{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "16c7790e-1d3a-4a33-9bf0-8ed02cef3133",
          "code": "5950-12-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5950-12-9",
          "code_system": "CAS",
          "references": [
            "bc5cb34c-285f-44c9-90ae-0dfddc0f1537",
            "27ac8a72-37e7-4705-912b-860b337f506e"
          ]
        },
        {
          "uuid": "71693f6a-737f-477f-8147-60ebb62d050d",
          "code": "5320621",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5320621",
          "code_system": "PUBCHEM",
          "references": [
            "bc5cb34c-285f-44c9-90ae-0dfddc0f1537"
          ]
        },
        {
          "uuid": "0b8a1da5-12d4-955b-c804-a28ed349e54b",
          "code": "Piperlonguminine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Piperlonguminine",
          "code_system": "WIKIPEDIA",
          "references": [
            "a7164bd1-f81a-1112-489f-f3b3f60ac6c9"
          ]
        },
        {
          "uuid": "c6a609e5-8be8-4496-9eb4-2eb905cb7297",
          "code": "HN39MC8KIO",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "39c3e8f6-78b6-8da3-ba2a-b7924407d47b",
          "code": "125178",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=125178",
          "code_system": "NSC",
          "references": [
            "5081b429-a122-b06c-cb58-0c6019d3bec9"
          ]
        },
        {
          "uuid": "a0958a6c-e503-c361-d367-77e2540655be",
          "code": "DTXSID401021742",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID401021742",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "730bdab7-18ee-4fef-ab4b-5771eee0b901",
          "name": "2,4-PENTADIENAMIDE, 5-(1,3-BENZODIOXOL-5-YL)-N-(2-METHYLPROPYL)-, (2E,4E)-",
          "stdName": "2,4-PENTADIENAMIDE, 5-(1,3-BENZODIOXOL-5-YL)-N-(2-METHYLPROPYL)-, (2E,4E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5fb4270-e25b-441e-b586-e110a46c114c",
            "62103fa4-d350-4274-bb15-d2d70f86349b"
          ],
          "display_name": false
        },
        {
          "uuid": "acde0d14-4548-4898-af60-9251c8fdb1ae",
          "name": "2,4-PENTADIENAMIDE, 5-(1,3-BENZODIOXOL-5-YL)-N-(2-METHYLPROPYL)-, (E,E)-",
          "stdName": "2,4-PENTADIENAMIDE, 5-(1,3-BENZODIOXOL-5-YL)-N-(2-METHYLPROPYL)-, (E,E)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5fb4270-e25b-441e-b586-e110a46c114c",
            "62103fa4-d350-4274-bb15-d2d70f86349b"
          ],
          "display_name": false
        },
        {
          "uuid": "c5db48a8-01f2-4b26-8d36-c644d695fe49",
          "name": "N-ISOBUTYLPIPERAMIDE",
          "stdName": "N-ISOBUTYLPIPERAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5fb4270-e25b-441e-b586-e110a46c114c",
            "62103fa4-d350-4274-bb15-d2d70f86349b"
          ],
          "display_name": false
        },
        {
          "uuid": "1f2617a5-6990-49d8-92f4-933b3e108af2",
          "name": "NSC-125178",
          "stdName": "NSC-125178",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5fb4270-e25b-441e-b586-e110a46c114c",
            "62103fa4-d350-4274-bb15-d2d70f86349b"
          ],
          "display_name": false
        },
        {
          "uuid": "52c40415-534b-41d3-ba83-fbab631400b1",
          "name": "PIPERAMIDE, N-ISOBUTYL-",
          "stdName": "PIPERAMIDE, N-ISOBUTYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5fb4270-e25b-441e-b586-e110a46c114c",
            "62103fa4-d350-4274-bb15-d2d70f86349b"
          ],
          "display_name": false
        },
        {
          "uuid": "01045435-aafa-42e1-b141-d3b96aa16a67",
          "name": "PIPERLONGUMININ",
          "stdName": "PIPERLONGUMININ",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5fb4270-e25b-441e-b586-e110a46c114c",
            "62103fa4-d350-4274-bb15-d2d70f86349b"
          ],
          "display_name": false
        },
        {
          "uuid": "c47153bf-21f4-48f7-b4a4-4b438573035f",
          "name": "PIPERLONGUMININE",
          "stdName": "PIPERLONGUMININE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "605b805e-98e7-4c3e-a409-8b3c514631ef",
            "62103fa4-d350-4274-bb15-d2d70f86349b",
            "a3a2250a-3840-44e1-b107-662cb4ae86f9"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "07ea1b9a-6ec7-48fe-9aa3-23ef2e5b1095",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "605b805e-98e7-4c3e-a409-8b3c514631ef",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "62103fa4-d350-4274-bb15-d2d70f86349b",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e5fb4270-e25b-441e-b586-e110a46c114c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc5cb34c-285f-44c9-90ae-0dfddc0f1537",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391544000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3858fd33-a1d5-4f2e-b5b4-6ac04136ae72",
          "citation": "SRS import [HN39MC8KIO]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HN39MC8KIO",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391544000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3a2250a-3840-44e1-b107-662cb4ae86f9",
          "citation": "PIPERLONGUMININE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a7164bd1-f81a-1112-489f-f3b3f60ac6c9",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "27ac8a72-37e7-4705-912b-860b337f506e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5081b429-a122-b06c-cb58-0c6019d3bec9",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "04f46857-75ea-4539-9514-0d0b21dc0b1a",
          "id": "04f46857-75ea-4539-9514-0d0b21dc0b1a",
          "molfile": "\n  Marvin  01132100332D          \n\n 20 21  0  0  0  0            999 V2000\n    2.4865   -5.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2010   -6.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2010   -6.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9155   -5.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9155   -4.7954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6299   -4.3829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6299   -3.5579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3444   -4.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0589   -4.3829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7733   -4.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4877   -4.3829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2022   -4.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2022   -5.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9167   -6.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6312   -5.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4158   -5.8753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9007   -5.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4158   -4.5404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6312   -4.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9167   -4.3829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 20 12  2  0  0  0  0\n 13 14  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 19 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CNC(=O)/C=C/C=C/c1ccc2c(c1)OCO2",
          "formula": "C16H19NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "590ec030-a379-49a4-ab9e-721e977d7cd8"
          },
          "defined_stereo": 0,
          "ez_centers": 2,
          "molecular_weight": "273.3276",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "02d421e4-714a-43ed-96a9-246da6b48185",
      "version": "6",
      "structure": {
        "id": "9967c94f-34ac-4c98-a804-b72dff253bda",
        "molfile": "\n  Marvin  01132107582D          \n\n 20 21  0  0  0  0            999 V2000\n    8.2022   -4.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4877   -4.3829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7733   -4.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0589   -4.3829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3444   -4.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6299   -4.3829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9155   -4.7954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9155   -5.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2010   -6.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4865   -5.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2010   -6.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6299   -3.5579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9167   -4.3829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6312   -4.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4158   -4.5404    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9007   -5.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4158   -5.8753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6312   -5.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9167   -6.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2022   -5.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  6 12  2  0  0  0  0\n 13  1  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 14 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  2  0  0  0  0\n  1 20  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CNC(=O)/C=C/C=C/c1ccc2c(c1)OCO2",
        "formula": "C16H19NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 2,
        "molecular_weight": "273.3276",
        "optical_activity": "NONE",
        "references": [
          "e5fb4270-e25b-441e-b586-e110a46c114c",
          "3858fd33-a1d5-4f2e-b5b4-6ac04136ae72"
        ],
        "stereo_centers": 0
      },
      "unii": "HN39MC8KIO"
    }
  ]
}