{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "99e59b8f-f36e-48d2-969d-8702ff27d497",
          "code": "CLONAZOLAM",
          "comments": "Clonazolam (also known as clonitrazolam) is a benzodiazepine that has been sold online as a designer drug.Clonazolam is reputed to be highly potent, and concerns have been raised that clonazolam and flubromazolam in particular may pose comparatively higher risks than other designer benzodiazepines, due to their ability to produce strong sedation and amnesia at oral doses of as little as 0.5 mg.",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Clonazolam",
          "code_system": "WIKIPEDIA",
          "references": [
            "c7691882-4239-4af3-aec4-7ee4485e6cd3"
          ]
        },
        {
          "uuid": "60fb9219-ab7e-4215-a3db-0680f9c00b36",
          "code": "33887-02-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=33887-02-4",
          "code_system": "CAS",
          "references": [
            "c7691882-4239-4af3-aec4-7ee4485e6cd3",
            "48b7af74-2b71-450c-8384-dc0e58033772"
          ]
        },
        {
          "uuid": "41c5b1a2-1ac1-41e6-8615-aaab46f616c5",
          "code": "SUB179333",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c7691882-4239-4af3-aec4-7ee4485e6cd3"
          ]
        },
        {
          "uuid": "8c5a76ff-1757-4bef-b1f1-9107201ad95f",
          "code": "12317881",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12317881",
          "code_system": "PUBCHEM",
          "references": [
            "c7691882-4239-4af3-aec4-7ee4485e6cd3"
          ]
        },
        {
          "uuid": "b1190291-ebf6-8f8e-3bd4-ccc78d74d563",
          "code": "DB14716",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB14716",
          "code_system": "DRUG BANK",
          "references": [
            "672539e1-c209-c564-540e-efb570732e39"
          ]
        },
        {
          "uuid": "7a7987a1-1697-489c-8ae3-22f510ee4c36",
          "code": "HJH52YYC1X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d7c9c64b-33fd-7a04-1c13-4f5c88476882",
          "code": "Designer-drugs-Clonazolam",
          "comments": "Wikipedia|List of designer drugs|Sedatives|Benzodiazepines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "672539e1-c209-c564-540e-efb570732e39"
          ]
        },
        {
          "uuid": "affa1401-ae2b-7383-ba71-0181938f7e5a",
          "code": "100000164746",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "de29fd64-280d-dd22-6054-3faef173f1d8"
          ]
        },
        {
          "uuid": "4512562d-1b6a-4343-a3a2-95ed9398b6c4",
          "code": "2786",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I.|Temporary listing of substances subject to emergency scheduling",
          "type": "PRIMARY",
          "url": "https://www.ecfr.gov/current/title-21/chapter-II/part-1308",
          "code_system": "DEA NO."
        },
        {
          "uuid": "1a7201a9-4373-0eb7-f223-4966e93d217e",
          "code": "DTXSID301014166",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301014166",
          "code_system": "EPA CompTox",
          "references": [
            "23e04b18-79f6-f16c-48a7-0a489e772581"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2c5da059-1361-4477-8541-64a4cf8aa60d",
          "amount": {
            "uuid": "1f719b89-c778-4fa3-b1cb-06c71679f8f3"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "aa62473a-1ce3-416d-a504-eb344bc56056",
            "refuuid": "09f08fd2-17e0-42c7-86e3-c600f93f96a4",
            "name": "Clonazolam",
            "unii": "HJH52YYC1X",
            "linking_id": "HJH52YYC1X",
            "ref_pname": "Clonazolam",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ddc3d565-e9b3-44d3-af3d-05596620ff72",
          "amount": {
            "uuid": "82460d80-be8a-4d35-846c-d6c2819cbfd6"
          },
          "type": "METABOLITE ACTIVE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "32653f8b-1b36-45b0-9b7e-98b5fc2707f7"
          ],
          "related_substance": {
            "uuid": "3634b1a5-7a32-48fc-bd96-2904ac802139",
            "refuuid": "3823bb19-99bf-440b-944b-3487674012b4",
            "name": "7-Aminoclonazolam",
            "unii": "K958PBK774",
            "linking_id": "K958PBK774",
            "ref_pname": "7-Aminoclonazolam",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f474e7f8-6b7d-4a2b-8f0b-e6f484f53846",
          "name": "4H-[1,2,4]Triazolo[4,3-a][1,4]benzodiazepine, 6-(2-chlorophenyl)-1-methyl-8-nitro-",
          "stdName": "4H-(1,2,4)TRIAZOLO(4,3-A)(1,4)BENZODIAZEPINE, 6-(2-CHLOROPHENYL)-1-METHYL-8-NITRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60bdcb4a-2233-46b7-8423-a2ae3256b79b"
          ],
          "display_name": false
        },
        {
          "uuid": "e5d70988-2de1-407b-b074-098206643840",
          "name": "6-(2-Chlorophenyl)-1-methyl-8-nitro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine",
          "stdName": "6-(2-CHLOROPHENYL)-1-METHYL-8-NITRO-4H-(1,2,4)TRIAZOLO(4,3-A)(1,4)BENZODIAZEPINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70f8a0db-aba9-4eb3-9256-213d741daf0b"
          ],
          "display_name": false
        },
        {
          "uuid": "b72beef8-6a5c-4cfa-9ba5-cc42b5fe66fa",
          "name": "6-(2-chlorophenyl)-1-methyl-8-nitro-4H-benzo[f][1,2,4]triazolo[4,3-a][1,4]diazepine",
          "stdName": "6-(2-CHLOROPHENYL)-1-METHYL-8-NITRO-4H-BENZO(F)(1,2,4)TRIAZOLO(4,3-A)(1,4)DIAZEPINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eb5a7c75-2844-4592-8c65-3c8208a9ad41"
          ],
          "display_name": false
        },
        {
          "uuid": "cb20914d-9617-4d54-8eab-7dd59edcc853",
          "name": "Clonazolam",
          "stdName": "CLONAZOLAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70f8a0db-aba9-4eb3-9256-213d741daf0b"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "70f8a0db-aba9-4eb3-9256-213d741daf0b",
          "citation": "Forensic Toxicology (2015) 33:388?395",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "60bdcb4a-2233-46b7-8423-a2ae3256b79b",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c7691882-4239-4af3-aec4-7ee4485e6cd3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393310000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "270ee671-6f2f-4c40-9ac6-227fb65ae6ee",
          "citation": "SRS import [HJH52YYC1X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HJH52YYC1X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393310000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70642c29-0027-4461-9e25-db9800a3c839",
          "citation": "Edinoff, Amber N., et al. \"Novel designer benzodiazepines: comprehensive review of evolving clinical and adverse effects.\" Neurology International 14.3 (2022): 648-663.",
          "url": "https://www.ncbi.nlm.nih.gov/pmc/articles/PMC9397074/",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "32653f8b-1b36-45b0-9b7e-98b5fc2707f7",
          "citation": "Edinoff, Amber N., et al. \"Novel designer benzodiazepines: comprehensive review of evolving clinical and adverse effects.\" Neurology International 14.3 (2022): 648-663.",
          "url": "https://www.ncbi.nlm.nih.gov/pmc/articles/PMC9397074/",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "672539e1-c209-c564-540e-efb570732e39",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "48b7af74-2b71-450c-8384-dc0e58033772",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "23e04b18-79f6-f16c-48a7-0a489e772581",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "de29fd64-280d-dd22-6054-3faef173f1d8",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "eb5a7c75-2844-4592-8c65-3c8208a9ad41",
          "citation": "CFR",
          "url": "https://www.ecfr.gov/current/title-21/chapter-II/part-1308",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6130b850-dfb9-4ccc-a39c-43322398de77",
          "id": "6130b850-dfb9-4ccc-a39c-43322398de77",
          "molfile": "\n  Marvin  01132105022D          \n\n 25 28  0  0  0  0            999 V2000\n    9.0187   -4.4726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5707   -5.0856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3912   -4.9994    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7267   -5.7531    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1136   -6.3051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2366   -7.1209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6755   -7.7257    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8528   -7.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4403   -8.3785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6153   -8.3785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2028   -9.0930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6153   -9.8074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4403   -9.8074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8528   -9.0930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6778   -9.0930    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.3880   -6.9824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5837   -7.1660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0226   -6.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2657   -5.7728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0700   -5.5893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6312   -6.1940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3992   -5.8926    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2183   -6.7448    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.6571   -6.1400    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.9751   -7.5331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n 22  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n 22  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 16  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 14  9  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 21 16  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 18 23  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  2  0  0  0  0\nM  CHG  2  23   1  24  -1\nM  END",
          "smiles": "Cc1nnc2CN=C(c3ccccc3Cl)c4cc(ccc4-n12)[N+](=O)[O-]",
          "formula": "C17H12ClN5O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "337e6bc8-f8bb-4701-9feb-b33623cc80e4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "353.7631",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "09f08fd2-17e0-42c7-86e3-c600f93f96a4",
      "version": "14",
      "structure": {
        "id": "1bdccfe5-77b4-45e4-9d31-51152476ae2d",
        "molfile": "\n  Marvin  01132101372D          \n\n 25 28  0  0  0  0            999 V2000\n    8.6312   -6.1940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0700   -5.5893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2657   -5.7728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0226   -6.5612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2183   -6.7448    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.6571   -6.1400    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.9751   -7.5331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5837   -7.1660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3880   -6.9824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8528   -7.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4403   -8.3785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6153   -8.3785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2028   -9.0930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6153   -9.8074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4403   -9.8074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8528   -9.0930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6778   -9.0930    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.6755   -7.7257    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2366   -7.1209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1136   -6.3051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7267   -5.7531    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3912   -4.9994    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5707   -5.0856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0187   -4.4726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3992   -5.8926    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  4  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n  1  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 11  2  0  0  0  0\n 16 17  1  0  0  0  0\n 10 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 23 24  1  0  0  0  0\n 25 23  1  0  0  0  0\n  1 25  1  0  0  0  0\n 25 20  1  0  0  0  0\nM  CHG  2   5   1   6  -1\nM  END",
        "smiles": "Cc1nnc2CN=C(c3ccccc3Cl)c4cc(ccc4-n12)[N+](=O)[O-]",
        "formula": "C17H12ClN5O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "353.7631",
        "optical_activity": "NONE",
        "references": [
          "70f8a0db-aba9-4eb3-9256-213d741daf0b",
          "270ee671-6f2f-4c40-9ac6-227fb65ae6ee"
        ],
        "stereo_centers": 0
      },
      "unii": "HJH52YYC1X"
    }
  ]
}