24018E7"
    }
  ]
}