{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1463a7d4-51a9-4611-aac9-c58906b370fe",
          "code": "364048-94-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=364048-94-2",
          "code_system": "CAS",
          "references": [
            "9185c796-9487-473e-a9b4-d16616de7c06",
            "16816e8b-41af-4bcf-98a5-3900c1eb7faf"
          ]
        },
        {
          "uuid": "12664176-cabe-436d-b751-4326963f9d31",
          "code": "44241258",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44241258",
          "code_system": "PUBCHEM",
          "references": [
            "9185c796-9487-473e-a9b4-d16616de7c06"
          ]
        },
        {
          "uuid": "0463c99a-927b-2632-fef3-be79fada8103",
          "code": "DTXSID70189932",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70189932",
          "code_system": "EPA CompTox",
          "references": [
            "013c915b-fa76-bee0-a6da-e192575b7b6e"
          ]
        },
        {
          "uuid": "421cc089-a995-4394-9589-91c7b5df0cc5",
          "code": "HFN1DLN96K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "03d6e2a8-3c68-477f-a1df-152b8f99d7b5",
          "name": "2-PROPENAMIDE, N,N'-1,4-BUTANEDIYLBIS(3-(4-HYDROXYPHENYL)-, (2E,2'E)-",
          "stdName": "2-PROPENAMIDE, N,N'-1,4-BUTANEDIYLBIS(3-(4-HYDROXYPHENYL)-, (2E,2'E)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76ca9db0-4998-42b5-bdda-6cc32ec3c43b",
            "84e227f9-f89b-40a6-b347-fbcb74a48192"
          ],
          "display_name": false
        },
        {
          "uuid": "81083751-1a58-47bc-8271-5b99fa56c210",
          "name": "BIS-COUMARAMIDOBUTANE",
          "stdName": "BIS-COUMARAMIDOBUTANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f95da9d9-ca11-4fc9-aede-b2ed141472a8",
            "83568686-8cee-4227-9d6e-969632b8b8c9",
            "76ca9db0-4998-42b5-bdda-6cc32ec3c43b"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a62c8413-f2bb-4611-aee3-992f7e09a2b7",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9419449b-717e-44ac-b0a2-7be9ad0afe81",
          "name": "N,N'-DICOUMAROYLPUTRESCINE",
          "stdName": "N,N'-DICOUMAROYLPUTRESCINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76ca9db0-4998-42b5-bdda-6cc32ec3c43b",
            "84e227f9-f89b-40a6-b347-fbcb74a48192"
          ],
          "display_name": false
        },
        {
          "uuid": "cf196e8e-4d03-4be6-8ce9-ebaadb32900b",
          "name": "SID CORN DCP",
          "stdName": "SID CORN DCP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f95da9d9-ca11-4fc9-aede-b2ed141472a8",
            "76ca9db0-4998-42b5-bdda-6cc32ec3c43b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "84e227f9-f89b-40a6-b347-fbcb74a48192",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "76ca9db0-4998-42b5-bdda-6cc32ec3c43b",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f95da9d9-ca11-4fc9-aede-b2ed141472a8",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9185c796-9487-473e-a9b4-d16616de7c06",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391419000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c489d935-fb92-483a-95b3-d2355859df7e",
          "citation": "SRS import [HFN1DLN96K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=HFN1DLN96K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391419000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83568686-8cee-4227-9d6e-969632b8b8c9",
          "citation": "BIS-COUMARAMIDOBUTANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "013c915b-fa76-bee0-a6da-e192575b7b6e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=364048-94-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "16816e8b-41af-4bcf-98a5-3900c1eb7faf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "da7f00d7-0db3-44d2-aa05-0ebbd00a4e38",
          "id": "da7f00d7-0db3-44d2-aa05-0ebbd00a4e38",
          "molfile": "\n  Marvin  01132111202D          \n\n 28 29  0  0  0  0            999 V2000\n   13.1997   -6.7124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4852   -6.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7707   -6.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0563   -6.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0563   -5.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7707   -5.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4852   -5.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3418   -5.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6273   -5.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9129   -5.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9129   -4.2374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1984   -5.4749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4839   -5.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4839   -4.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7695   -3.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7695   -2.9999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0550   -2.5874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3405   -2.9999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6260   -2.5874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3405   -3.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6260   -4.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6260   -5.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3405   -5.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3405   -6.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6260   -6.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6260   -7.5374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9115   -6.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9115   -5.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 18  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 22 28  2  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 27 25  2  0  0  0  0\n 28 27  1  0  0  0  0\nM  END",
          "smiles": "C(CCNC(=O)/C=C/c1ccc(cc1)O)CNC(=O)/C=C/c2ccc(cc2)O",
          "formula": "C22H24N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "98a35223-9d19-4aa0-9b9e-fb48a3f03770"
          },
          "defined_stereo": 0,
          "ez_centers": 2,
          "molecular_weight": "380.4378",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "32c81d05-7000-4cc8-a4a9-f783e7f6ec4e",
      "version": "4",
      "structure": {
        "id": "059ac247-3830-4263-b7e5-80797b68ce86",
        "molfile": "\n  Marvin  01132100352D          \n\n 28 29  0  0  0  0            999 V2000\n    8.9129   -5.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6273   -5.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3418   -5.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0563   -5.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0563   -6.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7707   -6.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4852   -6.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4852   -5.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7707   -5.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1997   -6.7124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9129   -4.2374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1984   -5.4749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4839   -5.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4839   -4.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7695   -3.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7695   -2.9999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3405   -5.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3405   -6.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9115   -6.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9115   -5.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6260   -7.5374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6260   -6.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6260   -5.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6260   -4.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3405   -3.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6260   -2.5874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0550   -2.5874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3405   -2.9999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1 12  1  0  0  0  0\n  1 11  2  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  7 10  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 27 16  1  0  0  0  0\n 23 20  2  0  0  0  0\n 17 23  1  0  0  0  0\n 18 17  2  0  0  0  0\n 22 18  1  0  0  0  0\n 19 22  2  0  0  0  0\n 20 19  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 25 28  1  0  0  0  0\n 28 26  2  0  0  0  0\n 28 27  1  0  0  0  0\n 13 12  1  0  0  0  0\nM  END",
        "smiles": "C(CCNC(=O)/C=C/c1ccc(cc1)O)CNC(=O)/C=C/c2ccc(cc2)O",
        "formula": "C22H24N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 2,
        "molecular_weight": "380.4378",
        "optical_activity": "NONE",
        "references": [
          "84e227f9-f89b-40a6-b347-fbcb74a48192",
          "c489d935-fb92-483a-95b3-d2355859df7e"
        ],
        "stereo_centers": 0
      },
      "unii": "HFN1DLN96K"
    }
  ]
}