{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "708c3f36-6729-4761-acff-1ec938ca3779", "code": "HL2MH8L5Y3", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "94ddf2f8-7fb9-4362-853e-db8746fbd5e0", "code": "3068-78-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=3068-78-8", "code_system": "CAS", "references": [ "5ca9db6a-62a8-43d5-820e-1c8d207744fd", "9b675ac1-e7f6-478e-a947-0bc2eed9f0ef" ] }, { "uuid": "cb156ebb-ea56-4e98-b7ac-94a0292f9bc0", "code": "221-329-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.019.391", "code_system": "ECHA (EC/EINECS)", "references": [ "5ca9db6a-62a8-43d5-820e-1c8d207744fd" ] }, { "uuid": "41f02206-dc82-4cc0-ae54-c2c2a45f09a5", "code": "76477", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/76477", "code_system": "PUBCHEM", "references": [ "5ca9db6a-62a8-43d5-820e-1c8d207744fd" ] }, { "uuid": "0900ce42-d648-622e-691b-cc3e18efd15b", "code": "DTXSID9074644", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9074644", "code_system": "EPA CompTox", "references": [ "299d17cb-ef1d-d1ed-50f1-ed010672ccc6" ] } ], "substance_class": "chemical", "names": [ { "uuid": "24c2c766-a8a6-4647-9e99-48b348644374", "name": "CYCLOHEXANAMINE, N-(3-(TRIMETHOXYSILYL)PROPYL)-", "stdName": "CYCLOHEXANAMINE, N-(3-(TRIMETHOXYSILYL)PROPYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "133cb400-45c0-4091-9da2-0892d99cd639" ], "display_name": false }, { "uuid": "eb0716a3-4994-417c-8b94-33925000314f", "name": "GENIOSIL GF 92", "stdName": "GENIOSIL GF 92", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2f49a31f-cd9e-47eb-b824-2138fb1b087f", "c5aa6033-441e-4839-bb9b-f6140318149c" ], "display_name": true }, { "uuid": "77295ff7-acc6-499b-bb50-4e3a17d741aa", "name": "N-(3-(TRIMETHOXYSILYL)PROPYL)CYCLOHEXANAMINE", "stdName": "N-(3-(TRIMETHOXYSILYL)PROPYL)CYCLOHEXANAMINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9b675ac1-e7f6-478e-a947-0bc2eed9f0ef" ], "display_name": false }, { "uuid": "9d410b3a-1bf6-42d6-8f66-37925be52fc4", "name": "N-(3-(TRIMETHOXYSILYL)PROPYLCYCLOHEXYLAMINE)", "stdName": "N-(3-(TRIMETHOXYSILYL)PROPYLCYCLOHEXYLAMINE)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "133cb400-45c0-4091-9da2-0892d99cd639" ], "display_name": false } ], "references": [ { "uuid": "2f49a31f-cd9e-47eb-b824-2138fb1b087f", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c5aa6033-441e-4839-bb9b-f6140318149c", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5ca9db6a-62a8-43d5-820e-1c8d207744fd", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394058000, "tags": [ "NOMEN" ] }, { "uuid": "299d17cb-ef1d-d1ed-50f1-ed010672ccc6", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3068-78-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "133cb400-45c0-4091-9da2-0892d99cd639", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "9b675ac1-e7f6-478e-a947-0bc2eed9f0ef", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a5cd6458-dfad-4fd5-8b3e-d3a91f062bdd", "id": "a5cd6458-dfad-4fd5-8b3e-d3a91f062bdd", "molfile": "\n Marvin 01132108372D \n\n 17 17 0 0 0 0 999 V2000\n 4.9975 6.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7055 7.0798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4135 6.6634 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1215 6.2469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8294 6.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5416 6.2469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2496 6.6634 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9576 6.2469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9576 5.4140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6656 4.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3777 5.4140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3777 6.2469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6656 6.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9970 5.9554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1642 5.9554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8299 7.3714 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4135 8.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 0 0 0 0\n 14 3 1 0 0 0 0\n 16 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 13 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 17 16 1 0 0 0 0\nM END", "smiles": "CO[Si](CCCNC1CCCCC1)(OC)OC", "formula": "C12H27NO3Si", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e93248c4-f39c-4cc9-8493-07cb24f348ce" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "261.4335", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "bb8f84b3-8211-4f3b-9d12-8de64957fc1a", "version": "5", "structure": { "id": "490c2f8e-8cf7-480a-862d-60f0a5d9fece", "molfile": "\n Marvin 01132103502D \n\n 17 17 0 0 0 0 999 V2000\n 6.4135 6.6634 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9970 5.9554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7055 7.0798 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8299 7.3714 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2496 6.6634 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1215 6.2469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8294 6.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9576 6.2469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5416 6.2469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9975 6.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1642 5.9554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4135 8.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6656 6.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9576 5.4140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6656 4.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3777 6.2469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3777 5.4140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 1 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 9 1 0 0 0 0\n 6 1 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 5 1 0 0 0 0\n 9 7 1 0 0 0 0\n 10 3 1 0 0 0 0\n 11 2 1 0 0 0 0\n 12 4 1 0 0 0 0\n 13 8 1 0 0 0 0\n 14 8 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 13 1 0 0 0 0\n 17 15 1 0 0 0 0\n 17 16 1 0 0 0 0\nM END", "smiles": "CO[Si](CCCNC1CCCCC1)(OC)OC", "formula": "C12H27NO3Si", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "261.4335", "optical_activity": "NONE", "references": [ "2f49a31f-cd9e-47eb-b824-2138fb1b087f" ], "stereo_centers": 0 }, "unii": "HL2MH8L5Y3" } ] }