{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2ae621ab-1895-4fce-b77f-0b5bdf908615",
          "code": "78281-02-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=78281-02-4",
          "code_system": "CAS",
          "references": [
            "53d98932-3a7b-4cad-83f9-4b37e6fcc36d"
          ]
        },
        {
          "uuid": "641d3573-642e-41a7-a4fb-eb93a5815f57",
          "code": "HI7O919OYZ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b45ac410-148a-4b28-a243-27c22641c7fd",
          "code": "1423072-23-4",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1423072-23-4",
          "code_system": "CAS",
          "references": [
            "53d98932-3a7b-4cad-83f9-4b37e6fcc36d"
          ]
        },
        {
          "uuid": "66e9c2be-7e8c-4c7b-9c56-45569f05c7f1",
          "code": "855782-18-2",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=855782-18-2",
          "code_system": "CAS",
          "references": [
            "53d98932-3a7b-4cad-83f9-4b37e6fcc36d"
          ]
        },
        {
          "uuid": "89363467-8fc6-066a-40e4-7f082a79844d",
          "code": "139030",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:139030",
          "code_system": "CHEBI",
          "references": [
            "473a688b-62b2-90f9-c108-00241aaf5d29"
          ]
        },
        {
          "uuid": "8c81b599-3f3b-c566-2ab4-7e64837907ce",
          "code": "DTXSID801031226",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801031226",
          "code_system": "EPA CompTox",
          "references": [
            "473a688b-62b2-90f9-c108-00241aaf5d29"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "4c74e95f-a796-49fd-a8ae-0db4a165f051",
          "citation": "International Immunopharmacology 2011;11:295-309",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b3e580b-141e-4db7-a7f0-7bdd13c8def5",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "80caf4b0-5d15-4600-9ca9-b9bf994eb108",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392453000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc47ac6b-b4ba-46fd-85be-05a1d230ea1a",
          "citation": "YAO XUE XUE BAO 2008;43:570?575",
          "url": "http://www.ncbi.nlm.nih.gov/pubmed/?term=Yao+Xue+Xue+Bao+and+Chen+TT+and+2008",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8efb641-6fe2-44d2-8766-03bffcb4aed0",
          "citation": "YAO XUE XUE BAO 2008;43:570?5",
          "url": "http://www.ncbi.nlm.nih.gov/pubmed/?term=Yao+Xue+Xue+Bao+and+Chen+TT+and+2008",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb451a4d-d9dd-45e4-9c2b-bffedc7e5d6c",
          "citation": "Chen TT, et al; Yao Xue Xue Bao 2008;43:570?575",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53d98932-3a7b-4cad-83f9-4b37e6fcc36d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ed1b4b76-464e-446f-ad00-6973e84cabeb",
          "citation": "J. Nat. Prod. 2013, 76, 2, 270–274 Publication Date:February 6, 2013 https://doi.org/10.1021/np300814k",
          "url": "https://pubs.acs.org/doi/pdf/10.1021/np300814k",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "473a688b-62b2-90f9-c108-00241aaf5d29",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "585cc3e4-47b4-cd2f-cd8a-3d39523ca5bc",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6fcdf085-49ae-4d85-9107-2f31d4e11005",
          "id": "6fcdf085-49ae-4d85-9107-2f31d4e11005",
          "molfile": "\n  Marvin  01132105482D          \n\n 44 47  0  0  1  0            999 V2000\n   12.6845   -3.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6845   -4.5374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3990   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1134   -4.5374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1134   -3.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3990   -3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3990   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8279   -3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6515   -3.7998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3878   -3.4310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9712   -3.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9712   -4.6685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6857   -5.0810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4002   -4.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4002   -3.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6857   -3.4310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1147   -5.0810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8279   -2.4006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9701   -4.9499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3990   -5.7750    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.1135   -6.1874    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.1134   -7.0123    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.3990   -7.4249    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.6845   -7.0123    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.6845   -6.1874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9701   -3.3000    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.2557   -3.7124    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.5412   -3.3000    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.5412   -2.4750    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.2557   -2.0625    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.9701   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2557   -4.5374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8267   -3.7124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8267   -2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2557   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5412   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8279   -4.9499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6845   -5.3624    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8279   -5.7749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8279   -7.4249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9702   -7.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2557   -7.0123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1135   -5.3624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3990   -8.2499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  6  1  0  0  0  0\n 26  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  2 19  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 20  1  0  0  0  0\n  3 43  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4 37  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  8  1  0  0  0  0\n  6  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  8 18  2  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 16  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 17  1  0  0  0  0\n 15 16  2  0  0  0  0\n 21 20  1  0  0  0  0\n 20 25  1  0  0  0  0\n 20 38  1  6  0  0  0\n 22 21  1  0  0  0  0\n 21 39  1  6  0  0  0\n 23 22  1  0  0  0  0\n 22 40  1  1  0  0  0\n 24 23  1  0  0  0  0\n 23 44  1  6  0  0  0\n 25 24  1  0  0  0  0\n 24 41  1  1  0  0  0\n 27 26  1  0  0  0  0\n 26 31  1  0  0  0  0\n 28 27  1  0  0  0  0\n 27 32  1  6  0  0  0\n 29 28  1  0  0  0  0\n 28 33  1  1  0  0  0\n 30 29  1  0  0  0  0\n 29 34  1  6  0  0  0\n 31 30  1  0  0  0  0\n 30 35  1  1  0  0  0\n 35 36  1  0  0  0  0\n 41 42  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1/C=C/C(=O)C2=C(C(C(=C(C2=O)[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)([C@@]4([H])[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)O)O)O",
          "formula": "C27H32O16",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3aa2b055-4afb-4094-a369-92e831d56195"
          },
          "defined_stereo": 10,
          "ez_centers": 1,
          "molecular_weight": "612.5345",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 11
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b33489fa-eec9-4d80-b061-fd63a3fa973f",
      "version": "12",
      "structure": {
        "id": "b993e1df-3568-445a-af0e-838cca7e2c04",
        "molfile": "\n  Marvin  01132109362D          \n\n 44 47  0  0  1  0            999 V2000\n   12.6845   -3.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6845   -4.5374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3990   -4.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1134   -4.5374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1134   -3.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3990   -3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3990   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8279   -3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6515   -3.7998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3878   -3.4310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9712   -3.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9712   -4.6685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6857   -5.0810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4002   -4.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4002   -3.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6857   -3.4310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1147   -5.0810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8279   -2.4006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9701   -4.9499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3990   -5.7750    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.1135   -6.1874    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.1134   -7.0123    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.3990   -7.4249    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.6845   -7.0123    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.6845   -6.1874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9701   -3.3000    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.2557   -3.7124    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.5412   -3.3000    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.5412   -2.4750    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.2557   -2.0625    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.9701   -2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2557   -4.5374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8267   -3.7124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8267   -2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2557   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5412   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8279   -4.9499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6845   -5.3624    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8279   -5.7749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8279   -7.4249    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9702   -7.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2557   -7.0123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1135   -5.3624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3990   -8.2499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 11 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n  8 18  2  0  0  0  0\n  2 19  1  0  0  0  0\n  3 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 20 25  1  0  0  0  0\n 26  1  1  1  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 29  1  0  0  0  0\n 31 30  1  0  0  0  0\n 26 31  1  0  0  0  0\n 27 32  1  6  0  0  0\n 28 33  1  1  0  0  0\n 29 34  1  6  0  0  0\n 30 35  1  1  0  0  0\n 35 36  1  0  0  0  0\n  4 37  1  0  0  0  0\n 20 38  1  6  0  0  0\n 21 39  1  6  0  0  0\n 22 40  1  1  0  0  0\n 24 41  1  1  0  0  0\n 41 42  1  0  0  0  0\n  3 43  1  0  0  0  0\n 23 44  1  6  0  0  0\nM  END",
        "smiles": "c1cc(ccc1/C=C/C(=O)C2=C(C(C(=C(C2=O)[C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)O)([C@@]4([H])[C@@H]([C@H]([C@@H]([C@@H](CO)O4)O)O)O)O)O)O",
        "formula": "C27H32O16",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 10,
        "ez_centers": 1,
        "molecular_weight": "612.5345",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "fb451a4d-d9dd-45e4-9c2b-bffedc7e5d6c",
          "ed1b4b76-464e-446f-ad00-6973e84cabeb"
        ],
        "stereo_centers": 11
      },
      "unii": "HI7O919OYZ",
      "relationships": [
        {
          "uuid": "a0fdf5db-35ad-4180-bcb2-32dca7e17dfb",
          "amount": {
            "uuid": "b0935b41-d586-4559-969b-ea46d4993844"
          },
          "type": "PARENT->ACTIVE CONSTITUENT ALWAYS PRESENT",
          "references": [
            "c8efb641-6fe2-44d2-8766-03bffcb4aed0"
          ],
          "related_substance": {
            "uuid": "35cdc92b-a8bf-461e-ad4f-13e14db47d2b",
            "refuuid": "37c67c62-d249-41f1-9acf-0ecf4ff37cf0",
            "name": "CARTHAMUS TINCTORIUS WHOLE",
            "unii": "5EMV416J82",
            "linking_id": "5EMV416J82",
            "ref_pname": "CARTHAMUS TINCTORIUS WHOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "34c18f76-9eb0-47f6-b49a-fecf256a83f2",
          "amount": {
            "uuid": "7caf3dcb-ab18-475d-b43a-bdcfca849287"
          },
          "type": "ACTIVE MOIETY",
          "references": [
            "cc47ac6b-b4ba-46fd-85be-05a1d230ea1a"
          ],
          "related_substance": {
            "uuid": "57e21c6d-de1d-4f51-9c7d-03307a6cf936",
            "refuuid": "b33489fa-eec9-4d80-b061-fd63a3fa973f",
            "name": "HYDROXYSAFFLOR YELLOW A",
            "unii": "HI7O919OYZ",
            "linking_id": "HI7O919OYZ",
            "ref_pname": "HYDROXYSAFFLOR YELLOW A",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "8589efa5-3af6-4b30-913d-072d822f3d61",
          "name": "2,5-CYCLOHEXADIEN-1-ONE, 2,4-DI-.BETA.-D-GLUCOPYRANOSYL-3,4,5-TRIHYDROXY-6-((2E)-3-(4-HYDROXYPHENYL)-1-OXO-2-PROPEN-1-YL)-",
          "stdName": "2,5-CYCLOHEXADIEN-1-ONE, 2,4-DI-.BETA.-D-GLUCOPYRANOSYL-3,4,5-TRIHYDROXY-6-((2E)-3-(4-HYDROXYPHENYL)-1-OXO-2-PROPEN-1-YL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b3e580b-141e-4db7-a7f0-7bdd13c8def5"
          ],
          "display_name": false
        },
        {
          "uuid": "bb0e56d6-63ac-4be1-9741-5dbb847bf8a4",
          "name": "HSYA",
          "stdName": "HSYA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b3e580b-141e-4db7-a7f0-7bdd13c8def5"
          ],
          "display_name": false
        },
        {
          "uuid": "dafaa560-12d0-4b74-aa4f-6960d6dc441b",
          "name": "HYDROXYSAFFLOR YELLOW A",
          "stdName": "HYDROXYSAFFLOR YELLOW A",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c74e95f-a796-49fd-a8ae-0db4a165f051"
          ],
          "display_name": true
        },
        {
          "uuid": "c4ba90d2-601c-4fbb-8e92-7dea6392b3c2",
          "name": "SAFFLOMIN A",
          "stdName": "SAFFLOMIN A",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b3e580b-141e-4db7-a7f0-7bdd13c8def5"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "fb0c0116-cdf7-4d6b-8f2e-103cb5512b92"
      }
    }
  ]
}