{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ac27074f-e68d-4b2c-bfc1-94d5673cf7b8", "code": "6985-95-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6985-95-1", "code_system": "CAS", "references": [ "34fe6ab2-630e-43e6-9b14-b95d8f967e98", "1c9db7cd-d79f-4b36-9ba1-421c307b3123" ] }, { "uuid": "13044cdb-2360-4655-8df0-7fb5ba2c9c74", "code": "230-250-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.027.501", "code_system": "ECHA (EC/EINECS)", "references": [ "34fe6ab2-630e-43e6-9b14-b95d8f967e98" ] }, { "uuid": "20251d1c-9848-2bb4-7c50-515c18981718", "code": "DTXSID5064540", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5064540", "code_system": "EPA CompTox", "references": [ "c9bbbcd4-6c45-ae74-ce77-755d709ee6d4" ] }, { "uuid": "90af9139-1b63-4a79-9b09-186a52c63683", "code": "HM2QQL7LGE", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "1c9db7cd-d79f-4b36-9ba1-421c307b3123" ] } ], "substance_class": "chemical", "names": [ { "uuid": "96682479-4cd1-418f-8bf7-bbdd2f9b616a", "name": "2-Naphthalenecarboxamide, N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-3-hydroxy-4-[(2-methoxy-4-nitrophenyl)azo]-", "stdName": "2-NAPHTHALENECARBOXAMIDE, N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)-3-HYDROXY-4-((2-METHOXY-4-NITROPHENYL)AZO)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ea0405d4-7a81-44a1-9f66-8a0e8555e8e9", "24d44ba3-2cfb-4ebb-969a-d79abc7413fc" ], "display_name": false }, { "uuid": "b1e177db-9c82-4db8-b081-da536582bc5e", "name": "2-Naphthalenecarboxamide, N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-3-hydroxy-4-[2-(2-methoxy-4-nitrophenyl)diazenyl]-", "stdName": "2-NAPHTHALENECARBOXAMIDE, N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)-3-HYDROXY-4-(2-(2-METHOXY-4-NITROPHENYL)DIAZENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1c9db7cd-d79f-4b36-9ba1-421c307b3123" ], "display_name": false }, { "uuid": "597ea6d9-a0f6-456a-8f32-b6c1c64400dc", "name": "N-(2,3-Dihydro-2-oxo-1H-benzimidazol-5-yl)-3-hydroxy-4-[2-(2-methoxy-4-nitrophenyl)diazenyl]-2-naphthalenecarboxamide", "stdName": "N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)-3-HYDROXY-4-(2-(2-METHOXY-4-NITROPHENYL)DIAZENYL)-2-NAPHTHALENECARBOXAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "1c9db7cd-d79f-4b36-9ba1-421c307b3123" ], "display_name": true } ], "references": [ { "uuid": "24d44ba3-2cfb-4ebb-969a-d79abc7413fc", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ea0405d4-7a81-44a1-9f66-8a0e8555e8e9", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "34fe6ab2-630e-43e6-9b14-b95d8f967e98", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393757000, "tags": [ "NOMEN" ] }, { "uuid": "c9bbbcd4-6c45-ae74-ce77-755d709ee6d4", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6985-95-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "1c9db7cd-d79f-4b36-9ba1-421c307b3123", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "05fa0def-f7b8-4783-aad4-3c8119712752", "id": "05fa0def-f7b8-4783-aad4-3c8119712752", "molfile": "\n Marvin 01132100362D \n\n 37 41 0 0 0 0 999 V2000\n 3.9781 -1.7514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6973 -2.1583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4130 -1.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1321 -2.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8491 -1.7386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8511 -0.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1310 -0.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4100 -0.9226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6916 -0.5145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6897 0.3090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9712 0.7170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2558 0.3069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2587 -0.5126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5341 0.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5336 1.5357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2547 1.9459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2583 2.7729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9784 3.1754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6991 2.7602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6908 1.9457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9707 1.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8175 0.3052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0920 0.7149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8184 -0.5133 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0973 -0.9239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3760 -0.5141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3396 -0.9239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3396 -1.7434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9593 -2.2963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6206 -3.0464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0305 -3.7580 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.2135 -2.9545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3760 -2.1532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0973 -1.7434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5704 -2.1488 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 7.5664 -2.9757 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 8.2839 -1.7423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 8 3 2 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 5 35 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 11 21 2 0 0 0 0\n 12 13 1 0 0 0 0\n 14 12 2 0 0 0 0\n 15 14 1 0 0 0 0\n 22 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 16 17 1 0 0 0 0\n 21 16 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 23 22 2 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 34 25 2 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 33 28 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 30 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 35 36 1 0 0 0 0\n 35 37 2 0 0 0 0\nM CHG 2 35 1 36 -1\nM END", "smiles": "COc1cc(ccc1/N=N/c2c3ccccc3cc(c2O)C(=O)Nc4ccc5c(c4)[nH]c(=O)[nH]5)[N+](=O)[O-]", "formula": "C25H18N6O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "70c7f827-c34f-4487-9953-9b970d25241a" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "498.448", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "eefdde5a-8841-4c31-b8f9-648ac6e6facd", "version": "7", "structure": { "id": "ba5f5c0c-c0bb-4408-aa34-991705ee3b9c", "molfile": "\n JSDraw211272319202D\n\n 37 41 0 0 0 0 0 V2000\n 15.8723 -6.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2230 -7.0210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5742 -6.2414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5749 -4.6805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9265 -3.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2773 -4.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2766 -6.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9250 -7.0216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9250 -8.5816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2760 -9.3615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2760 -10.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9240 -11.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5720 -10.9215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2201 -11.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2201 -13.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5720 -14.0414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9240 -13.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2760 -14.0414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.6279 -13.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.6279 -11.7015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9787 -10.9213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9787 -14.0416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9785 -15.6016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.3299 -13.2618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6807 -14.0420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6807 -15.6020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0326 -16.3820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3846 -15.6020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3846 -14.0420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0326 -13.2620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8718 -13.5636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7869 -14.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3469 -14.8220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.8718 -16.0804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9265 -2.3400 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 18.5756 -1.5600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2774 -1.5600 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 3 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 12 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 11 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 19 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 25 30 1 0 0 0 0\n 29 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 32 34 1 0 0 0 0\n 28 34 1 0 0 0 0\n 5 35 1 0 0 0 0\n 35 36 2 0 0 0 0\n 35 37 1 0 0 0 0\nM CHG 2 35 1 37 -1\nM END", "smiles": "COc1cc(ccc1/N=N/c2c3ccccc3cc(c2O)C(=O)Nc4ccc5c(c4)[nH]c(=O)[nH]5)[N+](=O)[O-]", "formula": "C25H18N6O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "498.448", "optical_activity": "NONE", "references": [ "24d44ba3-2cfb-4ebb-969a-d79abc7413fc" ], "stereo_centers": 0 }, "unii": "HM2QQL7LGE" } ] }