{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "be5e2755-3232-4ed4-b9bd-1b6649f878e6",
          "code": "CITRONELLYL PHENYLACETATE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4331",
          "code_system": "JECFA EVALUATION",
          "references": [
            "ab57963a-66ac-4329-8d71-05a460eec488"
          ]
        },
        {
          "uuid": "7ac76777-acb8-494e-88a5-e7aa85f355a3",
          "code": "139-70-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=139-70-8",
          "code_system": "CAS",
          "references": [
            "ab57963a-66ac-4329-8d71-05a460eec488",
            "f21a20fe-50ff-45a0-a771-9759615b6908"
          ]
        },
        {
          "uuid": "cb008800-1664-455f-8fe3-ebfeecdfd3d4",
          "code": "21 CFR 172.515",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart F--Flavoring Agents and Related Substances|Sec. 172.515 Synthetic flavoring substances and adjuvants.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.515",
          "code_system": "CFR",
          "references": [
            "ab57963a-66ac-4329-8d71-05a460eec488"
          ]
        },
        {
          "uuid": "0d0d895e-94ab-491c-8310-6009c861abc3",
          "code": "205-373-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.885",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ab57963a-66ac-4329-8d71-05a460eec488"
          ]
        },
        {
          "uuid": "a829b8d3-0b32-4d9a-9925-c14e8b3db7a3",
          "code": "8767",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8767",
          "code_system": "PUBCHEM",
          "references": [
            "ab57963a-66ac-4329-8d71-05a460eec488"
          ]
        },
        {
          "uuid": "2ce9cd5a-5d6b-4d56-b1a6-ffa393e8c1ff",
          "code": "HH43UJ4D76",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7622f568-89d8-1fa0-3b0b-b70960d17531",
          "code": "DTXSID90861804",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90861804",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "2f8b125c-66e4-be03-e731-6473e2c9ec85",
          "code": "954",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/954/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "7d9adb1f-ba7d-672d-0510-7a984954827a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ec53a347-0bff-414d-b54c-55bedb4eafe1",
          "name": "(±)-CITRONELLYL PHENYLACETATE",
          "stdName": "(+/-)-CITRONELLYL PHENYLACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b07b64bd-d531-42f7-8c08-0732adef8e36",
            "a08b0539-ca1c-45f9-b4d1-574d54164a80"
          ],
          "display_name": false
        },
        {
          "uuid": "b770f006-8b31-4aed-a79b-5cb05667d992",
          "name": "6-OCTEN-1-OL, 3,7-DIMETHYL-, PHENYLACETATE",
          "stdName": "6-OCTEN-1-OL, 3,7-DIMETHYL-, PHENYLACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08ca41b7-c16d-472b-914e-52a1f8f8ef00",
            "b07b64bd-d531-42f7-8c08-0732adef8e36"
          ],
          "display_name": false
        },
        {
          "uuid": "3cec805f-be61-4793-9cb8-ec9eb93f804a",
          "name": "ACETIC ACID, PHENYL-, 3,7-DIMETHYL-6-OCTENYL ESTER",
          "stdName": "ACETIC ACID, PHENYL-, 3,7-DIMETHYL-6-OCTENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08ca41b7-c16d-472b-914e-52a1f8f8ef00",
            "b07b64bd-d531-42f7-8c08-0732adef8e36"
          ],
          "display_name": false
        },
        {
          "uuid": "0ae5656e-6a79-4b6e-b447-ade6317da697",
          "name": "BENZENEACETIC ACID, 3,7-DIMETHYL-6-OCTEN-1-YL ESTER",
          "stdName": "BENZENEACETIC ACID, 3,7-DIMETHYL-6-OCTEN-1-YL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08ca41b7-c16d-472b-914e-52a1f8f8ef00",
            "b07b64bd-d531-42f7-8c08-0732adef8e36"
          ],
          "display_name": false
        },
        {
          "uuid": "21a12462-5417-4678-ab61-f2c3a5049003",
          "name": "BENZENEACETIC ACID, 3,7-DIMETHYL-6-OCTENYL ESTER",
          "stdName": "BENZENEACETIC ACID, 3,7-DIMETHYL-6-OCTENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08ca41b7-c16d-472b-914e-52a1f8f8ef00",
            "b07b64bd-d531-42f7-8c08-0732adef8e36"
          ],
          "display_name": false
        },
        {
          "uuid": "2d8153d9-0f7b-4ca1-885e-e62fb0b8c061",
          "name": "CITRONELLYL .ALPHA.-TOLUATE",
          "stdName": "CITRONELLYL .ALPHA.-TOLUATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b07b64bd-d531-42f7-8c08-0732adef8e36",
            "d05198bc-9062-4415-a453-34d489317e10"
          ],
          "display_name": false
        },
        {
          "uuid": "56099fac-3dff-4ed9-80aa-04553fa42c9e",
          "name": "CITRONELLYL PHENYLACETATE",
          "stdName": "CITRONELLYL PHENYLACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a8c877f3-f418-491c-8652-f94f824b13ce",
            "dc0a5432-3c7d-4397-bd1d-262dbd3817fd",
            "b07b64bd-d531-42f7-8c08-0732adef8e36",
            "9f101464-4b27-4589-aaac-87f19ec15905"
          ],
          "display_name": true
        },
        {
          "uuid": "1ac2a824-aa6f-4747-80ce-43726b9ce82b",
          "name": "CITRONELLYL PHENYLACETATE [FHFI]",
          "stdName": "CITRONELLYL PHENYLACETATE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b07b64bd-d531-42f7-8c08-0732adef8e36",
            "9f101464-4b27-4589-aaac-87f19ec15905"
          ],
          "display_name": false
        },
        {
          "uuid": "8580ff5f-b4a6-4f4e-9dad-1a4cd1dc1f43",
          "name": "CITRONELLYL PHENYLACETATE, (±)-",
          "stdName": "CITRONELLYL PHENYLACETATE, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b07b64bd-d531-42f7-8c08-0732adef8e36",
            "a08b0539-ca1c-45f9-b4d1-574d54164a80"
          ],
          "display_name": false
        },
        {
          "uuid": "e1080d06-e826-4a90-b8b9-0a838fe45814",
          "name": "FEMA NO. 2315",
          "stdName": "FEMA NO. 2315",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc0a5432-3c7d-4397-bd1d-262dbd3817fd",
            "b07b64bd-d531-42f7-8c08-0732adef8e36"
          ],
          "display_name": false
        },
        {
          "uuid": "d203c5ed-98e4-4025-8c8b-7453e93fd0bc",
          "name": "PHENYLACETIC ACID, 3,7-DIMETHYL-6-OCTENYL ESTER",
          "stdName": "PHENYLACETIC ACID, 3,7-DIMETHYL-6-OCTENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08ca41b7-c16d-472b-914e-52a1f8f8ef00",
            "b07b64bd-d531-42f7-8c08-0732adef8e36"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "dc0a5432-3c7d-4397-bd1d-262dbd3817fd",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b07b64bd-d531-42f7-8c08-0732adef8e36",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08ca41b7-c16d-472b-914e-52a1f8f8ef00",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d05198bc-9062-4415-a453-34d489317e10",
          "citation": "JECFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f101464-4b27-4589-aaac-87f19ec15905",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a08b0539-ca1c-45f9-b4d1-574d54164a80",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab57963a-66ac-4329-8d71-05a460eec488",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391216000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a8fbbdc-8be0-4575-a7a3-79c42ece7547",
          "citation": "SRS import [HH43UJ4D76]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HH43UJ4D76",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391216000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a8c877f3-f418-491c-8652-f94f824b13ce",
          "citation": "CITRONELLYL PHENYLACETATE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f21a20fe-50ff-45a0-a771-9759615b6908",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7d9adb1f-ba7d-672d-0510-7a984954827a",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "82cbefda-b055-4c64-82e9-d02092bf369f",
          "id": "82cbefda-b055-4c64-82e9-d02092bf369f",
          "molfile": "\n  Marvin  01132106472D          \n\n 20 20  0  0  0  0            999 V2000\n    3.9806   -1.5563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9806   -2.3691    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.6746   -2.8182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3908   -2.4433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0812   -2.8886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8198   -2.5065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8198   -1.7011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5213   -2.9629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2561   -2.5844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2561   -1.7716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0317   -1.3967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6850   -1.8421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6850   -2.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9464   -3.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2457   -2.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5406   -2.2986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8131   -2.6734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1154   -2.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1154   -1.4189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3731   -2.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 15  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 14  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCCC(C)CCOC(=O)Cc1ccccc1)C",
          "formula": "C18H26O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "65c4374a-6fbe-46d1-b2ae-a328a9b8c507"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "274.3985",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5f6cd0e0-85d2-40cd-8b00-a161aa682836",
      "version": "4",
      "structure": {
        "id": "2fd8b12c-d0f8-4f3a-a721-d5cb4f48b955",
        "molfile": "\n  Marvin  01132102342D          \n\n 20 20  0  0  0  0            999 V2000\n    1.1154   -1.4189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3731   -2.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1154   -2.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8131   -2.6734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5406   -2.2986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9806   -1.5563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2457   -2.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9806   -2.3691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6746   -2.8182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3908   -2.4433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6850   -1.8421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8198   -1.7011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0812   -2.8886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0317   -1.3967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6850   -2.6511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8198   -2.5065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2561   -1.7716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9464   -3.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5213   -2.9629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2561   -2.5844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 14 11  1  0  0  0  0\n  3  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 13 10  1  0  0  0  0\n 15 11  2  0  0  0  0\n 16 12  2  0  0  0  0\n 16 13  1  0  0  0  0\n 17 14  2  0  0  0  0\n 18 15  1  0  0  0  0\n 19 16  1  0  0  0  0\n 20 17  1  0  0  0  0\n 20 18  2  0  0  0  0\n 20 19  1  0  0  0  0\nM  END",
        "smiles": "CC(=CCCC(C)CCOC(=O)Cc1ccccc1)C",
        "formula": "C18H26O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "274.3985",
        "optical_activity": "( + / - )",
        "references": [
          "8a8fbbdc-8be0-4575-a7a3-79c42ece7547",
          "dc0a5432-3c7d-4397-bd1d-262dbd3817fd"
        ],
        "stereo_centers": 1
      },
      "unii": "HH43UJ4D76"
    }
  ]
}