{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2df9a901-edb2-4c9c-b88b-a156657aaa72", "code": "100241-46-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=100241-46-1", "code_system": "CAS", "references": [ "5b7027f8-dc2c-48a5-927b-ad5b423f063d", "290a4640-d61c-4459-9333-cb019ef378a5" ] }, { "uuid": "0327eae9-5c94-46e3-9efb-e899d2c2cb2e", "code": "127504", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/127504", "code_system": "PUBCHEM", "references": [ "5b7027f8-dc2c-48a5-927b-ad5b423f063d" ] }, { "uuid": "f7e77bcd-8621-74e0-1dd2-018feee2c6c5", "code": "DTXSID30143050", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30143050", "code_system": "EPA CompTox", "references": [ "69895eae-d9e6-f905-13e2-63d2bcb7d34d" ] }, { "uuid": "1b55b22e-8d60-490c-8746-f98c094db7d4", "code": "HK76HE61AQ", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "278bbdb0-c68b-b3dc-463a-f182127e11fe", "code": "DB08017", "type": "PRIMARY", "url": "http://www.drugbank.ca/drugs/DB08017", "code_system": "DRUG BANK", "references": [ "193a8ca8-1891-49a6-69c0-7a7d796f40b6" ] } ], "substance_class": "chemical", "names": [ { "uuid": "e276d159-1b38-4ae7-8441-809573a1ecec", "name": "3-METHOXY-6-(4-(3-METHYLPHENYL)-1-PIPERAZINYL)PYRIDAZINE", "stdName": "3-METHOXY-6-(4-(3-METHYLPHENYL)-1-PIPERAZINYL)PYRIDAZINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7878f8df-27d1-4a63-95b3-0acdf577f686" ], "display_name": true }, { "uuid": "06013086-815d-6bd1-66af-982749a00625", "name": "3-METHOXY-6-(4-(3-METHYLPHENYL)PIPERAZIN-1-YL)PYRIDAZINE", "stdName": "3-METHOXY-6-(4-(3-METHYLPHENYL)PIPERAZIN-1-YL)PYRIDAZINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "290a4640-d61c-4459-9333-cb019ef378a5" ], "display_name": false }, { "uuid": "bbdb84c7-95f5-d73a-115b-c391125bca01", "name": "PYRIDAZINE, 3-METHOXY-6-(4-(3-METHYLPHENYL)-1-PIPERAZINYL)-", "stdName": "PYRIDAZINE, 3-METHOXY-6-(4-(3-METHYLPHENYL)-1-PIPERAZINYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "290a4640-d61c-4459-9333-cb019ef378a5" ], "display_name": false }, { "uuid": "2fdfbaac-3074-b98f-510e-308d0a9a5858", "name": "R-61837", "stdName": "R-61837", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "290a4640-d61c-4459-9333-cb019ef378a5" ], "display_name": false } ], "references": [ { "uuid": "7878f8df-27d1-4a63-95b3-0acdf577f686", "citation": "Drug Bank", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "5b7027f8-dc2c-48a5-927b-ad5b423f063d", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393548000, "tags": [ "NOMEN" ] }, { "uuid": "74001817-4b2f-47c6-b3b5-9c17ab6d28b8", "citation": "Drug Bank DB08017", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "69895eae-d9e6-f905-13e2-63d2bcb7d34d", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=100241-46-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "193a8ca8-1891-49a6-69c0-7a7d796f40b6", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "290a4640-d61c-4459-9333-cb019ef378a5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "b21dbb9a-b49e-4027-9626-3711f8d906ca", "id": "b21dbb9a-b49e-4027-9626-3711f8d906ca", "molfile": "\n Marvin 01132109142D \n\n 21 23 0 0 0 0 999 V2000\n -0.7263 4.4727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0118 4.0602 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0118 3.2352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7263 2.8227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7263 1.9977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0118 1.5852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7027 1.9977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7027 2.8227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0118 0.7602 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7027 0.3477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7027 -0.4773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0118 -0.8898 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7263 -0.4773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7263 0.3477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0118 -1.7148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7263 -2.1273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7263 -2.9523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0118 -3.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7027 -2.9523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4171 -3.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7027 -2.1273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 8 2 0 0 0 0\n 5 4 2 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 6 9 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 14 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 15 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 21 2 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 2 0 0 0 0\n 19 20 1 0 0 0 0\n 21 19 1 0 0 0 0\nM END", "smiles": "Cc1cccc(c1)N2CCN(CC2)c3ccc(nn3)OC", "formula": "C16H20N4O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "edadf66a-a400-4b21-a9e7-aa4e50ac4b08" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "284.3568", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "217362b5-335d-4c1b-8bb4-8b0edc6460f1", "version": "7", "structure": { "id": "599a3708-c068-43ae-812f-21acd5c433a7", "molfile": "\n Marvin 01132104392D \n\n 21 23 0 0 0 0 999 V2000\n 16.7169 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4314 -1.2375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4314 -2.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1459 -2.4749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1459 -3.2999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4314 -3.7124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7169 -3.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7169 -2.4749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4314 -4.5374 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1459 -4.9499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1459 -5.7748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4314 -6.1873 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7169 -5.7748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7169 -4.9499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4314 -7.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1459 -7.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1459 -8.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4314 -8.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7169 -8.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7169 -7.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8603 -8.6622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 3 8 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 6 9 1 0 0 0 0\n 7 8 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 14 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 15 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 20 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 17 21 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\nM END", "smiles": "Cc1cccc(c1)N2CCN(CC2)c3ccc(nn3)OC", "formula": "C16H20N4O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "284.3568", "optical_activity": "NONE", "references": [ "74001817-4b2f-47c6-b3b5-9c17ab6d28b8" ], "stereo_centers": 0 }, "unii": "HK76HE61AQ" } ] }