{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "6dffb9b8-7f3e-4d8e-b1aa-3a9edebad700", "code": "22881-35-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=22881-35-2", "code_system": "CAS", "references": [ "dad0ed66-45be-439f-b885-c79049b506d8", "bed32da1-9246-4be0-b190-3f48ed18bdef" ] }, { "uuid": "c981df82-9f70-45f2-9271-697496755606", "code": "C076013", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67076013", "code_system": "MESH", "references": [ "dad0ed66-45be-439f-b885-c79049b506d8" ] }, { "uuid": "d683f4ad-d5dd-4fbb-8c45-630937ea5e0c", "code": "SUB07506MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "dad0ed66-45be-439f-b885-c79049b506d8" ] }, { "uuid": "f7a0c020-e78f-47df-b65d-2d1df451b2e9", "code": "2645", "type": "PRIMARY", "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2645", "code_system": "INN", "references": [ "dad0ed66-45be-439f-b885-c79049b506d8" ] }, { "uuid": "419e83aa-822f-445d-ad93-fbe300e7e95d", "code": "245-284-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.041.153", "code_system": "ECHA (EC/EINECS)", "references": [ "dad0ed66-45be-439f-b885-c79049b506d8" ] }, { "uuid": "a8f91bb8-53ec-4ba1-b106-a1c248d30b8d", "code": "C65616", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C65616", "code_system": "NCI_THESAURUS", "references": [ "dad0ed66-45be-439f-b885-c79049b506d8" ] }, { "uuid": "d2bbaed8-3f2e-4339-a36c-fa620679eb69", "code": "CHEMBL1475693", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1475693", "code_system": "ChEMBL", "references": [ "dad0ed66-45be-439f-b885-c79049b506d8" ] }, { "uuid": "c313a5d3-df5b-411c-86f2-df86deb901f6", "code": "3326", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3326", "code_system": "PUBCHEM", "references": [ "dad0ed66-45be-439f-b885-c79049b506d8" ] }, { "uuid": "6e10f057-1856-078f-beb0-013601af5d7c", "code": "Famprofazone", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Famprofazone", "code_system": "WIKIPEDIA", "references": [ "3f329e53-05ac-7c76-1b29-c9ecd951ebd4" ] }, { "uuid": "a3df5360-8ea3-75e0-0707-e4143ff3fc28", "code": "DTXSID3045435", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3045435", "code_system": "EPA CompTox", "references": [ "e0b9fa56-4122-d90f-2487-7f6ccf03b727" ] }, { "uuid": "064a9eab-1198-82c8-a2ba-fa5c956029b5", "code": "C257", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic[C2356]|Nonsteroidal Antiinflammatory Drug", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C257", "code_system": "NCI_THESAURUS", "references": [ "817dab23-b452-eea1-45fc-59110700a0a7" ] }, { "uuid": "839ab9bb-2bfb-419f-8a45-30bde9f94103", "code": "HN0NCX453C", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "67bacce0-f4b3-7872-1ad3-57fa763b0fe2", "code": "1130", "type": "PRIMARY", "url": "https://drugcentral.org/drugcard/1130", "code_system": "DRUG CENTRAL", "references": [ "817dab23-b452-eea1-45fc-59110700a0a7" ] }, { "uuid": "ea637175-e2c0-ec3c-25e6-584d6d963929", "code": "100000081760", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "836446c9-3c89-a80a-336d-b7ca03f27ff3" ] }, { "uuid": "69a39656-c80b-3c3e-2328-359790212c88", "code": "759244", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759244", "code_system": "NSC", "references": [ "bec9b5fa-5062-c19f-9534-cad359c2a02a" ] } ], "relationships": [ { "uuid": "8c21d478-4850-4a72-a6b9-2bc4dbe3b827", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "6ed5241a-f60f-44a1-970a-eec1fa57ad17", "refuuid": "a93fd7c7-9797-4345-aad3-801c0a298ef8", "name": "FAMPROFAZONE", "unii": "HN0NCX453C", "linking_id": "HN0NCX453C", "ref_pname": "FAMPROFAZONE", "substance_class": "reference" } }, { "uuid": "516ff2af-f76b-4dd2-8240-88e4d5029b8b", "type": "ENANTIOMER->RACEMATE", "related_substance": { "uuid": "30103c18-7470-40af-bd13-6096aa7acf59", "refuuid": "91ee636e-d623-4a33-ba04-8732367023cb", "name": "FAMPROFAZONE, (S)-", "unii": "3EJA3FCJ0N", "linking_id": "3EJA3FCJ0N", "ref_pname": "FAMPROFAZONE, (S)-", "substance_class": "reference" } }, { "uuid": "08adfb8b-aad3-4049-a55d-5019266f4662", "type": "ENANTIOMER->RACEMATE", "related_substance": { "uuid": "e1748d2a-2ca5-43ff-b1d9-c92742880f9e", "refuuid": "d8d30dda-5795-4e3c-833e-de119e150425", "name": "FAMPROFAZONE, (R)-", "unii": "5KDU94DO5F", "linking_id": "5KDU94DO5F", "ref_pname": "FAMPROFAZONE, (R)-", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "a334a278-9835-4a62-abce-c16ce9585917", "name": "4-ISOPROPYL-2-METHYL-3-((METHYL(.ALPHA.-METHYLPHENETHYL)AMINO)METHYL)-1-PHENYL-3-PYRAZOLIN-5-ONE", "stdName": "4-ISOPROPYL-2-METHYL-3-((METHYL(.ALPHA.-METHYLPHENETHYL)AMINO)METHYL)-1-PHENYL-3-PYRAZOLIN-5-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "97eab851-23b6-4ea2-b70c-c1ce8abb7a2c" ], "display_name": false }, { "uuid": "2039541a-7797-4e8d-be4b-a33f684e4541", "name": "FAMPROFAZONE", "stdName": "FAMPROFAZONE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "926b04a2-5564-4061-826e-040051c61b98", "d3be585b-7860-4d99-8d87-7b526230abfb", "e427d192-f0b0-49e0-bce7-c8ba04e3accb", "f040ea32-85c0-4b10-ad7b-e43876fb2a96", "97a25c62-4bd9-4968-ae44-d9b9cdad79c5", "c00622e2-0421-45bf-b0e1-353a941991a6", "28a59aa9-1b2e-435d-b05a-6cae554ae852", "97eab851-23b6-4ea2-b70c-c1ce8abb7a2c" ], "display_name": true, "domains": [ "drug" ], "name_orgs": [ { "uuid": "0e99c2ed-1e47-4785-9a90-c550f26c59a3", "name_org": "INN" } ] }, { "uuid": "52327592-d58a-4296-b6e1-e44c16eb0b55", "name": "FAMPROFAZONE [MART.]", "stdName": "FAMPROFAZONE [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c00622e2-0421-45bf-b0e1-353a941991a6" ], "display_name": false }, { "uuid": "56104ae6-a6ec-b275-f032-0c76a709906b", "name": "Famprofazone [WHO-DD]", "stdName": "FAMPROFAZONE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e60d3cd5-e575-5c25-3253-6627f0116f5a" ], "display_name": false }, { "uuid": "f9c600f7-f250-7cd4-c8e8-5cbddddd5373", "name": "NSC-759244", "stdName": "NSC-759244", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "bec9b5fa-5062-c19f-9534-cad359c2a02a" ], "display_name": false }, { "uuid": "e6862512-f72b-468a-89b0-fd79a8d57727", "name": "famprofazone [INN]", "stdName": "FAMPROFAZONE [INN]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f040ea32-85c0-4b10-ad7b-e43876fb2a96" ], "display_name": false } ], "references": [ { "uuid": "97eab851-23b6-4ea2-b70c-c1ce8abb7a2c", "citation": "USP DICTIONARY 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "f040ea32-85c0-4b10-ad7b-e43876fb2a96", "citation": "INN Proposed List 21", "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL21.pdf", "doc_type": "INN_LIST", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c00622e2-0421-45bf-b0e1-353a941991a6", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "97a25c62-4bd9-4968-ae44-d9b9cdad79c5", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e427d192-f0b0-49e0-bce7-c8ba04e3accb", "citation": "WHO DRUG DICTIONARY", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "dad0ed66-45be-439f-b885-c79049b506d8", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389948000, "tags": [ "NOMEN" ] }, { "uuid": "3aa03734-703d-4e63-9040-43489666eb92", "citation": "SRS import [HN0NCX453C]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HN0NCX453C", "doc_type": "SRS", "public_domain": true, "document_date": 1493389948000, "tags": [ "NOMEN" ] }, { "uuid": "bd0bac0c-1129-483c-b935-75982c102058", "citation": "USP Dictionary 2010; INN 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d3be585b-7860-4d99-8d87-7b526230abfb", "citation": "FAMPROFAZONE [INN]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "926b04a2-5564-4061-826e-040051c61b98", "citation": "FAMPROFAZONE [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "28a59aa9-1b2e-435d-b05a-6cae554ae852", "citation": "FAMPROFAZONE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "3f329e53-05ac-7c76-1b29-c9ecd951ebd4", "citation": "WIKI", "url": "https://en.wikipedia.org/wiki/Famprofazone", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e0b9fa56-4122-d90f-2487-7f6ccf03b727", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=22881-35-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "817dab23-b452-eea1-45fc-59110700a0a7", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "bed32da1-9246-4be0-b190-3f48ed18bdef", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "bec9b5fa-5062-c19f-9534-cad359c2a02a", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "e60d3cd5-e575-5c25-3253-6627f0116f5a", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "836446c9-3c89-a80a-336d-b7ca03f27ff3", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "8297cc0b-1f10-47ba-bd4e-5ea8fff0f089", "id": "8297cc0b-1f10-47ba-bd4e-5ea8fff0f089", "molfile": "\n Marvin 01132106462D \n\n 28 30 0 0 0 0 999 V2000\n 2.4905 -3.9282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2874 -4.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5009 -4.9386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8707 -3.5584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2948 -3.5584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0041 -3.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0083 -3.6917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0167 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8958 -4.3167 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 7.9166 -5.1561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7107 -3.7596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4635 -4.0905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5499 -4.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3006 -5.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9642 -4.7540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8722 -3.9335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1212 -3.6061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2948 -2.7334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8933 -1.9637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5786 -2.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5765 -1.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2930 -1.0806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2913 -0.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5752 0.1551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8594 -0.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8647 -1.0865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8707 -2.7334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1545 -2.3239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 4 5 2 0 0 0 0\n 27 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 18 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 17 12 2 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 27 1 0 0 0 0\n 21 22 1 0 0 0 0\n 26 21 2 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 27 28 2 0 0 0 0\nM END", "smiles": "CC(C)c1c(CN(C)C(C)Cc2ccccc2)n(C)n(-c3ccccc3)c1=O", "formula": "C24H31N3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "1c8ac9e2-3938-4a69-95c4-dcf603c3410a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "377.5233", "optical_activity": "( + / - )", "stereo_centers": 1 } ], "definition_level": "COMPLETE", "uuid": "a93fd7c7-9797-4345-aad3-801c0a298ef8", "version": "16", "structure": { "id": "d9176a2e-7e0b-4e96-b2f0-0c853be7e49e", "molfile": "\n Marvin 01132111152D \n\n 28 30 0 0 0 0 999 V2000\n 3.8707 -2.7334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8707 -3.5584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2948 -3.5584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2948 -2.7334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5786 -2.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2874 -4.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4905 -3.9282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5009 -4.9386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8933 -1.9637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1545 -2.3239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5765 -1.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2930 -1.0806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2913 -0.2564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5752 0.1551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8594 -0.2636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8647 -1.0865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0041 -3.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0083 -3.6917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8958 -4.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0167 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9166 -5.1561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7107 -3.7596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4635 -4.0905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5499 -4.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3006 -5.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9642 -4.7540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8722 -3.9335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1212 -3.6061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13 14 2 0 0 0 0\n 6 7 1 0 0 0 0\n 14 15 1 0 0 0 0\n 3 4 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 11 1 0 0 0 0\n 6 8 1 0 0 0 0\n 3 17 1 0 0 0 0\n 4 5 1 0 0 0 0\n 17 18 1 0 0 0 0\n 4 9 1 0 0 0 0\n 18 19 1 0 0 0 0\n 5 1 1 0 0 0 0\n 18 20 1 0 0 0 0\n 1 10 2 0 0 0 0\n 19 21 1 0 0 0 0\n 2 3 2 0 0 0 0\n 19 22 1 0 0 0 0\n 5 11 1 0 0 0 0\n 22 23 1 0 0 0 0\n 1 2 1 0 0 0 0\n 23 24 2 0 0 0 0\n 11 12 2 0 0 0 0\n 24 25 1 0 0 0 0\n 2 6 1 0 0 0 0\n 25 26 2 0 0 0 0\n 12 13 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 23 1 0 0 0 0\nM END", "smiles": "CC(C)c1c(CN(C)C(C)Cc2ccccc2)n(C)n(-c3ccccc3)c1=O", "formula": "C24H31N3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "RACEMIC", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "377.5233", "optical_activity": "( + / - )", "references": [ "bd0bac0c-1129-483c-b935-75982c102058", "3aa03734-703d-4e63-9040-43489666eb92", "f040ea32-85c0-4b10-ad7b-e43876fb2a96" ], "stereo_centers": 1 }, "unii": "HN0NCX453C" } ] }