{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "16b066f5-5e3f-4d23-9ec7-eccd1a1c29f9",
          "code": "793-24-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=793-24-8",
          "code_system": "CAS",
          "references": [
            "a3c480cb-4345-44c4-8e6a-6af7df659fd8",
            "c8a8c895-501e-43af-9898-79241b004e20"
          ]
        },
        {
          "uuid": "2a91e046-b5d9-44d8-9f8b-20fa7d9fe4a5",
          "code": "212-344-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.011.222",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a3c480cb-4345-44c4-8e6a-6af7df659fd8"
          ]
        },
        {
          "uuid": "2978aaa0-ee6b-41c9-80e2-5d0a6d6a393c",
          "code": "13101",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13101",
          "code_system": "PUBCHEM",
          "references": [
            "a3c480cb-4345-44c4-8e6a-6af7df659fd8"
          ]
        },
        {
          "uuid": "ab9f1de2-c3e9-5bc8-e457-39467f0886d8",
          "code": "5755",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5755",
          "code_system": "HSDB",
          "references": [
            "811ae4e9-2f9d-5404-e9fb-9a904a0effdd"
          ]
        },
        {
          "uuid": "56ca959b-67f5-6c61-7908-28770ab24c9c",
          "code": "DTXSID9025114",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9025114",
          "code_system": "EPA CompTox",
          "references": [
            "e7c6ea72-ee0b-4461-1823-7b59f8f1aa8f"
          ]
        },
        {
          "uuid": "4064cf80-3fa2-4010-b1e9-478f16b36df9",
          "code": "HJD0U67PS1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d424b356-3a59-f262-1b57-fd0d464d282f",
          "code": "6PPD",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/6PPD",
          "code_system": "WIKIPEDIA",
          "references": [
            "dde1d805-e5fa-cbbc-a8f1-8093b21f1d24"
          ]
        },
        {
          "uuid": "b4daf75b-206c-5c9a-e577-b11a57e73732",
          "code": "300000053729",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "4af8ca80-8263-6aa0-28c2-55ee3cca2818"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "1f221979-2dc1-4f6f-a6d1-4b43da55093c",
          "amount": {
            "uuid": "df09fdfd-952a-4cd9-b020-64d7d6adf9e2"
          },
          "type": "DEGRADENT->PARENT",
          "references": [
            "9286160e-c775-4f2c-bea5-d13a632c50e9"
          ],
          "related_substance": {
            "uuid": "9537b47c-e29c-4eb4-87da-0a78195e67c6",
            "refuuid": "a27b9da6-3539-449e-ba35-9db6d157d7d6",
            "name": "6PPD-quinone",
            "unii": "G8MFB8G7B6",
            "linking_id": "G8MFB8G7B6",
            "ref_pname": "6PPD-quinone",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1e8d40eb-f1b0-4684-90e6-9d4bf87d9650",
          "name": "1,4-BENZENEDIAMINE, N-(1,3-DIMETHYLBUTYL)-N'-PHENYL-",
          "stdName": "1,4-BENZENEDIAMINE, N-(1,3-DIMETHYLBUTYL)-N'-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8055a05-3c4a-4883-ac22-b2e865cb6ce9",
            "321c5f07-d509-4396-b9bf-0ee40096208b"
          ],
          "display_name": false
        },
        {
          "uuid": "e7804a83-9f31-4d27-a29b-22e9e2bbbffc",
          "name": "1,4-BENZENEDIAMINE, N1-(1,3-DIMETHYLBUTYL)-N4-PHENYL-",
          "stdName": "1,4-BENZENEDIAMINE, N1-(1,3-DIMETHYLBUTYL)-N4-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8055a05-3c4a-4883-ac22-b2e865cb6ce9",
            "321c5f07-d509-4396-b9bf-0ee40096208b"
          ],
          "display_name": false
        },
        {
          "uuid": "9dd14c6e-0e8a-497b-9c00-7c046eaac722",
          "name": "4-(1,3-DIMETHYLBUTYLAMINO)DIPHENYLAMINE",
          "stdName": "4-(1,3-DIMETHYLBUTYLAMINO)DIPHENYLAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8055a05-3c4a-4883-ac22-b2e865cb6ce9",
            "321c5f07-d509-4396-b9bf-0ee40096208b"
          ],
          "display_name": false
        },
        {
          "uuid": "f703e76d-73f4-4141-8f0b-317388006225",
          "name": "6PPD",
          "stdName": "6PPD",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2dda0252-21ed-46f6-b446-8f49a24a166e"
          ],
          "display_name": false
        },
        {
          "uuid": "d4b6ea23-f316-4062-824f-3deea1c6d187",
          "name": "ANTIOXIDANT 4020",
          "stdName": "ANTIOXIDANT 4020",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8055a05-3c4a-4883-ac22-b2e865cb6ce9",
            "321c5f07-d509-4396-b9bf-0ee40096208b"
          ],
          "display_name": false
        },
        {
          "uuid": "bb6d8cb4-4fce-484c-8b5d-1aae19617cc5",
          "name": "N-(1,3-DIMETHYLBUTYL)-N'-PHENYL-1,4-BENZENEDIAMINE",
          "stdName": "N-(1,3-DIMETHYLBUTYL)-N'-PHENYL-1,4-BENZENEDIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8055a05-3c4a-4883-ac22-b2e865cb6ce9",
            "321c5f07-d509-4396-b9bf-0ee40096208b"
          ],
          "display_name": false
        },
        {
          "uuid": "80a341a3-7eae-475f-a89d-b429ac680ce1",
          "name": "N-(1,3-DIMETHYLBUTYL)-N'-PHENYL-1,4-PHENYLENEDIAMINE",
          "stdName": "N-(1,3-DIMETHYLBUTYL)-N'-PHENYL-1,4-PHENYLENEDIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8055a05-3c4a-4883-ac22-b2e865cb6ce9",
            "321c5f07-d509-4396-b9bf-0ee40096208b"
          ],
          "display_name": false
        },
        {
          "uuid": "91b7cec8-1e43-48d4-bf94-94996001e0be",
          "name": "N-(1,3-DIMETHYLBUTYL)-N'-PHENYL-P-PHENYLENEDIAMINE",
          "stdName": "N-(1,3-DIMETHYLBUTYL)-N'-PHENYL-P-PHENYLENEDIAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73731f11-8701-428e-a32c-3ed0cfc48b79",
            "321c5f07-d509-4396-b9bf-0ee40096208b"
          ],
          "display_name": true
        },
        {
          "uuid": "af8d31be-344d-40b3-84ff-a9a93c813c4b",
          "name": "N-(1,3-DIMETHYLBUTYL)-N'-PHENYLBENZENE-1,4-DIAMINE",
          "stdName": "N-(1,3-DIMETHYLBUTYL)-N'-PHENYLBENZENE-1,4-DIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52b6e4a8-86d6-41b0-a108-60992d9d1630",
            "321c5f07-d509-4396-b9bf-0ee40096208b"
          ],
          "display_name": false
        },
        {
          "uuid": "08455931-f6a8-4944-bc2b-14f3c1f88221",
          "name": "N-(4-METHYL-2-PENTYL)-N'-PHENYL-P-PHENYLENEDIAMINE",
          "stdName": "N-(4-METHYL-2-PENTYL)-N'-PHENYL-P-PHENYLENEDIAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8055a05-3c4a-4883-ac22-b2e865cb6ce9",
            "321c5f07-d509-4396-b9bf-0ee40096208b"
          ],
          "display_name": false
        },
        {
          "uuid": "1a4811dc-9b8e-4ddd-ba57-4c95221a1da5",
          "name": "N-PHENYL-N'-(1,3-DIMETHYL BUTYL)-PARA-PHENYLENEDIAMINE [HSDB]",
          "stdName": "N-PHENYL-N'-(1,3-DIMETHYL BUTYL)-PARA-PHENYLENEDIAMINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73731f11-8701-428e-a32c-3ed0cfc48b79",
            "321c5f07-d509-4396-b9bf-0ee40096208b"
          ],
          "display_name": false
        },
        {
          "uuid": "679f20db-6379-4e34-82f1-f3a6467fd64a",
          "name": "N-PHENYL-N'-(1,3-DIMETHYLBUTYL)-1,4-PHENYLENEDIAMINE",
          "stdName": "N-PHENYL-N'-(1,3-DIMETHYLBUTYL)-1,4-PHENYLENEDIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8055a05-3c4a-4883-ac22-b2e865cb6ce9",
            "321c5f07-d509-4396-b9bf-0ee40096208b"
          ],
          "display_name": false
        },
        {
          "uuid": "510e7e34-9ecf-403e-8523-0c7569d23a28",
          "name": "N-PHENYL-N'-(1,3-DIMETHYLBUTYL)-P-PHENYL DIAMINE",
          "stdName": "N-PHENYL-N'-(1,3-DIMETHYLBUTYL)-P-PHENYL DIAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52b6e4a8-86d6-41b0-a108-60992d9d1630",
            "321c5f07-d509-4396-b9bf-0ee40096208b"
          ],
          "display_name": false
        },
        {
          "uuid": "fce7c434-ac69-4532-81aa-70d717bedf60",
          "name": "N-PHENYL-N'-(1,3-DIMETHYLBUTYL)-P-PHENYLENEDIAMINE",
          "stdName": "N-PHENYL-N'-(1,3-DIMETHYLBUTYL)-P-PHENYLENEDIAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8055a05-3c4a-4883-ac22-b2e865cb6ce9",
            "321c5f07-d509-4396-b9bf-0ee40096208b"
          ],
          "display_name": false
        },
        {
          "uuid": "6118d827-b95a-47c2-8aa9-a3a3d1037bb3",
          "name": "P-PHENYLENEDIAMINE, N-(1,3-DIMETHYLBUTYL)-N'-PHENYL-",
          "stdName": "P-PHENYLENEDIAMINE, N-(1,3-DIMETHYLBUTYL)-N'-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8055a05-3c4a-4883-ac22-b2e865cb6ce9",
            "321c5f07-d509-4396-b9bf-0ee40096208b"
          ],
          "display_name": false
        },
        {
          "uuid": "442219c8-589a-400e-a77d-b0044ab4d778",
          "name": "WINGSTAY 300",
          "stdName": "WINGSTAY 300",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73731f11-8701-428e-a32c-3ed0cfc48b79",
            "321c5f07-d509-4396-b9bf-0ee40096208b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c8055a05-3c4a-4883-ac22-b2e865cb6ce9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "321c5f07-d509-4396-b9bf-0ee40096208b",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73731f11-8701-428e-a32c-3ed0cfc48b79",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52b6e4a8-86d6-41b0-a108-60992d9d1630",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3c480cb-4345-44c4-8e6a-6af7df659fd8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392182000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4c0ac3b-14a0-4305-b11e-b7c2d246b1ae",
          "citation": "SRS import [HJD0U67PS1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HJD0U67PS1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392182000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "811ae4e9-2f9d-5404-e9fb-9a904a0effdd",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+793-24-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e7c6ea72-ee0b-4461-1823-7b59f8f1aa8f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=793-24-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dde1d805-e5fa-cbbc-a8f1-8093b21f1d24",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "c8a8c895-501e-43af-9898-79241b004e20",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9286160e-c775-4f2c-bea5-d13a632c50e9",
          "citation": "Hiki, Kyoshiro, et al. \"Acute toxicity of a tire rubber-derived chemical, 6PPD quinone, to freshwater fish and crustacean species.\" Environmental Science & Technology Letters 8.9 (2021): 779-784.",
          "url": "https://pubs.acs.org/doi/epdf/10.1021/acs.estlett.1c00453",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2dda0252-21ed-46f6-b446-8f49a24a166e",
          "citation": "https://www.commondreams.org/news/6ppd-salmon",
          "url": "https://www.commondreams.org/news/6ppd-salmon",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "4af8ca80-8263-6aa0-28c2-55ee3cca2818",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "50bb376e-06a3-4909-9944-41b184ce26cb",
          "id": "50bb376e-06a3-4909-9944-41b184ce26cb",
          "molfile": "\n  Marvin  01132104122D          \n\n 20 21  0  0  0  0            999 V2000\n    3.6385    1.4724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9670    1.0081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9651    0.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2955    1.4854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5908    1.0174    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.5871    0.1924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9471    1.5002    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2571    1.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2571    0.2238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4717   -0.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1635    0.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8960   -0.1369    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8960   -0.9563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1838   -1.3633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1838   -2.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8960   -2.5989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6137   -2.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6137   -1.3633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1561    1.0821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4328    1.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 20  8  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 19  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 18  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CC(C)Nc1ccc(cc1)Nc2ccccc2",
          "formula": "C18H24N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9b9c5cec-caf0-4280-a256-1ee4a5d4dcb0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "268.3972",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "166a1132-f054-4b8a-b54f-008e3e51f43b",
      "version": "8",
      "structure": {
        "id": "7d90f08f-7679-4707-aaab-a7b05d4bb878",
        "molfile": "\n  Marvin  01132106312D          \n\n 20 21  0  0  0  0            999 V2000\n   -1.1635    0.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8960   -0.1369    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4717   -0.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1561    1.0821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8960   -0.9563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2571    0.2238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4328    1.4780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1838   -1.3633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6137   -1.3633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2571    1.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1838   -2.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6137   -2.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9471    1.5002    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8960   -2.5989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5908    1.0174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2955    1.4854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5871    0.1924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9670    1.0081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6385    1.4724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9651    0.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  2  0  0  0  0\n  2  5  1  0  0  0  0\n  3  6  2  0  0  0  0\n  4  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  5  9  2  0  0  0  0\n  6 10  1  0  0  0  0\n  8 11  2  0  0  0  0\n  9 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n  7 10  2  0  0  0  0\n 12 14  2  0  0  0  0\nM  END",
        "smiles": "CC(C)CC(C)Nc1ccc(cc1)Nc2ccccc2",
        "formula": "C18H24N2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "268.3972",
        "optical_activity": "( + / - )",
        "references": [
          "d4c0ac3b-14a0-4305-b11e-b7c2d246b1ae",
          "73731f11-8701-428e-a32c-3ed0cfc48b79"
        ],
        "stereo_centers": 1
      },
      "unii": "HJD0U67PS1"
    }
  ]
}