{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b78bec1a-761a-4b43-867e-cbac3b36fab8",
          "code": "155-04-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=155-04-4",
          "code_system": "CAS",
          "references": [
            "29921cf2-7f44-4a74-b24e-e35b34efec0f",
            "c491d549-2849-4036-bb6c-4aeda0427bb5"
          ]
        },
        {
          "uuid": "ceeb2449-7695-475c-b14c-9afc0694d766",
          "code": "51705",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:588",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "29921cf2-7f44-4a74-b24e-e35b34efec0f"
          ]
        },
        {
          "uuid": "392d5bab-0655-45b4-bc0b-e3de1102dd98",
          "code": "205-840-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.311",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "29921cf2-7f44-4a74-b24e-e35b34efec0f"
          ]
        },
        {
          "uuid": "c7161546-331e-a515-ec08-e023afa4a66f",
          "code": "5419",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5419",
          "code_system": "HSDB",
          "references": [
            "37634115-12dd-0f5c-cd4a-054b1fb18067"
          ]
        },
        {
          "uuid": "7b36c7b3-c21d-bee8-f039-586df3e888bc",
          "code": "DTXSID6020808",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6020808",
          "code_system": "EPA CompTox",
          "references": [
            "48e434b6-b7e1-047c-2d19-060198ba4b9f"
          ]
        },
        {
          "uuid": "37989f1a-b8e6-71e4-a807-c61c18b8083f",
          "code": "9071",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9071",
          "code_system": "PUBCHEM",
          "references": [
            "c55259db-3e2d-a922-7036-7dffc2859c57"
          ]
        },
        {
          "uuid": "e9e501ee-a18a-4a51-a6a9-d374ff823eab",
          "code": "HMM5IX9Q3B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "46dcacdf-29cf-9f95-ed71-3cecfb13112c",
          "code": "285168",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=285168",
          "code_system": "NSC",
          "references": [
            "9d6558b7-693a-8bcd-1dbb-6bf06c0a005b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9d02ab5e-56d5-465e-8aa6-eed28c93228d",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "058cbdd7-3835-4cff-9bce-4874ae939076",
            "refuuid": "ba6b1cbe-4bee-4c98-854a-64d9f111bdf7",
            "name": "2-Mercaptobenzothiazole",
            "unii": "5RLR54Z22K",
            "linking_id": "5RLR54Z22K",
            "ref_pname": "2-Mercaptobenzothiazole",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "dc4d1b3b-8e4a-4efb-8309-7a3b9593e19e",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "914265e3-3c0c-4757-87e4-05bba9dc4317",
            "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c",
            "name": "ZINC CATION",
            "unii": "13S1S8SF37",
            "linking_id": "13S1S8SF37",
            "ref_pname": "ZINC CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "749486fe-bfcc-4bac-b2f4-c94150e1fa53",
          "amount": {
            "uuid": "e594c63e-34a5-491f-b3a4-043f92041ce6"
          },
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "2fb15fef-da5e-4a0b-a379-76c783f6d0f6",
            "refuuid": "ba6b1cbe-4bee-4c98-854a-64d9f111bdf7",
            "name": "2-Mercaptobenzothiazole",
            "unii": "5RLR54Z22K",
            "linking_id": "5RLR54Z22K",
            "ref_pname": "2-Mercaptobenzothiazole",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fddd74d2-4ada-64c0-79e8-ee3b15087313",
          "name": "NSC-285168",
          "stdName": "NSC-285168",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9d6558b7-693a-8bcd-1dbb-6bf06c0a005b"
          ],
          "display_name": false
        },
        {
          "uuid": "eff20724-2f46-426f-b462-d52247a1eaee",
          "name": "ZINC 2-MERCAPTOBENZOTHIAZOLE",
          "stdName": "ZINC 2-MERCAPTOBENZOTHIAZOLE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ab9dac4-ea1e-43fc-a82e-dc20c2302a1d"
          ],
          "display_name": true
        },
        {
          "uuid": "0face6b3-566f-4633-8f05-2c024a4d315d",
          "name": "ZINC MERCAPTOBENZOTHIAZOLE [HSDB]",
          "stdName": "ZINC MERCAPTOBENZOTHIAZOLE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bdebd4f4-265b-48ad-8dcd-d1ed87186c46",
            "fed982d7-0019-422c-90bb-0fa6f32fb075"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7ab9dac4-ea1e-43fc-a82e-dc20c2302a1d",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fed982d7-0019-422c-90bb-0fa6f32fb075",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bdebd4f4-265b-48ad-8dcd-d1ed87186c46",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29921cf2-7f44-4a74-b24e-e35b34efec0f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391116000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9266f657-8fd1-4fb7-922f-05eb08cea1a7",
          "citation": "SRS import [HMM5IX9Q3B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HMM5IX9Q3B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391116000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55e31954-9439-4c07-879f-9d83d38c96a4",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "37634115-12dd-0f5c-cd4a-054b1fb18067",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+155-04-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "48e434b6-b7e1-047c-2d19-060198ba4b9f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=155-04-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c55259db-3e2d-a922-7036-7dffc2859c57",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "c491d549-2849-4036-bb6c-4aeda0427bb5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9d6558b7-693a-8bcd-1dbb-6bf06c0a005b",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a400bd11-6075-43b2-8345-2816f34b5500",
          "id": "a400bd11-6075-43b2-8345-2816f34b5500",
          "molfile": "\n  Marvin  01132108312D          \n\n  1  0  0  0  0  0            999 V2000\n   11.8118   -1.9170    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Zn+2]",
          "formula": "Zn",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d22cea97-8b17-4593-923a-09c1fc736448"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "65.3956",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "71c074d9-d5f0-412c-be3b-f439e4392ecd",
          "id": "71c074d9-d5f0-412c-be3b-f439e4392ecd",
          "molfile": "\n  Marvin  01132105542D          \n\n 10 11  0  0  0  0            999 V2000\n    8.7668   -2.2072    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9324   -2.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4430   -2.8757    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6835   -2.6145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9593   -3.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2428   -2.6145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2428   -1.8092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9593   -1.3903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6835   -1.8092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4430   -1.5430    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  2 10  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  9  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)[nH]c(=S)s2",
          "formula": "C7H5NS2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "0cd619af-5d84-489e-9fa2-9787b6a4c8f4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "167.2537",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0733e033-ead1-4311-bce1-63368162bf75",
      "version": "8",
      "structure": {
        "id": "e013dce1-3380-48c9-af02-45a80109d580",
        "molfile": "\n  Marvin  01132111362D          \n\n 21 22  0  0  0  0            999 V2000\n   11.8118   -1.9170    0.0000 Zn  0  2  0  0  0  0  0  0  0  0  0  0\n    8.7668   -2.2072    0.0000 S   0  5  0  0  0  0  0  0  0  0  0  0\n    7.9324   -2.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4430   -2.8757    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6835   -2.6145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9593   -3.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2428   -2.6145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2428   -1.8092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9593   -1.3903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6835   -1.8092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4430   -1.5430    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7668   -2.2072    0.0000 S   0  5  0  0  0  0  0  0  0  0  0  0\n    7.9324   -2.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4430   -2.8757    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6835   -2.6145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9593   -3.0212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2428   -2.6145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2428   -1.8092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9593   -1.3903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6835   -1.8092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4430   -1.5430    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  5 10  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n  3 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 21  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 20  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\nM  CHG  3   1   2   2  -1  12  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1 15   2   3   4   5   6   7   8   9  10  11  12  13  14  15  16\nM  SAL   1  5  17  18  19  20  21\nM  SPA   1 10   2   3   4   5   6   7   8   9  10  11\nM  SDI   1  4    4.8228   -3.4412    4.8228   -0.9703\nM  SDI   1  4    9.1868   -0.9703    9.1868   -3.4412\nM  SMT   1 2\nM  END",
        "smiles": "c1ccc2c(c1)nc([S-])s2.c1ccc2c(c1)nc([S-])s2.[Zn+2]",
        "formula": "2C7H4NS2.Zn",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "397.8871",
        "optical_activity": "NONE",
        "references": [
          "9266f657-8fd1-4fb7-922f-05eb08cea1a7",
          "55e31954-9439-4c07-879f-9d83d38c96a4"
        ],
        "stereo_centers": 0
      },
      "unii": "HMM5IX9Q3B"
    }
  ]
}